Merge branch 'release/3.1'

Currently translated at 100.0% (571 of 571 strings)

Translation: KeePassDX/Strings
Translate-URL: https://hosted.weblate.org/projects/keepass-dx/strings/ru/

.github/ISSUE_TEMPLATE/bug_report.md

@@ -24,6 +24,7 @@ A clear and concise description of what you expected to happen.
  - Created with: [e.g Windows KeePass 2.42]
  - Version: [e.g. 2]
  - Location: [e.g. Remote file retrieved with GDrive app]
+ - File provider (`content://` URI): [e.g. `content://com.google.android.apps.docs.storage/5`]
  - Size: [e.g. 150Mo]
  - Contains attachment: [e.g. Yes]
 

CHANGELOG

@@ -1,10 +1,46 @@
+KeePassDX(3.1.0)
+ * Add breadcrumb
+ * Add path in search results #1148
+ * Add group info dialog #1177
+ * Manage colors #64 #913
+ * Fix UI in Android 8 #509
+ * Upgrade libs and SDK to 31 #833
+ * Fix parser of database v1 #1201
+ * Stop asking WRITE_EXTERNAL_STORAGE permission
+
+KeePassDX(3.0.4)
+ * Fix autofill inline bugs #1173 #1165
+ * Small UI change
+
+KeePassDX(3.0.3)
+ * Change default Argon2 parameters #1098
+ * Add & edit custom icon name #976
+ * Fix templates #1128 #1133 #1138
+ * Update Autofill compatibility list #725 #1154
+ * Improve fingerprint usage #1137 #1145
+ * Change backup configuration #1144
+ * Add lock button in database notification
+
+KeePassDX(3.0.2)
+ * Samsung DeX mode #1114 #245 (Thx @chenxiaolong)
+
+KeePassDX(3.0.1)
+ * Fix text size and smallest margin #1085
+ * Fix number of lines during an edition #1073
+ * Fix Magikeyboard URL auto action #1100
+ * Fix exception after group name change and save #1112
+ * Fix timeout reset #1107
+ * Fix search actions #1091 #1092
+ * Small changes #1106 #1085
+
 KeePassDX(3.0.0)
  * Add / Manage dynamic templates #191
  * Manually select RecycleBin group and Templates group #191
  * Setting to display OTP Token in list #655
  * Fix timeout in dialogs #716
  * Check URI permissions #626
- * Improvements #1035 #1043 #942 #1021 #1027
+ * Better autofill implementation #943 #946 #984 #1070 (Thx @uduerholz)
+ * Improvements #680 #1035 #1043 #942 #1021 #1027 #1046 #1082 #1083 (Thx @chenxiaolong)
 
 KeePassDX(2.10.5)
  * Increase the saving speed of database #1028

README.md

@@ -15,6 +15,7 @@
  - Material design with **themes**.
  - **Auto-Fill** and Integration.
  - Field filling **keyboard**.
+ - Dynamic **templates** 
  - **History** of each entry.
  - Precise management of **settings**.
  - Code written in **native languages** *(Kotlin / Java / JNI / C)*.
@@ -71,7 +72,7 @@ Other questions? You can read the [FAQ](https://github.com/Kunzisoft/KeePassDX/w
 
 ## License
 
-  Copyright © 2020 Jeremy Jamet / [Kunzisoft](https://www.kunzisoft.com).
+  Copyright © 2022 Jeremy Jamet / [Kunzisoft](https://www.kunzisoft.com).
 
   This file is part of KeePassDX.
 

app/build.gradle

@@ -3,16 +3,16 @@ apply plugin: 'kotlin-android'
 apply plugin: 'kotlin-kapt'
 
 android {
-    compileSdkVersion 30
-    buildToolsVersion "30.0.3"
+    compileSdkVersion 31
+    buildToolsVersion "31.0.0"
     ndkVersion "21.4.7075529"
 
     defaultConfig {
         applicationId "com.kunzisoft.keepass"
         minSdkVersion 15
-        targetSdkVersion 30
-        versionCode = 85
-        versionName = "3.0.0_beta02"
+        targetSdkVersion 31
+        versionCode = 92
+        versionName = "3.1.0"
         multiDexEnabled true
 
         testApplicationId = "com.kunzisoft.keepass.tests"
@@ -99,33 +99,33 @@ android {
     }
 }
 
-def room_version = "2.2.6"
+def room_version = "2.4.1"
 
 dependencies {
     implementation "org.jetbrains.kotlin:kotlin-stdlib-jdk8:$kotlin_version"
-    implementation 'androidx.appcompat:appcompat:1.2.0'
+    implementation "androidx.appcompat:appcompat:$android_appcompat_version"
     implementation 'androidx.preference:preference-ktx:1.1.1'
     implementation 'androidx.cardview:cardview:1.0.0'
-    implementation 'androidx.constraintlayout:constraintlayout:2.0.4'
-    implementation 'androidx.viewpager2:viewpager2:1.1.0-alpha01'
+    implementation 'androidx.constraintlayout:constraintlayout:2.1.3'
+    implementation 'androidx.viewpager2:viewpager2:1.1.0-beta01'
     implementation 'androidx.documentfile:documentfile:1.0.1'
     implementation 'androidx.biometric:biometric:1.1.0'
+    implementation 'androidx.media:media:1.4.3'
     // Lifecycle - LiveData - ViewModel - Coroutines
-    implementation "androidx.core:core-ktx:1.3.2"
-    implementation 'androidx.fragment:fragment-ktx:1.2.5'
-    // WARNING: Don't upgrade because slowdown https://github.com/Kunzisoft/KeePassDX/issues/923
-    implementation 'com.google.android.material:material:1.1.0'
+    implementation "androidx.core:core-ktx:$android_core_version"
+    implementation 'androidx.fragment:fragment-ktx:1.4.0'
+    implementation "com.google.android.material:material:$android_material_version"
     // Database
     implementation "androidx.room:room-runtime:$room_version"
     kapt "androidx.room:room-compiler:$room_version"
     // Autofill
     implementation "androidx.autofill:autofill:1.1.0"
     // Time
-    implementation 'joda-time:joda-time:2.10.6'
+    implementation 'joda-time:joda-time:2.10.13'
     // Color
-    implementation 'com.github.Kunzisoft:AndroidClearChroma:2.4'
+    implementation 'com.github.Kunzisoft:AndroidClearChroma:2.6'
     // Education
-    implementation 'com.getkeepsafe.taptargetview:taptargetview:1.13.0'
+    implementation 'com.getkeepsafe.taptargetview:taptargetview:1.13.3'
     // Apache Commons
     implementation 'commons-io:commons-io:2.8.0'
     implementation 'commons-codec:commons-codec:1.15'
@@ -136,6 +136,6 @@ dependencies {
     implementation project(path: ':icon-pack-material')
 
     // Tests
-    androidTestImplementation 'androidx.test:runner:1.3.0'
-    androidTestImplementation 'androidx.test:rules:1.3.0'
+    androidTestImplementation "androidx.test:runner:$android_test_version"
+    androidTestImplementation "androidx.test:rules:$android_test_version"
 }

app/src/main/AndroidManifest.xml

@@ -10,15 +10,12 @@
       android:anyDensity="true" />
     <uses-permission
         android:name="android.permission.FOREGROUND_SERVICE" />
+    <uses-permission
+        android:name="android.permission.SCHEDULE_EXACT_ALARM" />
     <uses-permission
         android:name="android.permission.USE_BIOMETRIC" />
     <uses-permission
         android:name="android.permission.VIBRATE"/>
-    <!-- Write permission until Android 10 -->
-    <uses-permission
-        android:name="android.permission.WRITE_EXTERNAL_STORAGE"
-        android:maxSdkVersion="28"
-        tools:ignore="ScopedStorage" />
     <!-- Open apps from links -->
     <uses-permission
         android:name="android.permission.QUERY_ALL_PACKAGES"
@@ -30,12 +27,13 @@
         android:roundIcon="@mipmap/ic_launcher_round"
         android:name="com.kunzisoft.keepass.app.App"
         android:allowBackup="true"
-        android:fullBackupContent="@xml/backup_rules"
+        android:fullBackupContent="@xml/old_backup_rules"
+        android:dataExtractionRules="@xml/backup_rules"
         android:backupAgent="com.kunzisoft.keepass.backup.SettingsBackupAgent"
         android:largeHeap="true"
         android:resizeableActivity="true"
         android:theme="@style/KeepassDXStyle.Night"
-        tools:targetApi="n">
+        tools:targetApi="s">
         <meta-data
             android:name="com.google.android.backup.api_key"
             android:value="${googleAndroidBackupAPIKey}" />
@@ -44,6 +42,7 @@
             android:theme="@style/KeepassDXStyle.SplashScreen"
             android:label="@string/app_name"
             android:launchMode="singleTop"
+            android:exported="true"
             android:configChanges="keyboardHidden"
             android:windowSoftInputMode="stateHidden|stateAlwaysHidden" >
             <intent-filter>
@@ -53,6 +52,7 @@
         </activity>
         <activity
             android:name="com.kunzisoft.keepass.activities.PasswordActivity"
+            android:exported="true"
             android:configChanges="keyboardHidden"
             android:windowSoftInputMode="adjustResize|stateUnchanged">
             <intent-filter>
@@ -111,6 +111,7 @@
         <!-- Main Activity -->
         <activity
             android:name="com.kunzisoft.keepass.activities.GroupActivity"
+            android:exported="false"
             android:configChanges="keyboardHidden"
             android:windowSoftInputMode="adjustPan">
             <meta-data
@@ -154,7 +155,8 @@
             android:name="com.kunzisoft.keepass.settings.AutofillSettingsActivity" />
         <activity
             android:name="com.kunzisoft.keepass.activities.EntrySelectionLauncherActivity"
-            android:theme="@style/Theme.Transparent">
+            android:theme="@style/Theme.Transparent"
+            android:exported="true">
             <intent-filter>
                 <action android:name="android.intent.action.SEND" />
                 <category android:name="android.intent.category.DEFAULT" />
@@ -173,7 +175,8 @@
             android:theme="@style/Theme.Transparent" />
         <activity
             android:name="com.kunzisoft.keepass.settings.MagikeyboardSettingsActivity"
-            android:label="@string/keyboard_setting_label">
+            android:label="@string/keyboard_setting_label"
+            android:exported="true">
             <intent-filter>
                 <action android:name="android.intent.action.MAIN"/>
             </intent-filter>
@@ -199,6 +202,7 @@
         <service
             android:name="com.kunzisoft.keepass.autofill.KeeAutofillService"
             android:label="@string/autofill_service_name"
+            android:exported="true"
             android:permission="android.permission.BIND_AUTOFILL_SERVICE">
             <meta-data
                 android:name="android.autofill"
@@ -210,6 +214,7 @@
         <service
             android:name="com.kunzisoft.keepass.magikeyboard.MagikeyboardService"
             android:label="@string/keyboard_label"
+            android:exported="true"
             android:permission="android.permission.BIND_INPUT_METHOD" >
             <meta-data android:name="android.view.im"
                 android:resource="@xml/keyboard_method"/>
@@ -221,6 +226,14 @@
             android:name="com.kunzisoft.keepass.services.KeyboardEntryNotificationService"
             android:enabled="true"
             android:exported="false" />
+        <receiver
+            android:name="com.kunzisoft.keepass.receivers.DexModeReceiver"
+            android:exported="true">
+            <intent-filter>
+                <action android:name="android.app.action.ENTER_KNOX_DESKTOP_MODE" />
+                <action android:name="android.app.action.EXIT_KNOX_DESKTOP_MODE" />
+            </intent-filter>
+        </receiver>
 
         <meta-data android:name="com.sec.android.support.multiwindow" android:value="true" />
     </application>

app/src/main/java/com/kunzisoft/keepass/activities/AutofillLauncherActivity.kt

@@ -23,28 +23,33 @@ import android.app.Activity
 import android.app.PendingIntent
 import android.content.Context
 import android.content.Intent
-import android.content.IntentSender
 import android.os.Build
-import android.view.inputmethod.InlineSuggestionsRequest
+import android.os.Bundle
 import android.widget.Toast
+import androidx.activity.result.ActivityResultLauncher
 import androidx.annotation.RequiresApi
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
 import com.kunzisoft.keepass.activities.helpers.SpecialMode
 import com.kunzisoft.keepass.activities.legacy.DatabaseModeActivity
+import com.kunzisoft.keepass.autofill.AutofillComponent
 import com.kunzisoft.keepass.autofill.AutofillHelper
-import com.kunzisoft.keepass.autofill.AutofillHelper.EXTRA_INLINE_SUGGESTIONS_REQUEST
+import com.kunzisoft.keepass.autofill.CompatInlineSuggestionsRequest
 import com.kunzisoft.keepass.autofill.KeeAutofillService
 import com.kunzisoft.keepass.database.element.Database
 import com.kunzisoft.keepass.database.search.SearchHelper
 import com.kunzisoft.keepass.model.RegisterInfo
 import com.kunzisoft.keepass.model.SearchInfo
 import com.kunzisoft.keepass.settings.PreferencesUtil
-import com.kunzisoft.keepass.utils.LOCK_ACTION
 
 @RequiresApi(api = Build.VERSION_CODES.O)
 class AutofillLauncherActivity : DatabaseModeActivity() {
 
+    private var mAutofillActivityResultLauncher: ActivityResultLauncher<Intent>? =
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O)
+            AutofillHelper.buildActivityResultLauncher(this, true)
+        else null
+
     override fun applyCustomStyle(): Boolean {
         return false
     }
@@ -60,16 +65,37 @@ class AutofillLauncherActivity : DatabaseModeActivity() {
         EntrySelectionHelper.retrieveSpecialModeFromIntent(intent).let { specialMode ->
             when (specialMode) {
                 SpecialMode.SELECTION -> {
-                    // Build search param
-                    val searchInfo = SearchInfo().apply {
-                        applicationId = intent.getStringExtra(KEY_SEARCH_APPLICATION_ID)
-                        webDomain = intent.getStringExtra(KEY_SEARCH_DOMAIN)
-                        webScheme = intent.getStringExtra(KEY_SEARCH_SCHEME)
-                    }
-                    SearchInfo.getConcreteWebDomain(this, searchInfo.webDomain) { concreteWebDomain ->
-                        searchInfo.webDomain = concreteWebDomain
-                        launchSelection(database, searchInfo)
+                    intent.getBundleExtra(KEY_SELECTION_BUNDLE)?.let { bundle ->
+                        // To pass extra inline request
+                        var compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest? = null
+                        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
+                            compatInlineSuggestionsRequest = bundle.getParcelable(KEY_INLINE_SUGGESTION)
+                        }
+                        // Build search param
+                        bundle.getParcelable<SearchInfo>(KEY_SEARCH_INFO)?.let { searchInfo ->
+                            SearchInfo.getConcreteWebDomain(
+                                this,
+                                searchInfo.webDomain
+                            ) { concreteWebDomain ->
+                                // Pass extra for Autofill (EXTRA_ASSIST_STRUCTURE)
+                                val assistStructure = AutofillHelper
+                                    .retrieveAutofillComponent(intent)
+                                    ?.assistStructure
+                                val newAutofillComponent = if (assistStructure != null) {
+                                    AutofillComponent(
+                                        assistStructure,
+                                        compatInlineSuggestionsRequest
+                                    )
+                                } else {
+                                    null
+                                }
+                                searchInfo.webDomain = concreteWebDomain
+                                launchSelection(database, newAutofillComponent, searchInfo)
+                            }
+                        }
                     }
+                    // Remove bundle
+                    intent.removeExtra(KEY_SELECTION_BUNDLE)
                 }
                 SpecialMode.REGISTRATION -> {
                     // To register info
@@ -90,10 +116,8 @@ class AutofillLauncherActivity : DatabaseModeActivity() {
     }
 
     private fun launchSelection(database: Database?,
+                                autofillComponent: AutofillComponent?,
                                 searchInfo: SearchInfo) {
-        // Pass extra for Autofill (EXTRA_ASSIST_STRUCTURE)
-        val autofillComponent = AutofillHelper.retrieveAutofillComponent(intent)
-
         if (autofillComponent == null) {
             setResult(Activity.RESULT_CANCELED)
             finish()
@@ -118,6 +142,7 @@ class AutofillLauncherActivity : DatabaseModeActivity() {
                         // Show the database UI to select the entry
                         GroupActivity.launchForAutofillResult(this,
                             openedDatabase,
+                            mAutofillActivityResultLauncher,
                             autofillComponent,
                             searchInfo,
                             false)
@@ -125,6 +150,7 @@ class AutofillLauncherActivity : DatabaseModeActivity() {
                     {
                         // If database not open
                         FileDatabaseSelectActivity.launchForAutofillResult(this,
+                                mAutofillActivityResultLauncher,
                                 autofillComponent,
                                 searchInfo)
                     }
@@ -185,53 +211,47 @@ class AutofillLauncherActivity : DatabaseModeActivity() {
         Toast.makeText(this.applicationContext, R.string.autofill_read_only_save, Toast.LENGTH_LONG).show()
     }
 
-    override fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?) {
-        AutofillHelper.onActivityResultSetResultAndFinish(this, requestCode, resultCode, data)
-
-        if (PreferencesUtil.isAutofillCloseDatabaseEnable(this)) {
-            // Close the database
-            sendBroadcast(Intent(LOCK_ACTION))
-        }
-
-        super.onActivityResult(requestCode, resultCode, data)
-    }
-
     companion object {
 
-        private const val KEY_SEARCH_APPLICATION_ID = "KEY_SEARCH_APPLICATION_ID"
-        private const val KEY_SEARCH_DOMAIN = "KEY_SEARCH_DOMAIN"
-        private const val KEY_SEARCH_SCHEME = "KEY_SEARCH_SCHEME"
+        private const val KEY_SELECTION_BUNDLE = "KEY_SELECTION_BUNDLE"
+        private const val KEY_SEARCH_INFO = "KEY_SEARCH_INFO"
+        private const val KEY_INLINE_SUGGESTION = "KEY_INLINE_SUGGESTION"
 
         private const val KEY_REGISTER_INFO = "KEY_REGISTER_INFO"
 
-        fun getAuthIntentSenderForSelection(context: Context,
-                                            searchInfo: SearchInfo? = null,
-                                            inlineSuggestionsRequest: InlineSuggestionsRequest? = null): IntentSender {
+        fun getPendingIntentForSelection(context: Context,
+                                         searchInfo: SearchInfo? = null,
+                                         compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest? = null): PendingIntent {
             return PendingIntent.getActivity(context, 0,
-                    // Doesn't work with Parcelable (don't know why?)
-                    Intent(context, AutofillLauncherActivity::class.java).apply {
-                        searchInfo?.let {
-                            putExtra(KEY_SEARCH_APPLICATION_ID, it.applicationId)
-                            putExtra(KEY_SEARCH_DOMAIN, it.webDomain)
-                            putExtra(KEY_SEARCH_SCHEME, it.webScheme)
-                        }
+                // Doesn't work with direct extra Parcelable (don't know why?)
+                // Wrap into a bundle to bypass the problem
+                Intent(context, AutofillLauncherActivity::class.java).apply {
+                    putExtra(KEY_SELECTION_BUNDLE, Bundle().apply {
+                        putParcelable(KEY_SEARCH_INFO, searchInfo)
                         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-                            inlineSuggestionsRequest?.let {
-                                putExtra(EXTRA_INLINE_SUGGESTIONS_REQUEST, it)
-                            }
+                            putParcelable(KEY_INLINE_SUGGESTION, compatInlineSuggestionsRequest)
                         }
-                    },
-                    PendingIntent.FLAG_CANCEL_CURRENT).intentSender
+                    })
+                },
+                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S) {
+                    PendingIntent.FLAG_MUTABLE or PendingIntent.FLAG_CANCEL_CURRENT
+                } else {
+                    PendingIntent.FLAG_CANCEL_CURRENT
+                })
         }
 
-        fun getAuthIntentSenderForRegistration(context: Context,
-                                               registerInfo: RegisterInfo): IntentSender {
+        fun getPendingIntentForRegistration(context: Context,
+                                            registerInfo: RegisterInfo): PendingIntent {
             return PendingIntent.getActivity(context, 0,
-                    Intent(context, AutofillLauncherActivity::class.java).apply {
-                        EntrySelectionHelper.addSpecialModeInIntent(this, SpecialMode.REGISTRATION)
-                        putExtra(KEY_REGISTER_INFO, registerInfo)
-                    },
-                    PendingIntent.FLAG_CANCEL_CURRENT).intentSender
+                Intent(context, AutofillLauncherActivity::class.java).apply {
+                    EntrySelectionHelper.addSpecialModeInIntent(this, SpecialMode.REGISTRATION)
+                    putExtra(KEY_REGISTER_INFO, registerInfo)
+                },
+                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S) {
+                    PendingIntent.FLAG_MUTABLE or PendingIntent.FLAG_CANCEL_CURRENT
+                } else {
+                    PendingIntent.FLAG_CANCEL_CURRENT
+                })
         }
 
         fun launchForRegistration(context: Context,

app/src/main/java/com/kunzisoft/keepass/activities/EntryActivity.kt

@@ -32,10 +32,16 @@ import android.view.MenuItem
 import android.view.View
 import android.widget.ImageView
 import android.widget.ProgressBar
+import androidx.activity.result.ActivityResultLauncher
 import androidx.activity.viewModels
 import androidx.appcompat.widget.Toolbar
 import androidx.coordinatorlayout.widget.CoordinatorLayout
+import androidx.core.graphics.BlendModeColorFilterCompat
+import androidx.core.graphics.BlendModeCompat
+import androidx.core.graphics.ColorUtils
+import com.google.android.material.appbar.AppBarLayout
 import com.google.android.material.appbar.CollapsingToolbarLayout
+import com.google.android.material.progressindicator.LinearProgressIndicator
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.fragments.EntryFragment
 import com.kunzisoft.keepass.activities.helpers.ExternalFileHelper
@@ -57,20 +63,24 @@ import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.tasks.ActionRunnable
 import com.kunzisoft.keepass.tasks.AttachmentFileBinderManager
 import com.kunzisoft.keepass.timeout.TimeoutHelper
-import com.kunzisoft.keepass.utils.*
+import com.kunzisoft.keepass.utils.MenuUtil
+import com.kunzisoft.keepass.utils.UriUtil
+import com.kunzisoft.keepass.utils.UuidUtil
+import com.kunzisoft.keepass.view.changeControlColor
+import com.kunzisoft.keepass.view.changeTitleColor
 import com.kunzisoft.keepass.view.hideByFading
 import com.kunzisoft.keepass.view.showActionErrorIfNeeded
 import com.kunzisoft.keepass.viewmodels.EntryViewModel
 import java.util.*
-import kotlin.collections.HashMap
 
 class EntryActivity : DatabaseLockActivity() {
 
     private var coordinatorLayout: CoordinatorLayout? = null
     private var collapsingToolbarLayout: CollapsingToolbarLayout? = null
+    private var appBarLayout: AppBarLayout? = null
     private var titleIconView: ImageView? = null
     private var historyView: View? = null
-    private var entryProgress: ProgressBar? = null
+    private var entryProgress: LinearProgressIndicator? = null
     private var lockView: View? = null
     private var toolbar: Toolbar? = null
     private var loadingView: ProgressBar? = null
@@ -81,13 +91,24 @@ class EntryActivity : DatabaseLockActivity() {
     private var mHistoryPosition: Int = -1
     private var mEntryIsHistory: Boolean = false
     private var mUrl: String? = null
+    private var mEntryLoaded = false
 
     private var mAttachmentFileBinderManager: AttachmentFileBinderManager? = null
-    private var mAttachmentsToDownload: HashMap<Int, Attachment> = HashMap()
     private var mExternalFileHelper: ExternalFileHelper? = null
+    private var mAttachmentSelected: Attachment? = null
+
+    private var mEntryActivityResultLauncher = EntryEditActivity.registerForEntryResult(this) {
+        // Reload the current id from database
+        mEntryViewModel.loadDatabase(mDatabase)
+    }
 
     private var mIcon: IconImage? = null
-    private var mIconColor: Int = 0
+    private var mColorAccent: Int = 0
+    private var mControlColor: Int = 0
+    private var mColorPrimary: Int = 0
+    private var mColorBackground: Int = 0
+    private var mBackgroundColor: Int? = null
+    private var mForegroundColor: Int? = null
 
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
@@ -102,6 +123,7 @@ class EntryActivity : DatabaseLockActivity() {
         // Get views
         coordinatorLayout = findViewById(R.id.toolbar_coordinator)
         collapsingToolbarLayout = findViewById(R.id.toolbar_layout)
+        appBarLayout = findViewById(R.id.app_bar)
         titleIconView = findViewById(R.id.entry_icon)
         historyView = findViewById(R.id.history_container)
         entryProgress = findViewById(R.id.entry_progress)
@@ -112,18 +134,28 @@ class EntryActivity : DatabaseLockActivity() {
         collapsingToolbarLayout?.title = " "
         toolbar?.title = " "
 
-        // Retrieve the textColor to tint the icon
-        val taIconColor = theme.obtainStyledAttributes(intArrayOf(R.attr.colorAccent))
-        mIconColor = taIconColor.getColor(0, Color.BLACK)
-        taIconColor.recycle()
+        // Retrieve the textColor to tint the toolbar
+        val taColorAccent = theme.obtainStyledAttributes(intArrayOf(R.attr.colorAccent))
+        val taControlColor = theme.obtainStyledAttributes(intArrayOf(R.attr.toolbarColorControl))
+        val taColorPrimary = theme.obtainStyledAttributes(intArrayOf(R.attr.colorPrimary))
+        val taColorBackground = theme.obtainStyledAttributes(intArrayOf(android.R.attr.windowBackground))
+        mColorAccent = taColorAccent.getColor(0, Color.BLACK)
+        mControlColor = taControlColor.getColor(0, Color.BLACK)
+        mColorPrimary = taColorPrimary.getColor(0, Color.BLACK)
+        mColorBackground = taColorBackground.getColor(0, Color.BLACK)
+        taColorAccent.recycle()
+        taControlColor.recycle()
+        taColorPrimary.recycle()
+        taColorBackground.recycle()
 
         // Get Entry from UUID
         try {
-            intent.getParcelableExtra<NodeId<UUID>?>(KEY_ENTRY)?.let { entryId ->
-                mMainEntryId = entryId
+            intent.getParcelableExtra<NodeId<UUID>?>(KEY_ENTRY)?.let { mainEntryId ->
                 intent.removeExtra(KEY_ENTRY)
-                mHistoryPosition = intent.getIntExtra(KEY_ENTRY_HISTORY_POSITION, -1)
+                val historyPosition = intent.getIntExtra(KEY_ENTRY_HISTORY_POSITION, -1)
                 intent.removeExtra(KEY_ENTRY_HISTORY_POSITION)
+
+                mEntryViewModel.loadEntry(mDatabase, mainEntryId, historyPosition)
             }
         } catch (e: ClassCastException) {
             Log.e(TAG, "Unable to retrieve the entry key")
@@ -131,6 +163,15 @@ class EntryActivity : DatabaseLockActivity() {
 
         // Init SAF manager
         mExternalFileHelper = ExternalFileHelper(this)
+        mExternalFileHelper?.buildCreateDocument { createdFileUri ->
+            mAttachmentSelected?.let { attachment ->
+                if (createdFileUri != null) {
+                    mAttachmentFileBinderManager
+                        ?.startDownloadAttachment(createdFileUri, attachment)
+                }
+                mAttachmentSelected = null
+            }
+        }
         // Init attachment service binder manager
         mAttachmentFileBinderManager = AttachmentFileBinderManager(this)
 
@@ -138,59 +179,57 @@ class EntryActivity : DatabaseLockActivity() {
             lockAndExit()
         }
 
-        mEntryViewModel.mainEntryId.observe(this) { mainEntryId ->
-            this.mMainEntryId = mainEntryId
-            invalidateOptionsMenu()
-        }
+        mEntryViewModel.entryInfoHistory.observe(this) { entryInfoHistory ->
+            if (entryInfoHistory != null) {
+                this.mMainEntryId = entryInfoHistory.mainEntryId
 
-        mEntryViewModel.historyPosition.observe(this) { historyPosition ->
-            this.mHistoryPosition = historyPosition
-            val entryIsHistory = historyPosition > -1
-            this.mEntryIsHistory = entryIsHistory
-            // Assign history dedicated view
-            historyView?.visibility = if (entryIsHistory) View.VISIBLE else View.GONE
-            if (entryIsHistory) {
-                val taColorAccent = theme.obtainStyledAttributes(intArrayOf(R.attr.colorAccent))
-                collapsingToolbarLayout?.contentScrim = ColorDrawable(taColorAccent.getColor(0, Color.BLACK))
-                taColorAccent.recycle()
-            }
-            invalidateOptionsMenu()
-        }
-
-        mEntryViewModel.entryInfo.observe(this) { entryInfo ->
-            // Manage entry copy to start notification if allowed (at the first start)
-            if (savedInstanceState == null) {
-                // Manage entry to launch copying notification if allowed
-                ClipboardEntryNotificationService.launchNotificationIfAllowed(this, entryInfo)
-                // Manage entry to populate Magikeyboard and launch keyboard notification if allowed
-                if (PreferencesUtil.isKeyboardEntrySelectionEnable(this)) {
-                    MagikeyboardService.addEntryAndLaunchNotificationIfAllowed(this, entryInfo)
+                // Manage history position
+                val historyPosition = entryInfoHistory.historyPosition
+                this.mHistoryPosition = historyPosition
+                val entryIsHistory = historyPosition > -1
+                this.mEntryIsHistory = entryIsHistory
+                // Assign history dedicated view
+                historyView?.visibility = if (entryIsHistory) View.VISIBLE else View.GONE
+                if (entryIsHistory) {
+                    collapsingToolbarLayout?.contentScrim =
+                        ColorDrawable(mColorAccent)
                 }
+
+                val entryInfo = entryInfoHistory.entryInfo
+                // Manage entry copy to start notification if allowed (at the first start)
+                if (savedInstanceState == null) {
+                    // Manage entry to launch copying notification if allowed
+                    ClipboardEntryNotificationService.launchNotificationIfAllowed(this, entryInfo)
+                    // Manage entry to populate Magikeyboard and launch keyboard notification if allowed
+                    if (PreferencesUtil.isKeyboardEntrySelectionEnable(this)) {
+                        MagikeyboardService.addEntryAndLaunchNotificationIfAllowed(this, entryInfo)
+                    }
+                }
+                // Assign title icon
+                mIcon = entryInfo.icon
+                // Assign title text
+                val entryTitle =
+                    if (entryInfo.title.isNotEmpty()) entryInfo.title else UuidUtil.toHexString(entryInfo.id)
+                collapsingToolbarLayout?.title = entryTitle
+                toolbar?.title = entryTitle
+                mUrl = entryInfo.url
+                // Assign colors
+                mBackgroundColor = entryInfo.backgroundColor
+                mForegroundColor = entryInfo.foregroundColor
+
+                loadingView?.hideByFading()
+                mEntryLoaded = true
+            } else {
+                finish()
             }
-
-            // Assign title icon
-            mIcon = entryInfo.icon
-            titleIconView?.let { iconView ->
-                mIconDrawableFactory?.assignDatabaseIcon(iconView, entryInfo.icon, mIconColor)
-            }
-
-            // Assign title text
-            val entryTitle = if (entryInfo.title.isNotEmpty()) entryInfo.title else entryInfo.id.toString()
-            collapsingToolbarLayout?.title = entryTitle
-            toolbar?.title = entryTitle
-
-            mUrl = entryInfo.url
-
             // Refresh Menu
             invalidateOptionsMenu()
-
-            loadingView?.hideByFading()
         }
 
         mEntryViewModel.onOtpElementUpdated.observe(this) { otpElement ->
-            if (otpElement == null)
+            if (otpElement == null) {
                 entryProgress?.visibility = View.GONE
-            when (otpElement?.type) {
+            } else when (otpElement.type) {
                 // Only add token if HOTP
                 OtpType.HOTP -> {
                     entryProgress?.visibility = View.GONE
@@ -199,7 +238,7 @@ class EntryActivity : DatabaseLockActivity() {
                 OtpType.TOTP -> {
                     entryProgress?.apply {
                         max = otpElement.period
-                        progress = otpElement.secondsRemaining
+                        setProgressCompat(otpElement.secondsRemaining, true)
                         visibility = View.VISIBLE
                     }
                 }
@@ -207,9 +246,8 @@ class EntryActivity : DatabaseLockActivity() {
         }
 
         mEntryViewModel.attachmentSelected.observe(this) { attachmentSelected ->
-            mExternalFileHelper?.createDocument(attachmentSelected.name)?.let { requestCode ->
-                mAttachmentsToDownload[requestCode] = attachmentSelected
-            }
+            mAttachmentSelected = attachmentSelected
+            mExternalFileHelper?.createDocument(attachmentSelected.name)
         }
 
         mEntryViewModel.historySelected.observe(this) { historySelected ->
@@ -218,7 +256,8 @@ class EntryActivity : DatabaseLockActivity() {
                     this,
                     database,
                     historySelected.nodeId,
-                    historySelected.historyPosition
+                    historySelected.historyPosition,
+                    mEntryActivityResultLauncher
                 )
             }
         }
@@ -235,14 +274,7 @@ class EntryActivity : DatabaseLockActivity() {
     override fun onDatabaseRetrieved(database: Database?) {
         super.onDatabaseRetrieved(database)
 
-        mEntryViewModel.loadEntry(mDatabase, mMainEntryId, mHistoryPosition)
-
-        // Assign title icon
-        mIcon?.let { icon ->
-            titleIconView?.let { iconView ->
-                mIconDrawableFactory?.assignDatabaseIcon(iconView, icon, mIconColor)
-            }
-        }
+        mEntryViewModel.loadDatabase(database)
     }
 
     override fun onDatabaseActionFinished(
@@ -288,54 +320,67 @@ class EntryActivity : DatabaseLockActivity() {
         super.onPause()
     }
 
-    override fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?) {
-        super.onActivityResult(requestCode, resultCode, data)
-
-        when (requestCode) {
-            EntryEditActivity.ADD_OR_UPDATE_ENTRY_REQUEST_CODE -> {
-                // Reload the current id from database
-                mEntryViewModel.updateEntry(mDatabase)
-            }
-        }
-
-        mExternalFileHelper?.onCreateDocumentResult(requestCode, resultCode, data) { createdFileUri ->
-            if (createdFileUri != null) {
-                mAttachmentsToDownload[requestCode]?.let { attachmentToDownload ->
-                    mAttachmentFileBinderManager
-                            ?.startDownloadAttachment(createdFileUri, attachmentToDownload)
-                }
+    private fun applyToolbarColors() {
+        appBarLayout?.setBackgroundColor(mBackgroundColor ?: mColorPrimary)
+        collapsingToolbarLayout?.contentScrim = ColorDrawable(mBackgroundColor ?: mColorPrimary)
+        val backgroundDarker = if (mBackgroundColor != null) {
+            ColorUtils.blendARGB(mBackgroundColor!!, Color.WHITE, 0.1f)
+        } else {
+            mColorBackground
+        }
+        titleIconView?.background?.colorFilter = BlendModeColorFilterCompat
+            .createBlendModeColorFilterCompat(backgroundDarker, BlendModeCompat.SRC_IN)
+        mIcon?.let { icon ->
+            titleIconView?.let { iconView ->
+                mIconDrawableFactory?.assignDatabaseIcon(
+                    iconView,
+                    icon,
+                    mForegroundColor ?: mColorAccent
+                )
             }
         }
+        toolbar?.changeControlColor(mForegroundColor ?: mControlColor)
+        collapsingToolbarLayout?.changeTitleColor(mForegroundColor ?: mControlColor)
     }
 
     override fun onCreateOptionsMenu(menu: Menu): Boolean {
         super.onCreateOptionsMenu(menu)
+        if (mEntryLoaded) {
+            val inflater = menuInflater
+            MenuUtil.contributionMenuInflater(inflater, menu)
 
-        val inflater = menuInflater
-        MenuUtil.contributionMenuInflater(inflater, menu)
+            inflater.inflate(R.menu.entry, menu)
+            inflater.inflate(R.menu.database, menu)
 
-        inflater.inflate(R.menu.entry, menu)
-        inflater.inflate(R.menu.database, menu)
+            if (mEntryIsHistory && !mDatabaseReadOnly) {
+                inflater.inflate(R.menu.entry_history, menu)
+            }
 
-        if (mUrl?.isEmpty() != false) {
-            menu.findItem(R.id.menu_goto_url)?.isVisible = false
+            // Show education views
+            Handler(Looper.getMainLooper()).post {
+                performedNextEducation(
+                    EntryActivityEducation(
+                        this
+                    ), menu
+                )
+            }
         }
+        return true
+    }
 
-        if (mEntryIsHistory && !mDatabaseReadOnly) {
-            inflater.inflate(R.menu.entry_history, menu)
+    override fun onPrepareOptionsMenu(menu: Menu?): Boolean {
+        if (mUrl?.isEmpty() != false) {
+            menu?.findItem(R.id.menu_goto_url)?.isVisible = false
         }
         if (mEntryIsHistory || mDatabaseReadOnly) {
-            menu.findItem(R.id.menu_save_database)?.isVisible = false
-            menu.findItem(R.id.menu_edit)?.isVisible = false
+            menu?.findItem(R.id.menu_save_database)?.isVisible = false
+            menu?.findItem(R.id.menu_edit)?.isVisible = false
         }
         if (mSpecialMode != SpecialMode.DEFAULT) {
-            menu.findItem(R.id.menu_reload_database)?.isVisible = false
+            menu?.findItem(R.id.menu_reload_database)?.isVisible = false
         }
-
-        // Show education views
-        Handler(Looper.getMainLooper()).post { performedNextEducation(EntryActivityEducation(this), menu) }
-
-        return true
+        applyToolbarColors()
+        return super.onPrepareOptionsMenu(menu)
     }
 
     private fun performedNextEducation(entryActivityEducation: EntryActivityEducation,
@@ -380,7 +425,8 @@ class EntryActivity : DatabaseLockActivity() {
                         EntryEditActivity.launchToUpdate(
                             this,
                             database,
-                            entryId
+                            entryId,
+                            mEntryActivityResultLauncher
                         )
                     }
                 }
@@ -421,7 +467,7 @@ class EntryActivity : DatabaseLockActivity() {
         // Transit data in previous Activity after an update
         Intent().apply {
             putExtra(EntryEditActivity.ADD_OR_UPDATE_ENTRY_KEY, mMainEntryId)
-            setResult(EntryEditActivity.ADD_OR_UPDATE_ENTRY_RESULT_CODE, this)
+            setResult(Activity.RESULT_OK, this)
         }
         super.finish()
     }
@@ -439,15 +485,13 @@ class EntryActivity : DatabaseLockActivity() {
          */
         fun launch(activity: Activity,
                    database: Database,
-                   entryId: NodeId<UUID>) {
+                   entryId: NodeId<UUID>,
+                   activityResultLauncher: ActivityResultLauncher<Intent>) {
             if (database.loaded) {
                 if (TimeoutHelper.checkTimeAndLockIfTimeout(activity)) {
                     val intent = Intent(activity, EntryActivity::class.java)
                     intent.putExtra(KEY_ENTRY, entryId)
-                    activity.startActivityForResult(
-                        intent,
-                        EntryEditActivity.ADD_OR_UPDATE_ENTRY_REQUEST_CODE
-                    )
+                    activityResultLauncher.launch(intent)
                 }
             }
         }
@@ -458,16 +502,14 @@ class EntryActivity : DatabaseLockActivity() {
         fun launch(activity: Activity,
                    database: Database,
                    entryId: NodeId<UUID>,
-                   historyPosition: Int) {
+                   historyPosition: Int,
+                   activityResultLauncher: ActivityResultLauncher<Intent>) {
             if (database.loaded) {
                 if (TimeoutHelper.checkTimeAndLockIfTimeout(activity)) {
                     val intent = Intent(activity, EntryActivity::class.java)
                     intent.putExtra(KEY_ENTRY, entryId)
                     intent.putExtra(KEY_ENTRY_HISTORY_POSITION, historyPosition)
-                    activity.startActivityForResult(
-                        intent,
-                        EntryEditActivity.ADD_OR_UPDATE_ENTRY_REQUEST_CODE
-                    )
+                    activityResultLauncher.launch(intent)
                 }
             }
         }

app/src/main/java/com/kunzisoft/keepass/activities/EntryEditActivity.kt

@@ -33,12 +33,17 @@ import android.view.Menu
 import android.view.MenuItem
 import android.view.View
 import android.widget.*
+import androidx.activity.result.ActivityResultLauncher
+import androidx.activity.result.contract.ActivityResultContracts
 import androidx.activity.viewModels
 import androidx.annotation.RequiresApi
 import androidx.appcompat.app.AlertDialog
+import androidx.appcompat.app.AppCompatActivity
 import androidx.coordinatorlayout.widget.CoordinatorLayout
 import androidx.core.view.isVisible
 import androidx.core.widget.NestedScrollView
+import androidx.fragment.app.Fragment
+import androidx.fragment.app.FragmentActivity
 import com.google.android.material.snackbar.Snackbar
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.dialogs.*
@@ -48,12 +53,9 @@ import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
 import com.kunzisoft.keepass.activities.helpers.ExternalFileHelper
 import com.kunzisoft.keepass.activities.legacy.DatabaseLockActivity
 import com.kunzisoft.keepass.adapters.TemplatesSelectorAdapter
-import com.kunzisoft.keepass.app.database.IOActionTask
 import com.kunzisoft.keepass.autofill.AutofillComponent
 import com.kunzisoft.keepass.autofill.AutofillHelper
 import com.kunzisoft.keepass.database.element.*
-import com.kunzisoft.keepass.database.element.icon.IconImage
-import com.kunzisoft.keepass.database.element.icon.IconImageStandard
 import com.kunzisoft.keepass.database.element.node.Node
 import com.kunzisoft.keepass.database.element.node.NodeId
 import com.kunzisoft.keepass.database.element.template.*
@@ -72,6 +74,7 @@ import com.kunzisoft.keepass.tasks.AttachmentFileBinderManager
 import com.kunzisoft.keepass.timeout.TimeoutHelper
 import com.kunzisoft.keepass.utils.UriUtil
 import com.kunzisoft.keepass.view.*
+import com.kunzisoft.keepass.viewmodels.ColorPickerViewModel
 import com.kunzisoft.keepass.viewmodels.EntryEditViewModel
 import org.joda.time.DateTime
 import java.util.*
@@ -95,15 +98,13 @@ class EntryEditActivity : DatabaseLockActivity(),
     private var lockView: View? = null
     private var loadingView: ProgressBar? = null
 
-    private var mEntryId: NodeId<UUID>? = null
-    private var mParentId: NodeId<*>? = null
-    private var mRegisterInfo: RegisterInfo? = null
-    private var mSearchInfo: SearchInfo? = null
-
     private val mEntryEditViewModel: EntryEditViewModel by viewModels()
-    private var mParent: Group? = null
-    private var mEntry: Entry? = null
+    private var mTemplate: Template? = null
     private var mIsTemplate: Boolean = false
+    private var mEntryLoaded: Boolean = false
+    private var mTemplatesSelectorAdapter: TemplatesSelectorAdapter? = null
+
+    private val mColorPickerViewModel: ColorPickerViewModel by viewModels()
 
     private var mAllowCustomFields = false
     private var mAllowOTP = false
@@ -114,6 +115,10 @@ class EntryEditActivity : DatabaseLockActivity(),
     // Education
     private var entryEditActivityEducation: EntryEditActivityEducation? = null
 
+    private var mIconSelectionActivityResultLauncher = IconPickerActivity.registerIconSelectionForResult(this) { icon ->
+        mEntryEditViewModel.selectIcon(icon)
+    }
+
     // To ask data lost only one time
     private var backPressedAlreadyApproved = false
 
@@ -138,25 +143,45 @@ class EntryEditActivity : DatabaseLockActivity(),
         stopService(Intent(this, ClipboardEntryNotificationService::class.java))
         stopService(Intent(this, KeyboardEntryNotificationService::class.java))
 
-        mRegisterInfo = EntrySelectionHelper.retrieveRegisterInfoFromIntent(intent)
-        mSearchInfo = EntrySelectionHelper.retrieveSearchInfoFromIntent(intent)
-
         // Entry is retrieve, it's an entry to update
+        var entryId: NodeId<UUID>? = null
         intent.getParcelableExtra<NodeId<UUID>>(KEY_ENTRY)?.let { entryToUpdate ->
-            //intent.removeExtra(KEY_ENTRY)
-            mEntryId = entryToUpdate
+            intent.removeExtra(KEY_ENTRY)
+            entryId = entryToUpdate
         }
 
         // Parent is retrieve, it's a new entry to create
+        var parentId: NodeId<*>? = null
         intent.getParcelableExtra<NodeId<*>>(KEY_PARENT)?.let { parent ->
-            //intent.removeExtra(KEY_PARENT)
-            mParentId = parent
+            intent.removeExtra(KEY_PARENT)
+            parentId = parent
         }
 
-        retrieveEntry(mDatabase)
+        mEntryEditViewModel.loadTemplateEntry(
+            mDatabase,
+            entryId,
+            parentId,
+            EntrySelectionHelper.retrieveRegisterInfoFromIntent(intent),
+            EntrySelectionHelper.retrieveSearchInfoFromIntent(intent)
+        )
 
         // To retrieve attachment
         mExternalFileHelper = ExternalFileHelper(this)
+        mExternalFileHelper?.buildOpenDocument { uri ->
+            uri?.let { attachmentToUploadUri ->
+                UriUtil.getFileData(this, attachmentToUploadUri)?.also { documentFile ->
+                    documentFile.name?.let { fileName ->
+                        if (documentFile.length() > MAX_WARNING_BINARY_FILE) {
+                            FileTooBigDialogFragment.build(attachmentToUploadUri, fileName)
+                                .show(supportFragmentManager, "fileTooBigFragment")
+                        } else {
+                            mEntryEditViewModel.buildNewAttachment(attachmentToUploadUri, fileName)
+                        }
+                    }
+                }
+            }
+        }
+
         mAttachmentFileBinderManager = AttachmentFileBinderManager(this)
         // Verify the education views
         entryEditActivityEducation = EntryEditActivityEducation(this)
@@ -166,43 +191,68 @@ class EntryEditActivity : DatabaseLockActivity(),
         // Save button
         validateButton?.setOnClickListener { saveEntry() }
 
-        mEntryEditViewModel.templatesEntry.observe(this) { templatesEntry ->
-            // Change template dynamically
-            templatesEntry?.templates?.let { templates ->
-                val defaultTemplate = templatesEntry.defaultTemplate
-                templateSelectorSpinner?.apply {
-                    // Build template selector
-                    if (templates.isNotEmpty()) {
-                        adapter = TemplatesSelectorAdapter(
-                            this@EntryEditActivity,
-                            mIconDrawableFactory,
-                            templates
-                        )
-                        setSelection(templates.indexOf(defaultTemplate))
-                        onItemSelectedListener = object : AdapterView.OnItemSelectedListener {
-                            override fun onItemSelected(
-                                parent: AdapterView<*>?,
-                                view: View?,
-                                position: Int,
-                                id: Long
-                            ) {
-                                mEntryEditViewModel.changeTemplate(templates[position])
-                            }
+        mEntryEditViewModel.onTemplateChanged.observe(this) { template ->
+            this.mTemplate = template
+        }
 
-                            override fun onNothingSelected(parent: AdapterView<*>?) {}
+        mEntryEditViewModel.templatesEntry.observe(this) { templatesEntry ->
+            if (templatesEntry != null) {
+                // Change template dynamically
+                this.mIsTemplate = templatesEntry.isTemplate
+                templatesEntry.templates.let { templates ->
+                    templateSelectorSpinner?.apply {
+                        // Build template selector
+                        if (templates.isNotEmpty()) {
+                            mTemplatesSelectorAdapter = TemplatesSelectorAdapter(
+                                this@EntryEditActivity,
+                                templates
+                            ).apply {
+                                iconDrawableFactory = mIconDrawableFactory
+                            }
+                            adapter = mTemplatesSelectorAdapter
+                            val selectedTemplate = if (mTemplate != null)
+                                mTemplate
+                            else
+                                templatesEntry.defaultTemplate
+                            setSelection(templates.indexOf(selectedTemplate))
+                            onItemSelectedListener = object : AdapterView.OnItemSelectedListener {
+                                override fun onItemSelected(
+                                    parent: AdapterView<*>?,
+                                    view: View?,
+                                    position: Int,
+                                    id: Long
+                                ) {
+                                    mEntryEditViewModel.changeTemplate(templates[position])
+                                }
+
+                                override fun onNothingSelected(parent: AdapterView<*>?) {}
+                            }
+                        } else {
+                            visibility = View.GONE
                         }
-                    } else {
-                        visibility = View.GONE
                     }
                 }
-            }
 
-            loadingView?.hideByFading()
+                loadingView?.hideByFading()
+                mEntryLoaded = true
+            } else {
+                finish()
+            }
+            invalidateOptionsMenu()
         }
 
         // View model listeners
         mEntryEditViewModel.requestIconSelection.observe(this) { iconImage ->
-            IconPickerActivity.launch(this@EntryEditActivity, iconImage)
+            IconPickerActivity.launch(this@EntryEditActivity, iconImage, mIconSelectionActivityResultLauncher)
+        }
+
+        mEntryEditViewModel.requestColorSelection.observe(this) { color ->
+            ColorPickerDialogFragment.newInstance(color)
+                .show(supportFragmentManager, "ColorPickerFragment")
+        }
+
+        mColorPickerViewModel.colorPicked.observe(this) { color ->
+            mEntryEditViewModel.selectColor(color)
         }
 
         mEntryEditViewModel.requestDateTimeSelection.observe(this) { dateInstant ->
@@ -309,77 +359,10 @@ class EntryEditActivity : DatabaseLockActivity(),
         super.onDatabaseRetrieved(database)
         mAllowCustomFields = database?.allowEntryCustomFields() == true
         mAllowOTP = database?.allowOTP == true
-        retrieveEntry(database)
-    }
-
-    private fun retrieveEntry(database: Database?) {
-        database?.let {
-            mEntryId?.let {
-                IOActionTask(
-                    {
-                        // Create an Entry copy to modify from the database entry
-                        mEntry = database.getEntryById(it)
-                        // Retrieve the parent
-                        mEntry?.let { entry ->
-                            // If no parent, add root group as parent
-                            if (entry.parent == null) {
-                                entry.parent = database.rootGroup
-                            }
-                        }
-                        // Define if current entry is a template (in direct template group)
-                        mIsTemplate = database.entryIsTemplate(mEntry)
-                    },
-                    {
-                        mEntryEditViewModel.loadTemplateEntry(
-                            database,
-                            mEntry,
-                            mIsTemplate,
-                            mRegisterInfo,
-                            mSearchInfo
-                        )
-                    }
-                ).execute()
-                mEntryId = null
-            }
-
-            mParentId?.let {
-                IOActionTask(
-                    {
-                        mParent = database.getGroupById(it)
-                        mParent?.let { parentGroup ->
-                            mEntry = database.createEntry()?.apply {
-                                // Add the default icon from parent if not a folder
-                                val parentIcon = parentGroup.icon
-                                // Set default icon
-                                if (parentIcon.custom.isUnknown
-                                    && parentIcon.standard.id != IconImageStandard.FOLDER_ID
-                                ) {
-                                    icon = IconImage(parentIcon.standard)
-                                }
-                                if (!parentIcon.custom.isUnknown) {
-                                    icon = IconImage(parentIcon.custom)
-                                }
-                                // Set default username
-                                username = database.defaultUsername
-                                // Warning only the entry recognize is parent, parent don't yet recognize the new entry
-                                // Useful to recognize child state (ie: entry is a template)
-                                parent = parentGroup
-                            }
-                        }
-                        mIsTemplate = database.entryIsTemplate(mEntry)
-                    },
-                    {
-                        mEntryEditViewModel.loadTemplateEntry(
-                            database,
-                            mEntry,
-                            mIsTemplate,
-                            mRegisterInfo,
-                            mSearchInfo
-                        )
-                    }
-                ).execute()
-                mParentId = null
-            }
+        mEntryEditViewModel.loadDatabase(database)
+        mTemplatesSelectorAdapter?.apply {
+            iconDrawableFactory = mIconDrawableFactory
+            notifyDataSetChanged()
         }
     }
 
@@ -532,29 +515,6 @@ class EntryEditActivity : DatabaseLockActivity(),
         }
     }
 
-    override fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?) {
-        super.onActivityResult(requestCode, resultCode, data)
-
-        IconPickerActivity.onActivityResult(requestCode, resultCode, data) { icon ->
-            mEntryEditViewModel.selectIcon(icon)
-        }
-
-        mExternalFileHelper?.onOpenDocumentResult(requestCode, resultCode, data) { uri ->
-            uri?.let { attachmentToUploadUri ->
-                UriUtil.getFileData(this, attachmentToUploadUri)?.also { documentFile ->
-                    documentFile.name?.let { fileName ->
-                        if (documentFile.length() > MAX_WARNING_BINARY_FILE) {
-                            FileTooBigDialogFragment.build(attachmentToUploadUri, fileName)
-                                    .show(supportFragmentManager, "fileTooBigFragment")
-                        } else {
-                            mEntryEditViewModel.buildNewAttachment(attachmentToUploadUri, fileName)
-                        }
-                    }
-                }
-            }
-        }
-    }
-
     /**
      * Set up OTP (HOTP or TOTP) and add it as extra field
      */
@@ -571,29 +531,33 @@ class EntryEditActivity : DatabaseLockActivity(),
      */
     private fun saveEntry() {
         mAttachmentFileBinderManager?.stopUploadAllAttachments()
-        mEntryEditViewModel.requestEntryInfoUpdate(mDatabase, mEntry, mParent)
+        mEntryEditViewModel.requestEntryInfoUpdate(mDatabase)
     }
 
     override fun onCreateOptionsMenu(menu: Menu): Boolean {
         super.onCreateOptionsMenu(menu)
-        menuInflater.inflate(R.menu.entry_edit, menu)
+        if (mEntryLoaded) {
+            menuInflater.inflate(R.menu.entry_edit, menu)
+            entryEditActivityEducation?.let {
+                Handler(Looper.getMainLooper()).post {
+                    performedNextEducation(it)
+                }
+            }
+        }
         return true
     }
 
     override fun onPrepareOptionsMenu(menu: Menu?): Boolean {
-
         menu?.findItem(R.id.menu_add_field)?.apply {
             isEnabled = mAllowCustomFields
             isVisible = isEnabled
         }
-
         menu?.findItem(R.id.menu_add_attachment)?.apply {
             // Attachment not compatible below KitKat
             isEnabled = !mIsTemplate
                     && Build.VERSION.SDK_INT >= Build.VERSION_CODES.KITKAT
             isVisible = isEnabled
         }
-
         menu?.findItem(R.id.menu_add_otp)?.apply {
             // OTP not compatible below KitKat
             isEnabled = mAllowOTP
@@ -601,14 +565,10 @@ class EntryEditActivity : DatabaseLockActivity(),
                     && Build.VERSION.SDK_INT >= Build.VERSION_CODES.KITKAT
             isVisible = isEnabled
         }
-
-        entryEditActivityEducation?.let {
-            Handler(Looper.getMainLooper()).post { performedNextEducation(it) }
-        }
         return super.onPrepareOptionsMenu(menu)
     }
 
-    fun performedNextEducation(entryEditActivityEducation: EntryEditActivityEducation) {
+    private fun performedNextEducation(entryEditActivityEducation: EntryEditActivityEducation) {
 
         val entryEditFragment = supportFragmentManager.findFragmentById(R.id.entry_edit_content)
                 as? EntryEditFragment?
@@ -645,7 +605,7 @@ class EntryEditActivity : DatabaseLockActivity(),
                         && entryEditActivityEducation.checkAndPerformedAttachmentEducation(
                         attachmentView,
                         {
-                            mExternalFileHelper?.openDocument()
+                            addNewAttachment()
                         },
                         {
                             performedNextEducation(entryEditActivityEducation)
@@ -746,7 +706,7 @@ class EntryEditActivity : DatabaseLockActivity(),
             val intentEntry = Intent()
             bundle.putParcelable(ADD_OR_UPDATE_ENTRY_KEY, entry.nodeId)
             intentEntry.putExtras(bundle)
-            setResult(ADD_OR_UPDATE_ENTRY_RESULT_CODE, intentEntry)
+            setResult(Activity.RESULT_OK, intentEntry)
             super.finish()
         } catch (e: Exception) {
             // Exception when parcelable can't be done
@@ -761,23 +721,46 @@ class EntryEditActivity : DatabaseLockActivity(),
         // Keys for current Activity
         const val KEY_ENTRY = "entry"
         const val KEY_PARENT = "parent"
-
-        // Keys for callback
-        const val ADD_OR_UPDATE_ENTRY_RESULT_CODE = 31
-        const val ADD_OR_UPDATE_ENTRY_REQUEST_CODE = 7129
         const val ADD_OR_UPDATE_ENTRY_KEY = "ADD_OR_UPDATE_ENTRY_KEY"
 
+        fun registerForEntryResult(fragment: Fragment,
+                                   entryAddedOrUpdatedListener: (NodeId<UUID>?) -> Unit): ActivityResultLauncher<Intent> {
+            return fragment.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) { result ->
+                if (result.resultCode == Activity.RESULT_OK) {
+                    entryAddedOrUpdatedListener.invoke(
+                        result.data?.getParcelableExtra(ADD_OR_UPDATE_ENTRY_KEY)
+                    )
+                } else {
+                    entryAddedOrUpdatedListener.invoke(null)
+                }
+            }
+        }
+
+        fun registerForEntryResult(activity: FragmentActivity,
+                                   entryAddedOrUpdatedListener: (NodeId<UUID>?) -> Unit): ActivityResultLauncher<Intent> {
+            return activity.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) { result ->
+                if (result.resultCode == Activity.RESULT_OK) {
+                    entryAddedOrUpdatedListener.invoke(
+                        result.data?.getParcelableExtra(ADD_OR_UPDATE_ENTRY_KEY)
+                    )
+                } else {
+                    entryAddedOrUpdatedListener.invoke(null)
+                }
+            }
+        }
+
         /**
          * Launch EntryEditActivity to update an existing entry by his [entryId]
          */
         fun launchToUpdate(activity: Activity,
                            database: Database,
-                           entryId: NodeId<UUID>) {
+                           entryId: NodeId<UUID>,
+                           activityResultLauncher: ActivityResultLauncher<Intent>) {
             if (database.loaded && !database.isReadOnly) {
                 if (TimeoutHelper.checkTimeAndLockIfTimeout(activity)) {
                     val intent = Intent(activity, EntryEditActivity::class.java)
                     intent.putExtra(KEY_ENTRY, entryId)
-                    activity.startActivityForResult(intent, ADD_OR_UPDATE_ENTRY_REQUEST_CODE)
+                    activityResultLauncher.launch(intent)
                 }
             }
         }
@@ -787,12 +770,13 @@ class EntryEditActivity : DatabaseLockActivity(),
          */
         fun launchToCreate(activity: Activity,
                            database: Database,
-                           groupId: NodeId<*>) {
+                           groupId: NodeId<*>,
+                           activityResultLauncher: ActivityResultLauncher<Intent>) {
             if (database.loaded && !database.isReadOnly) {
                 if (TimeoutHelper.checkTimeAndLockIfTimeout(activity)) {
                     val intent = Intent(activity, EntryEditActivity::class.java)
                     intent.putExtra(KEY_PARENT, groupId)
-                    activity.startActivityForResult(intent, ADD_OR_UPDATE_ENTRY_REQUEST_CODE)
+                    activityResultLauncher.launch(intent)
                 }
             }
         }
@@ -855,8 +839,9 @@ class EntryEditActivity : DatabaseLockActivity(),
          * Launch EntryEditActivity to add a new entry in autofill selection
          */
         @RequiresApi(api = Build.VERSION_CODES.O)
-        fun launchForAutofillResult(activity: Activity,
+        fun launchForAutofillResult(activity: AppCompatActivity,
                                     database: Database,
+                                    activityResultLauncher: ActivityResultLauncher<Intent>?,
                                     autofillComponent: AutofillComponent,
                                     groupId: NodeId<*>,
                                     searchInfo: SearchInfo? = null) {
@@ -867,6 +852,7 @@ class EntryEditActivity : DatabaseLockActivity(),
                     AutofillHelper.startActivityForAutofillResult(
                         activity,
                         intent,
+                        activityResultLauncher,
                         autofillComponent,
                         searchInfo
                     )

app/src/main/java/com/kunzisoft/keepass/activities/FileDatabaseSelectActivity.kt

@@ -31,8 +31,10 @@ import android.util.Log
 import android.view.Menu
 import android.view.MenuItem
 import android.view.View
+import androidx.activity.result.ActivityResultLauncher
 import androidx.activity.viewModels
 import androidx.annotation.RequiresApi
+import androidx.appcompat.app.AppCompatActivity
 import androidx.appcompat.widget.Toolbar
 import androidx.coordinatorlayout.widget.CoordinatorLayout
 import androidx.recyclerview.widget.LinearLayoutManager
@@ -85,9 +87,20 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
 
     private var mExternalFileHelper: ExternalFileHelper? = null
 
+    private var mAutofillActivityResultLauncher: ActivityResultLauncher<Intent>? =
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O)
+            AutofillHelper.buildActivityResultLauncher(this)
+        else null
+
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
 
+        // Enabling/disabling MagikeyboardService is normally done by DexModeReceiver, but this
+        // additional check will allow the keyboard to be reenabled more easily if the app crashes
+        // or is force quit within DeX mode and then the user leaves DeX mode. Without this, the
+        // user would need to enter and exit DeX mode once to reenable the service.
+        MagikeyboardUtil.setEnabled(this, !DexUtil.isDexMode(resources.configuration))
+
         mFileDatabaseHistoryAction = FileDatabaseHistoryAction.getInstance(applicationContext)
 
         setContentView(R.layout.activity_file_selection)
@@ -103,6 +116,22 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
 
         // Open database button
         mExternalFileHelper = ExternalFileHelper(this)
+        mExternalFileHelper?.buildOpenDocument { uri ->
+            uri?.let {
+                launchPasswordActivityWithPath(uri)
+            }
+        }
+        mExternalFileHelper?.buildCreateDocument("application/x-keepass") { databaseFileCreatedUri ->
+            mDatabaseFileUri = databaseFileCreatedUri
+            if (mDatabaseFileUri != null) {
+                AssignMasterKeyDialogFragment.getInstance(true)
+                    .show(supportFragmentManager, "passwordDialog")
+            } else {
+                val error = getString(R.string.error_create_database)
+                Snackbar.make(coordinatorLayout, error, Snackbar.LENGTH_LONG).asError().show()
+                Log.e(TAG, error)
+            }
+        }
         openDatabaseButtonView = findViewById(R.id.open_keyfile_button)
         openDatabaseButtonView?.setOpenDocumentClickListener(mExternalFileHelper)
 
@@ -250,8 +279,9 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
      * Create a new file by calling the content provider
      */
     private fun createNewFile() {
-        mExternalFileHelper?.createDocument( getString(R.string.database_file_name_default) +
-                getString(R.string.database_file_extension_default), "application/x-keepass")
+        mExternalFileHelper?.createDocument(
+            getString(R.string.database_file_name_default) +
+                getString(R.string.database_file_extension_default))
     }
 
     private fun fileNoFoundAction(e: FileNotFoundException) {
@@ -268,7 +298,8 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
                     fileNoFoundAction(exception)
                 },
                 { onCancelSpecialMode() },
-                { onLaunchActivitySpecialMode() })
+                { onLaunchActivitySpecialMode() },
+                mAutofillActivityResultLauncher)
     }
 
     private fun launchGroupActivityIfLoaded(database: Database) {
@@ -277,7 +308,8 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
                 database,
                 { onValidateSpecialMode() },
                 { onCancelSpecialMode() },
-                { onLaunchActivitySpecialMode() })
+                { onLaunchActivitySpecialMode() },
+                mAutofillActivityResultLauncher)
         }
     }
 
@@ -353,33 +385,6 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
 
     override fun onAssignKeyDialogNegativeClick(mainCredential: MainCredential) {}
 
-    override fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?) {
-        super.onActivityResult(requestCode, resultCode, data)
-
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
-            AutofillHelper.onActivityResultSetResultAndFinish(this, requestCode, resultCode, data)
-        }
-
-        mExternalFileHelper?.onOpenDocumentResult(requestCode, resultCode, data) { uri ->
-            if (uri != null) {
-                launchPasswordActivityWithPath(uri)
-            }
-        }
-
-        // Retrieve the created URI from the file manager
-        mExternalFileHelper?.onCreateDocumentResult(requestCode, resultCode, data) { databaseFileCreatedUri ->
-            mDatabaseFileUri = databaseFileCreatedUri
-            if (mDatabaseFileUri != null) {
-                AssignMasterKeyDialogFragment.getInstance(true)
-                        .show(supportFragmentManager, "passwordDialog")
-            } else {
-                val error = getString(R.string.error_create_database)
-                Snackbar.make(coordinatorLayout, error, Snackbar.LENGTH_LONG).asError().show()
-                Log.e(TAG, error)
-            }
-        }
-    }
-
     override fun onCreateOptionsMenu(menu: Menu): Boolean {
         super.onCreateOptionsMenu(menu)
 
@@ -493,11 +498,13 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
          */
 
         @RequiresApi(api = Build.VERSION_CODES.O)
-        fun launchForAutofillResult(activity: Activity,
+        fun launchForAutofillResult(activity: AppCompatActivity,
+                                    activityResultLauncher: ActivityResultLauncher<Intent>?,
                                     autofillComponent: AutofillComponent,
                                     searchInfo: SearchInfo? = null) {
             AutofillHelper.startActivityForAutofillResult(activity,
                     Intent(activity, FileDatabaseSelectActivity::class.java),
+                    activityResultLauncher,
                     autofillComponent,
                     searchInfo)
         }

app/src/main/java/com/kunzisoft/keepass/activities/GroupActivity.kt

@@ -25,7 +25,7 @@ import android.app.TimePickerDialog
 import android.content.ComponentName
 import android.content.Context
 import android.content.Intent
-import android.graphics.Color
+import android.graphics.PorterDuff
 import android.os.*
 import android.util.Log
 import android.view.Menu
@@ -33,18 +33,23 @@ import android.view.MenuItem
 import android.view.View
 import android.view.ViewGroup
 import android.widget.*
+import androidx.activity.result.ActivityResultLauncher
 import androidx.activity.viewModels
 import androidx.annotation.RequiresApi
+import androidx.appcompat.app.AppCompatActivity
 import androidx.appcompat.view.ActionMode
 import androidx.appcompat.widget.SearchView
 import androidx.appcompat.widget.Toolbar
 import androidx.coordinatorlayout.widget.CoordinatorLayout
+import androidx.core.view.isVisible
+import androidx.recyclerview.widget.RecyclerView
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.dialogs.*
 import com.kunzisoft.keepass.activities.fragments.GroupFragment
 import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
 import com.kunzisoft.keepass.activities.helpers.SpecialMode
 import com.kunzisoft.keepass.activities.legacy.DatabaseLockActivity
+import com.kunzisoft.keepass.adapters.BreadcrumbAdapter
 import com.kunzisoft.keepass.adapters.SearchEntryCursorAdapter
 import com.kunzisoft.keepass.autofill.AutofillComponent
 import com.kunzisoft.keepass.autofill.AutofillHelper
@@ -58,6 +63,7 @@ import com.kunzisoft.keepass.model.GroupInfo
 import com.kunzisoft.keepass.model.RegisterInfo
 import com.kunzisoft.keepass.model.SearchInfo
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_UPDATE_ENTRY_TASK
+import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_UPDATE_GROUP_TASK
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.NEW_NODES_KEY
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.getListNodesFromBundle
 import com.kunzisoft.keepass.settings.PreferencesUtil
@@ -75,6 +81,7 @@ class GroupActivity : DatabaseLockActivity(),
         GroupFragment.NodeClickListener,
         GroupFragment.NodesActionMenuListener,
         GroupFragment.OnScrollListener,
+        GroupFragment.GroupRefreshedListener,
         SortDialogFragment.SortSelectionListener {
 
     // Views
@@ -82,18 +89,25 @@ class GroupActivity : DatabaseLockActivity(),
     private var coordinatorLayout: CoordinatorLayout? = null
     private var lockView: View? = null
     private var toolbar: Toolbar? = null
+    private var databaseNameContainer: ViewGroup? = null
+    private var databaseColorView: ImageView? = null
+    private var databaseNameView: TextView? = null
+    private var searchContainer: ViewGroup? = null
+    private var searchNumbers: TextView? = null
+    private var searchString: TextView? = null
+    private var toolbarBreadcrumb: Toolbar? = null
     private var searchTitleView: View? = null
     private var toolbarAction: ToolbarAction? = null
-    private var iconView: ImageView? = null
     private var numberChildrenView: TextView? = null
     private var addNodeButtonView: AddNodeButtonView? = null
-    private var groupNameView: TextView? = null
-    private var groupMetaView: TextView? = null
+    private var breadcrumbListView: RecyclerView? = null
     private var loadingView: ProgressBar? = null
 
     private val mGroupViewModel: GroupViewModel by viewModels()
     private val mGroupEditViewModel: GroupEditViewModel by viewModels()
 
+    private var mBreadcrumbAdapter: BreadcrumbAdapter? = null
+
     private var mGroupFragment: GroupFragment? = null
     private var mRecyclingBinEnabled = false
     private var mRecyclingBinIsCurrentGroup = false
@@ -111,7 +125,15 @@ class GroupActivity : DatabaseLockActivity(),
     private var mSearchSuggestionAdapter: SearchEntryCursorAdapter? = null
     private var mOnSuggestionListener: SearchView.OnSuggestionListener? = null
 
-    private var mIconColor: Int = 0
+    private var mIconSelectionActivityResultLauncher = IconPickerActivity.registerIconSelectionForResult(this) { icon ->
+        // To create tree dialog for icon
+        mGroupEditViewModel.selectIcon(icon)
+    }
+
+    private var mAutofillActivityResultLauncher: ActivityResultLauncher<Intent>? =
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O)
+            AutofillHelper.buildActivityResultLauncher(this)
+        else null
 
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
@@ -122,13 +144,18 @@ class GroupActivity : DatabaseLockActivity(),
         // Initialize views
         rootContainerView = findViewById(R.id.activity_group_container_view)
         coordinatorLayout = findViewById(R.id.group_coordinator)
-        iconView = findViewById(R.id.group_icon)
         numberChildrenView = findViewById(R.id.group_numbers)
         addNodeButtonView = findViewById(R.id.add_node_button)
         toolbar = findViewById(R.id.toolbar)
+        databaseNameContainer = findViewById(R.id.database_name_container)
+        databaseColorView = findViewById(R.id.database_color)
+        databaseNameView = findViewById(R.id.database_name)
+        searchContainer = findViewById(R.id.search_container)
+        searchNumbers = findViewById(R.id.search_numbers)
+        searchString = findViewById(R.id.search_string)
+        toolbarBreadcrumb = findViewById(R.id.toolbar_breadcrumb)
         searchTitleView = findViewById(R.id.search_title)
-        groupNameView = findViewById(R.id.group_name)
-        groupMetaView = findViewById(R.id.group_meta)
+        breadcrumbListView = findViewById(R.id.breadcrumb_list)
         toolbarAction = findViewById(R.id.toolbar_action)
         lockView = findViewById(R.id.lock_button)
         loadingView = findViewById(R.id.loading)
@@ -140,10 +167,42 @@ class GroupActivity : DatabaseLockActivity(),
         toolbar?.title = ""
         setSupportActionBar(toolbar)
 
-        // Retrieve the textColor to tint the icon
-        val taTextColor = theme.obtainStyledAttributes(intArrayOf(R.attr.textColorInverse))
-        mIconColor = taTextColor.getColor(0, Color.WHITE)
-        taTextColor.recycle()
+        mBreadcrumbAdapter = BreadcrumbAdapter(this).apply {
+            // Open group on breadcrumb click
+            onItemClickListener = { node, _ ->
+                // If last item & not a virtual root group
+                val currentGroup = mCurrentGroup
+                if (currentGroup != null && node == currentGroup
+                    && (currentGroup != mDatabase?.rootGroup
+                            || mDatabase?.rootGroupIsVirtual == false)
+                ) {
+                    finishNodeAction()
+                    launchDialogToShowGroupInfo(currentGroup)
+                } else {
+                    if (mGroupFragment?.nodeActionSelectionMode == true) {
+                        finishNodeAction()
+                    }
+                    mDatabase?.let { database ->
+                        onNodeClick(database, node)
+                    }
+                }
+            }
+            onLongItemClickListener = { node, position ->
+                val currentGroup = mCurrentGroup
+                if (currentGroup != null && node == currentGroup
+                    && (currentGroup != mDatabase?.rootGroup
+                            || mDatabase?.rootGroupIsVirtual == false)
+                ) {
+                    finishNodeAction()
+                    launchDialogForGroupUpdate(currentGroup)
+                } else {
+                    onItemClickListener?.invoke(node, position)
+                }
+            }
+        }
+        breadcrumbListView?.apply {
+            adapter = mBreadcrumbAdapter
+        }
 
         // Retrieve group if defined at launch
         manageIntent(intent)
@@ -201,21 +260,22 @@ class GroupActivity : DatabaseLockActivity(),
 
                 // Add listeners to the add buttons
                 addNodeButtonView?.setAddGroupClickListener {
-                    GroupEditDialogFragment.create(GroupInfo().apply {
-                        if (currentGroup.allowAddNoteInGroup) {
-                            notes = ""
-                        }
-                    }).show(supportFragmentManager, GroupEditDialogFragment.TAG_CREATE_GROUP)
+                    launchDialogForGroupCreation(currentGroup)
                 }
                 addNodeButtonView?.setAddEntryClickListener {
                     mDatabase?.let { database ->
                         EntrySelectionHelper.doSpecialAction(intent,
                             {
-                                EntryEditActivity.launchToCreate(
-                                    this@GroupActivity,
-                                    database,
-                                    currentGroup.nodeId
-                                )
+                                mCurrentGroup?.nodeId?.let { currentParentGroupId ->
+                                    mGroupFragment?.mEntryActivityResultLauncher?.let { resultLauncher ->
+                                        EntryEditActivity.launchToCreate(
+                                            this@GroupActivity,
+                                            database,
+                                            currentParentGroupId,
+                                            resultLauncher
+                                        )
+                                    }
+                                }
                             },
                             {
                                 // Search not used
@@ -243,6 +303,7 @@ class GroupActivity : DatabaseLockActivity(),
                                     EntryEditActivity.launchForAutofillResult(
                                         this@GroupActivity,
                                         database,
+                                        mAutofillActivityResultLauncher,
                                         autofillComponent,
                                         currentGroup.nodeId,
                                         searchInfo
@@ -266,9 +327,6 @@ class GroupActivity : DatabaseLockActivity(),
                 }
             }
 
-            assignGroupViewElements(currentGroup)
-            invalidateOptionsMenu()
-
             loadingView?.hideByFading()
         }
 
@@ -277,7 +335,7 @@ class GroupActivity : DatabaseLockActivity(),
         }
 
         mGroupEditViewModel.requestIconSelection.observe(this) { iconImage ->
-            IconPickerActivity.launch(this@GroupActivity, iconImage)
+            IconPickerActivity.launch(this@GroupActivity, iconImage, mIconSelectionActivityResultLauncher)
         }
 
         mGroupEditViewModel.requestDateTimeSelection.observe(this) { dateInstant ->
@@ -319,6 +377,29 @@ class GroupActivity : DatabaseLockActivity(),
         return rootContainerView
     }
 
+    private fun loadGroup(database: Database?) {
+        when {
+            Intent.ACTION_SEARCH == intent.action -> {
+                finishNodeAction()
+                val searchString =
+                    intent.getStringExtra(SearchManager.QUERY)?.trim { it <= ' ' } ?: ""
+                mGroupViewModel.loadGroupFromSearch(
+                    database,
+                    searchString,
+                    PreferencesUtil.omitBackup(this)
+                )
+            }
+            mCurrentGroupState == null -> {
+                mRootGroup?.let { rootGroup ->
+                    mGroupViewModel.loadGroup(database, rootGroup, 0)
+                }
+            }
+            else -> {
+                mGroupViewModel.loadGroup(database, mCurrentGroupState)
+            }
+        }
+    }
+
     override fun onDatabaseRetrieved(database: Database?) {
         super.onDatabaseRetrieved(database)
 
@@ -328,17 +409,23 @@ class GroupActivity : DatabaseLockActivity(),
                 && database?.isRecycleBinEnabled == true
 
         mRootGroup = database?.rootGroup
-        if (mCurrentGroupState == null) {
-            mRootGroup?.let { rootGroup ->
-                mGroupViewModel.loadGroup(database, rootGroup, 0)
-            }
-        } else {
-            mGroupViewModel.loadGroup(database, mCurrentGroupState)
-        }
+        loadGroup(database)
 
         // Search suggestion
         database?.let {
+            databaseNameView?.text = if (it.name.isNotEmpty()) it.name else getString(R.string.database)
+            val customColor = it.customColor
+            if (customColor != null) {
+                databaseColorView?.visibility = View.VISIBLE
+                databaseColorView?.setColorFilter(
+                    customColor,
+                    PorterDuff.Mode.SRC_IN
+                )
+            } else {
+                databaseColorView?.visibility = View.GONE
+            }
             mSearchSuggestionAdapter = SearchEntryCursorAdapter(this, it)
+            mBreadcrumbAdapter?.iconDrawableFactory = it.iconDrawableFactory
             mOnSuggestionListener = object : SearchView.OnSuggestionListener {
                 override fun onSuggestionClick(position: Int): Boolean {
                     mSearchSuggestionAdapter?.let { searchAdapter ->
@@ -413,16 +500,27 @@ class GroupActivity : DatabaseLockActivity(),
                     )
                 }
             }
+            ACTION_DATABASE_UPDATE_GROUP_TASK -> {
+                if (result.isSuccess) {
+                    try {
+                        if (mCurrentGroup == newNodes[0] as Group)
+                            reloadCurrentGroup()
+                    } catch (e: Exception) {
+                        Log.e(
+                            TAG,
+                            "Unable to perform action after group update",
+                            e
+                        )
+                    }
+                }
+            }
         }
 
         coordinatorLayout?.showActionErrorIfNeeded(result)
         if (!result.isSuccess) {
             reloadCurrentGroup()
         }
-
         finishNodeAction()
-
-        refreshNumberOfChildren(mCurrentGroup)
     }
 
     /**
@@ -447,16 +545,7 @@ class GroupActivity : DatabaseLockActivity(),
             }
             // To transform KEY_SEARCH_INFO in ACTION_SEARCH
             transformSearchInfoIntent(intent)
-            if (Intent.ACTION_SEARCH == intent.action) {
-                finishNodeAction()
-                val searchString =
-                    intent.getStringExtra(SearchManager.QUERY)?.trim { it <= ' ' } ?: ""
-                mGroupViewModel.loadGroupFromSearch(
-                    mDatabase,
-                    searchString,
-                    PreferencesUtil.omitBackup(this)
-                )
-            }
+            loadGroup(mDatabase)
         }
     }
 
@@ -476,60 +565,44 @@ class GroupActivity : DatabaseLockActivity(),
         super.onSaveInstanceState(outState)
     }
 
+    override fun onGroupRefreshed() {
+        mCurrentGroup?.let { currentGroup ->
+            assignGroupViewElements(currentGroup)
+        }
+    }
+
     private fun assignGroupViewElements(group: Group?) {
         // Assign title
-        if (group != null) {
-            if (groupNameView != null) {
-                val title = group.title
-                groupNameView?.text = if (title.isNotEmpty()) title else getText(R.string.root)
-                groupNameView?.invalidate()
-            }
-            if (groupMetaView != null) {
-                val meta = group.nodeId.toString()
-                groupMetaView?.text = meta
-                if (meta.isNotEmpty() && PreferencesUtil.showUUID(this)) {
-                    groupMetaView?.visibility = View.VISIBLE
-                } else {
-                    groupMetaView?.visibility = View.GONE
-                }
-                groupMetaView?.invalidate()
-            }
-        }
-
         if (group?.isVirtual == true) {
-            searchTitleView?.visibility = View.VISIBLE
-            if (toolbar != null) {
-                toolbar?.navigationIcon = null
-            }
-            iconView?.visibility = View.GONE
+            searchContainer?.visibility = View.VISIBLE
+            val title = group.title
+            searchString?.text = if (title.isNotEmpty()) title else ""
+            searchNumbers?.text = group.numberOfChildEntries.toString()
+            databaseNameContainer?.visibility = View.GONE
+            toolbarBreadcrumb?.navigationIcon = null
+            toolbarBreadcrumb?.collapse()
         } else {
-            searchTitleView?.visibility = View.GONE
-            // Assign the group icon depending of IconPack or custom icon
-            iconView?.visibility = View.VISIBLE
-            group?.let { currentGroup ->
-                iconView?.let { imageView ->
-                    mIconDrawableFactory?.assignDatabaseIcon(
-                        imageView,
-                        currentGroup.icon,
-                        mIconColor
-                    )
-                }
-
-                if (toolbar != null) {
-                    if (group.containsParent())
-                        toolbar?.setNavigationIcon(R.drawable.ic_arrow_up_white_24dp)
-                    else {
-                        toolbar?.navigationIcon = null
-                    }
+            searchContainer?.visibility = View.GONE
+            databaseNameContainer?.visibility = View.VISIBLE
+            // Refresh breadcrumb
+            if (toolbarBreadcrumb?.isVisible != true) {
+                toolbarBreadcrumb?.expand {
+                    setBreadcrumbNode(group)
                 }
+            } else {
+                // Add breadcrumb
+                setBreadcrumbNode(group)
             }
         }
-
-        // Assign number of children
-        refreshNumberOfChildren(group)
-
-        // Hide button
         initAddButton(group)
+        invalidateOptionsMenu()
+    }
+
+    private fun setBreadcrumbNode(group: Group?) {
+        mBreadcrumbAdapter?.apply {
+            setNode(group)
+            breadcrumbListView?.scrollToPosition(itemCount -1)
+        }
     }
 
     private fun initAddButton(group: Group?) {
@@ -551,18 +624,6 @@ class GroupActivity : DatabaseLockActivity(),
         }
     }
 
-    private fun refreshNumberOfChildren(group: Group?) {
-        numberChildrenView?.apply {
-            if (PreferencesUtil.showNumberEntries(context)) {
-                group?.refreshNumberOfChildEntries(Group.ChildFilter.getDefaults(context))
-                text = group?.numberOfChildEntries?.toString() ?: ""
-                visibility = View.VISIBLE
-            } else {
-                visibility = View.GONE
-            }
-        }
-    }
-
     override fun onScrolled(dy: Int) {
         if (actionNodeMode == null)
             addNodeButtonView?.hideOrShowButtonOnScrollListener(dy)
@@ -592,11 +653,14 @@ class GroupActivity : DatabaseLockActivity(),
                 val entryVersioned = node as Entry
                 EntrySelectionHelper.doSpecialAction(intent,
                     {
-                        EntryActivity.launch(
-                            this@GroupActivity,
-                            database,
-                            entryVersioned.nodeId
-                        )
+                        mGroupFragment?.mEntryActivityResultLauncher?.let { resultLauncher ->
+                            EntryActivity.launch(
+                                this@GroupActivity,
+                                database,
+                                entryVersioned.nodeId,
+                                resultLauncher
+                            )
+                        }
                     },
                     {
                         // Nothing here, a search is simply performed
@@ -651,6 +715,8 @@ class GroupActivity : DatabaseLockActivity(),
                 Log.e(TAG, "Node can't be cast in Entry")
             }
         }
+
+        reloadGroupIfSearch()
     }
 
     private fun entrySelectedForSave(database: Database, entry: Entry, searchInfo: SearchInfo) {
@@ -736,6 +802,12 @@ class GroupActivity : DatabaseLockActivity(),
         actionNodeMode?.finish()
     }
 
+    private fun reloadGroupIfSearch() {
+        if (Intent.ACTION_SEARCH == intent.action) {
+            reloadCurrentGroup()
+        }
+    }
+
     override fun onNodeSelected(
         database: Database,
         nodes: List<Node>
@@ -778,22 +850,42 @@ class GroupActivity : DatabaseLockActivity(),
         finishNodeAction()
         when (node.type) {
             Type.GROUP -> {
-                mOldGroupToUpdate = node as Group
-                GroupEditDialogFragment.update(mOldGroupToUpdate!!.getGroupInfo())
-                    .show(
-                        supportFragmentManager,
-                        GroupEditDialogFragment.TAG_CREATE_GROUP
-                    )
+                launchDialogForGroupUpdate(node as Group)
+            }
+            Type.ENTRY -> {
+                mGroupFragment?.mEntryActivityResultLauncher?.let { resultLauncher ->
+                    EntryEditActivity.launchToUpdate(
+                        this@GroupActivity,
+                        database,
+                        (node as Entry).nodeId,
+                        resultLauncher
+                    )
+                }
             }
-            Type.ENTRY -> EntryEditActivity.launchToUpdate(
-                this@GroupActivity,
-                database,
-                (node as Entry).nodeId
-            )
         }
+        reloadGroupIfSearch()
         return true
     }
 
+    private fun launchDialogToShowGroupInfo(group: Group) {
+        GroupDialogFragment.launch(group.getGroupInfo())
+            .show(supportFragmentManager, GroupDialogFragment.TAG_SHOW_GROUP)
+    }
+
+    private fun launchDialogForGroupCreation(group: Group) {
+        GroupEditDialogFragment.create(GroupInfo().apply {
+            if (group.allowAddNoteInGroup) {
+                notes = ""
+            }
+        }).show(supportFragmentManager, GroupEditDialogFragment.TAG_CREATE_GROUP)
+    }
+
+    private fun launchDialogForGroupUpdate(group: Group) {
+        mOldGroupToUpdate = group
+        GroupEditDialogFragment.update(group.getGroupInfo())
+            .show(supportFragmentManager, GroupEditDialogFragment.TAG_CREATE_GROUP)
+    }
+
     override fun onCopyMenuClick(
         database: Database,
         nodes: List<Node>
@@ -845,6 +937,7 @@ class GroupActivity : DatabaseLockActivity(),
     ): Boolean {
         deleteNodes(nodes)
         finishNodeAction()
+        reloadGroupIfSearch()
         return true
     }
 
@@ -932,9 +1025,7 @@ class GroupActivity : DatabaseLockActivity(),
     ) {
 
         // If no node, show education to add new one
-        val addNodeButtonEducationPerformed = mGroupFragment != null
-                && mGroupFragment!!.isEmpty
-                && actionNodeMode == null
+        val addNodeButtonEducationPerformed = actionNodeMode == null
                 && addNodeButtonView?.addButtonView != null
                 && addNodeButtonView!!.isEnable
                 && groupActivityEducation.checkAndPerformedAddNodeButtonEducation(
@@ -974,7 +1065,7 @@ class GroupActivity : DatabaseLockActivity(),
 
                 if (!sortMenuEducationPerformed) {
                     // lockMenuEducationPerformed
-                    val lockButtonView = findViewById<View>(R.id.lock_button_icon)
+                    val lockButtonView = findViewById<View>(R.id.lock_button)
                     lockButtonView != null
                             && groupActivityEducation.checkAndPerformedLockMenuEducation(
                         lockButtonView,
@@ -992,7 +1083,7 @@ class GroupActivity : DatabaseLockActivity(),
     override fun onOptionsItemSelected(item: MenuItem): Boolean {
         when (item.itemId) {
             android.R.id.home -> {
-                onBackPressed()
+                // TODO change database
                 return true
             }
             R.id.menu_search ->
@@ -1047,37 +1138,6 @@ class GroupActivity : DatabaseLockActivity(),
         }
     }
 
-    override fun startActivityForResult(intent: Intent, requestCode: Int, options: Bundle?) {
-        /*
-         * ACTION_SEARCH automatically forces a new task. This occurs when you open a kdb file in
-         * another app such as Files or GoogleDrive and then Search for an entry. Here we remove the
-         * FLAG_ACTIVITY_NEW_TASK flag bit allowing search to open it's activity in the current task.
-         */
-        if (Intent.ACTION_SEARCH == intent.action) {
-            var flags = intent.flags
-            flags = flags and Intent.FLAG_ACTIVITY_NEW_TASK.inv()
-            intent.flags = flags
-        }
-
-        super.startActivityForResult(intent, requestCode, options)
-    }
-
-    override fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?) {
-        super.onActivityResult(requestCode, resultCode, data)
-
-        // To create tree dialog for icon
-        IconPickerActivity.onActivityResult(requestCode, resultCode, data) { icon ->
-            mGroupEditViewModel.selectIcon(icon)
-        }
-
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
-            AutofillHelper.onActivityResultSetResultAndFinish(this, requestCode, resultCode, data)
-        }
-
-        // Directly used the onActivityResult in fragment
-        mGroupFragment?.onActivityResult(requestCode, resultCode, data)
-    }
-
     private fun removeSearch() {
         intent.removeExtra(AUTO_SEARCH_KEY)
         if (Intent.ACTION_SEARCH == intent.action) {
@@ -1093,7 +1153,7 @@ class GroupActivity : DatabaseLockActivity(),
         try {
             mGroupViewModel.loadGroup(mDatabase, mCurrentGroupState)
         } catch (e: Exception) {
-            Log.e(TAG, "Unable to rebuild the list after deletion", e)
+            Log.e(TAG, "Unable to rebuild the group", e)
         }
     }
 
@@ -1282,8 +1342,9 @@ class GroupActivity : DatabaseLockActivity(),
          * -------------------------
          */
         @RequiresApi(api = Build.VERSION_CODES.O)
-        fun launchForAutofillResult(activity: Activity,
+        fun launchForAutofillResult(activity: AppCompatActivity,
                                     database: Database,
+                                    activityResultLaunch: ActivityResultLauncher<Intent>?,
                                     autofillComponent: AutofillComponent,
                                     searchInfo: SearchInfo? = null,
                                     autoSearch: Boolean = false) {
@@ -1293,6 +1354,7 @@ class GroupActivity : DatabaseLockActivity(),
                     AutofillHelper.startActivityForAutofillResult(
                         activity,
                         intent,
+                        activityResultLaunch,
                         autofillComponent,
                         searchInfo
                     )
@@ -1325,11 +1387,12 @@ class GroupActivity : DatabaseLockActivity(),
          * 		Global Launch
          * -------------------------
          */
-        fun launch(activity: Activity,
+        fun launch(activity: AppCompatActivity,
                    database: Database,
                    onValidateSpecialMode: () -> Unit,
                    onCancelSpecialMode: () -> Unit,
-                   onLaunchActivitySpecialMode: () -> Unit) {
+                   onLaunchActivitySpecialMode: () -> Unit,
+                   autofillActivityResultLauncher: ActivityResultLauncher<Intent>?) {
             EntrySelectionHelper.doSpecialAction(activity.intent,
                     {
                         GroupActivity.launch(
@@ -1441,6 +1504,7 @@ class GroupActivity : DatabaseLockActivity(),
                                         // Here no search info found, disable auto search
                                         GroupActivity.launchForAutofillResult(activity,
                                             database,
+                                            autofillActivityResultLauncher,
                                             autofillComponent,
                                             searchInfo,
                                             false)

app/src/main/java/com/kunzisoft/keepass/activities/IconPickerActivity.kt

@@ -27,12 +27,16 @@ import android.view.Menu
 import android.view.MenuItem
 import android.view.View
 import android.view.ViewGroup
+import androidx.activity.result.ActivityResultLauncher
+import androidx.activity.result.contract.ActivityResultContracts
 import androidx.activity.viewModels
 import androidx.appcompat.widget.Toolbar
 import androidx.coordinatorlayout.widget.CoordinatorLayout
+import androidx.fragment.app.FragmentActivity
 import androidx.fragment.app.commit
 import com.google.android.material.snackbar.Snackbar
 import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.activities.dialogs.IconEditDialogFragment
 import com.kunzisoft.keepass.activities.fragments.IconPickerFragment
 import com.kunzisoft.keepass.activities.helpers.ExternalFileHelper
 import com.kunzisoft.keepass.activities.helpers.setOpenDocumentClickListener
@@ -81,6 +85,9 @@ class IconPickerActivity : DatabaseLockActivity() {
         coordinatorLayout = findViewById(R.id.icon_picker_coordinator)
 
         mExternalFileHelper = ExternalFileHelper(this)
+        mExternalFileHelper?.buildOpenDocument { uri ->
+            addCustomIcon(uri)
+        }
 
         uploadButton = findViewById(R.id.icon_picker_upload)
 
@@ -139,6 +146,16 @@ class IconPickerActivity : DatabaseLockActivity() {
             }
             uploadButton.isEnabled = true
         }
+        iconPickerViewModel.customIconUpdated.observe(this) { iconCustomUpdated ->
+            if (iconCustomUpdated.error && !iconCustomUpdated.errorConsumed) {
+                Snackbar.make(coordinatorLayout, iconCustomUpdated.errorStringId, Snackbar.LENGTH_LONG).asError().show()
+                iconCustomUpdated.errorConsumed = true
+            }
+            iconCustomUpdated.iconCustom?.let {
+                mDatabase?.updateCustomIcon(it)
+            }
+            iconPickerViewModel.deselectAllCustomIcons()
+        }
     }
 
     override fun viewToInvalidateTimeout(): View? {
@@ -197,6 +214,10 @@ class IconPickerActivity : DatabaseLockActivity() {
     }
 
     override fun onPrepareOptionsMenu(menu: Menu?): Boolean {
+        menu?.findItem(R.id.menu_edit)?.apply {
+            isEnabled = mIconsSelected.size == 1
+            isVisible = isEnabled
+        }
         menu?.findItem(R.id.menu_delete)?.apply {
             isEnabled = mCustomIconsSelectionMode
             isVisible = isEnabled
@@ -213,6 +234,9 @@ class IconPickerActivity : DatabaseLockActivity() {
                     onBackPressed()
                 }
             }
+            R.id.menu_edit -> {
+                updateCustomIcon(mIconsSelected[0])
+            }
             R.id.menu_delete -> {
                 mIconsSelected.forEach { iconToRemove ->
                     removeCustomIcon(iconToRemove)
@@ -277,6 +301,11 @@ class IconPickerActivity : DatabaseLockActivity() {
         }
     }
 
+    private fun updateCustomIcon(iconImageCustom: IconImageCustom) {
+        IconEditDialogFragment.update(iconImageCustom)
+            .show(supportFragmentManager, IconEditDialogFragment.TAG_UPDATE_ICON)
+    }
+
     private fun removeCustomIcon(iconImageCustom: IconImageCustom) {
         uploadButton.isEnabled = false
         iconPickerViewModel.deselectAllCustomIcons()
@@ -286,14 +315,6 @@ class IconPickerActivity : DatabaseLockActivity() {
         )
     }
 
-    override fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?) {
-        super.onActivityResult(requestCode, resultCode, data)
-
-        mExternalFileHelper?.onOpenDocumentResult(requestCode, resultCode, data) { uri ->
-            addCustomIcon(uri)
-        }
-    }
-
     private fun setResult() {
         setResult(Activity.RESULT_OK, Intent().apply {
             putExtra(EXTRA_ICON, mIconImage)
@@ -308,30 +329,28 @@ class IconPickerActivity : DatabaseLockActivity() {
     companion object {
 
         private const val ICON_PICKER_FRAGMENT_TAG = "ICON_PICKER_FRAGMENT_TAG"
-
-        private const val ICON_SELECTED_REQUEST = 15861
         private const val EXTRA_ICON = "EXTRA_ICON"
-
         private const val MAX_ICON_SIZE = 5242880
 
-        fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?, listener: (icon: IconImage) -> Unit) {
-            if (requestCode == ICON_SELECTED_REQUEST) {
-                if (resultCode == Activity.RESULT_OK) {
-                    listener.invoke(data?.getParcelableExtra(EXTRA_ICON) ?: IconImage())
+        fun registerIconSelectionForResult(context: FragmentActivity,
+                                           listener: (icon: IconImage) -> Unit): ActivityResultLauncher<Intent> {
+            return context.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) { result ->
+                if (result.resultCode == Activity.RESULT_OK) {
+                    listener.invoke(result.data?.getParcelableExtra(EXTRA_ICON) ?: IconImage())
                 }
             }
         }
 
-        fun launch(context: Activity,
-                   previousIcon: IconImage?) {
+        fun launch(context: FragmentActivity,
+                   previousIcon: IconImage?,
+                   resultLauncher: ActivityResultLauncher<Intent>) {
             // Create an instance to return the picker icon
-            context.startActivityForResult(
-                    Intent(context,
-                    IconPickerActivity::class.java).apply {
+            resultLauncher.launch(
+                Intent(context, IconPickerActivity::class.java).apply {
                         if (previousIcon != null)
                             putExtra(EXTRA_ICON, previousIcon)
-                    },
-                    ICON_SELECTED_REQUEST)
+                    }
+            )
         }
     }
 }

app/src/main/java/com/kunzisoft/keepass/activities/PasswordActivity.kt

@@ -21,7 +21,6 @@ package com.kunzisoft.keepass.activities
 
 import android.app.Activity
 import android.content.Intent
-import android.content.pm.PackageManager
 import android.net.Uri
 import android.os.Build
 import android.os.Bundle
@@ -35,12 +34,12 @@ import android.view.KeyEvent.KEYCODE_ENTER
 import android.view.inputmethod.EditorInfo.IME_ACTION_DONE
 import android.view.inputmethod.InputMethodManager
 import android.widget.*
-import android.widget.TextView.OnEditorActionListener
+import androidx.activity.result.ActivityResultLauncher
 import androidx.activity.viewModels
 import androidx.annotation.RequiresApi
+import androidx.appcompat.app.AppCompatActivity
 import androidx.appcompat.widget.Toolbar
 import androidx.coordinatorlayout.widget.CoordinatorLayout
-import androidx.core.app.ActivityCompat
 import androidx.fragment.app.commit
 import com.google.android.material.snackbar.Snackbar
 import com.kunzisoft.keepass.R
@@ -71,11 +70,12 @@ import com.kunzisoft.keepass.utils.MenuUtil
 import com.kunzisoft.keepass.utils.UriUtil
 import com.kunzisoft.keepass.view.KeyFileSelectionView
 import com.kunzisoft.keepass.view.asError
+import com.kunzisoft.keepass.viewmodels.AdvancedUnlockViewModel
 import com.kunzisoft.keepass.viewmodels.DatabaseFileViewModel
 import java.io.FileNotFoundException
 
 
-open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.BuilderListener {
+class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.BuilderListener {
 
     // Views
     private var toolbar: Toolbar? = null
@@ -89,7 +89,8 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
     private lateinit var coordinatorLayout: CoordinatorLayout
     private var advancedUnlockFragment: AdvancedUnlockFragment? = null
 
-    private val databaseFileViewModel: DatabaseFileViewModel by viewModels()
+    private val mDatabaseFileViewModel: DatabaseFileViewModel by viewModels()
+    private val mAdvancedUnlockViewModel: AdvancedUnlockViewModel by viewModels()
 
     private var mDefaultDatabase: Boolean = false
     private var mDatabaseFileUri: Uri? = null
@@ -98,20 +99,13 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
     private var mRememberKeyFile: Boolean = false
     private var mExternalFileHelper: ExternalFileHelper? = null
 
-    private var mPermissionAsked = false
     private var mReadOnly: Boolean = false
     private var mForceReadOnly: Boolean = false
-        set(value) {
-            infoContainerView?.visibility = if (value) {
-                mReadOnly = true
-                View.VISIBLE
-            } else {
-                View.GONE
-            }
-            field = value
-        }
 
-    private var mAllowAutoOpenBiometricPrompt: Boolean = true
+    private var mAutofillActivityResultLauncher: ActivityResultLauncher<Intent>? =
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O)
+            AutofillHelper.buildActivityResultLauncher(this)
+        else null
 
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
@@ -133,7 +127,6 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
         infoContainerView = findViewById(R.id.activity_password_info_container)
         coordinatorLayout = findViewById(R.id.activity_password_coordinator_layout)
 
-        mPermissionAsked = savedInstanceState?.getBoolean(KEY_PERMISSION_ASKED) ?: mPermissionAsked
         mReadOnly = if (savedInstanceState != null && savedInstanceState.containsKey(KEY_READ_ONLY)) {
             savedInstanceState.getBoolean(KEY_READ_ONLY)
         } else {
@@ -142,6 +135,12 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
         mRememberKeyFile = PreferencesUtil.rememberKeyFileLocations(this)
 
         mExternalFileHelper = ExternalFileHelper(this@PasswordActivity)
+        mExternalFileHelper?.buildOpenDocument { uri ->
+            if (uri != null) {
+                mDatabaseKeyFileUri = uri
+                populateKeyFileTextView(uri)
+            }
+        }
         keyFileSelectionView?.setOpenDocumentClickListener(mExternalFileHelper)
 
         passwordView?.setOnEditorActionListener(onEditorActionListener)
@@ -170,9 +169,6 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
         if (savedInstanceState?.containsKey(KEY_KEYFILE) == true) {
             mDatabaseKeyFileUri = UriUtil.parse(savedInstanceState.getString(KEY_KEYFILE))
         }
-        if (savedInstanceState?.containsKey(ALLOW_AUTO_OPEN_BIOMETRIC_PROMPT) == true) {
-            mAllowAutoOpenBiometricPrompt = savedInstanceState.getBoolean(ALLOW_AUTO_OPEN_BIOMETRIC_PROMPT)
-        }
 
         // Init Biometric elements
         advancedUnlockFragment = supportFragmentManager
@@ -188,21 +184,30 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
 
         // Listen password checkbox to init advanced unlock and confirmation button
         checkboxPasswordView?.setOnCheckedChangeListener { _, _ ->
-            advancedUnlockFragment?.checkUnlockAvailability()
+            mAdvancedUnlockViewModel.checkUnlockAvailability()
             enableOrNotTheConfirmationButton()
         }
 
         // Observe if default database
-        databaseFileViewModel.isDefaultDatabase.observe(this) { isDefaultDatabase ->
+        mDatabaseFileViewModel.isDefaultDatabase.observe(this) { isDefaultDatabase ->
             mDefaultDatabase = isDefaultDatabase
         }
 
         // Observe database file change
-        databaseFileViewModel.databaseFileLoaded.observe(this) { databaseFile ->
+        mDatabaseFileViewModel.databaseFileLoaded.observe(this) { databaseFile ->
+
             // Force read only if the file does not exists
-            mForceReadOnly = databaseFile?.let {
+            val databaseFileNotExists = databaseFile?.let {
                 !it.databaseFileExists
             } ?: true
+            infoContainerView?.visibility = if (databaseFileNotExists) {
+                mReadOnly = true
+                View.VISIBLE
+            } else {
+                View.GONE
+            }
+            mForceReadOnly = databaseFileNotExists
+
             invalidateOptionsMenu()
 
             // Post init uri with KeyFile only if needed
@@ -232,15 +237,13 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
         }
 
         // Don't allow auto open prompt if lock become when UI visible
-        mAllowAutoOpenBiometricPrompt = if (DatabaseLockActivity.LOCKING_ACTIVITY_UI_VISIBLE_DURING_LOCK == true)
-            false
-        else
-            mAllowAutoOpenBiometricPrompt
-        mDatabaseFileUri?.let { databaseFileUri ->
-            databaseFileViewModel.loadDatabaseFile(databaseFileUri)
+        if (DatabaseLockActivity.LOCKING_ACTIVITY_UI_VISIBLE_DURING_LOCK == true) {
+            mAdvancedUnlockViewModel.allowAutoOpenBiometricPrompt = false
         }
 
-        checkPermission()
+        mDatabaseFileUri?.let { databaseFileUri ->
+            mDatabaseFileViewModel.loadDatabaseFile(databaseFileUri)
+        }
 
         mDatabase?.let { database ->
             launchGroupActivityIfLoaded(database)
@@ -263,7 +266,7 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
         when (actionTask) {
             ACTION_DATABASE_LOAD_TASK -> {
                 // Recheck advanced unlock if error
-                advancedUnlockFragment?.initAdvancedUnlockMode()
+                mAdvancedUnlockViewModel.initAdvancedUnlockMode()
 
                 if (result.isSuccess) {
                     launchGroupActivityIfLoaded(database)
@@ -311,7 +314,7 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
                             is FileNotFoundDatabaseException -> {
                                 // Remove this default database inaccessible
                                 if (mDefaultDatabase) {
-                                    databaseFileViewModel.removeDefaultDatabase()
+                                    mDatabaseFileViewModel.removeDefaultDatabase()
                                 }
                             }
                         }
@@ -344,7 +347,7 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
             mDatabaseKeyFileUri = intent?.getParcelableExtra(KEY_KEYFILE)
         }
         mDatabaseFileUri?.let {
-            databaseFileViewModel.checkIfIsDefaultDatabase(it)
+            mDatabaseFileViewModel.checkIfIsDefaultDatabase(it)
         }
     }
 
@@ -361,7 +364,8 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
                 database,
                 { onValidateSpecialMode() },
                 { onCancelSpecialMode() },
-                { onLaunchActivitySpecialMode() }
+                { onLaunchActivitySpecialMode() },
+                mAutofillActivityResultLauncher
             )
         }
     }
@@ -435,8 +439,7 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
             verifyCheckboxesAndLoadDatabase(password, keyFileUri)
         } else {
             // Init Biometric elements
-            advancedUnlockFragment?.loadDatabase(databaseFileUri,
-                    mAllowAutoOpenBiometricPrompt)
+            mAdvancedUnlockViewModel.databaseFileLoaded(databaseFileUri)
         }
 
         enableOrNotTheConfirmationButton()
@@ -496,18 +499,15 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
     override fun onPause() {
         // Reinit locking activity UI variable
         DatabaseLockActivity.LOCKING_ACTIVITY_UI_VISIBLE_DURING_LOCK = null
-        mAllowAutoOpenBiometricPrompt = true
 
         super.onPause()
     }
 
     override fun onSaveInstanceState(outState: Bundle) {
-        outState.putBoolean(KEY_PERMISSION_ASKED, mPermissionAsked)
         mDatabaseKeyFileUri?.let {
             outState.putString(KEY_KEYFILE, it.toString())
         }
         outState.putBoolean(KEY_READ_ONLY, mReadOnly)
-        outState.putBoolean(ALLOW_AUTO_OPEN_BIOMETRIC_PROMPT, false)
         super.onSaveInstanceState(outState)
     }
 
@@ -606,35 +606,6 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
         return true
     }
 
-    // Check permission
-    private fun checkPermission() {
-        if (Build.VERSION.SDK_INT in 23..28
-                && !mReadOnly
-                && !mPermissionAsked) {
-            mPermissionAsked = true
-            // Check self permission to show or not the dialog
-            val writePermission = android.Manifest.permission.WRITE_EXTERNAL_STORAGE
-            val permissions = arrayOf(writePermission)
-            if (toolbar != null
-                    && ActivityCompat.checkSelfPermission(this, writePermission) != PackageManager.PERMISSION_GRANTED) {
-                ActivityCompat.requestPermissions(this, permissions, WRITE_EXTERNAL_STORAGE_REQUEST)
-            }
-        }
-    }
-
-    override fun onRequestPermissionsResult(requestCode: Int, permissions: Array<out String>, grantResults: IntArray) {
-        super.onRequestPermissionsResult(requestCode, permissions, grantResults)
-
-        when (requestCode) {
-            WRITE_EXTERNAL_STORAGE_REQUEST -> {
-                if (grantResults.isEmpty() || grantResults[0] != PackageManager.PERMISSION_GRANTED) {
-                    if (ActivityCompat.shouldShowRequestPermissionRationale(this, android.Manifest.permission.WRITE_EXTERNAL_STORAGE))
-                        Toast.makeText(this, R.string.read_only_warning, Toast.LENGTH_LONG).show()
-                }
-            }
-        }
-    }
-
     // To fix multiple view education
     private var performedEductionInProgress = false
     private fun launchEducation(menu: Menu) {
@@ -709,45 +680,6 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
         return super.onOptionsItemSelected(item)
     }
 
-    override fun onActivityResult(
-            requestCode: Int,
-            resultCode: Int,
-            data: Intent?) {
-        super.onActivityResult(requestCode, resultCode, data)
-
-        mAllowAutoOpenBiometricPrompt = false
-
-        // To get device credential unlock result
-        advancedUnlockFragment?.onActivityResult(requestCode, resultCode, data)
-
-        // To get entry in result
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
-            AutofillHelper.onActivityResultSetResultAndFinish(this, requestCode, resultCode, data)
-        }
-
-        var keyFileResult = false
-        mExternalFileHelper?.let {
-            keyFileResult = it.onOpenDocumentResult(requestCode, resultCode, data) { uri ->
-                if (uri != null) {
-                    mDatabaseKeyFileUri = uri
-                    populateKeyFileTextView(uri)
-                }
-            }
-        }
-        if (!keyFileResult) {
-            // this block if not a key file response
-            when (resultCode) {
-                DatabaseLockActivity.RESULT_EXIT_LOCK -> {
-                    clearCredentialsViews()
-                    closeDatabase()
-                }
-                Activity.RESULT_CANCELED -> {
-                    clearCredentialsViews()
-                }
-            }
-        }
-    }
-
     companion object {
 
         private val TAG = PasswordActivity::class.java.name
@@ -761,10 +693,6 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
         private const val KEY_READ_ONLY = "KEY_READ_ONLY"
         private const val KEY_PASSWORD = "password"
         private const val KEY_LAUNCH_IMMEDIATELY = "launchImmediately"
-        private const val KEY_PERMISSION_ASKED = "KEY_PERMISSION_ASKED"
-        private const val WRITE_EXTERNAL_STORAGE_REQUEST = 647
-
-        private const val ALLOW_AUTO_OPEN_BIOMETRIC_PROMPT = "ALLOW_AUTO_OPEN_BIOMETRIC_PROMPT"
 
         private fun buildAndLaunchIntent(activity: Activity, databaseFile: Uri, keyFile: Uri?,
                                          intentBuildLauncher: (Intent) -> Unit) {
@@ -855,15 +783,17 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
 
         @RequiresApi(api = Build.VERSION_CODES.O)
         @Throws(FileNotFoundException::class)
-        fun launchForAutofillResult(activity: Activity,
+        fun launchForAutofillResult(activity: AppCompatActivity,
                                     databaseFile: Uri,
                                     keyFile: Uri?,
+                                    activityResultLauncher: ActivityResultLauncher<Intent>?,
                                     autofillComponent: AutofillComponent,
                                     searchInfo: SearchInfo?) {
             buildAndLaunchIntent(activity, databaseFile, keyFile) { intent ->
                 AutofillHelper.startActivityForAutofillResult(
                         activity,
                         intent,
+                        activityResultLauncher,
                         autofillComponent,
                         searchInfo)
             }
@@ -891,12 +821,13 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
          * 		Global Launch
          * -------------------------
          */
-        fun launch(activity: Activity,
+        fun launch(activity: AppCompatActivity,
                    databaseUri: Uri,
                    keyFile: Uri?,
                    fileNoFoundAction: (exception: FileNotFoundException) -> Unit,
                    onCancelSpecialMode: () -> Unit,
-                   onLaunchActivitySpecialMode: () -> Unit) {
+                   onLaunchActivitySpecialMode: () -> Unit,
+                   autofillActivityResultLauncher: ActivityResultLauncher<Intent>?) {
 
             try {
                 EntrySelectionHelper.doSpecialAction(activity.intent,
@@ -926,6 +857,7 @@ open class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.Bui
                             if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
                                 PasswordActivity.launchForAutofillResult(activity,
                                         databaseUri, keyFile,
+                                        autofillActivityResultLauncher,
                                         autofillComponent,
                                         searchInfo)
                                 onLaunchActivitySpecialMode()

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/AssignMasterKeyDialogFragment.kt

@@ -22,7 +22,6 @@ package com.kunzisoft.keepass.activities.dialogs
 import android.app.Dialog
 import android.content.Context
 import android.content.DialogInterface
-import android.content.Intent
 import android.net.Uri
 import android.os.Bundle
 import android.text.Editable
@@ -133,6 +132,18 @@ class AssignMasterKeyDialogFragment : DatabaseDialogFragment() {
             keyFileSelectionView = rootView?.findViewById(R.id.keyfile_selection)
 
             mExternalFileHelper = ExternalFileHelper(this)
+            mExternalFileHelper?.buildOpenDocument { uri ->
+                uri?.let { pathUri ->
+                    UriUtil.getFileData(requireContext(), uri)?.length()?.let { lengthFile ->
+                        keyFileSelectionView?.error = null
+                        keyFileCheckBox?.isChecked = true
+                        keyFileSelectionView?.uri = pathUri
+                        if (lengthFile <= 0L) {
+                            showEmptyKeyFileConfirmationDialog()
+                        }
+                    }
+                }
+            }
             keyFileSelectionView?.setOpenDocumentClickListener(mExternalFileHelper)
 
             val dialog = builder.create()
@@ -208,7 +219,11 @@ class AssignMasterKeyDialogFragment : DatabaseDialogFragment() {
                 passwordRepeatTextInputLayout?.error = getString(R.string.error_pass_match)
             }
 
-            if (mMasterPassword == null || mMasterPassword!!.isEmpty()) {
+            if ((mMasterPassword == null
+                        || mMasterPassword!!.isEmpty())
+                && (keyFileCheckBox == null
+                        || !keyFileCheckBox!!.isChecked
+                        || keyFileSelectionView?.uri == null)) {
                 error = true
                 showEmptyPasswordConfirmationDialog()
             }
@@ -282,23 +297,6 @@ class AssignMasterKeyDialogFragment : DatabaseDialogFragment() {
         }
     }
 
-    override fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?) {
-        super.onActivityResult(requestCode, resultCode, data)
-
-        mExternalFileHelper?.onOpenDocumentResult(requestCode, resultCode, data) { uri ->
-            uri?.let { pathUri ->
-                UriUtil.getFileData(requireContext(), uri)?.length()?.let { lengthFile ->
-                    keyFileSelectionView?.error = null
-                    keyFileCheckBox?.isChecked = true
-                    keyFileSelectionView?.uri = pathUri
-                    if (lengthFile <= 0L) {
-                        showEmptyKeyFileConfirmationDialog()
-                    }
-                }
-            }
-        }
-    }
-
     companion object {
 
         private const val ALLOW_NO_MASTER_KEY_ARG = "ALLOW_NO_MASTER_KEY_ARG"

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/ColorPickerDialogFragment.kt

@@ -0,0 +1,95 @@
+package com.kunzisoft.keepass.activities.dialogs
+
+import android.app.Dialog
+import android.graphics.Color
+import android.os.Bundle
+import android.widget.CompoundButton
+import androidx.annotation.ColorInt
+import androidx.appcompat.app.AlertDialog
+import androidx.fragment.app.activityViewModels
+import com.kunzisoft.androidclearchroma.view.ChromaColorView
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.viewmodels.ColorPickerViewModel
+
+class ColorPickerDialogFragment : DatabaseDialogFragment() {
+
+    private val mColorPickerViewModel: ColorPickerViewModel by activityViewModels()
+
+    private lateinit var enableSwitchView: CompoundButton
+    private lateinit var chromaColorView: ChromaColorView
+
+    private var mDefaultColor = Color.WHITE
+    private var mActivated = false
+
+    override fun onCreateDialog(savedInstanceState: Bundle?): Dialog {
+
+        activity?.let { activity ->
+            val root = activity.layoutInflater.inflate(R.layout.fragment_color_picker, null)
+            enableSwitchView = root.findViewById(R.id.switch_element)
+            chromaColorView = root.findViewById(R.id.chroma_color_view)
+
+            if (savedInstanceState != null) {
+                if (savedInstanceState.containsKey(ARG_INITIAL_COLOR)) {
+                    mDefaultColor = savedInstanceState.getInt(ARG_INITIAL_COLOR)
+                }
+                if (savedInstanceState.containsKey(ARG_ACTIVATED)) {
+                    mActivated = savedInstanceState.getBoolean(ARG_ACTIVATED)
+                }
+            } else {
+                arguments?.apply {
+                    if (containsKey(ARG_INITIAL_COLOR)) {
+                        mDefaultColor = getInt(ARG_INITIAL_COLOR)
+                    }
+                    if (containsKey(ARG_ACTIVATED)) {
+                        mActivated = getBoolean(ARG_ACTIVATED)
+                    }
+                }
+            }
+            enableSwitchView.isChecked = mActivated
+            chromaColorView.currentColor = mDefaultColor
+
+            chromaColorView.setOnColorChangedListener {
+                if (!enableSwitchView.isChecked)
+                    enableSwitchView.isChecked = true
+            }
+
+            val builder = AlertDialog.Builder(activity)
+            builder.setView(root)
+                .setPositiveButton(android.R.string.ok) { _, _ ->
+                    val color: Int? = if (enableSwitchView.isChecked)
+                        chromaColorView.currentColor
+                    else
+                        null
+                    mColorPickerViewModel.pickColor(color)
+                }
+                .setNegativeButton(android.R.string.cancel) { _, _ ->
+                    // Do nothing
+                }
+
+            return builder.create()
+        }
+        return super.onCreateDialog(savedInstanceState)
+    }
+
+    override fun onSaveInstanceState(outState: Bundle) {
+        super.onSaveInstanceState(outState)
+        outState.putInt(ARG_INITIAL_COLOR, chromaColorView.currentColor)
+        outState.putBoolean(ARG_ACTIVATED, mActivated)
+    }
+
+    companion object {
+        private const val ARG_INITIAL_COLOR = "ARG_INITIAL_COLOR"
+        private const val ARG_ACTIVATED = "ARG_ACTIVATED"
+
+        fun newInstance(
+            @ColorInt initialColor: Int?,
+        ): ColorPickerDialogFragment {
+            return ColorPickerDialogFragment().apply {
+                arguments = Bundle().apply {
+                    putInt(ARG_INITIAL_COLOR, initialColor ?: Color.WHITE)
+                    putBoolean(ARG_ACTIVATED, initialColor != null)
+                }
+            }
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/DatabaseDialogFragment.kt

@@ -29,6 +29,7 @@ abstract class DatabaseDialogFragment : DialogFragment(), DatabaseRetrieval {
         }
     }
 
+    @Suppress("DEPRECATION")
     override fun onActivityCreated(savedInstanceState: Bundle?) {
         super.onActivityCreated(savedInstanceState)
 

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/GroupDialogFragment.kt

@@ -0,0 +1,151 @@
+/*
+ * Copyright 2021 Jeremy Jamet / Kunzisoft.
+ *     
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.activities.dialogs
+
+import android.app.Dialog
+import android.graphics.Color
+import android.os.Bundle
+import android.view.View
+import android.view.ViewGroup
+import android.widget.ImageView
+import android.widget.TextView
+import androidx.appcompat.app.AlertDialog
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.database.element.Database
+import com.kunzisoft.keepass.database.element.icon.IconImage
+import com.kunzisoft.keepass.model.GroupInfo
+import com.kunzisoft.keepass.settings.PreferencesUtil
+import com.kunzisoft.keepass.utils.UuidUtil
+import com.kunzisoft.keepass.view.DateTimeFieldView
+
+class GroupDialogFragment : DatabaseDialogFragment() {
+
+    private var mPopulateIconMethod: ((ImageView, IconImage) -> Unit)? = null
+    private var mGroupInfo = GroupInfo()
+
+    private lateinit var iconView: ImageView
+    private var mIconColor: Int = 0
+    private lateinit var nameTextView: TextView
+    private lateinit var notesTextLabelView: TextView
+    private lateinit var notesTextView: TextView
+    private lateinit var expirationView: DateTimeFieldView
+    private lateinit var creationView: TextView
+    private lateinit var modificationView: TextView
+    private lateinit var uuidContainerView: ViewGroup
+    private lateinit var uuidReferenceView: TextView
+
+    override fun onDatabaseRetrieved(database: Database?) {
+        super.onDatabaseRetrieved(database)
+        mPopulateIconMethod = { imageView, icon ->
+            database?.iconDrawableFactory?.assignDatabaseIcon(imageView, icon, mIconColor)
+        }
+        mPopulateIconMethod?.invoke(iconView, mGroupInfo.icon)
+    }
+
+    override fun onCreateDialog(savedInstanceState: Bundle?): Dialog {
+        activity?.let { activity ->
+            val root = activity.layoutInflater.inflate(R.layout.fragment_group, null)
+            iconView = root.findViewById(R.id.group_icon)
+            nameTextView = root.findViewById(R.id.group_name)
+            notesTextLabelView = root.findViewById(R.id.group_note_label)
+            notesTextView = root.findViewById(R.id.group_note)
+            expirationView = root.findViewById(R.id.group_expiration)
+            creationView = root.findViewById(R.id.group_created)
+            modificationView = root.findViewById(R.id.group_modified)
+            uuidContainerView = root.findViewById(R.id.group_UUID_container)
+            uuidReferenceView = root.findViewById(R.id.group_UUID_reference)
+
+            // Retrieve the textColor to tint the icon
+            val ta = activity.theme.obtainStyledAttributes(intArrayOf(R.attr.colorAccent))
+            mIconColor = ta.getColor(0, Color.WHITE)
+            ta.recycle()
+
+            if (savedInstanceState != null
+                    && savedInstanceState.containsKey(KEY_GROUP_INFO)) {
+                mGroupInfo = savedInstanceState.getParcelable(KEY_GROUP_INFO) ?: mGroupInfo
+            } else {
+                arguments?.apply {
+                    if (containsKey(KEY_GROUP_INFO)) {
+                        mGroupInfo = getParcelable(KEY_GROUP_INFO) ?: mGroupInfo
+                    }
+                }
+            }
+
+            // populate info in views
+            val title = mGroupInfo.title
+            if (title.isEmpty()) {
+                nameTextView.visibility = View.GONE
+            } else {
+                nameTextView.text = title
+                nameTextView.visibility = View.VISIBLE
+            }
+            val notes = mGroupInfo.notes
+            if (notes == null || notes.isEmpty()) {
+                notesTextLabelView.visibility = View.GONE
+                notesTextView.visibility = View.GONE
+            } else {
+                notesTextView.text = notes
+                notesTextLabelView.visibility = View.VISIBLE
+                notesTextView.visibility = View.VISIBLE
+            }
+            expirationView.activation = mGroupInfo.expires
+            expirationView.dateTime = mGroupInfo.expiryTime
+            creationView.text = mGroupInfo.creationTime.getDateTimeString(resources)
+            modificationView.text = mGroupInfo.lastModificationTime.getDateTimeString(resources)
+            val uuid = UuidUtil.toHexString(mGroupInfo.id)
+            if (uuid == null || uuid.isEmpty()) {
+                uuidContainerView.visibility = View.GONE
+            } else {
+                uuidReferenceView.text = uuid
+                uuidContainerView.apply {
+                    visibility = if (PreferencesUtil.showUUID(context)) View.VISIBLE else View.GONE
+                }
+            }
+
+            val builder = AlertDialog.Builder(activity)
+            builder.setView(root)
+                    .setPositiveButton(android.R.string.ok){ _, _ ->
+                        // Do nothing
+                    }
+            return builder.create()
+        }
+        return super.onCreateDialog(savedInstanceState)
+    }
+
+    override fun onSaveInstanceState(outState: Bundle) {
+        outState.putParcelable(KEY_GROUP_INFO, mGroupInfo)
+        super.onSaveInstanceState(outState)
+    }
+
+    data class Error(val isError: Boolean, val messageId: Int?)
+
+    companion object {
+        const val TAG_SHOW_GROUP = "TAG_SHOW_GROUP"
+        private const val KEY_GROUP_INFO = "KEY_GROUP_INFO"
+
+        fun launch(groupInfo: GroupInfo): GroupDialogFragment {
+            val bundle = Bundle()
+            bundle.putParcelable(KEY_GROUP_INFO, groupInfo)
+            val fragment = GroupDialogFragment()
+            fragment.arguments = bundle
+            return fragment
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/GroupEditDialogFragment.kt

@@ -246,8 +246,8 @@ class GroupEditDialogFragment : DatabaseDialogFragment() {
     companion object {
 
         const val TAG_CREATE_GROUP = "TAG_CREATE_GROUP"
-        const val KEY_ACTION_ID = "KEY_ACTION_ID"
-        const val KEY_GROUP_INFO = "KEY_GROUP_INFO"
+        private const val KEY_ACTION_ID = "KEY_ACTION_ID"
+        private const val KEY_GROUP_INFO = "KEY_GROUP_INFO"
 
         fun create(groupInfo: GroupInfo): GroupEditDialogFragment {
             val bundle = Bundle()

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/IconEditDialogFragment.kt

@@ -0,0 +1,126 @@
+/*
+ * Copyright 2021 Jeremy Jamet / Kunzisoft.
+ *     
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.activities.dialogs
+
+import android.app.Dialog
+import android.os.Bundle
+import android.widget.ImageView
+import android.widget.TextView
+import androidx.appcompat.app.AlertDialog
+import androidx.fragment.app.activityViewModels
+import com.google.android.material.textfield.TextInputLayout
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.database.element.Database
+import com.kunzisoft.keepass.database.element.DateInstant
+import com.kunzisoft.keepass.database.element.icon.IconImage
+import com.kunzisoft.keepass.database.element.icon.IconImageCustom
+import com.kunzisoft.keepass.viewmodels.IconPickerViewModel
+
+class IconEditDialogFragment : DatabaseDialogFragment() {
+
+    private val mIconPickerViewModel: IconPickerViewModel by activityViewModels()
+
+    private var mPopulateIconMethod: ((ImageView, IconImage) -> Unit)? = null
+    private lateinit var iconView: ImageView
+    private lateinit var nameTextLayoutView: TextInputLayout
+    private lateinit var nameTextView: TextView
+
+    private var mCustomIcon: IconImageCustom? = null
+
+    override fun onDatabaseRetrieved(database: Database?) {
+        super.onDatabaseRetrieved(database)
+        mPopulateIconMethod = { imageView, icon ->
+            database?.iconDrawableFactory?.assignDatabaseIcon(imageView, icon)
+        }
+        mCustomIcon?.let { customIcon ->
+            populateViewsWithCustomIcon(customIcon)
+        }
+    }
+
+    override fun onCreateDialog(savedInstanceState: Bundle?): Dialog {
+        activity?.let { activity ->
+            val root = activity.layoutInflater.inflate(R.layout.fragment_icon_edit, null)
+            iconView = root.findViewById(R.id.icon_edit_image)
+            nameTextLayoutView = root.findViewById(R.id.icon_edit_name_container)
+            nameTextView = root.findViewById(R.id.icon_edit_name)
+
+            if (savedInstanceState != null
+                    && savedInstanceState.containsKey(KEY_CUSTOM_ICON_ID)) {
+                mCustomIcon = savedInstanceState.getParcelable(KEY_CUSTOM_ICON_ID) ?: mCustomIcon
+            } else {
+                arguments?.apply {
+                    if (containsKey(KEY_CUSTOM_ICON_ID)) {
+                        mCustomIcon = getParcelable(KEY_CUSTOM_ICON_ID) ?: mCustomIcon
+                    }
+                }
+            }
+
+            val builder = AlertDialog.Builder(activity)
+            builder.setView(root)
+                    .setPositiveButton(android.R.string.ok) { _, _ ->
+                        retrieveIconInfoFromViews()
+                        mCustomIcon?.let { customIcon ->
+                            mIconPickerViewModel.updateCustomIcon(
+                                IconPickerViewModel.IconCustomState(customIcon, false)
+                            )
+                        }
+                    }
+                    .setNegativeButton(android.R.string.cancel) { _, _ ->
+                        // Do nothing
+                        mIconPickerViewModel.updateCustomIcon(
+                            IconPickerViewModel.IconCustomState(null, false)
+                        )
+                    }
+
+            return builder.create()
+        }
+        return super.onCreateDialog(savedInstanceState)
+    }
+
+    private fun populateViewsWithCustomIcon(customIcon: IconImageCustom) {
+        mPopulateIconMethod?.invoke(iconView, customIcon.getIconImageToDraw())
+        nameTextView.text = customIcon.name
+    }
+
+    private fun retrieveIconInfoFromViews() {
+        mCustomIcon?.name = nameTextView.text.toString()
+        mCustomIcon?.lastModificationTime = DateInstant()
+    }
+
+    override fun onSaveInstanceState(outState: Bundle) {
+        retrieveIconInfoFromViews()
+        outState.putParcelable(KEY_CUSTOM_ICON_ID, mCustomIcon)
+        super.onSaveInstanceState(outState)
+    }
+
+    companion object {
+
+        const val TAG_UPDATE_ICON = "TAG_UPDATE_ICON"
+        const val KEY_CUSTOM_ICON_ID = "KEY_CUSTOM_ICON_ID"
+
+        fun update(customIcon: IconImageCustom): IconEditDialogFragment {
+            val bundle = Bundle()
+            bundle.putParcelable(KEY_CUSTOM_ICON_ID, IconImageCustom(customIcon))
+            val fragment = IconEditDialogFragment()
+            fragment.arguments = bundle
+            return fragment
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/SetOTPDialogFragment.kt

@@ -309,7 +309,7 @@ class SetOTPDialogFragment : DatabaseDialogFragment() {
             override fun afterTextChanged(s: Editable?) {
                 s?.toString()?.let { userString ->
                     try {
-                        mOtpElement.setBase32Secret(userString.toUpperCase(Locale.ENGLISH))
+                        mOtpElement.setBase32Secret(userString.uppercase(Locale.ENGLISH))
                         otpSecretContainer?.error = null
                     } catch (exception: Exception) {
                         otpSecretContainer?.error = getString(R.string.error_otp_secret_key)

app/src/main/java/com/kunzisoft/keepass/activities/fragments/EntryEditFragment.kt

@@ -35,6 +35,7 @@ import com.kunzisoft.keepass.activities.dialogs.SetOTPDialogFragment
 import com.kunzisoft.keepass.adapters.EntryAttachmentsItemsAdapter
 import com.kunzisoft.keepass.database.element.Attachment
 import com.kunzisoft.keepass.database.element.Database
+import com.kunzisoft.keepass.database.element.template.Template
 import com.kunzisoft.keepass.model.AttachmentState
 import com.kunzisoft.keepass.model.EntryAttachmentState
 import com.kunzisoft.keepass.model.EntryInfo
@@ -55,6 +56,7 @@ class EntryEditFragment: DatabaseFragment() {
     private lateinit var attachmentsListView: RecyclerView
     private var attachmentsAdapter: EntryAttachmentsItemsAdapter? = null
 
+    private var mTemplate: Template? = null
     private var mAllowMultipleAttachments: Boolean = false
 
     private var mIconColor: Int = 0
@@ -97,6 +99,12 @@ class EntryEditFragment: DatabaseFragment() {
             setOnIconClickListener {
                 mEntryEditViewModel.requestIconSelection(templateView.getIcon())
             }
+            setOnBackgroundColorClickListener {
+                mEntryEditViewModel.requestBackgroundColorSelection(templateView.getBackgroundColor())
+            }
+            setOnForegroundColorClickListener {
+                mEntryEditViewModel.requestForegroundColorSelection(templateView.getForegroundColor())
+            }
             setOnCustomEditionActionClickListener { field ->
                 mEntryEditViewModel.requestCustomFieldEdition(field)
             }
@@ -115,19 +123,26 @@ class EntryEditFragment: DatabaseFragment() {
         }
 
         mEntryEditViewModel.onTemplateChanged.observe(viewLifecycleOwner) { template ->
+            this.mTemplate = template
             templateView.setTemplate(template)
         }
 
         mEntryEditViewModel.templatesEntry.observe(viewLifecycleOwner) { templateEntry ->
-            templateView.setTemplate(templateEntry.defaultTemplate)
-            // Load entry info only the first time to keep change locally
-            if (savedInstanceState == null) {
-                assignEntryInfo(templateEntry.entryInfo)
+            if (templateEntry != null) {
+                val selectedTemplate = if (mTemplate != null)
+                    mTemplate
+                else
+                    templateEntry.defaultTemplate
+                templateView.setTemplate(selectedTemplate)
+                // Load entry info only the first time to keep change locally
+                if (savedInstanceState == null) {
+                    assignEntryInfo(templateEntry.entryInfo)
+                }
+                // To prevent flickering
+                rootView.showByFading()
+                // Apply timeout reset
+                resetAppTimeoutWhenViewFocusedOrChanged(rootView)
             }
-            // To prevent flickering
-            rootView.showByFading()
-            // Apply timeout reset
-            resetAppTimeoutWhenViewFocusedOrChanged(rootView)
         }
 
         mEntryEditViewModel.requestEntryInfoUpdate.observe(viewLifecycleOwner) {
@@ -138,6 +153,14 @@ class EntryEditFragment: DatabaseFragment() {
             templateView.setIcon(iconImage)
         }
 
+        mEntryEditViewModel.onBackgroundColorSelected.observe(this) { color ->
+            templateView.setBackgroundColor(color)
+        }
+
+        mEntryEditViewModel.onForegroundColorSelected.observe(this) { color ->
+            templateView.setForegroundColor(color)
+        }
+
         mEntryEditViewModel.onPasswordSelected.observe(viewLifecycleOwner) { passwordField ->
             templateView.setPasswordField(passwordField)
         }

app/src/main/java/com/kunzisoft/keepass/activities/fragments/EntryFragment.kt

@@ -42,7 +42,6 @@ class EntryFragment: DatabaseFragment() {
     private var attachmentsAdapter: EntryAttachmentsItemsAdapter? = null
 
     private lateinit var uuidContainerView: View
-    private lateinit var uuidView: TextView
     private lateinit var uuidReferenceView: TextView
 
     private var mClipboardHelper: ClipboardHelper? = null
@@ -88,18 +87,16 @@ class EntryFragment: DatabaseFragment() {
         uuidContainerView.apply {
             visibility = if (PreferencesUtil.showUUID(context)) View.VISIBLE else View.GONE
         }
-        uuidView = view.findViewById(R.id.entry_UUID)
         uuidReferenceView = view.findViewById(R.id.entry_UUID_reference)
 
-        mEntryViewModel.template.observe(viewLifecycleOwner) { template ->
-            templateView.setTemplate(template)
-        }
-
-        mEntryViewModel.entryInfo.observe(viewLifecycleOwner) { entryInfo ->
-            assignEntryInfo(entryInfo)
-            // Smooth appearing
-            rootView.showByFading()
-            resetAppTimeoutWhenViewFocusedOrChanged(rootView)
+        mEntryViewModel.entryInfoHistory.observe(viewLifecycleOwner) { entryInfoHistory ->
+            if (entryInfoHistory != null) {
+                templateView.setTemplate(entryInfoHistory.template)
+                assignEntryInfo(entryInfoHistory.entryInfo)
+                // Smooth appearing
+                rootView.showByFading()
+                resetAppTimeoutWhenViewFocusedOrChanged(rootView)
+            }
         }
 
         mEntryViewModel.onAttachmentAction.observe(viewLifecycleOwner) { entryAttachmentState ->
@@ -201,7 +198,6 @@ class EntryFragment: DatabaseFragment() {
     }
 
     private fun assignUUID(uuid: UUID?) {
-        uuidView.text = uuid?.toString()
         uuidReferenceView.text = UuidUtil.toHexString(uuid)
     }
 

app/src/main/java/com/kunzisoft/keepass/activities/fragments/EntryHistoryFragment.kt

@@ -55,9 +55,11 @@ class EntryHistoryFragment: StylishFragment() {
      * History
      * -------------
      */
-    private fun assignHistory(history: List<EntryInfo>) {
+    private fun assignHistory(history: List<EntryInfo>?) {
         historyAdapter?.clear()
-        historyAdapter?.entryHistoryList?.addAll(history)
+        history?.let {
+            historyAdapter?.entryHistoryList?.addAll(history)
+        }
         historyAdapter?.onItemClickListener = { item, position ->
             mEntryViewModel.onHistorySelected(item, position)
         }

app/src/main/java/com/kunzisoft/keepass/activities/fragments/GroupFragment.kt

@@ -20,7 +20,6 @@
 package com.kunzisoft.keepass.activities.fragments
 
 import android.content.Context
-import android.content.Intent
 import android.os.Bundle
 import android.util.Log
 import android.view.*
@@ -34,12 +33,11 @@ import com.kunzisoft.keepass.activities.EntryEditActivity
 import com.kunzisoft.keepass.activities.dialogs.SortDialogFragment
 import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
 import com.kunzisoft.keepass.activities.helpers.SpecialMode
-import com.kunzisoft.keepass.adapters.NodeAdapter
+import com.kunzisoft.keepass.adapters.NodesAdapter
 import com.kunzisoft.keepass.database.element.Database
 import com.kunzisoft.keepass.database.element.Group
 import com.kunzisoft.keepass.database.element.SortNodeEnum
 import com.kunzisoft.keepass.database.element.node.Node
-import com.kunzisoft.keepass.database.element.node.NodeId
 import com.kunzisoft.keepass.database.element.node.Type
 import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.tasks.ActionRunnable
@@ -50,10 +48,11 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
 
     private var nodeClickListener: NodeClickListener? = null
     private var onScrollListener: OnScrollListener? = null
+    private var groupRefreshed: GroupRefreshedListener? = null
 
     private var mNodesRecyclerView: RecyclerView? = null
     private var mLayoutManager: LinearLayoutManager? = null
-    private var mAdapter: NodeAdapter? = null
+    private var mAdapter: NodesAdapter? = null
 
     private val mGroupViewModel: GroupViewModel by activityViewModels()
 
@@ -74,8 +73,18 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
     private var mRecycleBinEnable: Boolean = false
     private var mRecycleBin: Group? = null
 
-    val isEmpty: Boolean
-        get() = mAdapter == null || mAdapter?.itemCount?:0 <= 0
+    var mEntryActivityResultLauncher = EntryEditActivity.registerForEntryResult(this) { entryId ->
+        entryId?.let {
+            // Simply refresh the list
+            rebuildList()
+            // Scroll to the new entry
+            mDatabase?.getEntryById(it)?.let { entry ->
+                mAdapter?.indexOf(entry)?.let { position ->
+                    mNodesRecyclerView?.scrollToPosition(position)
+                }
+            }
+        } ?: Log.e(this.javaClass.name, "Entry cannot be retrieved in Activity Result")
+    }
 
     private var mRecycleViewScrollListener = object : RecyclerView.OnScrollListener() {
         override fun onScrollStateChanged(recyclerView: RecyclerView, newState: Int) {
@@ -92,12 +101,14 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
 
     override fun onAttach(context: Context) {
         super.onAttach(context)
+
+        // TODO Change to ViewModel
         try {
             nodeClickListener = context as NodeClickListener
         } catch (e: ClassCastException) {
             // The activity doesn't implement the interface, throw exception
             throw ClassCastException(context.toString()
-                    + " must implement " + NodeAdapter.NodeClickCallback::class.java.name)
+                    + " must implement " + NodesAdapter.NodeClickCallback::class.java.name)
         }
 
         try {
@@ -105,14 +116,24 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
         } catch (e: ClassCastException) {
             onScrollListener = null
             // Context menu can be omit
-            Log.w(TAG, context.toString()
+            Log.w(
+                TAG, context.toString()
                     + " must implement " + RecyclerView.OnScrollListener::class.java.name)
         }
+
+        try {
+            groupRefreshed = context as GroupRefreshedListener
+        } catch (e: ClassCastException) {
+            // The activity doesn't implement the interface, throw exception
+            throw ClassCastException(context.toString()
+                    + " must implement " + GroupRefreshedListener::class.java.name)
+        }
     }
 
     override fun onDetach() {
         nodeClickListener = null
         onScrollListener = null
+        groupRefreshed = null
         super.onDetach()
     }
 
@@ -128,8 +149,8 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
 
         contextThemed?.let { context ->
             database?.let { database ->
-                mAdapter = NodeAdapter(context, database).apply {
-                    setOnNodeClickListener(object : NodeAdapter.NodeClickCallback {
+                mAdapter = NodesAdapter(context, database).apply {
+                    setOnNodeClickListener(object : NodesAdapter.NodeClickCallback {
                         override fun onNodeClick(database: Database, node: Node) {
                             if (nodeActionSelectionMode) {
                                 if (listActionNodes.contains(node)) {
@@ -185,7 +206,7 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
         super.onCreateView(inflater, container, savedInstanceState)
         // To apply theme
         return inflater.cloneInContext(contextThemed)
-                .inflate(R.layout.fragment_group, container, false)
+                .inflate(R.layout.fragment_nodes, container, false)
     }
 
     override fun onViewCreated(view: View, savedInstanceState: Bundle?) {
@@ -233,7 +254,6 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
         return mLayoutManager?.findFirstVisibleItemPosition() ?: 0
     }
 
-    @Throws(IllegalArgumentException::class)
     private fun rebuildList() {
         try {
             // Add elements to the list
@@ -251,6 +271,8 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
         } else {
             notFoundView?.visibility = View.GONE
         }
+
+        groupRefreshed?.onGroupRefreshed()
     }
 
     override fun onSortSelected(sortNodeEnum: SortNodeEnum,
@@ -283,15 +305,17 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
                     val sortDialogFragment: SortDialogFragment =
                             if (mRecycleBinEnable) {
                                 SortDialogFragment.getInstance(
-                                        PreferencesUtil.getListSort(context),
-                                        PreferencesUtil.getAscendingSort(context),
-                                        PreferencesUtil.getGroupsBeforeSort(context),
-                                        PreferencesUtil.getRecycleBinBottomSort(context))
+                                    PreferencesUtil.getListSort(context),
+                                    PreferencesUtil.getAscendingSort(context),
+                                    PreferencesUtil.getGroupsBeforeSort(context),
+                                    PreferencesUtil.getRecycleBinBottomSort(context)
+                                )
                             } else {
                                 SortDialogFragment.getInstance(
-                                        PreferencesUtil.getListSort(context),
-                                        PreferencesUtil.getAscendingSort(context),
-                                        PreferencesUtil.getGroupsBeforeSort(context))
+                                    PreferencesUtil.getListSort(context),
+                                    PreferencesUtil.getAscendingSort(context),
+                                    PreferencesUtil.getGroupsBeforeSort(context)
+                                )
                             }
 
                     sortDialogFragment.show(childFragmentManager, "sortDialog")
@@ -403,27 +427,6 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
         }
     }
 
-    override fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?) {
-        super.onActivityResult(requestCode, resultCode, data)
-
-        when (requestCode) {
-            EntryEditActivity.ADD_OR_UPDATE_ENTRY_REQUEST_CODE -> {
-                if (resultCode == EntryEditActivity.ADD_OR_UPDATE_ENTRY_RESULT_CODE) {
-                    data?.getParcelableExtra<NodeId<UUID>>(EntryEditActivity.ADD_OR_UPDATE_ENTRY_KEY)?.let {
-                        // Simply refresh the list
-                        rebuildList()
-                        // Scroll to the new entry
-                        mDatabase?.getEntryById(it)?.let { entry ->
-                            mAdapter?.indexOf(entry)?.let { position ->
-                                mNodesRecyclerView?.scrollToPosition(position)
-                            }
-                        }
-                    } ?: Log.e(this.javaClass.name, "New node can be retrieve in Activity Result")
-                }
-            }
-        }
-    }
-
     /**
      * Callback listener to redefine to do an action when a node is click
      */
@@ -459,6 +462,10 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
         fun onScrolled(dy: Int)
     }
 
+    interface GroupRefreshedListener {
+        fun onGroupRefreshed()
+    }
+
     companion object {
         private val TAG = GroupFragment::class.java.name
     }

app/src/main/java/com/kunzisoft/keepass/activities/fragments/IconCustomFragment.kt

@@ -55,8 +55,10 @@ class IconCustomFragment : IconFragment<IconImageCustom>() {
                 iconCustomAdded?.iconCustom?.let { icon ->
                     iconPickerAdapter.addIcon(icon)
                     iconCustomAdded.iconCustom = null
+                    try {
+                        iconsGridView.smoothScrollToPosition(iconPickerAdapter.lastPosition)
+                    } catch (ignore: Exception) {}
                 }
-                iconsGridView.smoothScrollToPosition(iconPickerAdapter.lastPosition)
             }
         }
         iconPickerViewModel.customIconRemoved.observe(viewLifecycleOwner) { iconCustomRemoved ->
@@ -67,6 +69,14 @@ class IconCustomFragment : IconFragment<IconImageCustom>() {
                 }
             }
         }
+        iconPickerViewModel.customIconUpdated.observe(viewLifecycleOwner) { iconCustomUpdated ->
+            if (!iconCustomUpdated.error) {
+                iconCustomUpdated?.iconCustom?.let { icon ->
+                    iconPickerAdapter.updateIcon(icon)
+                    iconCustomUpdated.iconCustom = null
+                }
+            }
+        }
     }
 
     override fun onIconClickListener(icon: IconImageCustom) {

app/src/main/java/com/kunzisoft/keepass/activities/helpers/ExternalFileHelper.kt

@@ -20,14 +20,16 @@
 package com.kunzisoft.keepass.activities.helpers
 
 import android.annotation.SuppressLint
-import android.app.Activity.RESULT_OK
+import android.content.Context
 import android.content.Intent
 import android.content.pm.PackageManager
 import android.net.Uri
 import android.os.Build
 import android.util.Log
 import android.view.View
-import androidx.annotation.RequiresApi
+import androidx.activity.result.ActivityResultCallback
+import androidx.activity.result.ActivityResultLauncher
+import androidx.activity.result.contract.ActivityResultContracts
 import androidx.fragment.app.Fragment
 import androidx.fragment.app.FragmentActivity
 import com.kunzisoft.keepass.activities.dialogs.FileManagerDialogFragment
@@ -38,6 +40,10 @@ class ExternalFileHelper {
     private var activity: FragmentActivity? = null
     private var fragment: Fragment? = null
 
+    private var getContentResultLauncher: ActivityResultLauncher<String>? = null
+    private var openDocumentResultLauncher: ActivityResultLauncher<Array<String>>? = null
+    private var createDocumentResultLauncher: ActivityResultLauncher<String>? = null
+
     constructor(context: FragmentActivity) {
         this.activity = context
         this.fragment = null
@@ -48,94 +54,81 @@ class ExternalFileHelper {
         this.fragment = context
     }
 
+    fun buildOpenDocument(onFileSelected: ((uri: Uri?) -> Unit)?) {
+
+        val resultCallback = ActivityResultCallback<Uri> { result ->
+            result?.let { uri ->
+                UriUtil.takeUriPermission(activity?.contentResolver, uri)
+                onFileSelected?.invoke(uri)
+            }
+        }
+
+        getContentResultLauncher = if (fragment != null) {
+            fragment?.registerForActivityResult(
+                GetContent(),
+                resultCallback
+            )
+        } else {
+            activity?.registerForActivityResult(
+                GetContent(),
+                resultCallback
+            )
+        }
+
+        openDocumentResultLauncher = if (fragment != null) {
+            fragment?.registerForActivityResult(
+                OpenDocument(),
+                resultCallback
+            )
+        } else {
+            activity?.registerForActivityResult(
+                OpenDocument(),
+                resultCallback
+            )
+        }
+    }
+
+    fun buildCreateDocument(typeString: String = "application/octet-stream",
+                            onFileCreated: (fileCreated: Uri?)->Unit) {
+
+        val resultCallback = ActivityResultCallback<Uri> { result ->
+            onFileCreated.invoke(result)
+        }
+
+        createDocumentResultLauncher = if (fragment != null) {
+            fragment?.registerForActivityResult(
+                CreateDocument(typeString),
+                resultCallback
+            )
+        } else {
+            activity?.registerForActivityResult(
+                CreateDocument(typeString),
+                resultCallback
+            )
+        }
+    }
+
     fun openDocument(getContent: Boolean = false,
                      typeString: String = "*/*") {
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.KITKAT) {
-            try {
-                if (getContent) {
-                    openActivityWithActionGetContent(typeString)
-                } else {
-                    openActivityWithActionOpenDocument(typeString)
-                }
-            } catch (e: Exception) {
-                Log.e(TAG, "Unable to open document", e)
-                showFileManagerDialogFragment()
+        try {
+            if (getContent) {
+                getContentResultLauncher?.launch(typeString)
+            } else {
+                openDocumentResultLauncher?.launch(arrayOf(typeString))
             }
-        } else {
+        } catch (e: Exception) {
+            Log.e(TAG, "Unable to open document", e)
             showFileManagerDialogFragment()
         }
     }
 
-    @RequiresApi(Build.VERSION_CODES.KITKAT)
-    private fun openActivityWithActionOpenDocument(typeString: String) {
-        val intentOpenDocument = Intent(Intent.ACTION_OPEN_DOCUMENT).apply {
-            addCategory(Intent.CATEGORY_OPENABLE)
-            type = typeString
-            addFlags(Intent.FLAG_GRANT_PERSISTABLE_URI_PERMISSION)
-            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.LOLLIPOP) {
-                addFlags(Intent.FLAG_GRANT_PREFIX_URI_PERMISSION)
-            }
-            addFlags(Intent.FLAG_GRANT_READ_URI_PERMISSION)
-            addFlags(Intent.FLAG_GRANT_WRITE_URI_PERMISSION)
+    fun createDocument(titleString: String) {
+        try {
+            createDocumentResultLauncher?.launch(titleString)
+        } catch (e: Exception) {
+            Log.e(TAG, "Unable to create document", e)
+            showFileManagerDialogFragment()
         }
-        if (fragment != null)
-            fragment?.startActivityForResult(intentOpenDocument, OPEN_DOC)
-        else
-            activity?.startActivityForResult(intentOpenDocument, OPEN_DOC)
-    }
-
-    @RequiresApi(Build.VERSION_CODES.KITKAT)
-    private fun openActivityWithActionGetContent(typeString: String) {
-        val intentGetContent = Intent(Intent.ACTION_GET_CONTENT).apply {
-            addCategory(Intent.CATEGORY_OPENABLE)
-            type = typeString
-            addFlags(Intent.FLAG_GRANT_PERSISTABLE_URI_PERMISSION)
-            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.LOLLIPOP) {
-                addFlags(Intent.FLAG_GRANT_PREFIX_URI_PERMISSION)
-            }
-            addFlags(Intent.FLAG_GRANT_READ_URI_PERMISSION)
-            addFlags(Intent.FLAG_GRANT_WRITE_URI_PERMISSION)
-        }
-        if (fragment != null)
-            fragment?.startActivityForResult(intentGetContent, GET_CONTENT)
-        else
-            activity?.startActivityForResult(intentGetContent, GET_CONTENT)
-    }
-
-    /**
-     * To use in onActivityResultCallback in Fragment or Activity
-     * @param onFileSelected Callback retrieve from data
-     * @return true if requestCode was captured, false elsewhere
-     */
-    fun onOpenDocumentResult(requestCode: Int, resultCode: Int, data: Intent?,
-                             onFileSelected: ((uri: Uri?) -> Unit)?): Boolean {
-
-        when (requestCode) {
-            FILE_BROWSE -> {
-                if (resultCode == RESULT_OK) {
-                    val filename = data?.dataString
-                    var keyUri: Uri? = null
-                    if (filename != null) {
-                        keyUri = UriUtil.parse(filename)
-                    }
-                    onFileSelected?.invoke(keyUri)
-                }
-                return true
-            }
-            GET_CONTENT, OPEN_DOC -> {
-                if (resultCode == RESULT_OK) {
-                    if (data != null) {
-                        val uri = data.data
-                        if (uri != null) {
-                            UriUtil.takeUriPermission(activity?.contentResolver, uri)
-                            onFileSelected?.invoke(uri)
-                        }
-                    }
-                }
-                return true
-            }
-        }
-        return false
     }
 
     /**
@@ -155,62 +148,50 @@ class ExternalFileHelper {
         }
     }
 
-    fun createDocument(titleString: String,
-                       typeString: String = "application/octet-stream"): Int? {
-        val idCode = getUnusedCreateFileRequestCode()
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.KITKAT) {
-            try {
-                val intent = Intent(Intent.ACTION_CREATE_DOCUMENT).apply {
-                    addCategory(Intent.CATEGORY_OPENABLE)
-                    type = typeString
-                    putExtra(Intent.EXTRA_TITLE, titleString)
+    class OpenDocument : ActivityResultContracts.OpenDocument() {
+        @SuppressLint("InlinedApi")
+        override fun createIntent(context: Context, input: Array<out String>): Intent {
+            return super.createIntent(context, input).apply {
+                addCategory(Intent.CATEGORY_OPENABLE)
+                addFlags(Intent.FLAG_GRANT_PERSISTABLE_URI_PERMISSION)
+                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.LOLLIPOP) {
+                    addFlags(Intent.FLAG_GRANT_PREFIX_URI_PERMISSION)
                 }
-                if (fragment != null)
-                    fragment?.startActivityForResult(intent, idCode)
-                else
-                    activity?.startActivityForResult(intent, idCode)
-                return idCode
-            } catch (e: Exception) {
-                Log.e(TAG, "Unable to create document", e)
-                showFileManagerDialogFragment()
+                addFlags(Intent.FLAG_GRANT_READ_URI_PERMISSION)
+                addFlags(Intent.FLAG_GRANT_WRITE_URI_PERMISSION)
             }
-        } else {
-            showFileManagerDialogFragment()
         }
-        return null
     }
 
-    /**
-     * To use in onActivityResultCallback in Fragment or Activity
-     * @param onFileCreated Callback retrieve from data
-     * @return true if requestCode was captured, false elsewhere
-     */
-    fun onCreateDocumentResult(requestCode: Int, resultCode: Int, data: Intent?,
-                               onFileCreated: (fileCreated: Uri?)->Unit) {
-        // Retrieve the created URI from the file manager
-        if (fileRequestCodes.contains(requestCode) && resultCode == RESULT_OK) {
-            onFileCreated.invoke(data?.data)
-            fileRequestCodes.remove(requestCode)
+    class GetContent : ActivityResultContracts.GetContent() {
+        @SuppressLint("InlinedApi")
+        override fun createIntent(context: Context, input: String): Intent {
+            return super.createIntent(context, input).apply {
+                addCategory(Intent.CATEGORY_OPENABLE)
+                addFlags(Intent.FLAG_GRANT_PERSISTABLE_URI_PERMISSION)
+                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.LOLLIPOP) {
+                    addFlags(Intent.FLAG_GRANT_PREFIX_URI_PERMISSION)
+                }
+                addFlags(Intent.FLAG_GRANT_READ_URI_PERMISSION)
+                addFlags(Intent.FLAG_GRANT_WRITE_URI_PERMISSION)
+            }
         }
     }
 
+    class CreateDocument(private val typeString: String) : ActivityResultContracts.CreateDocument() {
+        override fun createIntent(context: Context, input: String): Intent {
+            return super.createIntent(context, input).apply {
+                addCategory(Intent.CATEGORY_OPENABLE)
+                type = typeString
+            }
+        }
+    }
+
+
     companion object {
 
         private const val TAG = "OpenFileHelper"
 
-        private const val GET_CONTENT = 25745
-        private const val OPEN_DOC = 25845
-        private const val FILE_BROWSE = 25645
-
-        private var CREATE_FILE_REQUEST_CODE_DEFAULT = 3853
-        private var fileRequestCodes = ArrayList<Int>()
-
-        private fun getUnusedCreateFileRequestCode(): Int {
-            val newCreateFileRequestCode = CREATE_FILE_REQUEST_CODE_DEFAULT++
-            fileRequestCodes.add(newCreateFileRequestCode)
-            return newCreateFileRequestCode
-        }
-
         @SuppressLint("InlinedApi")
         fun allowCreateDocumentByStorageAccessFramework(packageManager: PackageManager,
                                                         typeString: String = "application/octet-stream"): Boolean {
@@ -231,7 +212,7 @@ class ExternalFileHelper {
 fun View.setOpenDocumentClickListener(externalFileHelper: ExternalFileHelper?) {
     externalFileHelper?.let { fileHelper ->
         setOnClickListener {
-            fileHelper.openDocument()
+            fileHelper.openDocument(false)
         }
         setOnLongClickListener {
             fileHelper.openDocument(true)

app/src/main/java/com/kunzisoft/keepass/activities/legacy/DatabaseActivity.kt

@@ -7,14 +7,9 @@ import com.kunzisoft.keepass.activities.stylish.StylishActivity
 import com.kunzisoft.keepass.app.database.CipherDatabaseEntity
 import com.kunzisoft.keepass.database.action.DatabaseTaskProvider
 import com.kunzisoft.keepass.database.element.Database
-import com.kunzisoft.keepass.database.element.Entry
-import com.kunzisoft.keepass.database.element.Group
-import com.kunzisoft.keepass.database.element.node.Node
-import com.kunzisoft.keepass.database.element.node.NodeId
 import com.kunzisoft.keepass.model.MainCredential
 import com.kunzisoft.keepass.tasks.ActionRunnable
 import com.kunzisoft.keepass.viewmodels.DatabaseViewModel
-import java.util.*
 
 abstract class DatabaseActivity: StylishActivity(), DatabaseRetrieval {
 
@@ -28,7 +23,11 @@ abstract class DatabaseActivity: StylishActivity(), DatabaseRetrieval {
         mDatabaseTaskProvider = DatabaseTaskProvider(this)
 
         mDatabaseTaskProvider?.onDatabaseRetrieved = { database ->
-            if (mDatabase == null || mDatabase != database) {
+            val databaseWasReloaded = database?.wasReloaded == true
+            if (databaseWasReloaded && finishActivityIfReloadRequested()) {
+                finish()
+            } else if (mDatabase == null || mDatabase != database || databaseWasReloaded) {
+                database?.wasReloaded = false
                 onDatabaseRetrieved(database)
             }
         }
@@ -69,17 +68,8 @@ abstract class DatabaseActivity: StylishActivity(), DatabaseRetrieval {
         mDatabase?.clearAndClose(this)
     }
 
-    override fun reloadActivity() {
-        super.reloadActivity()
-        mDatabase?.wasReloaded = false
-    }
-
     override fun onResume() {
         super.onResume()
-
-        if (mDatabase?.wasReloaded == true) {
-            reloadActivity()
-        }
         mDatabaseTaskProvider?.registerProgressTask()
     }
 

app/src/main/java/com/kunzisoft/keepass/activities/legacy/DatabaseLockActivity.kt

@@ -100,7 +100,7 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
         }
 
         mDatabaseViewModel.saveDefaultUsername.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveName(it.oldValue, it.newValue, it.save)
+            mDatabaseTaskProvider?.startDatabaseSaveDefaultUsername(it.oldValue, it.newValue, it.save)
         }
 
         mDatabaseViewModel.saveColor.observe(this) {
@@ -180,8 +180,7 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
                         closeDatabase(database)
                         if (LOCKING_ACTIVITY_UI_VISIBLE_DURING_LOCK == null)
                             LOCKING_ACTIVITY_UI_VISIBLE_DURING_LOCK = LOCKING_ACTIVITY_UI_VISIBLE
-                        // Add onActivityForResult response
-                        setResult(RESULT_EXIT_LOCK)
+                        mExitLock = true
                         closeOptionsMenu()
                         finish()
                     }
@@ -353,14 +352,6 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
         mDatabaseTaskProvider?.startDatabaseDeleteEntryHistory(mainEntryId, entryHistoryPosition, mAutoSaveEnable)
     }
 
-    override fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?) {
-        super.onActivityResult(requestCode, resultCode, data)
-        if (resultCode == RESULT_EXIT_LOCK) {
-            mExitLock = true
-            lockAndExit()
-        }
-    }
-
     private fun checkRegister() {
         // If in ave or registration mode, don't allow read only
         if ((mSpecialMode == SpecialMode.SAVE
@@ -440,8 +431,6 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
 
         const val TAG = "LockingActivity"
 
-        const val RESULT_EXIT_LOCK = 1450
-
         const val TIMEOUT_ENABLE_KEY = "TIMEOUT_ENABLE_KEY"
         const val TIMEOUT_ENABLE_KEY_DEFAULT = true
 

app/src/main/java/com/kunzisoft/keepass/activities/stylish/Stylish.kt

@@ -39,7 +39,11 @@ object Stylish {
      */
     fun load(context: Context) {
         Log.d(Stylish::class.java.name, "Attatching to " + context.packageName)
-        themeString = PreferencesUtil.getStyle(context)
+        try {
+            themeString = PreferencesUtil.getStyle(context)
+        } catch (e: Exception) {
+            Log.e("Stylish", "Unable to get preference style", e)
+        }
     }
 
     fun retrieveEquivalentSystemStyle(context: Context, styleString: String): String {

app/src/main/java/com/kunzisoft/keepass/activities/stylish/StylishActivity.kt

@@ -28,7 +28,7 @@ import android.util.Log
 import android.view.WindowManager
 import androidx.annotation.StyleRes
 import androidx.appcompat.app.AppCompatActivity
-import com.kunzisoft.keepass.settings.NestedAppSettingsFragment.Companion.DATABASE_APPEARANCE_PREFERENCE_CHANGED
+import com.kunzisoft.keepass.settings.NestedAppSettingsFragment.Companion.DATABASE_PREFERENCE_CHANGED
 
 /**
  * Stylish Hide Activity that apply a dynamic style and sets FLAG_SECURE to prevent screenshots / from
@@ -89,8 +89,8 @@ abstract class StylishActivity : AppCompatActivity() {
         super.onResume()
 
         if ((customStyle && Stylish.getThemeId(this) != this.themeId)
-            || DATABASE_APPEARANCE_PREFERENCE_CHANGED) {
-            DATABASE_APPEARANCE_PREFERENCE_CHANGED = false
+            || DATABASE_PREFERENCE_CHANGED) {
+            DATABASE_PREFERENCE_CHANGED = false
             Log.d(this.javaClass.name, "Theme change detected, restarting activity")
             recreateActivity()
         }

app/src/main/java/com/kunzisoft/keepass/activities/stylish/StylishFragment.kt

@@ -23,12 +23,12 @@ import android.content.Context
 import android.graphics.Color
 import android.os.Build
 import android.os.Bundle
-import androidx.annotation.StyleRes
-import androidx.fragment.app.Fragment
-import androidx.appcompat.view.ContextThemeWrapper
 import android.view.LayoutInflater
 import android.view.View
 import android.view.ViewGroup
+import androidx.annotation.StyleRes
+import androidx.appcompat.view.ContextThemeWrapper
+import androidx.fragment.app.Fragment
 
 abstract class StylishFragment : Fragment() {
 
@@ -42,7 +42,6 @@ abstract class StylishFragment : Fragment() {
         contextThemed = ContextThemeWrapper(context, themeId)
     }
 
-    @Suppress("DEPRECATION")
     override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? {
         // To fix status bar color
         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.LOLLIPOP) {
@@ -58,6 +57,7 @@ abstract class StylishFragment : Fragment() {
                 try {
                     val taWindowStatusLight = contextThemed?.theme?.obtainStyledAttributes(intArrayOf(android.R.attr.windowLightStatusBar))
                     if (taWindowStatusLight?.getBoolean(0, false) == true) {
+                        @Suppress("DEPRECATION")
                         window.decorView.systemUiVisibility = View.SYSTEM_UI_FLAG_LIGHT_STATUS_BAR
                     }
                     taWindowStatusLight?.recycle()

app/src/main/java/com/kunzisoft/keepass/adapters/BreadcrumbAdapter.kt

@@ -0,0 +1,150 @@
+package com.kunzisoft.keepass.adapters
+
+import android.annotation.SuppressLint
+import android.content.Context
+import android.graphics.Color
+import android.view.LayoutInflater
+import android.view.View
+import android.view.ViewGroup
+import android.widget.ImageView
+import android.widget.TextView
+import androidx.recyclerview.widget.RecyclerView
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.database.element.Group
+import com.kunzisoft.keepass.database.element.node.Node
+import com.kunzisoft.keepass.database.element.node.Type
+import com.kunzisoft.keepass.icons.IconDrawableFactory
+import com.kunzisoft.keepass.settings.PreferencesUtil
+import com.kunzisoft.keepass.view.strikeOut
+
+class BreadcrumbAdapter(val context: Context)
+    : RecyclerView.Adapter<BreadcrumbAdapter.BreadcrumbGroupViewHolder>() {
+
+    private val inflater: LayoutInflater = LayoutInflater.from(context)
+    var iconDrawableFactory: IconDrawableFactory? = null
+        @SuppressLint("NotifyDataSetChanged")
+        set(value) {
+            field = value
+            notifyDataSetChanged()
+        }
+    private var mNodeBreadcrumb: MutableList<Node?> = mutableListOf()
+    var onItemClickListener: ((item: Node, position: Int)->Unit)? = null
+    var onLongItemClickListener: ((item: Node, position: Int)->Unit)? = null
+
+    private var mShowNumberEntries = false
+    private var mShowUUID = false
+    private var mIconColor: Int = 0
+
+    init {
+        mShowNumberEntries = PreferencesUtil.showNumberEntries(context)
+        mShowUUID = PreferencesUtil.showUUID(context)
+
+        // Retrieve the textColor to tint the icon
+        val taTextColor = context.theme.obtainStyledAttributes(intArrayOf(R.attr.textColorInverse))
+        mIconColor = taTextColor.getColor(0, Color.WHITE)
+        taTextColor.recycle()
+    }
+
+    @SuppressLint("NotifyDataSetChanged")
+    fun setNode(node: Node?) {
+        mNodeBreadcrumb.clear()
+        node?.let {
+            var currentNode = it
+            mNodeBreadcrumb.add(0, currentNode)
+            while (currentNode.containsParent()) {
+                currentNode.parent?.let { parent ->
+                    currentNode = parent
+                    mNodeBreadcrumb.add(0, currentNode)
+                }
+            }
+        }
+        notifyDataSetChanged()
+    }
+
+    override fun getItemViewType(position: Int): Int {
+        return when (position) {
+            mNodeBreadcrumb.size - 1 -> 0
+            else -> 1
+        }
+    }
+
+    override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): BreadcrumbGroupViewHolder {
+        return BreadcrumbGroupViewHolder(inflater.inflate(
+            when (viewType) {
+                0 -> R.layout.item_group
+                else -> R.layout.item_breadcrumb
+            }, parent, false)
+        )
+    }
+
+    override fun onBindViewHolder(holder: BreadcrumbGroupViewHolder, position: Int) {
+        val node = mNodeBreadcrumb[position]
+
+        holder.groupNameView.apply {
+            text = node?.title ?: ""
+            strikeOut(node?.isCurrentlyExpires ?: false)
+        }
+
+        holder.itemView.apply {
+            setOnClickListener {
+                node?.let {
+                    onItemClickListener?.invoke(it, position)
+                }
+            }
+            setOnLongClickListener {
+                node?.let {
+                    onLongItemClickListener?.invoke(it, position)
+                }
+                true
+            }
+        }
+
+        if (node?.type == Type.GROUP) {
+            (node as Group).let { group ->
+
+                holder.groupIconView?.let { imageView ->
+                    iconDrawableFactory?.assignDatabaseIcon(
+                        imageView,
+                        group.icon,
+                        mIconColor
+                    )
+                }
+
+                holder.groupNumbersView?.apply {
+                    if (mShowNumberEntries) {
+                        group.refreshNumberOfChildEntries(Group.ChildFilter.getDefaults(context))
+                        text = group.numberOfChildEntries.toString()
+                        visibility = View.VISIBLE
+                    } else {
+                        visibility = View.GONE
+                    }
+                }
+
+                holder.groupMetaView?.apply {
+                    val meta = group.nodeId.toVisualString()
+                    visibility = if (meta != null
+                        && !group.isVirtual
+                        && mShowUUID
+                    ) {
+                        text = meta
+                        View.VISIBLE
+                    } else {
+                        View.GONE
+                    }
+                }
+            }
+        }
+
+    }
+
+    override fun getItemCount(): Int {
+        return mNodeBreadcrumb.size
+    }
+
+    inner class BreadcrumbGroupViewHolder(itemView: View) : RecyclerView.ViewHolder(itemView) {
+        var groupIconView: ImageView? = itemView.findViewById(R.id.group_icon)
+        var groupNumbersView: TextView? = itemView.findViewById(R.id.group_numbers)
+        var groupNameView: TextView = itemView.findViewById(R.id.group_name)
+        var groupMetaView: TextView? = itemView.findViewById(R.id.group_meta)
+    }
+}

app/src/main/java/com/kunzisoft/keepass/adapters/NodesAdapter.kt

@@ -28,11 +28,13 @@ import android.view.ViewGroup
 import android.widget.ImageView
 import android.widget.ProgressBar
 import android.widget.TextView
+import android.widget.Toast
 import androidx.annotation.ColorInt
 import androidx.core.content.ContextCompat
 import androidx.recyclerview.widget.RecyclerView
 import androidx.recyclerview.widget.SortedList
 import androidx.recyclerview.widget.SortedListAdapterCallback
+import com.google.android.material.progressindicator.CircularProgressIndicator
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.database.element.Database
 import com.kunzisoft.keepass.database.element.Entry
@@ -41,9 +43,11 @@ import com.kunzisoft.keepass.database.element.SortNodeEnum
 import com.kunzisoft.keepass.database.element.node.Node
 import com.kunzisoft.keepass.database.element.node.NodeVersionedInterface
 import com.kunzisoft.keepass.database.element.node.Type
+import com.kunzisoft.keepass.database.element.template.TemplateField
 import com.kunzisoft.keepass.otp.OtpElement
 import com.kunzisoft.keepass.otp.OtpType
 import com.kunzisoft.keepass.settings.PreferencesUtil
+import com.kunzisoft.keepass.timeout.ClipboardHelper
 import com.kunzisoft.keepass.view.setTextSize
 import com.kunzisoft.keepass.view.strikeOut
 import java.util.*
@@ -52,9 +56,9 @@ import java.util.*
  * Create node list adapter with contextMenu or not
  * @param context Context to use
  */
-class NodeAdapter (private val context: Context,
-                   private val database: Database)
-    : RecyclerView.Adapter<NodeAdapter.NodeViewHolder>() {
+class NodesAdapter (private val context: Context,
+                    private val database: Database)
+    : RecyclerView.Adapter<NodesAdapter.NodeViewHolder>() {
 
     private var mNodeComparator: Comparator<NodeVersionedInterface<Group>>? = null
     private val mNodeSortedListCallback: NodeSortedListCallback
@@ -64,8 +68,10 @@ class NodeAdapter (private val context: Context,
     private var mCalculateViewTypeTextSize = Array(2) { true } // number of view type
     private var mTextSizeUnit: Int = TypedValue.COMPLEX_UNIT_PX
     private var mPrefSizeMultiplier: Float = 0F
-    private var mSubtextDefaultDimension: Float = 0F
-    private var mInfoTextDefaultDimension: Float = 0F
+    private var mTextDefaultDimension: Float = 0F
+    private var mSubTextDefaultDimension: Float = 0F
+    private var mMetaTextDefaultDimension: Float = 0F
+    private var mOtpTokenTextDefaultDimension: Float = 0F
     private var mNumberChildrenTextDefaultDimension: Float = 0F
     private var mIconDefaultDimension: Float = 0F
 
@@ -74,16 +80,25 @@ class NodeAdapter (private val context: Context,
     private var mShowOTP: Boolean = false
     private var mShowUUID: Boolean = false
     private var mEntryFilters = arrayOf<Group.ChildFilter>()
+    private var mOldVirtualGroup = false
+    private var mVirtualGroup = false
 
     private var mActionNodesList = LinkedList<Node>()
     private var mNodeClickCallback: NodeClickCallback? = null
+    private var mClipboardHelper = ClipboardHelper(context)
 
     @ColorInt
     private val mContentSelectionColor: Int
     @ColorInt
-    private val mIconGroupColor: Int
+    private val mTextColorPrimary: Int
     @ColorInt
-    private val mIconEntryColor: Int
+    private val mTextColor: Int
+    @ColorInt
+    private val mTextColorSecondary: Int
+    @ColorInt
+    private val mColorAccentLight: Int
+    @ColorInt
+    private val mTextColorInverse: Int
 
     /**
      * Determine if the adapter contains or not any element
@@ -104,12 +119,24 @@ class NodeAdapter (private val context: Context,
         this.mContentSelectionColor = ContextCompat.getColor(context, R.color.white)
         // Retrieve the color to tint the icon
         val taTextColorPrimary = context.theme.obtainStyledAttributes(intArrayOf(android.R.attr.textColorPrimary))
-        this.mIconGroupColor = taTextColorPrimary.getColor(0, Color.BLACK)
+        this.mTextColorPrimary = taTextColorPrimary.getColor(0, Color.BLACK)
         taTextColorPrimary.recycle()
-        // In two times to fix bug compilation
+        // To get text color
         val taTextColor = context.theme.obtainStyledAttributes(intArrayOf(android.R.attr.textColor))
-        this.mIconEntryColor = taTextColor.getColor(0, Color.BLACK)
+        this.mTextColor = taTextColor.getColor(0, Color.BLACK)
         taTextColor.recycle()
+        // To get text color secondary
+        val taTextColorSecondary = context.theme.obtainStyledAttributes(intArrayOf(android.R.attr.textColorSecondary))
+        this.mTextColorSecondary = taTextColorSecondary.getColor(0, Color.BLACK)
+        taTextColorSecondary.recycle()
+        // To get background color for selection
+        val taSelectionColor = context.theme.obtainStyledAttributes(intArrayOf(R.attr.colorAccentLight))
+        this.mColorAccentLight = taSelectionColor.getColor(0, Color.GRAY)
+        taSelectionColor.recycle()
+        // To get text color for selection
+        val taSelectionTextColor = context.theme.obtainStyledAttributes(intArrayOf(R.attr.textColorInverse))
+        this.mTextColorInverse = taSelectionTextColor.getColor(0, Color.WHITE)
+        taSelectionTextColor.recycle()
     }
 
     private fun assignPreferences() {
@@ -139,6 +166,8 @@ class NodeAdapter (private val context: Context,
      * Rebuild the list by clear and build children from the group
      */
     fun rebuildList(group: Group) {
+        mOldVirtualGroup = mVirtualGroup
+        mVirtualGroup = group.isVirtual
         assignPreferences()
         mNodeSortedList.replaceAll(group.getFilteredChildren(mEntryFilters))
     }
@@ -149,14 +178,19 @@ class NodeAdapter (private val context: Context,
         }
 
         override fun areContentsTheSame(oldItem: Node, newItem: Node): Boolean {
+            if (mOldVirtualGroup != mVirtualGroup)
+                return false
             var typeContentTheSame = true
             if (oldItem is Entry && newItem is Entry) {
                 typeContentTheSame = oldItem.getVisualTitle() == newItem.getVisualTitle()
                         && oldItem.username == newItem.username
+                        && oldItem.backgroundColor == newItem.backgroundColor
+                        && oldItem.foregroundColor == newItem.foregroundColor
                         && oldItem.getOtpElement() == newItem.getOtpElement()
                         && oldItem.containsAttachment() == newItem.containsAttachment()
             } else if (oldItem is Group && newItem is Group) {
                 typeContentTheSame = oldItem.numberOfChildEntries == newItem.numberOfChildEntries
+                        && oldItem.notes == newItem.notes
             }
             return typeContentTheSame
                     && oldItem.nodeId == newItem.nodeId
@@ -299,8 +333,10 @@ class NodeAdapter (private val context: Context,
             mInflater.inflate(R.layout.item_list_nodes_entry, parent, false)
         }
         val nodeViewHolder = NodeViewHolder(view)
-        mInfoTextDefaultDimension = nodeViewHolder.text.textSize
-        mSubtextDefaultDimension = nodeViewHolder.subText.textSize
+        mTextDefaultDimension = nodeViewHolder.text.textSize
+        mSubTextDefaultDimension = nodeViewHolder.subText?.textSize ?: mSubTextDefaultDimension
+        mMetaTextDefaultDimension = nodeViewHolder.meta.textSize
+        mOtpTokenTextDefaultDimension = nodeViewHolder.otpToken?.textSize ?: mOtpTokenTextDefaultDimension
         nodeViewHolder.numberChildren?.let {
             mNumberChildrenTextDefaultDimension = it.textSize
         }
@@ -311,14 +347,16 @@ class NodeAdapter (private val context: Context,
         val subNode = mNodeSortedList.get(position)
 
         // Node selection
-        holder.container.isSelected = mActionNodesList.contains(subNode)
+        holder.container.apply {
+            isSelected = mActionNodesList.contains(subNode)
+        }
 
         // Assign image
         val iconColor = if (holder.container.isSelected)
             mContentSelectionColor
         else when (subNode.type) {
-            Type.GROUP -> mIconGroupColor
-            Type.ENTRY -> mIconEntryColor
+            Type.GROUP -> mTextColorPrimary
+            Type.ENTRY -> mTextColor
         }
         holder.imageIdentifier?.setColorFilter(iconColor)
         holder.icon.apply {
@@ -333,19 +371,28 @@ class NodeAdapter (private val context: Context,
         // Assign text
         holder.text.apply {
             text = subNode.title
-            setTextSize(mTextSizeUnit, mInfoTextDefaultDimension, mPrefSizeMultiplier)
+            setTextSize(mTextSizeUnit, mTextDefaultDimension, mPrefSizeMultiplier)
             strikeOut(subNode.isCurrentlyExpires)
         }
-        // Add subText with username
-        holder.subText.apply {
-            text = ""
-            strikeOut(subNode.isCurrentlyExpires)
-            visibility = View.GONE
-        }
         // Add meta text to show UUID
         holder.meta.apply {
-            text = subNode.nodeId.toString()
-            visibility = if (mShowUUID) View.VISIBLE else View.GONE
+            val nodeId = subNode.nodeId?.toVisualString()
+            if (mShowUUID && nodeId != null) {
+                text = nodeId
+                setTextSize(mTextSizeUnit, mMetaTextDefaultDimension, mPrefSizeMultiplier)
+                visibility = View.VISIBLE
+            } else {
+                visibility = View.GONE
+            }
+        }
+        // Add path to virtual group
+        if (mVirtualGroup) {
+            holder.path?.apply {
+                text = subNode.getPathString()
+                visibility = View.VISIBLE
+            }
+        } else {
+            holder.path?.visibility = View.GONE
         }
 
         // Specific elements for entry
@@ -354,12 +401,16 @@ class NodeAdapter (private val context: Context,
             database.startManageEntry(entry)
 
             holder.text.text = entry.getVisualTitle()
-            holder.subText.apply {
+            // Add subText with username
+            holder.subText?.apply {
                 val username = entry.username
                 if (mShowUserNames && username.isNotEmpty()) {
                     visibility = View.VISIBLE
                     text = username
-                    setTextSize(mTextSizeUnit, mSubtextDefaultDimension, mPrefSizeMultiplier)
+                    setTextSize(mTextSizeUnit, mSubTextDefaultDimension, mPrefSizeMultiplier)
+                    strikeOut(subNode.isCurrentlyExpires)
+                } else {
+                    visibility = View.GONE
                 }
             }
 
@@ -385,6 +436,50 @@ class NodeAdapter (private val context: Context,
             holder.attachmentIcon?.visibility =
                     if (entry.containsAttachment()) View.VISIBLE else View.GONE
 
+            // Assign colors
+            val backgroundColor = entry.backgroundColor
+            if (!holder.container.isSelected) {
+                if (backgroundColor != null) {
+                    holder.container.setBackgroundColor(backgroundColor)
+                } else {
+                    holder.container.setBackgroundColor(Color.TRANSPARENT)
+                }
+            } else {
+                holder.container.setBackgroundColor(mColorAccentLight)
+            }
+            val foregroundColor = entry.foregroundColor
+            if (!holder.container.isSelected) {
+                if (foregroundColor != null) {
+                    holder.text.setTextColor(foregroundColor)
+                    holder.subText?.setTextColor(foregroundColor)
+                    holder.otpToken?.setTextColor(foregroundColor)
+                    holder.otpProgress?.setIndicatorColor(foregroundColor)
+                    holder.attachmentIcon?.setColorFilter(foregroundColor)
+                    holder.meta.setTextColor(foregroundColor)
+                    holder.icon.apply {
+                        database.iconDrawableFactory.assignDatabaseIcon(
+                            this,
+                            subNode.icon,
+                            foregroundColor
+                        )
+                    }
+                } else {
+                    holder.text.setTextColor(mTextColor)
+                    holder.subText?.setTextColor(mTextColorSecondary)
+                    holder.otpToken?.setTextColor(mTextColorSecondary)
+                    holder.otpProgress?.setIndicatorColor(mTextColorSecondary)
+                    holder.attachmentIcon?.setColorFilter(mTextColorSecondary)
+                    holder.meta.setTextColor(mTextColor)
+                }
+            } else {
+                holder.text.setTextColor(mTextColorInverse)
+                holder.subText?.setTextColor(mTextColorInverse)
+                holder.otpToken?.setTextColor(mTextColorInverse)
+                holder.otpProgress?.setIndicatorColor(mTextColorInverse)
+                holder.attachmentIcon?.setColorFilter(mTextColorInverse)
+                holder.meta.setTextColor(mTextColorInverse)
+            }
+
             database.stopManageEntry(entry)
         }
 
@@ -417,17 +512,32 @@ class NodeAdapter (private val context: Context,
             OtpType.HOTP -> {
                 holder?.otpProgress?.apply {
                     max = 100
-                    progress = 100
+                    setProgressCompat(100, true)
                 }
             }
             OtpType.TOTP -> {
                 holder?.otpProgress?.apply {
                     max = otpElement.period
-                    progress = otpElement.secondsRemaining
+                    setProgressCompat(otpElement.secondsRemaining, true)
                 }
             }
+            null -> {}
+        }
+        holder?.otpToken?.apply {
+            text = otpElement?.token
+            setTextSize(mTextSizeUnit, mOtpTokenTextDefaultDimension, mPrefSizeMultiplier)
+        }
+        holder?.otpContainer?.setOnClickListener {
+            otpElement?.token?.let { token ->
+                Toast.makeText(
+                        context,
+                        context.getString(R.string.copy_field,
+                                TemplateField.getLocalizedName(context, TemplateField.LABEL_TOKEN)),
+                        Toast.LENGTH_LONG
+                ).show()
+                mClipboardHelper.copyToClipboard(token)
+            }
         }
-        holder?.otpToken?.text = otpElement?.token
     }
 
     class OtpRunnable(val view: View?): Runnable {
@@ -468,10 +578,11 @@ class NodeAdapter (private val context: Context,
         var imageIdentifier: ImageView? = itemView.findViewById(R.id.node_image_identifier)
         var icon: ImageView = itemView.findViewById(R.id.node_icon)
         var text: TextView = itemView.findViewById(R.id.node_text)
-        var subText: TextView = itemView.findViewById(R.id.node_subtext)
+        var subText: TextView? = itemView.findViewById(R.id.node_subtext)
         var meta: TextView = itemView.findViewById(R.id.node_meta)
+        var path: TextView? = itemView.findViewById(R.id.node_path)
         var otpContainer: ViewGroup? = itemView.findViewById(R.id.node_otp_container)
-        var otpProgress: ProgressBar? = itemView.findViewById(R.id.node_otp_progress)
+        var otpProgress: CircularProgressIndicator? = itemView.findViewById(R.id.node_otp_progress)
         var otpToken: TextView? = itemView.findViewById(R.id.node_otp_token)
         var otpRunnable: OtpRunnable = OtpRunnable(otpContainer)
         var numberChildren: TextView? = itemView.findViewById(R.id.node_child_numbers)
@@ -479,6 +590,6 @@ class NodeAdapter (private val context: Context,
     }
 
     companion object {
-        private val TAG = NodeAdapter::class.java.name
+        private val TAG = NodesAdapter::class.java.name
     }
 }

app/src/main/java/com/kunzisoft/keepass/adapters/TemplatesSelectorAdapter.kt

@@ -16,9 +16,9 @@ import com.kunzisoft.keepass.icons.IconDrawableFactory
 
 
 class TemplatesSelectorAdapter(private val context: Context,
-                               private val iconDrawableFactory: IconDrawableFactory?,
                                private var templates: List<Template>): BaseAdapter() {
 
+    var iconDrawableFactory: IconDrawableFactory? = null
     private val inflater: LayoutInflater = LayoutInflater.from(context)
     private var mIconColor = Color.BLACK
 

app/src/main/java/com/kunzisoft/keepass/autofill/AutofillComponent.kt

@@ -4,4 +4,4 @@ import android.app.assist.AssistStructure
 import android.view.inputmethod.InlineSuggestionsRequest
 
 data class AutofillComponent(val assistStructure: AssistStructure,
-                             val inlineSuggestionsRequest: InlineSuggestionsRequest?)
+                             val compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest?)

app/src/main/java/com/kunzisoft/keepass/autofill/AutofillHelper.kt

@@ -34,34 +34,35 @@ import android.service.autofill.InlinePresentation
 import android.util.Log
 import android.view.autofill.AutofillManager
 import android.view.autofill.AutofillValue
-import android.view.inputmethod.InlineSuggestionsRequest
 import android.widget.RemoteViews
 import android.widget.Toast
+import android.widget.inline.InlinePresentationSpec
+import androidx.activity.result.ActivityResultLauncher
+import androidx.activity.result.contract.ActivityResultContracts
 import androidx.annotation.RequiresApi
+import androidx.appcompat.app.AppCompatActivity
 import androidx.autofill.inline.UiVersions
 import androidx.autofill.inline.v1.InlineSuggestionUi
 import androidx.core.content.ContextCompat
 import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.activities.AutofillLauncherActivity
 import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
 import com.kunzisoft.keepass.activities.helpers.SpecialMode
 import com.kunzisoft.keepass.database.element.Database
 import com.kunzisoft.keepass.database.element.icon.IconImage
+import com.kunzisoft.keepass.database.element.template.TemplateField
 import com.kunzisoft.keepass.model.EntryInfo
 import com.kunzisoft.keepass.model.SearchInfo
-import com.kunzisoft.keepass.database.element.template.TemplateField
 import com.kunzisoft.keepass.settings.AutofillSettingsActivity
 import com.kunzisoft.keepass.settings.PreferencesUtil
-import java.util.*
-import kotlin.collections.ArrayList
+import com.kunzisoft.keepass.utils.LOCK_ACTION
 
 
 @RequiresApi(api = Build.VERSION_CODES.O)
 object AutofillHelper {
 
-    private const val AUTOFILL_RESPONSE_REQUEST_CODE = 8165
-
     private const val EXTRA_ASSIST_STRUCTURE = AutofillManager.EXTRA_ASSIST_STRUCTURE
-    const val EXTRA_INLINE_SUGGESTIONS_REQUEST = "com.kunzisoft.keepass.autofill.INLINE_SUGGESTIONS_REQUEST"
+    private const val EXTRA_INLINE_SUGGESTIONS_REQUEST = "com.kunzisoft.keepass.autofill.INLINE_SUGGESTIONS_REQUEST"
 
     fun retrieveAutofillComponent(intent: Intent?): AutofillComponent? {
         intent?.getParcelableExtra<AssistStructure?>(EXTRA_ASSIST_STRUCTURE)?.let { assistStructure ->
@@ -110,7 +111,7 @@ object AutofillHelper {
                              database: Database,
                              entryInfo: EntryInfo,
                              struct: StructureParser.Result,
-                             inlinePresentation: InlinePresentation?): Dataset? {
+                             additionalBuild: ((build: Dataset.Builder) -> Unit)? = null): Dataset? {
         val title = makeEntryTitle(entryInfo)
         val views = newRemoteViews(context, database, title, entryInfo.icon)
         val builder = Dataset.Builder(views)
@@ -126,12 +127,14 @@ object AutofillHelper {
         if (entryInfo.expires) {
             val year = entryInfo.expiryTime.getYearInt()
             val month = entryInfo.expiryTime.getMonthInt()
+            val monthString = month.toString().padStart(2, '0')
             val day = entryInfo.expiryTime.getDay()
+            val dayString = day.toString().padStart(2, '0')
 
             struct.creditCardExpirationDateId?.let {
                 if (struct.isWebView) {
                     // set date string as defined in https://html.spec.whatwg.org
-                    builder.setValue(it, AutofillValue.forText("$year\u002D$month"))
+                    builder.setValue(it, AutofillValue.forText("$year\u002D$monthString"))
                 } else {
                     builder.setValue(it, AutofillValue.forDate(entryInfo.expiryTime.date.time))
                 }
@@ -157,24 +160,24 @@ object AutofillHelper {
             }
             struct.creditCardExpirationMonthId?.let {
                 if (struct.isWebView) {
-                    builder.setValue(it, AutofillValue.forText(month.toString()))
+                    builder.setValue(it, AutofillValue.forText(monthString))
                 } else {
                     if (struct.creditCardExpirationMonthOptions != null) {
                         // index starts at 0
                         builder.setValue(it, AutofillValue.forList(month - 1))
                     } else {
-                        builder.setValue(it, AutofillValue.forText(month.toString()))
+                        builder.setValue(it, AutofillValue.forText(monthString))
                     }
                 }
             }
             struct.creditCardExpirationDayId?.let {
                 if (struct.isWebView) {
-                    builder.setValue(it, AutofillValue.forText(day.toString()))
+                    builder.setValue(it, AutofillValue.forText(dayString))
                 } else {
                     if (struct.creditCardExpirationDayOptions != null) {
                         builder.setValue(it, AutofillValue.forList(day - 1))
                     } else {
-                        builder.setValue(it, AutofillValue.forText(day.toString()))
+                        builder.setValue(it, AutofillValue.forText(dayString))
                     }
                 }
             }
@@ -197,11 +200,7 @@ object AutofillHelper {
             }
         }
 
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-            inlinePresentation?.let {
-                builder.setInlinePresentation(it)
-            }
-        }
+        additionalBuild?.invoke(builder)
 
         return try {
             builder.build()
@@ -232,49 +231,81 @@ object AutofillHelper {
     @SuppressLint("RestrictedApi")
     private fun buildInlinePresentationForEntry(context: Context,
                                                 database: Database,
-                                                inlineSuggestionsRequest: InlineSuggestionsRequest,
+                                                compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest,
                                                 positionItem: Int,
                                                 entryInfo: EntryInfo): InlinePresentation? {
-        val inlinePresentationSpecs = inlineSuggestionsRequest.inlinePresentationSpecs
-        val maxSuggestion = inlineSuggestionsRequest.maxSuggestionCount
+        compatInlineSuggestionsRequest.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
+            val inlinePresentationSpecs = inlineSuggestionsRequest.inlinePresentationSpecs
+            val maxSuggestion = inlineSuggestionsRequest.maxSuggestionCount
 
-        if (positionItem <= maxSuggestion - 1
-                && inlinePresentationSpecs.size > positionItem) {
-            val inlinePresentationSpec = inlinePresentationSpecs[positionItem]
+            if (positionItem <= maxSuggestion - 1
+                && inlinePresentationSpecs.size > positionItem
+            ) {
+                val inlinePresentationSpec = inlinePresentationSpecs[positionItem]
 
-            // Make sure that the IME spec claims support for v1 UI template.
-            val imeStyle = inlinePresentationSpec.style
-            if (!UiVersions.getVersions(imeStyle).contains(UiVersions.INLINE_UI_VERSION_1))
-                return null
+                // Make sure that the IME spec claims support for v1 UI template.
+                val imeStyle = inlinePresentationSpec.style
+                if (!UiVersions.getVersions(imeStyle).contains(UiVersions.INLINE_UI_VERSION_1))
+                    return null
 
-            // Build the content for IME UI
-            val pendingIntent = PendingIntent.getActivity(context,
+                // Build the content for IME UI
+                val pendingIntent = PendingIntent.getActivity(
+                    context,
                     0,
                     Intent(context, AutofillSettingsActivity::class.java),
-                    0)
-            return InlinePresentation(
+                    if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+                        PendingIntent.FLAG_IMMUTABLE
+                    } else {
+                        0
+                    }
+                )
+                return InlinePresentation(
                     InlineSuggestionUi.newContentBuilder(pendingIntent).apply {
                         setContentDescription(context.getString(R.string.autofill_sign_in_prompt))
                         setTitle(entryInfo.title)
                         setSubtitle(entryInfo.username)
-                        setStartIcon(Icon.createWithResource(context, R.mipmap.ic_launcher_round).apply {
-                            setTintBlendMode(BlendMode.DST)
-                        })
+                        setStartIcon(
+                            Icon.createWithResource(context, R.mipmap.ic_launcher_round).apply {
+                                setTintBlendMode(BlendMode.DST)
+                            })
                         buildIconFromEntry(context, database, entryInfo)?.let { icon ->
                             setEndIcon(icon.apply {
                                 setTintBlendMode(BlendMode.DST)
                             })
                         }
-                    }.build().slice, inlinePresentationSpec, false)
+                    }.build().slice, inlinePresentationSpec, false
+                )
+            }
         }
         return null
     }
 
+    @RequiresApi(Build.VERSION_CODES.R)
+    @SuppressLint("RestrictedApi")
+    private fun buildInlinePresentationForManualSelection(context: Context,
+                                                          inlinePresentationSpec: InlinePresentationSpec,
+                                                          pendingIntent: PendingIntent): InlinePresentation? {
+        // Make sure that the IME spec claims support for v1 UI template.
+        val imeStyle = inlinePresentationSpec.style
+        if (!UiVersions.getVersions(imeStyle).contains(UiVersions.INLINE_UI_VERSION_1))
+            return null
+
+        // Build the content for IME UI
+        return InlinePresentation(
+                InlineSuggestionUi.newContentBuilder(pendingIntent).apply {
+                    setContentDescription(context.getString(R.string.autofill_sign_in_prompt))
+                    setTitle(context.getString(R.string.autofill_select_entry))
+                    setStartIcon(Icon.createWithResource(context, R.drawable.ic_arrow_right_green_24dp).apply {
+                        setTintBlendMode(BlendMode.DST)
+                    })
+                }.build().slice, inlinePresentationSpec, false)
+    }
+
     fun buildResponse(context: Context,
                       database: Database,
                       entriesInfo: List<EntryInfo>,
                       parseResult: StructureParser.Result,
-                      inlineSuggestionsRequest: InlineSuggestionsRequest?): FillResponse? {
+                      compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest?): FillResponse? {
         val responseBuilder = FillResponse.Builder()
         // Add Header
         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.P) {
@@ -293,17 +324,63 @@ object AutofillHelper {
         }
 
         // Add inline suggestion for new IME and dataset
-        entriesInfo.forEachIndexed { index, entryInfo ->
-            val inlinePresentation = inlineSuggestionsRequest?.let {
-                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-                    buildInlinePresentationForEntry(context, database, inlineSuggestionsRequest, index, entryInfo)
-                } else {
-                    null
+        var numberInlineSuggestions = 0
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
+            compatInlineSuggestionsRequest?.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
+                numberInlineSuggestions = minOf(inlineSuggestionsRequest.maxSuggestionCount, entriesInfo.size)
+                if (PreferencesUtil.isAutofillManualSelectionEnable(context)) {
+                    if (entriesInfo.size >= inlineSuggestionsRequest.maxSuggestionCount) {
+                        --numberInlineSuggestions
+                    }
                 }
             }
-            val dataSet = buildDataset(context, database, entryInfo, parseResult, inlinePresentation)
-            dataSet?.let {
-                responseBuilder.addDataset(it)
+
+        }
+
+        entriesInfo.forEachIndexed { _, entry ->
+            if (numberInlineSuggestions > 0
+                && Build.VERSION.SDK_INT >= Build.VERSION_CODES.R
+                && compatInlineSuggestionsRequest != null) {
+                responseBuilder.addDataset(buildDataset(context, database, entry, parseResult) { builder ->
+                    buildInlinePresentationForEntry(context, database,
+                        compatInlineSuggestionsRequest, numberInlineSuggestions--, entry
+                    )?.let { inlinePresentation ->
+                        builder.setInlinePresentation(inlinePresentation)
+                    }
+                })
+            } else {
+                responseBuilder.addDataset(buildDataset(context, database, entry, parseResult))
+            }
+        }
+
+        if (PreferencesUtil.isAutofillManualSelectionEnable(context)) {
+            val searchInfo = SearchInfo().apply {
+                applicationId = parseResult.applicationId
+                webDomain = parseResult.webDomain
+                webScheme = parseResult.webScheme
+                manualSelection = true
+            }
+            val manualSelectionView = RemoteViews(context.packageName, R.layout.item_autofill_select_entry)
+            val pendingIntent = AutofillLauncherActivity.getPendingIntentForSelection(context,
+                    searchInfo, compatInlineSuggestionsRequest)
+
+            parseResult.allAutofillIds().let { autofillIds ->
+                autofillIds.forEach { id ->
+                    val builder = Dataset.Builder(manualSelectionView)
+
+                    if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
+                        compatInlineSuggestionsRequest?.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
+                            val inlinePresentationSpec = inlineSuggestionsRequest.inlinePresentationSpecs[0]
+                            val inlinePresentation = buildInlinePresentationForManualSelection(context, inlinePresentationSpec, pendingIntent)
+                            inlinePresentation?.let {
+                                builder.setInlinePresentation(it)
+                            }
+                        }
+                    }
+                    builder.setValue(id, null)
+                    builder.setAuthentication(pendingIntent.intentSender)
+                    responseBuilder.addDataset(builder.build())
+                }
             }
         }
 
@@ -337,11 +414,11 @@ object AutofillHelper {
                 StructureParser(structure).parse()?.let { result ->
                     // New Response
                     val response = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-                        val inlineSuggestionsRequest = activity.intent?.getParcelableExtra<InlineSuggestionsRequest?>(EXTRA_INLINE_SUGGESTIONS_REQUEST)
-                        if (inlineSuggestionsRequest != null) {
+                        val compatInlineSuggestionsRequest = activity.intent?.getParcelableExtra<CompatInlineSuggestionsRequest?>(EXTRA_INLINE_SUGGESTIONS_REQUEST)
+                        if (compatInlineSuggestionsRequest != null) {
                             Toast.makeText(activity.applicationContext, R.string.autofill_inline_suggestions_keyboard, Toast.LENGTH_SHORT).show()
                         }
-                        buildResponse(activity, database, entriesInfo, result, inlineSuggestionsRequest)
+                        buildResponse(activity, database, entriesInfo, result, compatInlineSuggestionsRequest)
                     } else {
                         buildResponse(activity, database, entriesInfo, result, null)
                     }
@@ -361,37 +438,44 @@ object AutofillHelper {
         }
     }
 
+    fun buildActivityResultLauncher(activity: AppCompatActivity,
+                                    lockDatabase: Boolean = false): ActivityResultLauncher<Intent> {
+        return activity.registerForActivityResult(
+            ActivityResultContracts.StartActivityForResult()
+        ) {
+            // Utility method to loop and close each activity with return data
+            if (it.resultCode == Activity.RESULT_OK) {
+                activity.setResult(it.resultCode, it.data)
+            }
+            if (it.resultCode == Activity.RESULT_CANCELED) {
+                activity.setResult(Activity.RESULT_CANCELED)
+            }
+            activity.finish()
+
+            if (lockDatabase && PreferencesUtil.isAutofillCloseDatabaseEnable(activity)) {
+                // Close the database
+                activity.sendBroadcast(Intent(LOCK_ACTION))
+            }
+        }
+    }
+
     /**
      * Utility method to start an activity with an Autofill for result
      */
-    fun startActivityForAutofillResult(activity: Activity,
+    fun startActivityForAutofillResult(activity: AppCompatActivity,
                                        intent: Intent,
+                                       activityResultLauncher: ActivityResultLauncher<Intent>?,
                                        autofillComponent: AutofillComponent,
                                        searchInfo: SearchInfo?) {
         EntrySelectionHelper.addSpecialModeInIntent(intent, SpecialMode.SELECTION)
         intent.putExtra(EXTRA_ASSIST_STRUCTURE, autofillComponent.assistStructure)
         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R
                 && PreferencesUtil.isAutofillInlineSuggestionsEnable(activity)) {
-            autofillComponent.inlineSuggestionsRequest?.let {
+            autofillComponent.compatInlineSuggestionsRequest?.let {
                 intent.putExtra(EXTRA_INLINE_SUGGESTIONS_REQUEST, it)
             }
         }
         EntrySelectionHelper.addSearchInfoInIntent(intent, searchInfo)
-        activity.startActivityForResult(intent, AUTOFILL_RESPONSE_REQUEST_CODE)
-    }
-
-    /**
-     * Utility method to loop and close each activity with return data
-     */
-    fun onActivityResultSetResultAndFinish(activity: Activity, requestCode: Int, resultCode: Int, data: Intent?) {
-        if (requestCode == AUTOFILL_RESPONSE_REQUEST_CODE) {
-            if (resultCode == Activity.RESULT_OK) {
-                activity.setResult(resultCode, data)
-            }
-            if (resultCode == Activity.RESULT_CANCELED) {
-                activity.setResult(Activity.RESULT_CANCELED)
-            }
-            activity.finish()
-        }
+        activityResultLauncher?.launch(intent)
     }
 }

app/src/main/java/com/kunzisoft/keepass/autofill/CompatInlineSuggestionsRequest.kt

@@ -0,0 +1,83 @@
+/*
+ * Copyright 2021 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.autofill
+
+import android.annotation.TargetApi
+import android.os.Build
+import android.os.Parcel
+import android.os.Parcelable
+import android.service.autofill.FillRequest
+import android.view.inputmethod.InlineSuggestionsRequest
+import androidx.annotation.RequiresApi
+
+/**
+ * Utility class only to prevent java.lang.NoClassDefFoundError for old Android version and new lib compilation
+ */
+@RequiresApi(Build.VERSION_CODES.O)
+class CompatInlineSuggestionsRequest : Parcelable {
+
+    @TargetApi(Build.VERSION_CODES.R)
+    var inlineSuggestionsRequest: InlineSuggestionsRequest? = null
+        private set
+
+    constructor(fillRequest: FillRequest) {
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
+            this.inlineSuggestionsRequest = fillRequest.inlineSuggestionsRequest
+        } else {
+            this.inlineSuggestionsRequest = null
+        }
+    }
+
+    @RequiresApi(Build.VERSION_CODES.R)
+    constructor(inlineSuggestionsRequest: InlineSuggestionsRequest?) {
+        this.inlineSuggestionsRequest = inlineSuggestionsRequest
+    }
+
+    constructor(parcel: Parcel) {
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
+            this.inlineSuggestionsRequest =
+                parcel.readParcelable(FillRequest::class.java.classLoader)
+        }
+        else {
+            this.inlineSuggestionsRequest = null
+        }
+    }
+
+    override fun writeToParcel(parcel: Parcel, flags: Int) {
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
+            parcel.writeParcelable(inlineSuggestionsRequest, flags)
+        }
+    }
+
+    override fun describeContents(): Int {
+        return 0
+    }
+
+    companion object CREATOR : Parcelable.Creator<CompatInlineSuggestionsRequest> {
+        override fun createFromParcel(parcel: Parcel): CompatInlineSuggestionsRequest {
+            return CompatInlineSuggestionsRequest(parcel)
+        }
+
+        override fun newArray(size: Int): Array<CompatInlineSuggestionsRequest?> {
+            return arrayOfNulls(size)
+        }
+    }
+
+}

app/src/main/java/com/kunzisoft/keepass/autofill/KeeAutofillService.kt

@@ -109,7 +109,7 @@ class KeeAutofillService : AutofillService() {
                         searchInfo.webDomain = webDomainWithoutSubDomain
                         val inlineSuggestionsRequest = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R
                                 && autofillInlineSuggestionsEnabled) {
-                            request.inlineSuggestionsRequest
+                            CompatInlineSuggestionsRequest(request)
                         } else {
                             null
                         }
@@ -127,7 +127,7 @@ class KeeAutofillService : AutofillService() {
     private fun launchSelection(database: Database?,
                                 searchInfo: SearchInfo,
                                 parseResult: StructureParser.Result,
-                                inlineSuggestionsRequest: InlineSuggestionsRequest?,
+                                inlineSuggestionsRequest: CompatInlineSuggestionsRequest?,
                                 callback: FillCallback) {
         SearchHelper.checkAutoSearchInfo(this,
                 database,
@@ -138,14 +138,14 @@ class KeeAutofillService : AutofillService() {
                                     items, parseResult, inlineSuggestionsRequest)
                     )
                 },
-                {
+                { openedDatabase ->
                     // Show UI if no search result
-                    showUIForEntrySelection(parseResult,
+                    showUIForEntrySelection(parseResult, openedDatabase,
                             searchInfo, inlineSuggestionsRequest, callback)
                 },
                 {
                     // Show UI if database not open
-                    showUIForEntrySelection(parseResult,
+                    showUIForEntrySelection(parseResult, null,
                             searchInfo, inlineSuggestionsRequest, callback)
                 }
         )
@@ -153,26 +153,59 @@ class KeeAutofillService : AutofillService() {
 
     @SuppressLint("RestrictedApi")
     private fun showUIForEntrySelection(parseResult: StructureParser.Result,
+                                        database: Database?,
                                         searchInfo: SearchInfo,
-                                        inlineSuggestionsRequest: InlineSuggestionsRequest?,
+                                        inlineSuggestionsRequest: CompatInlineSuggestionsRequest?,
                                         callback: FillCallback) {
         parseResult.allAutofillIds().let { autofillIds ->
             if (autofillIds.isNotEmpty()) {
                 // If the entire Autofill Response is authenticated, AuthActivity is used
                 // to generate Response.
-                val intentSender = AutofillLauncherActivity.getAuthIntentSenderForSelection(this,
-                        searchInfo, inlineSuggestionsRequest)
+                val intentSender = AutofillLauncherActivity.getPendingIntentForSelection(this,
+                        searchInfo, inlineSuggestionsRequest).intentSender
                 val responseBuilder = FillResponse.Builder()
-                val remoteViewsUnlock: RemoteViews = if (!parseResult.webDomain.isNullOrEmpty()) {
-                    RemoteViews(packageName, R.layout.item_autofill_unlock_web_domain).apply {
-                        setTextViewText(R.id.autofill_web_domain_text, parseResult.webDomain)
-                    }
-                } else if (!parseResult.applicationId.isNullOrEmpty()) {
-                    RemoteViews(packageName, R.layout.item_autofill_unlock_app_id).apply {
-                        setTextViewText(R.id.autofill_app_id_text, parseResult.applicationId)
+                val remoteViewsUnlock: RemoteViews = if (database == null) {
+                    if (!parseResult.webDomain.isNullOrEmpty()) {
+                        RemoteViews(
+                            packageName,
+                            R.layout.item_autofill_unlock_web_domain
+                        ).apply {
+                            setTextViewText(
+                                R.id.autofill_web_domain_text,
+                                parseResult.webDomain
+                            )
+                        }
+                    } else if (!parseResult.applicationId.isNullOrEmpty()) {
+                        RemoteViews(packageName, R.layout.item_autofill_unlock_app_id).apply {
+                            setTextViewText(
+                                R.id.autofill_app_id_text,
+                                parseResult.applicationId
+                            )
+                        }
+                    } else {
+                        RemoteViews(packageName, R.layout.item_autofill_unlock)
                     }
                 } else {
-                    RemoteViews(packageName, R.layout.item_autofill_unlock)
+                    if (!parseResult.webDomain.isNullOrEmpty()) {
+                        RemoteViews(
+                            packageName,
+                            R.layout.item_autofill_select_entry_web_domain
+                        ).apply {
+                            setTextViewText(
+                                R.id.autofill_web_domain_text,
+                                parseResult.webDomain
+                            )
+                        }
+                    } else if (!parseResult.applicationId.isNullOrEmpty()) {
+                        RemoteViews(packageName, R.layout.item_autofill_select_entry_app_id).apply {
+                            setTextViewText(
+                                R.id.autofill_app_id_text,
+                                parseResult.applicationId
+                            )
+                        }
+                    } else {
+                        RemoteViews(packageName, R.layout.item_autofill_select_entry)
+                    }
                 }
 
                 // Tell the autofill framework the interest to save credentials
@@ -216,7 +249,7 @@ class KeeAutofillService : AutofillService() {
                 if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R
                         && autofillInlineSuggestionsEnabled) {
                     var inlinePresentation: InlinePresentation? = null
-                    inlineSuggestionsRequest?.let {
+                    inlineSuggestionsRequest?.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
                         val inlinePresentationSpecs = inlineSuggestionsRequest.inlinePresentationSpecs
                         if (inlineSuggestionsRequest.maxSuggestionCount > 0
                                 && inlinePresentationSpecs.size > 0) {
@@ -229,9 +262,13 @@ class KeeAutofillService : AutofillService() {
                                 inlinePresentation = InlinePresentation(
                                         InlineSuggestionUi.newContentBuilder(
                                                 PendingIntent.getActivity(this,
-                                                        0,
-                                                        Intent(this, AutofillSettingsActivity::class.java),
-                                                        0)
+                                                    0,
+                                                    Intent(this, AutofillSettingsActivity::class.java),
+                                                    if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+                                                        PendingIntent.FLAG_IMMUTABLE
+                                                    } else {
+                                                        0
+                                                    })
                                         ).apply {
                                             setContentDescription(getString(R.string.autofill_sign_in_prompt))
                                             setTitle(getString(R.string.autofill_sign_in_prompt))
@@ -244,8 +281,9 @@ class KeeAutofillService : AutofillService() {
                     }
                     // Build response
                     responseBuilder.setAuthentication(autofillIds, intentSender, remoteViewsUnlock, inlinePresentation)
+                } else {
+                    responseBuilder.setAuthentication(autofillIds, intentSender, remoteViewsUnlock)
                 }
-                responseBuilder.setAuthentication(autofillIds, intentSender, remoteViewsUnlock)
                 callback.onSuccess(responseBuilder.build())
             }
         }

app/src/main/java/com/kunzisoft/keepass/autofill/StructureParser.kt

@@ -53,8 +53,10 @@ class StructureParser(private val structure: AssistStructure) {
                     applicationId = windowNode.title.toString().split("/")[0]
                     Log.d(TAG, "Autofill applicationId: $applicationId")
 
-                    if (parseViewNode(windowNode.rootViewNode))
-                        break@mainLoop
+                    if (applicationId?.contains("PopupWindow:") == false) {
+                        if (parseViewNode(windowNode.rootViewNode))
+                            break@mainLoop
+                    }
                 }
                 // If not explicit username field found, add the field just before password field.
                 if (usernameId == null && passwordId != null && usernameIdCandidate != null) {
@@ -143,19 +145,19 @@ class StructureParser(private val structure: AssistStructure) {
                     Log.d(TAG, "Autofill password hint")
                     return true
                 }
-                it.contains("cc-name", true) -> {
+                it.equals("cc-name", true) -> {
                     Log.d(TAG, "Autofill credit card name hint")
                     result?.creditCardHolderId = autofillId
                     result?.creditCardHolder = node.autofillValue?.textValue?.toString()
                 }
                 it.contains(View.AUTOFILL_HINT_CREDIT_CARD_NUMBER, true)
-                        || it.contains("cc-number", true) -> {
+                        || it.equals("cc-number", true) -> {
                     Log.d(TAG, "Autofill credit card number hint")
                     result?.creditCardNumberId = autofillId
                     result?.creditCardNumber = node.autofillValue?.textValue?.toString()
                 }
                 // expect date string as defined in https://html.spec.whatwg.org, e.g. 2014-12
-                it.contains("cc-exp", true) -> {
+                it.equals("cc-exp", true) -> {
                     Log.d(TAG, "Autofill credit card expiration date hint")
                     result?.creditCardExpirationDateId = autofillId
                     node.autofillValue?.let { value ->
@@ -182,7 +184,7 @@ class StructureParser(private val structure: AssistStructure) {
                     }
                 }
                 it.contains(View.AUTOFILL_HINT_CREDIT_CARD_EXPIRATION_YEAR, true)
-                        || it.contains("cc-exp-year", true) -> {
+                        || it.equals("cc-exp-year", true) -> {
                     Log.d(TAG, "Autofill credit card expiration year hint")
                     result?.creditCardExpirationYearId = autofillId
                     if (node.autofillOptions != null) {
@@ -204,7 +206,7 @@ class StructureParser(private val structure: AssistStructure) {
                     }
                 }
                 it.contains(View.AUTOFILL_HINT_CREDIT_CARD_EXPIRATION_MONTH, true)
-                        || it.contains("cc-exp-month", true) -> {
+                        || it.equals("cc-exp-month", true) -> {
                     Log.d(TAG, "Autofill credit card expiration month hint")
                     result?.creditCardExpirationMonthId = autofillId
                     if (node.autofillOptions != null) {
@@ -227,7 +229,7 @@ class StructureParser(private val structure: AssistStructure) {
                     }
                 }
                 it.contains(View.AUTOFILL_HINT_CREDIT_CARD_EXPIRATION_DAY, true)
-                        || it.contains("cc-exp-day", true) -> {
+                        || it.equals("cc-exp-day", true) -> {
                     Log.d(TAG, "Autofill credit card expiration day hint")
                     result?.creditCardExpirationDayId = autofillId
                     if (node.autofillOptions != null) {
@@ -270,12 +272,12 @@ class StructureParser(private val structure: AssistStructure) {
     private fun parseNodeByHtmlAttributes(node: AssistStructure.ViewNode): Boolean {
         val autofillId = node.autofillId
         val nodHtml = node.htmlInfo
-        when (nodHtml?.tag?.toLowerCase(Locale.ENGLISH)) {
+        when (nodHtml?.tag?.lowercase(Locale.ENGLISH)) {
             "input" -> {
                 nodHtml.attributes?.forEach { pairAttribute ->
-                    when (pairAttribute.first.toLowerCase(Locale.ENGLISH)) {
+                    when (pairAttribute.first.lowercase(Locale.ENGLISH)) {
                         "type" -> {
-                            when (pairAttribute.second.toLowerCase(Locale.ENGLISH)) {
+                            when (pairAttribute.second.lowercase(Locale.ENGLISH)) {
                                 "tel", "email" -> {
                                     result?.usernameId = autofillId
                                     result?.usernameValue = node.autofillValue
@@ -399,7 +401,6 @@ class StructureParser(private val structure: AssistStructure) {
     class Result {
         var isWebView: Boolean = false
         var applicationId: String? = null
-
         var webDomain: String? = null
             set(value) {
                 if (field == null)

app/src/main/java/com/kunzisoft/keepass/biometric/AdvancedUnlockFragment.kt

@@ -19,6 +19,7 @@
  */
 package com.kunzisoft.keepass.biometric
 
+import android.app.Activity
 import android.content.Context
 import android.content.Intent
 import android.net.Uri
@@ -27,9 +28,11 @@ import android.os.Bundle
 import android.provider.Settings
 import android.util.Log
 import android.view.*
+import androidx.activity.result.contract.ActivityResultContracts
 import androidx.annotation.RequiresApi
 import androidx.biometric.BiometricManager
 import androidx.biometric.BiometricPrompt
+import androidx.fragment.app.activityViewModels
 import androidx.lifecycle.lifecycleScope
 import com.getkeepsafe.taptargetview.TapTargetView
 import com.kunzisoft.keepass.R
@@ -39,6 +42,7 @@ import com.kunzisoft.keepass.database.exception.IODatabaseException
 import com.kunzisoft.keepass.education.PasswordActivityEducation
 import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.view.AdvancedUnlockInfoView
+import com.kunzisoft.keepass.viewmodels.AdvancedUnlockViewModel
 import kotlinx.coroutines.Dispatchers
 import kotlinx.coroutines.launch
 
@@ -59,9 +63,12 @@ class AdvancedUnlockFragment: StylishFragment(), AdvancedUnlockManager.AdvancedU
     /**
      * Manage setting to auto open biometric prompt
      */
-    private var mAutoOpenPrompt: Boolean = false
+    private var mAutoOpenPrompt: Boolean
         get() {
-            return field && mAutoOpenPromptEnabled
+            return mAdvancedUnlockViewModel.allowAutoOpenBiometricPrompt && mAutoOpenPromptEnabled
+        }
+        set(value) {
+            mAdvancedUnlockViewModel.allowAutoOpenBiometricPrompt = value
         }
 
     // Variable to check if the prompt can be open (if the right activity is currently shown)
@@ -72,6 +79,8 @@ class AdvancedUnlockFragment: StylishFragment(), AdvancedUnlockManager.AdvancedU
 
     private var cipherDatabaseListener: CipherDatabaseAction.CipherDatabaseListener? = null
 
+    private val mAdvancedUnlockViewModel: AdvancedUnlockViewModel by activityViewModels()
+
     // Only to fix multiple fingerprint menu #332
     private var mAllowAdvancedUnlockMenu = false
     private var mAddBiometricMenuInProgress = false
@@ -79,6 +88,15 @@ class AdvancedUnlockFragment: StylishFragment(), AdvancedUnlockManager.AdvancedU
     // Only keep connection when we request a device credential activity
     private var keepConnection = false
 
+    private var mDeviceCredentialResultLauncher = registerForActivityResult(ActivityResultContracts.StartActivityForResult()) { result ->
+        mAdvancedUnlockViewModel.allowAutoOpenBiometricPrompt = false
+        // To wait resume
+        if (keepConnection) {
+            mAdvancedUnlockViewModel.deviceCredentialAuthSucceeded = result.resultCode == Activity.RESULT_OK
+        }
+        keepConnection = false
+    }
+
     override fun onAttach(context: Context) {
         super.onAttach(context)
 
@@ -97,10 +115,21 @@ class AdvancedUnlockFragment: StylishFragment(), AdvancedUnlockManager.AdvancedU
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
 
-        retainInstance = true
         setHasOptionsMenu(true)
 
         cipherDatabaseAction = CipherDatabaseAction.getInstance(requireContext().applicationContext)
+
+        mAdvancedUnlockViewModel.onInitAdvancedUnlockModeRequested.observe(this) {
+            initAdvancedUnlockMode()
+        }
+
+        mAdvancedUnlockViewModel.onUnlockAvailabilityCheckRequested.observe(this) {
+            checkUnlockAvailability()
+        }
+
+        mAdvancedUnlockViewModel.onDatabaseFileLoaded.observe(this) {
+            onDatabaseLoaded(it)
+        }
     }
 
     override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? {
@@ -114,17 +143,6 @@ class AdvancedUnlockFragment: StylishFragment(), AdvancedUnlockManager.AdvancedU
         return rootView
     }
 
-    private data class ActivityResult(var requestCode: Int, var resultCode: Int, var data: Intent?)
-    private var activityResult: ActivityResult? = null
-
-    override fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?) {
-        // To wait resume
-        if (keepConnection) {
-            activityResult = ActivityResult(requestCode, resultCode, data)
-        }
-        keepConnection = false
-    }
-
     override fun onResume() {
         super.onResume()
         context?.let {
@@ -154,32 +172,38 @@ class AdvancedUnlockFragment: StylishFragment(), AdvancedUnlockManager.AdvancedU
         return super.onOptionsItemSelected(item)
     }
 
-    fun loadDatabase(databaseUri: Uri?, autoOpenPrompt: Boolean) {
+    private fun onDatabaseLoaded(databaseUri: Uri?) {
         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
             // To get device credential unlock result, only if same database uri
             if (databaseUri != null
                     && mAdvancedUnlockEnabled) {
-                activityResult?.let {
+                val deviceCredentialAuthSucceeded = mAdvancedUnlockViewModel.deviceCredentialAuthSucceeded
+                deviceCredentialAuthSucceeded?.let {
                     if (databaseUri == databaseFileUri) {
-                        advancedUnlockManager?.onActivityResult(it.requestCode, it.resultCode)
+                        if (deviceCredentialAuthSucceeded == true) {
+                            advancedUnlockManager?.advancedUnlockCallback?.onAuthenticationSucceeded()
+                        } else {
+                            advancedUnlockManager?.advancedUnlockCallback?.onAuthenticationFailed()
+                        }
                     } else {
                         disconnect()
                     }
                 } ?: run {
-                    this.mAutoOpenPrompt = autoOpenPrompt
-                    connect(databaseUri)
+                    if (databaseUri != databaseFileUri) {
+                        connect(databaseUri)
+                    }
                 }
             } else {
                 disconnect()
             }
-            activityResult = null
+            mAdvancedUnlockViewModel.deviceCredentialAuthSucceeded = null
         }
     }
 
     /**
      * Check unlock availability and change the current mode depending of device's state
      */
-    fun checkUnlockAvailability() {
+    private fun checkUnlockAvailability() {
         context?.let { context ->
             if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
                 allowOpenBiometricPrompt = true
@@ -317,7 +341,8 @@ class AdvancedUnlockFragment: StylishFragment(), AdvancedUnlockManager.AdvancedU
                 if (cryptoPrompt.isDeviceCredentialOperation)
                     keepConnection = true
                 try {
-                    advancedUnlockManager?.openAdvancedUnlockPrompt(cryptoPrompt)
+                    advancedUnlockManager?.openAdvancedUnlockPrompt(cryptoPrompt,
+                        mDeviceCredentialResultLauncher)
                 } catch (e: Exception) {
                     Log.e(TAG, "Unable to open advanced unlock prompt", e)
                     setAdvancedUnlockedTitleView(R.string.advanced_unlock_prompt_not_initialized)
@@ -369,8 +394,7 @@ class AdvancedUnlockFragment: StylishFragment(), AdvancedUnlockManager.AdvancedU
         } ?: throw Exception("AdvancedUnlockManager not initialized")
     }
 
-    @Synchronized
-    fun initAdvancedUnlockMode() {
+    private fun initAdvancedUnlockMode() {
         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
             mAllowAdvancedUnlockMenu = false
             try {
@@ -444,6 +468,7 @@ class AdvancedUnlockFragment: StylishFragment(), AdvancedUnlockManager.AdvancedU
 
     @RequiresApi(Build.VERSION_CODES.M)
     fun deleteEncryptedDatabaseKey() {
+        mAllowAdvancedUnlockMenu = false
         advancedUnlockManager?.closeBiometricPrompt()
         databaseFileUri?.let { databaseUri ->
             cipherDatabaseAction.deleteByDatabaseUri(databaseUri) {
@@ -516,6 +541,11 @@ class AdvancedUnlockFragment: StylishFragment(), AdvancedUnlockManager.AdvancedU
         }
     }
 
+    @RequiresApi(Build.VERSION_CODES.M)
+    override fun onUnrecoverableKeyException(e: Exception) {
+        setAdvancedUnlockedMessageView(R.string.advanced_unlock_invalid_key)
+    }
+
     @RequiresApi(Build.VERSION_CODES.M)
     override fun onInvalidKeyException(e: Exception) {
         setAdvancedUnlockedMessageView(R.string.advanced_unlock_invalid_key)

app/src/main/java/com/kunzisoft/keepass/biometric/AdvancedUnlockManager.kt

@@ -19,15 +19,18 @@
  */
 package com.kunzisoft.keepass.biometric
 
-import android.app.Activity
 import android.app.KeyguardManager
 import android.content.Context
+import android.content.Intent
+import android.content.pm.PackageManager
 import android.os.Build
 import android.security.keystore.KeyGenParameterSpec
 import android.security.keystore.KeyPermanentlyInvalidatedException
 import android.security.keystore.KeyProperties
 import android.util.Base64
 import android.util.Log
+import android.widget.Toast
+import androidx.activity.result.ActivityResultLauncher
 import androidx.annotation.RequiresApi
 import androidx.biometric.BiometricManager
 import androidx.biometric.BiometricManager.Authenticators.*
@@ -35,6 +38,7 @@ import androidx.biometric.BiometricPrompt
 import androidx.core.content.ContextCompat
 import androidx.fragment.app.FragmentActivity
 import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.app.database.CipherDatabaseAction
 import com.kunzisoft.keepass.settings.PreferencesUtil
 import java.security.KeyStore
 import java.security.UnrecoverableKeyException
@@ -136,18 +140,24 @@ class AdvancedUnlockManager(private var retrieveContext: () -> FragmentActivity)
                         // and the constrains (purposes) in the constructor of the Builder
                         keyGenerator?.init(
                                 KeyGenParameterSpec.Builder(
-                                        ADVANCED_UNLOCK_KEYSTORE_KEY,
-                                        KeyProperties.PURPOSE_ENCRYPT or KeyProperties.PURPOSE_DECRYPT)
-                                        .setBlockModes(KeyProperties.BLOCK_MODE_CBC)
-                                        .setEncryptionPaddings(KeyProperties.ENCRYPTION_PADDING_PKCS7)
+                                    ADVANCED_UNLOCK_KEYSTORE_KEY,
+                                    KeyProperties.PURPOSE_ENCRYPT or KeyProperties.PURPOSE_DECRYPT)
+                                    .setBlockModes(KeyProperties.BLOCK_MODE_CBC)
+                                    .setEncryptionPaddings(KeyProperties.ENCRYPTION_PADDING_PKCS7)
+                                    .apply {
                                         // Require the user to authenticate with a fingerprint to authorize every use
                                         // of the key, don't use it for device credential because it's the user authentication
-                                        .apply {
-                                            if (biometricUnlockEnable) {
-                                                setUserAuthenticationRequired(true)
-                                            }
+                                        if (biometricUnlockEnable) {
+                                            setUserAuthenticationRequired(true)
                                         }
-                                        .build())
+                                        // To store in the security chip
+                                        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.P
+                                            && retrieveContext().packageManager.hasSystemFeature(
+                                                PackageManager.FEATURE_STRONGBOX_KEYSTORE)) {
+                                            setIsStrongBoxBacked(true)
+                                        }
+                                    }
+                                    .build())
                         keyGenerator?.generateKey()
                     }
                 } catch (e: Exception) {
@@ -164,8 +174,12 @@ class AdvancedUnlockManager(private var retrieveContext: () -> FragmentActivity)
         return null
     }
 
-    fun initEncryptData(actionIfCypherInit
-                        : (cryptoPrompt: AdvancedUnlockCryptoPrompt) -> Unit) {
+    fun initEncryptData(actionIfCypherInit: (cryptoPrompt: AdvancedUnlockCryptoPrompt) -> Unit,) {
+        initEncryptData(actionIfCypherInit, true)
+    }
+
+    private fun initEncryptData(actionIfCypherInit: (cryptoPrompt: AdvancedUnlockCryptoPrompt) -> Unit,
+                                firstLaunch: Boolean) {
         if (!isKeyManagerInitialized) {
             return
         }
@@ -185,10 +199,15 @@ class AdvancedUnlockManager(private var retrieveContext: () -> FragmentActivity)
             }
         } catch (unrecoverableKeyException: UnrecoverableKeyException) {
             Log.e(TAG, "Unable to initialize encrypt data", unrecoverableKeyException)
-            advancedUnlockCallback?.onInvalidKeyException(unrecoverableKeyException)
+            advancedUnlockCallback?.onUnrecoverableKeyException(unrecoverableKeyException)
         } catch (invalidKeyException: KeyPermanentlyInvalidatedException) {
             Log.e(TAG, "Unable to initialize encrypt data", invalidKeyException)
-            advancedUnlockCallback?.onInvalidKeyException(invalidKeyException)
+            if (firstLaunch) {
+                deleteAllEntryKeysInKeystoreForBiometric(retrieveContext())
+                initEncryptData(actionIfCypherInit, false)
+            } else {
+                advancedUnlockCallback?.onInvalidKeyException(invalidKeyException)
+            }
         } catch (e: Exception) {
             Log.e(TAG, "Unable to initialize encrypt data", e)
             advancedUnlockCallback?.onGenericException(e)
@@ -214,8 +233,14 @@ class AdvancedUnlockManager(private var retrieveContext: () -> FragmentActivity)
         }
     }
 
-    fun initDecryptData(ivSpecValue: String, actionIfCypherInit
-                        : (cryptoPrompt: AdvancedUnlockCryptoPrompt) -> Unit) {
+    fun initDecryptData(ivSpecValue: String,
+                        actionIfCypherInit: (cryptoPrompt: AdvancedUnlockCryptoPrompt) -> Unit) {
+        initDecryptData(ivSpecValue, actionIfCypherInit, true)
+    }
+
+    private fun initDecryptData(ivSpecValue: String,
+                        actionIfCypherInit: (cryptoPrompt: AdvancedUnlockCryptoPrompt) -> Unit,
+                        firstLaunch: Boolean = true) {
         if (!isKeyManagerInitialized) {
             return
         }
@@ -239,10 +264,20 @@ class AdvancedUnlockManager(private var retrieveContext: () -> FragmentActivity)
             }
         } catch (unrecoverableKeyException: UnrecoverableKeyException) {
             Log.e(TAG, "Unable to initialize decrypt data", unrecoverableKeyException)
-            deleteKeystoreKey()
+            if (firstLaunch) {
+                deleteKeystoreKey()
+                initDecryptData(ivSpecValue, actionIfCypherInit, firstLaunch)
+            } else {
+                advancedUnlockCallback?.onUnrecoverableKeyException(unrecoverableKeyException)
+            }
         } catch (invalidKeyException: KeyPermanentlyInvalidatedException) {
             Log.e(TAG, "Unable to initialize decrypt data", invalidKeyException)
-            advancedUnlockCallback?.onInvalidKeyException(invalidKeyException)
+            if (firstLaunch) {
+                deleteAllEntryKeysInKeystoreForBiometric(retrieveContext())
+                initDecryptData(ivSpecValue, actionIfCypherInit, firstLaunch)
+            } else {
+                advancedUnlockCallback?.onInvalidKeyException(invalidKeyException)
+            }
         } catch (e: Exception) {
             Log.e(TAG, "Unable to initialize decrypt data", e)
             advancedUnlockCallback?.onGenericException(e)
@@ -278,9 +313,9 @@ class AdvancedUnlockManager(private var retrieveContext: () -> FragmentActivity)
         }
     }
 
-    @Suppress("DEPRECATION")
-    @Synchronized
-    fun openAdvancedUnlockPrompt(cryptoPrompt: AdvancedUnlockCryptoPrompt) {
+    fun openAdvancedUnlockPrompt(cryptoPrompt: AdvancedUnlockCryptoPrompt,
+                                 deviceCredentialResultLauncher: ActivityResultLauncher<Intent>
+    ) {
         // Init advanced unlock prompt
         if (biometricPrompt == null) {
             biometricPrompt = BiometricPrompt(retrieveContext(),
@@ -311,20 +346,10 @@ class AdvancedUnlockManager(private var retrieveContext: () -> FragmentActivity)
         }
         else if (cryptoPrompt.isDeviceCredentialOperation) {
             val keyGuardManager = ContextCompat.getSystemService(retrieveContext(), KeyguardManager::class.java)
-            retrieveContext().startActivityForResult(
-                    keyGuardManager?.createConfirmDeviceCredentialIntent(promptTitle, promptDescription),
-                    REQUEST_DEVICE_CREDENTIAL)
-        }
-    }
-
-    @Synchronized
-    fun onActivityResult(requestCode: Int, resultCode: Int) {
-        if (requestCode == REQUEST_DEVICE_CREDENTIAL) {
-            if (resultCode == Activity.RESULT_OK) {
-                advancedUnlockCallback?.onAuthenticationSucceeded()
-            } else {
-                advancedUnlockCallback?.onAuthenticationFailed()
-            }
+            @Suppress("DEPRECATION")
+            deviceCredentialResultLauncher.launch(
+                keyGuardManager?.createConfirmDeviceCredentialIntent(promptTitle, promptDescription)
+            )
         }
     }
 
@@ -333,6 +358,7 @@ class AdvancedUnlockManager(private var retrieveContext: () -> FragmentActivity)
     }
 
     interface AdvancedUnlockErrorCallback {
+        fun onUnrecoverableKeyException(e: Exception)
         fun onInvalidKeyException(e: Exception)
         fun onGenericException(e: Exception)
     }
@@ -355,8 +381,6 @@ class AdvancedUnlockManager(private var retrieveContext: () -> FragmentActivity)
         private const val ADVANCED_UNLOCK_BLOCKS_MODES = KeyProperties.BLOCK_MODE_CBC
         private const val ADVANCED_UNLOCK_ENCRYPTION_PADDING = KeyProperties.ENCRYPTION_PADDING_PKCS7
 
-        private const val REQUEST_DEVICE_CREDENTIAL = 556
-
         @RequiresApi(api = Build.VERSION_CODES.M)
         fun canAuthenticate(context: Context): Int {
             return try {
@@ -449,6 +473,10 @@ class AdvancedUnlockManager(private var retrieveContext: () -> FragmentActivity)
 
                     override fun handleDecryptedResult(decryptedValue: String) {}
 
+                    override fun onUnrecoverableKeyException(e: Exception) {
+                        advancedCallback.onUnrecoverableKeyException(e)
+                    }
+
                     override fun onInvalidKeyException(e: Exception) {
                         advancedCallback.onInvalidKeyException(e)
                     }
@@ -460,6 +488,33 @@ class AdvancedUnlockManager(private var retrieveContext: () -> FragmentActivity)
                 deleteKeystoreKey()
             }
         }
+
+        fun deleteAllEntryKeysInKeystoreForBiometric(activity: FragmentActivity) {
+            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+                deleteEntryKeyInKeystoreForBiometric(
+                    activity,
+                    object : AdvancedUnlockErrorCallback {
+                        fun showException(e: Exception) {
+                            Toast.makeText(activity,
+                                activity.getString(R.string.advanced_unlock_scanning_error, e.localizedMessage),
+                                Toast.LENGTH_SHORT).show()
+                        }
+
+                        override fun onUnrecoverableKeyException(e: Exception) {
+                            showException(e)
+                        }
+
+                        override fun onInvalidKeyException(e: Exception) {
+                            showException(e)
+                        }
+
+                        override fun onGenericException(e: Exception) {
+                            showException(e)
+                        }
+                    })
+            }
+            CipherDatabaseAction.getInstance(activity.applicationContext).deleteAll()
+        }
     }
 
 }

app/src/main/java/com/kunzisoft/keepass/database/action/node/ActionNodeDatabaseRunnable.kt

@@ -36,7 +36,11 @@ abstract class ActionNodeDatabaseRunnable(
     abstract fun nodeAction()
 
     override fun onStartRun() {
-        nodeAction()
+        try {
+            nodeAction()
+        } catch (e: Exception) {
+            setError(e)
+        }
         super.onStartRun()
     }
 

app/src/main/java/com/kunzisoft/keepass/database/action/node/UpdateGroupRunnable.kt

@@ -42,6 +42,9 @@ class UpdateGroupRunnable constructor(
             // Update group with new values
             mNewGroup.touch(modified = true, touchParents = true)
 
+            if (database.rootGroup == mOldGroup) {
+                database.rootGroup = mNewGroup
+            }
             // Only change data in index
             database.updateGroup(mNewGroup)
         }
@@ -50,6 +53,9 @@ class UpdateGroupRunnable constructor(
     override fun nodeFinish(): ActionNodesValues {
         if (!result.isSuccess) {
             // If we fail to save, back out changes to global structure
+            if (database.rootGroup == mNewGroup) {
+                database.rootGroup = mOldGroup
+            }
             database.updateGroup(mOldGroup)
         }
 

app/src/main/java/com/kunzisoft/keepass/database/crypto/kdf/Argon2Kdf.kt

@@ -192,17 +192,17 @@ class Argon2Kdf(private val type: Type) : KdfEngine() {
         private val MIN_VERSION = UnsignedInt(0x10)
         private val MAX_VERSION = UnsignedInt(0x13)
 
-        private val DEFAULT_ITERATIONS = UnsignedLong(2L)
+        private val DEFAULT_ITERATIONS = UnsignedLong(3L)
         private val MIN_ITERATIONS = UnsignedLong(1L)
         private val MAX_ITERATIONS = UnsignedLong(4294967295L)
 
-        private val DEFAULT_MEMORY = UnsignedLong((1024L * 1024L))
+        private val DEFAULT_MEMORY = UnsignedLong((1024L * 1024L * 16L))
         private val MIN_MEMORY = UnsignedLong(1024L * 8L)
         private val MAX_MEMORY = UnsignedInt.MAX_VALUE.toKotlinLong()
         private const val MEMORY_BLOCK_SIZE: Long = 1024L
 
-        private val DEFAULT_PARALLELISM = UnsignedInt(2)
+        private val DEFAULT_PARALLELISM = UnsignedInt(4)
         private val MIN_PARALLELISM = UnsignedInt.fromKotlinLong(1L)
-        private val MAX_PARALLELISM = UnsignedInt.fromKotlinLong(((1 shl 24) - 1))
+        private val MAX_PARALLELISM = UnsignedInt.fromKotlinLong(((1 shl 24) - 1).toLong())
     }
 }

app/src/main/java/com/kunzisoft/keepass/database/cursor/EntryCursor.kt

@@ -68,7 +68,7 @@ abstract class EntryCursor<EntryId, PwEntryV : EntryVersioned<*, EntryId, *, *>>
         pwEntry.notes = getString(getColumnIndex(COLUMN_INDEX_NOTES))
         pwEntry.expiryTime = DateInstant(getString(getColumnIndex(COLUMN_INDEX_EXPIRY_TIME)))
         pwEntry.expires = getString(getColumnIndex(COLUMN_INDEX_EXPIRES))
-                                        .toLowerCase(Locale.ENGLISH) != "false"
+                                        .lowercase(Locale.ENGLISH) != "false"
     }
 
     companion object {

app/src/main/java/com/kunzisoft/keepass/database/element/Database.kt

@@ -22,10 +22,10 @@ package com.kunzisoft.keepass.database.element
 import android.content.ContentResolver
 import android.content.Context
 import android.content.res.Resources
+import android.graphics.Color
 import android.net.Uri
-import android.os.Build
 import android.util.Log
-import com.kunzisoft.keepass.app.database.FileDatabaseHistoryAction
+import com.kunzisoft.androidclearchroma.ChromaUtil
 import com.kunzisoft.keepass.database.action.node.NodeHandler
 import com.kunzisoft.keepass.database.crypto.EncryptionAlgorithm
 import com.kunzisoft.keepass.database.crypto.kdf.KdfEngine
@@ -147,6 +147,10 @@ class Database {
         iconsManager.removeCustomIcon(binaryCache, customIcon.uuid)
     }
 
+    fun updateCustomIcon(customIcon: IconImageCustom) {
+        iconsManager.getIcon(customIcon.uuid).updateWith(customIcon)
+    }
+
     fun getTemplates(templateCreation: Boolean): List<Template> {
         return mDatabaseKDBX?.getTemplates(templateCreation) ?: listOf()
     }
@@ -222,31 +226,33 @@ class Database {
             mDatabaseKDBX?.descriptionChanged = DateInstant()
         }
 
-    val allowDefaultUsername: Boolean
-        get() = mDatabaseKDBX != null
-        // TODO get() = mDatabaseKDB != null || mDatabaseKDBX != null
-
     var defaultUsername: String
         get() {
-            return mDatabaseKDBX?.defaultUserName ?: "" // TODO mDatabaseKDB default username
+            return mDatabaseKDB?.defaultUserName ?: mDatabaseKDBX?.defaultUserName ?: ""
         }
         set(username) {
+            mDatabaseKDB?.defaultUserName = username
             mDatabaseKDBX?.defaultUserName = username
             mDatabaseKDBX?.defaultUserNameChanged = DateInstant()
         }
 
-    val allowCustomColor: Boolean
-        get() = mDatabaseKDBX != null
-        // TODO get() = mDatabaseKDB != null || mDatabaseKDBX != null
-
-    // with format "#000000"
-    var customColor: String
+    var customColor: Int?
         get() {
-            return mDatabaseKDBX?.color ?: "" // TODO mDatabaseKDB color
+            var colorInt: Int? = null
+            mDatabaseKDBX?.color?.let {
+                try {
+                    colorInt = Color.parseColor(it)
+                } catch (e: Exception) {}
+            }
+            return mDatabaseKDB?.color ?: colorInt
         }
         set(value) {
-            // TODO Check color string
-            mDatabaseKDBX?.color = value
+            mDatabaseKDB?.color = value
+            mDatabaseKDBX?.color = if (value == null) {
+                ""
+            } else {
+                ChromaUtil.getFormattedColorString(value, false)
+            }
         }
 
     val allowOTP: Boolean
@@ -360,7 +366,7 @@ class Database {
             mDatabaseKDBX?.masterKey = masterKey
         }
 
-    val rootGroup: Group?
+    var rootGroup: Group?
         get() {
             mDatabaseKDB?.rootGroup?.let {
                 return Group(it)
@@ -370,6 +376,25 @@ class Database {
             }
             return null
         }
+        set(value) {
+            value?.groupKDB?.let { rootKDB ->
+                mDatabaseKDB?.rootGroup = rootKDB
+            }
+            value?.groupKDBX?.let { rootKDBX ->
+                mDatabaseKDBX?.rootGroup = rootKDBX
+            }
+        }
+
+    val rootGroupIsVirtual: Boolean
+        get() {
+            mDatabaseKDB?.let {
+                return true
+            }
+            mDatabaseKDBX?.let {
+                return false
+            }
+            return true
+        }
 
     /**
      * Do not modify groups here, used for read only

app/src/main/java/com/kunzisoft/keepass/database/element/Entry.kt

@@ -19,8 +19,10 @@
  */
 package com.kunzisoft.keepass.database.element
 
+import android.graphics.Color
 import android.os.Parcel
 import android.os.Parcelable
+import com.kunzisoft.androidclearchroma.ChromaUtil
 import com.kunzisoft.keepass.database.element.binary.AttachmentPool
 import com.kunzisoft.keepass.database.element.database.DatabaseKDBX
 import com.kunzisoft.keepass.database.element.database.DatabaseVersioned
@@ -238,6 +240,42 @@ class Entry : Node, EntryVersionedInterface<Group> {
             entryKDBX?.notes = value
         }
 
+    var backgroundColor: Int?
+        get() {
+            var colorInt: Int? = null
+            entryKDBX?.backgroundColor?.let {
+                try {
+                    colorInt = Color.parseColor(it)
+                } catch (e: Exception) {}
+            }
+            return colorInt
+        }
+        set(value) {
+            entryKDBX?.backgroundColor = if (value == null) {
+                ""
+            } else {
+                ChromaUtil.getFormattedColorString(value, false)
+            }
+        }
+
+    var foregroundColor: Int?
+        get() {
+            var colorInt: Int? = null
+            entryKDBX?.foregroundColor?.let {
+                try {
+                    colorInt = Color.parseColor(it)
+                } catch (e: Exception) {}
+            }
+            return colorInt
+        }
+        set(value) {
+            entryKDBX?.foregroundColor = if (value == null) {
+                ""
+            } else {
+                ChromaUtil.getFormattedColorString(value, false)
+            }
+        }
+
     private fun isTan(): Boolean {
         return title == PMS_TAN_ENTRY && username.isNotEmpty()
     }
@@ -419,6 +457,8 @@ class Entry : Node, EntryVersionedInterface<Group> {
             entryInfo.expiryTime = expiryTime
             entryInfo.url = url
             entryInfo.notes = notes
+            entryInfo.backgroundColor = backgroundColor
+            entryInfo.foregroundColor = foregroundColor
             entryInfo.customFields = getExtraFields().toMutableList()
             // Add otpElement to generate token
             entryInfo.otpModel = getOtpElement()?.otpModel
@@ -453,6 +493,8 @@ class Entry : Node, EntryVersionedInterface<Group> {
         expiryTime = newEntryInfo.expiryTime
         url = newEntryInfo.url
         notes = newEntryInfo.notes
+        backgroundColor = newEntryInfo.backgroundColor
+        foregroundColor = newEntryInfo.foregroundColor
         addExtraFields(newEntryInfo.customFields)
         database?.attachmentPool?.let { binaryPool ->
             newEntryInfo.attachments.forEach { attachment ->

app/src/main/java/com/kunzisoft/keepass/database/element/Group.kt

@@ -31,6 +31,7 @@ import com.kunzisoft.keepass.database.element.node.*
 import com.kunzisoft.keepass.model.EntryInfo
 import com.kunzisoft.keepass.model.GroupInfo
 import com.kunzisoft.keepass.settings.PreferencesUtil
+import com.kunzisoft.keepass.utils.UuidUtil
 import java.util.*
 import kotlin.collections.ArrayList
 
@@ -177,16 +178,20 @@ class Group : Node, GroupVersionedInterface<Group, Entry> {
     fun addChildrenFrom(group: Group) {
         group.groupKDB?.getChildEntries()?.forEach { entryToAdd ->
             groupKDB?.addChildEntry(entryToAdd)
+            entryToAdd.parent = groupKDB
         }
         group.groupKDB?.getChildGroups()?.forEach { groupToAdd ->
             groupKDB?.addChildGroup(groupToAdd)
+            groupToAdd.parent = groupKDB
         }
 
         group.groupKDBX?.getChildEntries()?.forEach { entryToAdd ->
             groupKDBX?.addChildEntry(entryToAdd)
+            entryToAdd.parent = groupKDBX
         }
         group.groupKDBX?.getChildGroups()?.forEach { groupToAdd ->
             groupKDBX?.addChildGroup(groupToAdd)
+            groupToAdd.parent = groupKDBX
         }
     }
 
@@ -304,8 +309,9 @@ class Group : Node, GroupVersionedInterface<Group, Entry> {
         val withoutMetaStream = filters.contains(ChildFilter.META_STREAM)
         val showExpiredEntries = !filters.contains(ChildFilter.EXPIRED)
 
+        // TODO Change KDB parser to remove meta entries
         return groupKDB?.getChildEntries()?.filter {
-            (!withoutMetaStream || (withoutMetaStream && !it.isMetaStream))
+            (!withoutMetaStream || (withoutMetaStream && !it.isMetaStream()))
                     && (!it.isCurrentlyExpires or showExpiredEntries)
         }?.map {
             Entry(it)
@@ -449,6 +455,7 @@ class Group : Node, GroupVersionedInterface<Group, Entry> {
 
     fun getGroupInfo(): GroupInfo {
         val groupInfo = GroupInfo()
+        groupInfo.id = groupKDBX?.nodeId?.id
         groupInfo.title = title
         groupInfo.icon = icon
         groupInfo.creationTime = creationTime

app/src/main/java/com/kunzisoft/keepass/database/element/binary/CustomIconPool.kt

@@ -31,6 +31,10 @@ class CustomIconPool(private val binaryCache: BinaryCache) : BinaryPool<UUID>(bi
         return newUUID
     }
 
+    fun getCustomIcon(key: UUID): IconImageCustom? {
+        return customIcons[key]
+    }
+
     fun any(predicate: (IconImageCustom)-> Boolean): Boolean {
         return customIcons.any { predicate(it.value) }
     }

app/src/main/java/com/kunzisoft/keepass/database/element/database/DatabaseKDB.kt

@@ -41,18 +41,16 @@ class DatabaseKDB : DatabaseVersioned<Int, UUID, GroupKDB, EntryKDB>() {
     private var kdfListV3: MutableList<KdfEngine> = ArrayList()
 
     override val version: String
-        get() = "KeePass 1"
+        get() = "V1"
 
     init {
+        // New manual root because KDB contains multiple root groups (here available with getRootGroups())
+        rootGroup = createGroup().apply {
+            icon.standard = getStandardIcon(IconImageStandard.DATABASE_ID)
+        }
         kdfListV3.add(KdfFactory.aesKdf)
     }
 
-    private fun getGroupById(groupId: Int): GroupKDB? {
-        if (groupId == -1)
-            return null
-        return getGroupById(NodeIdInt(groupId))
-    }
-
     val backupGroup: GroupKDB?
         get() {
             return retrieveBackup()
@@ -63,6 +61,10 @@ class DatabaseKDB : DatabaseVersioned<Int, UUID, GroupKDB, EntryKDB>() {
             return listOf(BACKUP_FOLDER_TITLE)
         }
 
+    var defaultUserName: String = ""
+
+    var color: Int? = null
+
     override val kdfEngine: KdfEngine
         get() = kdfListV3[0]
 
@@ -77,11 +79,6 @@ class DatabaseKDB : DatabaseVersioned<Int, UUID, GroupKDB, EntryKDB>() {
             return list
         }
 
-    val rootGroups: List<GroupKDB>
-        get() {
-            return rootGroup?.getChildGroups() ?: ArrayList()
-        }
-
     override val passwordEncoding: String
         get() = "ISO-8859-1"
 

app/src/main/java/com/kunzisoft/keepass/database/element/database/DatabaseKDBX.kt

@@ -156,7 +156,7 @@ class DatabaseKDBX : DatabaseVersioned<UUID, UUID, GroupKDBX, EntryKDBX> {
                 FILE_VERSION_41 -> "4.1"
                 else -> "UNKNOWN"
             }
-            return "KeePass 2 - KDBX$kdbxStringVersion"
+            return "V2 - KDBX$kdbxStringVersion"
         }
 
     override val kdfEngine: KdfEngine?
@@ -414,37 +414,37 @@ class DatabaseKDBX : DatabaseVersioned<UUID, UUID, GroupKDBX, EntryKDBX> {
     }
 
     fun getEntryByTitle(title: String, recursionLevel: Int): EntryKDBX? {
-        return this.entryIndexes.values.find { entry ->
+        return findEntry { entry ->
             entry.decodeTitleKey(recursionLevel).equals(title, true)
         }
     }
 
     fun getEntryByUsername(username: String, recursionLevel: Int): EntryKDBX? {
-        return this.entryIndexes.values.find { entry ->
+        return findEntry { entry ->
             entry.decodeUsernameKey(recursionLevel).equals(username, true)
         }
     }
 
     fun getEntryByURL(url: String, recursionLevel: Int): EntryKDBX? {
-        return this.entryIndexes.values.find { entry ->
+        return findEntry { entry ->
             entry.decodeUrlKey(recursionLevel).equals(url, true)
         }
     }
 
     fun getEntryByPassword(password: String, recursionLevel: Int): EntryKDBX? {
-        return this.entryIndexes.values.find { entry ->
+        return findEntry { entry ->
             entry.decodePasswordKey(recursionLevel).equals(password, true)
         }
     }
 
     fun getEntryByNotes(notes: String, recursionLevel: Int): EntryKDBX? {
-        return this.entryIndexes.values.find { entry ->
+        return findEntry { entry ->
             entry.decodeNotesKey(recursionLevel).equals(notes, true)
         }
     }
 
     fun getEntryByCustomData(customDataValue: String): EntryKDBX? {
-        return entryIndexes.values.find { entry ->
+        return findEntry { entry ->
             entry.customData.containsItemWithValue(customDataValue)
         }
     }

app/src/main/java/com/kunzisoft/keepass/database/element/database/DatabaseVersioned.kt

@@ -67,7 +67,7 @@ abstract class DatabaseVersioned<
     var changeDuplicateId = false
 
     private var groupIndexes = LinkedHashMap<NodeId<GroupId>, Group>()
-    protected var entryIndexes = LinkedHashMap<NodeId<EntryId>, Entry>()
+    private var entryIndexes = LinkedHashMap<NodeId<EntryId>, Entry>()
 
     abstract val version: String
 
@@ -89,6 +89,7 @@ abstract class DatabaseVersioned<
         set(value) {
             field = value
             value?.let {
+                removeGroupIndex(it)
                 addGroupIndex(it)
             }
         }
@@ -124,25 +125,29 @@ abstract class DatabaseVersioned<
 
     @Throws(IOException::class)
     protected fun getFileKey(keyInputStream: InputStream): ByteArray {
-        val keyData = keyInputStream.readBytes()
+        try {
+            val keyData = keyInputStream.readBytes()
 
-        // Check XML key file
-        val xmlKeyByteArray = loadXmlKeyFile(ByteArrayInputStream(keyData))
-        if (xmlKeyByteArray != null) {
-            return xmlKeyByteArray
-        }
-
-        // Check 32 bytes key file
-        when (keyData.size) {
-            32 -> return keyData
-            64 -> try {
-                return Hex.decodeHex(String(keyData).toCharArray())
-            } catch (ignoredException: Exception) {
-                // Key is not base 64, treat it as binary data
+            // Check XML key file
+            val xmlKeyByteArray = loadXmlKeyFile(ByteArrayInputStream(keyData))
+            if (xmlKeyByteArray != null) {
+                return xmlKeyByteArray
             }
+
+            // Check 32 bytes key file
+            when (keyData.size) {
+                32 -> return keyData
+                64 -> try {
+                    return Hex.decodeHex(String(keyData).toCharArray())
+                } catch (ignoredException: Exception) {
+                    // Key is not base 64, treat it as binary data
+                }
+            }
+            // Hash file as binary data
+            return HashManager.hashSha256(keyData)
+        } catch (outOfMemoryError: OutOfMemoryError) {
+            throw IOException("Keyfile data is too large", outOfMemoryError)
         }
-        // Hash file as binary data
-        return HashManager.hashSha256(keyData)
     }
 
     protected open fun loadXmlKeyFile(keyInputStream: InputStream): ByteArray? {
@@ -194,12 +199,6 @@ abstract class DatabaseVersioned<
      * -------------------------------------
      */
 
-    fun doForEachGroupInIndex(action: (Group) -> Unit) {
-        for (group in groupIndexes) {
-            action.invoke(group.value)
-        }
-    }
-
     /**
      * Determine if an id number is already in use
      *
@@ -215,14 +214,7 @@ abstract class DatabaseVersioned<
         return groupIndexes.values
     }
 
-    fun setGroupIndexes(groupList: List<Group>) {
-        this.groupIndexes.clear()
-        for (currentGroup in groupList) {
-            this.groupIndexes[currentGroup.nodeId] = currentGroup
-        }
-    }
-
-    fun getGroupById(id: NodeId<GroupId>): Group? {
+    open fun getGroupById(id: NodeId<GroupId>): Group? {
         return this.groupIndexes[id]
     }
 
@@ -246,16 +238,6 @@ abstract class DatabaseVersioned<
         this.groupIndexes.remove(group.nodeId)
     }
 
-    fun numberOfGroups(): Int {
-        return groupIndexes.size
-    }
-
-    fun doForEachEntryInIndex(action: (Entry) -> Unit) {
-        for (entry in entryIndexes) {
-            action.invoke(entry.value)
-        }
-    }
-
     fun isEntryIdUsed(id: NodeId<EntryId>): Boolean {
         return entryIndexes.containsKey(id)
     }
@@ -268,6 +250,10 @@ abstract class DatabaseVersioned<
         return this.entryIndexes[id]
     }
 
+    fun findEntry(predicate: (Entry) -> Boolean): Entry? {
+        return this.entryIndexes.values.find(predicate)
+    }
+
     fun addEntryIndex(entry: Entry) {
         val entryId = entry.nodeId
         if (entryIndexes.containsKey(entryId)) {
@@ -288,10 +274,6 @@ abstract class DatabaseVersioned<
         this.entryIndexes.remove(entry.nodeId)
     }
 
-    fun numberOfEntries(): Int {
-        return entryIndexes.size
-    }
-
     open fun clearCache() {
         this.groupIndexes.clear()
         this.entryIndexes.clear()

app/src/main/java/com/kunzisoft/keepass/database/element/entry/EntryKDB.kt

@@ -25,6 +25,7 @@ import com.kunzisoft.keepass.database.element.Attachment
 import com.kunzisoft.keepass.database.element.binary.AttachmentPool
 import com.kunzisoft.keepass.database.element.binary.BinaryData
 import com.kunzisoft.keepass.database.element.group.GroupKDB
+import com.kunzisoft.keepass.database.element.icon.IconImageStandard
 import com.kunzisoft.keepass.database.element.icon.IconImageStandard.Companion.KEY_ID
 import com.kunzisoft.keepass.database.element.node.NodeId
 import com.kunzisoft.keepass.database.element.node.NodeIdUUID
@@ -60,18 +61,43 @@ class EntryKDB : EntryVersioned<Int, UUID, GroupKDB, EntryKDB>, NodeKDBInterface
     private var binaryDataId: Int? = null
 
     // Determine if this is a MetaStream entry
-    val isMetaStream: Boolean
-        get() {
-            if (notes.isEmpty()) return false
-            if (binaryDescription != PMS_ID_BINDESC) return false
-            if (title.isEmpty()) return false
-            if (title != PMS_ID_TITLE) return false
-            if (username.isEmpty()) return false
-            if (username != PMS_ID_USER) return false
-            if (url.isEmpty()) return false
-            if (url != PMS_ID_URL) return false
-            return icon.standard.id == KEY_ID
-        }
+    fun isMetaStream(): Boolean {
+        if (notes.isEmpty()) return false
+        if (binaryDescription != PMS_ID_BINDESC) return false
+        if (title.isEmpty()) return false
+        if (title != PMS_ID_TITLE) return false
+        if (username.isEmpty()) return false
+        if (username != PMS_ID_USER) return false
+        if (url.isEmpty()) return false
+        if (url != PMS_ID_URL) return false
+        return icon.standard.id == KEY_ID
+    }
+
+    fun isMetaStreamDefaultUsername(): Boolean {
+        return isMetaStream() && notes == PMS_STREAM_DEFAULTUSER
+    }
+
+    private fun setMetaStream() {
+        binaryDescription = PMS_ID_BINDESC
+        title = PMS_ID_TITLE
+        username = PMS_ID_USER
+        url = PMS_ID_URL
+        icon.standard = IconImageStandard(KEY_ID)
+    }
+
+    fun setMetaStreamDefaultUsername() {
+        notes = PMS_STREAM_DEFAULTUSER
+        setMetaStream()
+    }
+
+    fun isMetaStreamDatabaseColor(): Boolean {
+        return isMetaStream() && notes == PMS_STREAM_DBCOLOR
+    }
+
+    fun setMetaStreamDatabaseColor() {
+        notes = PMS_STREAM_DBCOLOR
+        setMetaStream()
+    }
 
     override fun initNodeId(): NodeId<UUID> {
         return NodeIdUUID()
@@ -184,6 +210,13 @@ class EntryKDB : EntryVersioned<Int, UUID, GroupKDB, EntryKDB>, NodeKDBInterface
         private const val PMS_ID_USER = "SYSTEM"
         private const val PMS_ID_URL = "$"
 
+         const val PMS_STREAM_SIMPLESTATE = "Simple UI State"
+         const val PMS_STREAM_DEFAULTUSER = "Default User Name"
+         const val PMS_STREAM_SEARCHHISTORYITEM = "Search History Item"
+         const val PMS_STREAM_CUSTOMKVP = "Custom KVP"
+         const val PMS_STREAM_DBCOLOR = "Database Color"
+         const val PMS_STREAM_KPXICON2 = "KPX_CUSTOM_ICONS_2"
+
         @JvmField
         val CREATOR: Parcelable.Creator<EntryKDB> = object : Parcelable.Creator<EntryKDB> {
             override fun createFromParcel(parcel: Parcel): EntryKDB {

app/src/main/java/com/kunzisoft/keepass/database/element/icon/IconImageCustom.kt

@@ -32,6 +32,16 @@ class IconImageCustom : IconImageDraw {
     var name: String = ""
     var lastModificationTime: DateInstant? = null
 
+    fun updateWith(icon: IconImageCustom) {
+        this.name = icon.name
+        this.lastModificationTime = icon.lastModificationTime
+    }
+
+    constructor(copy: IconImageCustom) {
+        this.uuid = copy.uuid
+        updateWith(copy)
+    }
+
     constructor(name: String = "", lastModificationTime: DateInstant? = null) {
         this.uuid = DatabaseVersioned.UUID_ZERO
         this.name = name

app/src/main/java/com/kunzisoft/keepass/database/element/icon/IconImageStandard.kt

@@ -81,6 +81,7 @@ class IconImageStandard : IconImageDraw {
         const val CREDIT_CARD_ID = 37
         const val TRASH_ID = 43
         const val FOLDER_ID = 48
+        const val DATABASE_ID = 50
         const val LIST_ID = 57
         const val BUILD_ID = 59
         const val STAR_ID = 61

app/src/main/java/com/kunzisoft/keepass/database/element/icon/IconsManager.kt

@@ -65,7 +65,7 @@ class IconsManager(binaryCache: BinaryCache) {
     }
 
     fun getIcon(iconUuid: UUID): IconImageCustom {
-        return IconImageCustom(iconUuid)
+        return customCache.getCustomIcon(iconUuid) ?: IconImageCustom(iconUuid)
     }
 
     fun isCustomIconBinaryDuplicate(binaryData: BinaryData): Boolean {

app/src/main/java/com/kunzisoft/keepass/database/element/node/Node.kt

@@ -32,6 +32,19 @@ interface Node: NodeVersionedInterface<Group> {
     fun removeParent() {
         parent = null
     }
+
+    fun getPathString(): String {
+        val pathNodes = mutableListOf<Node>()
+        var currentNode = this
+        pathNodes.add(0, currentNode)
+        while (currentNode.containsParent()) {
+            currentNode.parent?.let { parent ->
+                currentNode = parent
+                pathNodes.add(0, currentNode)
+            }
+        }
+        return pathNodes.joinToString("/") { it.title }
+    }
 }
 
 /**

app/src/main/java/com/kunzisoft/keepass/database/element/node/NodeId.kt

@@ -44,4 +44,6 @@ abstract class NodeId<Id> : Parcelable {
     override fun hashCode(): Int {
         return id?.hashCode() ?: 0
     }
+
+    abstract fun toVisualString(): String?
 }

app/src/main/java/com/kunzisoft/keepass/database/element/node/NodeIdInt.kt

@@ -63,6 +63,10 @@ class NodeIdInt : NodeId<Int> {
         return id.toString()
     }
 
+    override fun toVisualString(): String? {
+        return null
+    }
+
     companion object {
         @JvmField
         val CREATOR: Parcelable.Creator<NodeIdInt> = object : Parcelable.Creator<NodeIdInt> {

app/src/main/java/com/kunzisoft/keepass/database/element/node/NodeIdUUID.kt

@@ -64,6 +64,10 @@ class NodeIdUUID : NodeId<UUID> {
         return UuidUtil.toHexString(id) ?: id.toString()
     }
 
+    override fun toVisualString(): String {
+        return toString()
+    }
+
     companion object {
         @JvmField
         val CREATOR: Parcelable.Creator<NodeIdUUID> = object : Parcelable.Creator<NodeIdUUID> {

app/src/main/java/com/kunzisoft/keepass/database/element/template/TemplateEngineCompatible.kt

@@ -208,16 +208,8 @@ class TemplateEngineCompatible(database: DatabaseKDBX): TemplateEngine(database)
                 when (attribute.type) {
                     TemplateAttributeType.TEXT -> {
                         try {
-                            when (attribute.options.getNumberLines()) {
-                                1 -> {
-                                    // If one line, default attribute option is number of chars
-                                    attribute.options.setNumberChars(defaultOption.toInt())
-                                }
-                                else -> {
-                                    // else it's number of lines
-                                    attribute.options.setNumberLines(defaultOption.toInt())
-                                }
-                            }
+                            // It's always a number of lines...
+                            attribute.options.setNumberLines(defaultOption.toInt())
                         } catch (e: Exception) {
                             Log.e(TAG, "Unable to transform default text option", e)
                         }

app/src/main/java/com/kunzisoft/keepass/database/element/template/TemplateField.kt

@@ -27,7 +27,7 @@ object TemplateField {
     const val LABEL_DATE_OF_ISSUE = "Date of issue"
     const val LABEL_EMAIL = "Email"
     const val LABEL_EMAIL_ADDRESS = "Email address"
-    const val LABEL_WIRELESS = "Wifi"
+    const val LABEL_WIRELESS = "Wi-Fi"
     const val LABEL_SSID = "SSID"
     const val LABEL_TYPE = "Type"
     const val LABEL_CRYPTOCURRENCY = "Cryptocurrency wallet"

app/src/main/java/com/kunzisoft/keepass/database/file/DatabaseHeader.kt

@@ -19,8 +19,6 @@
  */
 package com.kunzisoft.keepass.database.file
 
-import com.kunzisoft.keepass.utils.UnsignedInt
-
 abstract class DatabaseHeader {
 
     /**
@@ -33,8 +31,4 @@ abstract class DatabaseHeader {
      */
     var encryptionIV = ByteArray(16)
 
-    companion object {
-        val PWM_DBSIG_1 = UnsignedInt(-0x655d26fd)
-    }
-
 }

app/src/main/java/com/kunzisoft/keepass/database/file/DatabaseHeaderKDB.kt

@@ -34,7 +34,7 @@ class DatabaseHeaderKDB : DatabaseHeader() {
      */
     var transformSeed = ByteArray(32)
 
-    var signature1 = UnsignedInt(0)                  // = PWM_DBSIG_1
+    var signature1 = UnsignedInt(0)                  // = DBSIG_1
     var signature2 = UnsignedInt(0)                  // = DBSIG_2
     var flags= UnsignedInt(0)
     var version= UnsignedInt(0)
@@ -84,9 +84,9 @@ class DatabaseHeaderKDB : DatabaseHeader() {
     companion object {
 
         // DB sig from KeePass 1.03
-        val DBSIG_2 = UnsignedInt(-0x4ab4049b)
-        // DB sig from KeePass 1.03
-        val DBVER_DW = UnsignedInt(0x00030003)
+        val DBSIG_1 = UnsignedInt(-0x655d26fd) // 0x9AA2D903
+        val DBSIG_2 = UnsignedInt(-0x4ab4049b) // 0xB54BFB65
+        val DBVER_DW = UnsignedInt(0x00030004)
 
         val FLAG_SHA2 = UnsignedInt(1)
         val FLAG_RIJNDAEL = UnsignedInt(2)
@@ -97,7 +97,7 @@ class DatabaseHeaderKDB : DatabaseHeader() {
         const val BUF_SIZE = 124
 
         fun matchesHeader(sig1: UnsignedInt, sig2: UnsignedInt): Boolean {
-            return sig1.toKotlinInt() == PWM_DBSIG_1.toKotlinInt() && sig2.toKotlinInt() == DBSIG_2.toKotlinInt()
+            return sig1.toKotlinInt() == DBSIG_1.toKotlinInt() && sig2.toKotlinInt() == DBSIG_2.toKotlinInt()
         }
 
         fun compatibleHeaders(one: UnsignedInt, two: UnsignedInt): Boolean {

app/src/main/java/com/kunzisoft/keepass/database/file/DatabaseHeaderKDBX.kt

@@ -311,8 +311,9 @@ class DatabaseHeaderKDBX(private val databaseV4: DatabaseKDBX) : DatabaseHeader(
 
     companion object {
 
-        val DBSIG_PRE2 = UnsignedInt(-0x4ab4049a)
-        val DBSIG_2 = UnsignedInt(-0x4ab40499)
+        val DBSIG_1 = UnsignedInt(-0x655d26fd) // 0x9AA2D903
+        val DBSIG_PRE2 = UnsignedInt(-0x4ab4049a) // 0xB54BFB66
+        val DBSIG_2 = UnsignedInt(-0x4ab40499) // 0xB54BFB67
 
         private val FILE_VERSION_CRITICAL_MASK = UnsignedInt(-0x10000)
         val FILE_VERSION_31 = UnsignedInt(0x00030001)
@@ -335,7 +336,7 @@ class DatabaseHeaderKDBX(private val databaseV4: DatabaseKDBX) : DatabaseHeader(
         }
 
         fun matchesHeader(sig1: UnsignedInt, sig2: UnsignedInt): Boolean {
-            return sig1 == PWM_DBSIG_1 && (sig2 == DBSIG_PRE2 || sig2 == DBSIG_2)
+            return sig1 == DBSIG_1 && (sig2 == DBSIG_PRE2 || sig2 == DBSIG_2)
         }
     }
 }

app/src/main/java/com/kunzisoft/keepass/database/file/input/DatabaseInputKDB.kt

@@ -20,6 +20,7 @@
 
 package com.kunzisoft.keepass.database.file.input
 
+import android.graphics.Color
 import com.kunzisoft.encrypt.HashManager
 import com.kunzisoft.keepass.database.crypto.EncryptionAlgorithm
 import com.kunzisoft.keepass.database.element.DateInstant
@@ -30,7 +31,6 @@ import com.kunzisoft.keepass.database.element.group.GroupKDB
 import com.kunzisoft.keepass.database.element.node.NodeIdInt
 import com.kunzisoft.keepass.database.element.node.NodeIdUUID
 import com.kunzisoft.keepass.database.exception.*
-import com.kunzisoft.keepass.database.file.DatabaseHeader
 import com.kunzisoft.keepass.database.file.DatabaseHeaderKDB
 import com.kunzisoft.keepass.tasks.ProgressTaskUpdater
 import com.kunzisoft.keepass.utils.*
@@ -98,7 +98,7 @@ class DatabaseInputKDB(cacheDirectory: File,
             if (fileSize != (contentSize + DatabaseHeaderKDB.BUF_SIZE))
                 throw IOException("Header corrupted")
 
-            if (header.signature1 != DatabaseHeader.PWM_DBSIG_1
+            if (header.signature1 != DatabaseHeaderKDB.DBSIG_1
                     || header.signature2 != DatabaseHeaderKDB.DBSIG_2) {
                 throw SignatureDatabaseException()
             }
@@ -153,10 +153,6 @@ class DatabaseInputKDB(cacheDirectory: File,
                     )
             )
 
-            // New manual root because KDB contains multiple root groups (here available with getRootGroups())
-            val newRoot = mDatabase.createGroup()
-            mDatabase.rootGroup = newRoot
-
             // Import all nodes
             val groupLevelList = HashMap<GroupKDB, Int>()
             var newGroup: GroupKDB? = null
@@ -303,7 +299,34 @@ class DatabaseInputKDB(cacheDirectory: File,
                             newGroup = null
                         }
                         newEntry?.let { entry ->
-                            mDatabase.addEntryIndex(entry)
+                            // Parse meta info
+                            when {
+                                entry.isMetaStreamDefaultUsername() -> {
+                                    var defaultUser = ""
+                                    entry.getBinary(mDatabase.attachmentPool)
+                                        ?.getInputDataStream(mDatabase.binaryCache)?.use {
+                                            defaultUser = String(it.readBytes())
+                                        }
+                                    mDatabase.defaultUserName = defaultUser
+                                }
+                                entry.isMetaStreamDatabaseColor() -> {
+                                    var color: Int? = null
+                                    entry.getBinary(mDatabase.attachmentPool)
+                                        ?.getInputDataStream(mDatabase.binaryCache)?.use {
+                                            val reverseColor = UnsignedInt(it.readBytes4ToUInt()).toKotlinInt()
+                                            color = Color.rgb(
+                                                Color.blue(reverseColor),
+                                                Color.green(reverseColor),
+                                                Color.red(reverseColor)
+                                            )
+                                        }
+                                    mDatabase.color = color
+                                }
+                                // TODO manager other meta stream
+                                else -> {
+                                    mDatabase.addEntryIndex(entry)
+                                }
+                            }
                             currentEntryNumber++
                             newEntry = null
                         }

app/src/main/java/com/kunzisoft/keepass/database/file/output/DatabaseHeaderOutputKDBX.kt

@@ -68,7 +68,7 @@ constructor(private val databaseKDBX: DatabaseKDBX,
     @Throws(IOException::class)
     fun output() {
 
-        mos.write4BytesUInt(DatabaseHeader.PWM_DBSIG_1)
+        mos.write4BytesUInt(DatabaseHeaderKDBX.DBSIG_1)
         mos.write4BytesUInt(DatabaseHeaderKDBX.DBSIG_2)
         mos.write4BytesUInt(header.version)
 
@@ -130,6 +130,6 @@ constructor(private val databaseKDBX: DatabaseKDBX,
     }
 
     companion object {
-        private val EndHeaderValue = byteArrayOf('\r'.toByte(), '\n'.toByte(), '\r'.toByte(), '\n'.toByte())
+        private val EndHeaderValue = byteArrayOf('\r'.code.toByte(), '\n'.code.toByte(), '\r'.code.toByte(), '\n'.code.toByte())
     }
 }

app/src/main/java/com/kunzisoft/keepass/database/file/output/DatabaseOutputKDB.kt

@@ -19,9 +19,11 @@
  */
 package com.kunzisoft.keepass.database.file.output
 
+import android.graphics.Color
 import com.kunzisoft.encrypt.HashManager
 import com.kunzisoft.keepass.database.crypto.EncryptionAlgorithm
 import com.kunzisoft.keepass.database.element.database.DatabaseKDB
+import com.kunzisoft.keepass.database.element.entry.EntryKDB
 import com.kunzisoft.keepass.database.element.group.GroupKDB
 import com.kunzisoft.keepass.database.exception.DatabaseOutputException
 import com.kunzisoft.keepass.database.file.DatabaseHeader
@@ -34,7 +36,6 @@ import java.io.ByteArrayOutputStream
 import java.io.IOException
 import java.io.OutputStream
 import java.security.*
-import java.util.*
 import javax.crypto.Cipher
 import javax.crypto.CipherOutputStream
 
@@ -44,6 +45,9 @@ class DatabaseOutputKDB(private val mDatabaseKDB: DatabaseKDB,
 
     private var headerHashBlock: ByteArray? = null
 
+    private var mGroupList = mutableListOf<GroupKDB>()
+    private var mEntryList = mutableListOf<EntryKDB>()
+
     @Throws(DatabaseOutputException::class)
     fun getFinalKey(header: DatabaseHeader): ByteArray? {
         try {
@@ -61,7 +65,7 @@ class DatabaseOutputKDB(private val mDatabaseKDB: DatabaseKDB,
         // and remove any orphaned nodes that are no longer part of the tree hierarchy
         // also remove the virtual root not present in kdb
         val rootGroup = mDatabaseKDB.rootGroup
-        sortGroupsForOutput()
+        sortNodesForOutput()
 
         val header = outputHeader(mOutputStream)
 
@@ -91,6 +95,7 @@ class DatabaseOutputKDB(private val mDatabaseKDB: DatabaseKDB,
         } finally {
             // Add again the virtual root group for better management
             mDatabaseKDB.rootGroup = rootGroup
+            clearParser()
         }
     }
 
@@ -105,7 +110,7 @@ class DatabaseOutputKDB(private val mDatabaseKDB: DatabaseKDB,
     override fun outputHeader(outputStream: OutputStream): DatabaseHeaderKDB {
         // Build header
         val header = DatabaseHeaderKDB()
-        header.signature1 = DatabaseHeader.PWM_DBSIG_1
+        header.signature1 = DatabaseHeaderKDB.DBSIG_1
         header.signature2 = DatabaseHeaderKDB.DBSIG_2
         header.flags = DatabaseHeaderKDB.FLAG_SHA2
 
@@ -120,8 +125,9 @@ class DatabaseOutputKDB(private val mDatabaseKDB: DatabaseKDB,
         }
 
         header.version = DatabaseHeaderKDB.DBVER_DW
-        header.numGroups = UnsignedInt(mDatabaseKDB.numberOfGroups())
-        header.numEntries = UnsignedInt(mDatabaseKDB.numberOfEntries())
+        // To remove root
+        header.numGroups = UnsignedInt(mGroupList.size)
+        header.numEntries = UnsignedInt(mEntryList.size)
         header.numKeyEncRounds = UnsignedInt.fromKotlinLong(mDatabaseKDB.numberKeyEncryptionRounds)
 
         setIVs(header)
@@ -194,31 +200,89 @@ class DatabaseOutputKDB(private val mDatabaseKDB: DatabaseKDB,
         }
 
         // Groups
-        mDatabaseKDB.doForEachGroupInIndex { group ->
-            GroupOutputKDB(group, outputStream).output()
+        mGroupList.forEach { group ->
+            if (group != mDatabaseKDB.rootGroup) {
+                GroupOutputKDB(group, outputStream).output()
+            }
         }
         // Entries
-        mDatabaseKDB.doForEachEntryInIndex { entry ->
+        mEntryList.forEach { entry ->
             EntryOutputKDB(mDatabaseKDB, entry, outputStream).output()
         }
     }
 
-    private fun sortGroupsForOutput() {
-        val groupList = ArrayList<GroupKDB>()
-        // Rebuild list according to sorting order removing any orphaned groups
-        for (rootGroup in mDatabaseKDB.rootGroups) {
-            sortGroup(rootGroup, groupList)
-        }
-        mDatabaseKDB.setGroupIndexes(groupList)
+    private fun clearParser() {
+        mGroupList.clear()
+        mEntryList.clear()
     }
 
-    private fun sortGroup(group: GroupKDB, groupList: MutableList<GroupKDB>) {
+    private fun sortNodesForOutput() {
+        clearParser()
+        // Rebuild list according to sorting order removing any orphaned groups
+        // Do not keep root
+        mDatabaseKDB.rootGroup?.getChildGroups()?.let { rootSubGroups ->
+            for (rootGroup in rootSubGroups) {
+                sortGroup(rootGroup)
+            }
+        }
+    }
+
+    private fun sortGroup(group: GroupKDB) {
         // Add current tree
-        groupList.add(group)
+        mGroupList.add(group)
+
+        for (childEntry in group.getChildEntries()) {
+            if (!childEntry.isMetaStreamDefaultUsername()
+                && !childEntry.isMetaStreamDatabaseColor()) {
+                mEntryList.add(childEntry)
+            }
+        }
+
+        // Add MetaStream
+        if (mDatabaseKDB.defaultUserName.isNotEmpty()) {
+            val metaEntry = EntryKDB().apply {
+                setMetaStreamDefaultUsername()
+                setDefaultUsername(this)
+            }
+            mDatabaseKDB.addEntryTo(metaEntry, group)
+            mEntryList.add(metaEntry)
+        }
+        if (mDatabaseKDB.color != null) {
+            val metaEntry = EntryKDB().apply {
+                setMetaStreamDatabaseColor()
+                setDatabaseColor(this)
+            }
+            mDatabaseKDB.addEntryTo(metaEntry, group)
+            mEntryList.add(metaEntry)
+        }
 
         // Recurse over children
         for (childGroup in group.getChildGroups()) {
-            sortGroup(childGroup, groupList)
+            sortGroup(childGroup)
+        }
+    }
+
+    private fun setDefaultUsername(entryKDB: EntryKDB) {
+        val binaryData = mDatabaseKDB.buildNewAttachment()
+        entryKDB.putBinary(binaryData, mDatabaseKDB.attachmentPool)
+        BufferedOutputStream(binaryData.getOutputDataStream(mDatabaseKDB.binaryCache)).use { outputStream ->
+            outputStream.write(mDatabaseKDB.defaultUserName.toByteArray())
+        }
+    }
+
+    private fun setDatabaseColor(entryKDB: EntryKDB) {
+        val binaryData = mDatabaseKDB.buildNewAttachment()
+        entryKDB.putBinary(binaryData, mDatabaseKDB.attachmentPool)
+        BufferedOutputStream(binaryData.getOutputDataStream(mDatabaseKDB.binaryCache)).use { outputStream ->
+            var reversColor = Color.BLACK
+            mDatabaseKDB.color?.let {
+                reversColor = Color.rgb(
+                    Color.blue(it),
+                    Color.green(it),
+                    Color.red(it)
+                )
+            }
+            outputStream.write4BytesUInt(UnsignedInt(reversColor))
         }
     }
 

app/src/main/java/com/kunzisoft/keepass/database/file/output/DatabaseOutputKDBX.kt

@@ -48,7 +48,6 @@ import com.kunzisoft.keepass.database.file.DateKDBXUtil
 import com.kunzisoft.keepass.stream.HashedBlockOutputStream
 import com.kunzisoft.keepass.stream.HmacBlockOutputStream
 import com.kunzisoft.keepass.utils.*
-import org.joda.time.DateTime
 import org.xmlpull.v1.XmlSerializer
 import java.io.IOException
 import java.io.OutputStream
@@ -765,7 +764,7 @@ class DatabaseOutputKDBX(private val mDatabaseKDBX: DatabaseKDBX,
         var character: Char
         for (element in text) {
             character = element
-            val hexChar = character.toInt()
+            val hexChar = character.code
             if (
                     hexChar in 0x20..0xD7FF ||
                     hexChar == 0x9 ||

app/src/main/java/com/kunzisoft/keepass/database/search/SearchHelper.kt

@@ -106,7 +106,7 @@ class SearchHelper {
             } else if (TimeoutHelper.checkTime(context)) {
                 var searchWithoutUI = false
                 if (PreferencesUtil.isAutofillAutoSearchEnable(context)
-                        && searchInfo != null
+                        && searchInfo != null && !searchInfo.manualSelection
                         && !searchInfo.containsOnlyNullValues()) {
                     // If search provide results
                     database.createVirtualGroupFromSearchInfo(

app/src/main/java/com/kunzisoft/keepass/education/GroupActivityEducation.kt

@@ -119,7 +119,7 @@ class GroupActivityEducation(activity: Activity)
                         .outerCircleColorInt(getCircleColor())
                         .outerCircleAlpha(getCircleAlpha())
                         .textColorInt(getTextColor())
-                        .tintTarget(true)
+                        .tintTarget(false)
                         .cancelable(true),
                 object : TapTargetView.Listener() {
                     override fun onTargetClick(view: TapTargetView) {

app/src/main/java/com/kunzisoft/keepass/education/PasswordActivityEducation.kt

@@ -38,9 +38,9 @@ class PasswordActivityEducation(activity: Activity)
                         activity.getString(R.string.education_unlock_summary))
                         .outerCircleColorInt(getCircleColor())
                         .outerCircleAlpha(getCircleAlpha())
-                        .icon(ContextCompat.getDrawable(activity, R.mipmap.ic_launcher_round))
+                        .icon(ContextCompat.getDrawable(activity, R.drawable.ic_lock_open_white_24dp))
                         .textColorInt(getTextColor())
-                        .tintTarget(false)
+                        .tintTarget(true)
                         .cancelable(true),
                 object : TapTargetView.Listener() {
                     override fun onTargetClick(view: TapTargetView) {

app/src/main/java/com/kunzisoft/keepass/magikeyboard/MagikeyboardService.kt

@@ -178,6 +178,11 @@ class MagikeyboardService : InputMethodService(), KeyboardView.OnKeyboardActionL
         assignKeyboardView()
     }
 
+    override fun onEvaluateFullscreenMode(): Boolean {
+        return resources.getBoolean(R.bool.magikeyboard_allow_fullscreen_mode)
+                && super.onEvaluateFullscreenMode()
+    }
+
     private fun playVibration(keyCode: Int) {
         when (keyCode) {
             Keyboard.KEYCODE_DELETE -> {}
@@ -267,7 +272,7 @@ class MagikeyboardService : InputMethodService(), KeyboardView.OnKeyboardActionL
                 if (entryInfoKey != null) {
                     currentInputConnection.commitText(entryInfoKey!!.url, 1)
                 }
-                actionTabAutomatically()
+                actionGoAutomatically()
             }
             KEY_FIELDS -> {
                 if (entryInfoKey != null) {

app/src/main/java/com/kunzisoft/keepass/model/EntryInfo.kt

@@ -40,6 +40,8 @@ class EntryInfo : NodeInfo {
     var password: String = ""
     var url: String = ""
     var notes: String = ""
+    var backgroundColor: Int? = null
+    var foregroundColor: Int? = null
     var customFields: MutableList<Field> = mutableListOf()
     var attachments: MutableList<Attachment> = mutableListOf()
     var otpModel: OtpModel? = null
@@ -53,6 +55,10 @@ class EntryInfo : NodeInfo {
         password = parcel.readString() ?: password
         url = parcel.readString() ?: url
         notes = parcel.readString() ?: notes
+        val readBgColor = parcel.readInt()
+        backgroundColor = if (readBgColor == -1) null else readBgColor
+        val readFgColor = parcel.readInt()
+        foregroundColor = if (readFgColor == -1) null else readFgColor
         parcel.readList(customFields, Field::class.java.classLoader)
         parcel.readList(attachments, Attachment::class.java.classLoader)
         otpModel = parcel.readParcelable(OtpModel::class.java.classLoader) ?: otpModel
@@ -70,6 +76,8 @@ class EntryInfo : NodeInfo {
         parcel.writeString(password)
         parcel.writeString(url)
         parcel.writeString(notes)
+        parcel.writeInt(backgroundColor ?: -1)
+        parcel.writeInt(foregroundColor ?: -1)
         parcel.writeList(customFields)
         parcel.writeList(attachments)
         parcel.writeParcelable(otpModel, flags)
@@ -186,6 +194,43 @@ class EntryInfo : NodeInfo {
         }
     }
 
+    override fun equals(other: Any?): Boolean {
+        if (this === other) return true
+        if (other !is EntryInfo) return false
+        if (!super.equals(other)) return false
+
+        if (id != other.id) return false
+        if (username != other.username) return false
+        if (password != other.password) return false
+        if (url != other.url) return false
+        if (notes != other.notes) return false
+        if (backgroundColor != other.backgroundColor) return false
+        if (foregroundColor != other.foregroundColor) return false
+        if (customFields != other.customFields) return false
+        if (attachments != other.attachments) return false
+        if (otpModel != other.otpModel) return false
+        if (isTemplate != other.isTemplate) return false
+
+        return true
+    }
+
+    override fun hashCode(): Int {
+        var result = super.hashCode()
+        result = 31 * result + id.hashCode()
+        result = 31 * result + username.hashCode()
+        result = 31 * result + password.hashCode()
+        result = 31 * result + url.hashCode()
+        result = 31 * result + notes.hashCode()
+        result = 31 * result + backgroundColor.hashCode()
+        result = 31 * result + foregroundColor.hashCode()
+        result = 31 * result + customFields.hashCode()
+        result = 31 * result + attachments.hashCode()
+        result = 31 * result + (otpModel?.hashCode() ?: 0)
+        result = 31 * result + isTemplate.hashCode()
+        return result
+    }
+
+
     companion object {
 
         const val WEB_DOMAIN_FIELD_NAME = "URL"

app/src/main/java/com/kunzisoft/keepass/model/GroupInfo.kt

@@ -1,12 +1,15 @@
 package com.kunzisoft.keepass.model
 
 import android.os.Parcel
+import android.os.ParcelUuid
 import android.os.Parcelable
 import com.kunzisoft.keepass.database.element.icon.IconImageStandard
 import com.kunzisoft.keepass.database.element.icon.IconImageStandard.Companion.FOLDER_ID
+import java.util.*
 
 class GroupInfo : NodeInfo {
 
+    var id: UUID? = null
     var notes: String? = null
 
     init {
@@ -16,14 +19,35 @@ class GroupInfo : NodeInfo {
     constructor(): super()
 
     constructor(parcel: Parcel): super(parcel) {
+        id = parcel.readParcelable<ParcelUuid>(ParcelUuid::class.java.classLoader)?.uuid ?: id
         notes = parcel.readString()
     }
 
     override fun writeToParcel(parcel: Parcel, flags: Int) {
         super.writeToParcel(parcel, flags)
+        val uuid = if (id != null) ParcelUuid(id) else null
+        parcel.writeParcelable(uuid, flags)
         parcel.writeString(notes)
     }
 
+    override fun equals(other: Any?): Boolean {
+        if (this === other) return true
+        if (other !is GroupInfo) return false
+        if (!super.equals(other)) return false
+
+        if (id != other.id) return false
+        if (notes != other.notes) return false
+
+        return true
+    }
+
+    override fun hashCode(): Int {
+        var result = super.hashCode()
+        result = 31 * result + (id?.hashCode() ?: 0)
+        result = 31 * result + (notes?.hashCode() ?: 0)
+        return result
+    }
+
     companion object CREATOR : Parcelable.Creator<GroupInfo> {
         override fun createFromParcel(parcel: Parcel): GroupInfo {
             return GroupInfo(parcel)

app/src/main/java/com/kunzisoft/keepass/model/NodeInfo.kt

@@ -4,6 +4,8 @@ import android.os.Parcel
 import android.os.Parcelable
 import com.kunzisoft.keepass.database.element.DateInstant
 import com.kunzisoft.keepass.database.element.icon.IconImage
+import com.kunzisoft.keepass.utils.UuidUtil
+import java.util.*
 
 open class NodeInfo() : Parcelable {
 
@@ -36,6 +38,30 @@ open class NodeInfo() : Parcelable {
         return 0
     }
 
+    override fun equals(other: Any?): Boolean {
+        if (this === other) return true
+        if (other !is NodeInfo) return false
+
+        if (title != other.title) return false
+        if (icon != other.icon) return false
+        if (creationTime != other.creationTime) return false
+        if (lastModificationTime != other.lastModificationTime) return false
+        if (expires != other.expires) return false
+        if (expiryTime != other.expiryTime) return false
+
+        return true
+    }
+
+    override fun hashCode(): Int {
+        var result = title.hashCode()
+        result = 31 * result + icon.hashCode()
+        result = 31 * result + creationTime.hashCode()
+        result = 31 * result + lastModificationTime.hashCode()
+        result = 31 * result + expires.hashCode()
+        result = 31 * result + expiryTime.hashCode()
+        return result
+    }
+
     companion object CREATOR : Parcelable.Creator<NodeInfo> {
         override fun createFromParcel(parcel: Parcel): NodeInfo {
             return NodeInfo(parcel)

app/src/main/java/com/kunzisoft/keepass/model/SearchInfo.kt

@@ -14,7 +14,7 @@ import kotlinx.coroutines.launch
 import mozilla.components.lib.publicsuffixlist.PublicSuffixList
 
 class SearchInfo : ObjectNameResource, Parcelable {
-
+    var manualSelection: Boolean = false
     var applicationId: String? = null
         set(value) {
             field = when {
@@ -42,6 +42,7 @@ class SearchInfo : ObjectNameResource, Parcelable {
     constructor()
 
     constructor(toCopy: SearchInfo?) {
+        manualSelection = toCopy?.manualSelection ?: manualSelection
         applicationId = toCopy?.applicationId
         webDomain = toCopy?.webDomain
         webScheme = toCopy?.webScheme
@@ -49,6 +50,7 @@ class SearchInfo : ObjectNameResource, Parcelable {
     }
 
     private constructor(parcel: Parcel) {
+        manualSelection = parcel.readByte().toInt() != 0
         val readAppId = parcel.readString()
         applicationId =  if (readAppId.isNullOrEmpty()) null else readAppId
         val readDomain = parcel.readString()
@@ -64,6 +66,7 @@ class SearchInfo : ObjectNameResource, Parcelable {
     }
 
     override fun writeToParcel(parcel: Parcel, flags: Int) {
+        parcel.writeByte((if (manualSelection) 1 else 0).toByte())
         parcel.writeString(applicationId ?: "")
         parcel.writeString(webDomain ?: "")
         parcel.writeString(webScheme ?: "")
@@ -88,10 +91,9 @@ class SearchInfo : ObjectNameResource, Parcelable {
 
     override fun equals(other: Any?): Boolean {
         if (this === other) return true
-        if (javaClass != other?.javaClass) return false
-
-        other as SearchInfo
+        if (other !is SearchInfo) return false
 
+        if (manualSelection != other.manualSelection) return false
         if (applicationId != other.applicationId) return false
         if (webDomain != other.webDomain) return false
         if (webScheme != other.webScheme) return false
@@ -101,7 +103,8 @@ class SearchInfo : ObjectNameResource, Parcelable {
     }
 
     override fun hashCode(): Int {
-        var result = applicationId?.hashCode() ?: 0
+        var result = manualSelection.hashCode()
+        result = 31 * result + (applicationId?.hashCode() ?: 0)
         result = 31 * result + (webDomain?.hashCode() ?: 0)
         result = 31 * result + (webScheme?.hashCode() ?: 0)
         result = 31 * result + (otpString?.hashCode() ?: 0)

app/src/main/java/com/kunzisoft/keepass/otp/OtpElement.kt

@@ -234,7 +234,7 @@ data class OtpElement(var otpModel: OtpModel = OtpModel()) {
 
         fun replaceBase32Chars(parameter: String): String {
             // Add padding '=' at end if not Base32 length
-            var parameterNewSize = parameter.toUpperCase(Locale.ENGLISH).removeSpaceChars()
+            var parameterNewSize = parameter.uppercase(Locale.ENGLISH).removeSpaceChars()
             while (parameterNewSize.length % 8 != 0) {
                 parameterNewSize += '='
             }
@@ -264,7 +264,7 @@ enum class OtpTokenType {
 
     companion object {
         fun getFromString(tokenType: String): OtpTokenType {
-            return when (tokenType.toLowerCase(Locale.ENGLISH)) {
+            return when (tokenType.lowercase(Locale.ENGLISH)) {
                 "s", "steam" -> STEAM
                 "hotp" -> RFC4226
                 else -> RFC6238

app/src/main/java/com/kunzisoft/keepass/otp/OtpEntryFields.kt

@@ -143,7 +143,7 @@ object OtpEntryFields {
         if (otpPlainText != null && otpPlainText.isNotEmpty() && isOTPUri(otpPlainText)) {
             val uri = Uri.parse(otpPlainText.removeSpaceChars())
 
-            if (uri.scheme == null || OTP_SCHEME != uri.scheme!!.toLowerCase(Locale.ENGLISH)) {
+            if (uri.scheme == null || OTP_SCHEME != uri.scheme!!.lowercase(Locale.ENGLISH)) {
                 Log.e(TAG, "Invalid or missing scheme in uri")
                 return false
             }
@@ -309,7 +309,7 @@ object OtpEntryFields {
             }
             if (algorithmField != null) {
                 otpElement.algorithm =
-                        when (algorithmField.toUpperCase(Locale.ENGLISH)) {
+                        when (algorithmField.uppercase(Locale.ENGLISH)) {
                             TIMEOTP_ALGORITHM_SHA1_VALUE -> HashAlgorithm.SHA1
                             TIMEOTP_ALGORITHM_SHA256_VALUE -> HashAlgorithm.SHA256
                             TIMEOTP_ALGORITHM_SHA512_VALUE -> HashAlgorithm.SHA512
@@ -417,7 +417,7 @@ object OtpEntryFields {
         val output = HashMap<String, String>()
         for (element in elements) {
             val pair = element.split("=".toRegex()).dropLastWhile { it.isEmpty() }.toTypedArray()
-            output[pair[0].toLowerCase(Locale.ENGLISH)] = pair[1]
+            output[pair[0].lowercase(Locale.ENGLISH)] = pair[1]
         }
         return output
     }

app/src/main/java/com/kunzisoft/keepass/receivers/DexModeReceiver.kt

@@ -0,0 +1,33 @@
+package com.kunzisoft.keepass.receivers
+
+import android.content.BroadcastReceiver
+import android.content.ComponentName
+import android.content.Context
+import android.content.Intent
+import android.content.pm.PackageManager
+import android.util.Log
+import com.kunzisoft.keepass.magikeyboard.MagikeyboardService
+import com.kunzisoft.keepass.utils.DexUtil
+import com.kunzisoft.keepass.utils.MagikeyboardUtil
+
+class DexModeReceiver : BroadcastReceiver() {
+    override fun onReceive(context: Context?, intent: Intent?) {
+        val enabled = when (intent?.action) {
+            "android.app.action.ENTER_KNOX_DESKTOP_MODE" -> {
+                Log.i(TAG, "Entered DeX mode")
+                false
+            }
+            "android.app.action.EXIT_KNOX_DESKTOP_MODE" -> {
+                Log.i(TAG, "Left DeX mode")
+                true
+            }
+            else -> return
+        }
+
+        MagikeyboardUtil.setEnabled(context!!, enabled)
+    }
+
+    companion object {
+        private val TAG = DexModeReceiver::class.java.name
+    }
+}

app/src/main/java/com/kunzisoft/keepass/services/AdvancedUnlockNotificationService.kt

@@ -1,9 +1,11 @@
 package com.kunzisoft.keepass.services
 
+import android.annotation.SuppressLint
 import android.app.PendingIntent
 import android.content.*
 import android.net.Uri
 import android.os.Binder
+import android.os.Build
 import android.os.IBinder
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.app.database.CipherDatabaseEntity
@@ -50,11 +52,20 @@ class AdvancedUnlockNotificationService : NotificationService() {
         mTempCipherDao = ArrayList()
     }
 
+    // It's simpler to use pendingIntent to perform REMOVE_ADVANCED_UNLOCK_KEY_ACTION
+    // because can be directly broadcast to another module or app
+    @SuppressLint("LaunchActivityFromNotification")
     override fun onBind(intent: Intent): IBinder {
         super.onBind(intent)
 
         val pendingDeleteIntent = PendingIntent.getBroadcast(this,
-                4577, Intent(REMOVE_ADVANCED_UNLOCK_KEY_ACTION), 0)
+            4577,
+            Intent(REMOVE_ADVANCED_UNLOCK_KEY_ACTION),
+            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+                PendingIntent.FLAG_IMMUTABLE
+            } else {
+                0
+            })
         val biometricUnlockEnabled = PreferencesUtil.isBiometricUnlockEnable(this)
         val notificationBuilder = buildNewNotification().apply {
             setSmallIcon(if (biometricUnlockEnabled) {

app/src/main/java/com/kunzisoft/keepass/services/AttachmentFileNotificationService.kt

@@ -24,6 +24,7 @@ import android.content.ContentResolver
 import android.content.Intent
 import android.net.Uri
 import android.os.Binder
+import android.os.Build
 import android.os.IBinder
 import android.util.Log
 import com.kunzisoft.keepass.R
@@ -188,20 +189,30 @@ class AttachmentFileNotificationService: LockNotificationService() {
     private fun newNotification(attachmentNotification: AttachmentNotification) {
 
         val pendingContentIntent = PendingIntent.getActivity(this,
-                0,
-                Intent().apply {
-                    action = Intent.ACTION_VIEW
-                    setDataAndType(attachmentNotification.uri,
-                            contentResolver.getType(attachmentNotification.uri))
-                    addFlags(Intent.FLAG_GRANT_READ_URI_PERMISSION)
-                }, PendingIntent.FLAG_CANCEL_CURRENT)
+            0,
+            Intent().apply {
+                action = Intent.ACTION_VIEW
+                setDataAndType(attachmentNotification.uri,
+                        contentResolver.getType(attachmentNotification.uri))
+                addFlags(Intent.FLAG_GRANT_READ_URI_PERMISSION)
+            }, if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+                PendingIntent.FLAG_IMMUTABLE or PendingIntent.FLAG_CANCEL_CURRENT
+            } else {
+                PendingIntent.FLAG_CANCEL_CURRENT
+            }
+        )
 
         val pendingDeleteIntent =  PendingIntent.getService(this,
                 0,
                 Intent(this, AttachmentFileNotificationService::class.java).apply {
                     // No action to delete the service
                     putExtra(FILE_URI_KEY, attachmentNotification.uri)
-                }, PendingIntent.FLAG_CANCEL_CURRENT)
+                }, if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+                PendingIntent.FLAG_IMMUTABLE or PendingIntent.FLAG_CANCEL_CURRENT
+            } else {
+                PendingIntent.FLAG_CANCEL_CURRENT
+            }
+        )
 
         val fileName = UriUtil.getFileData(this, attachmentNotification.uri)?.name
                 ?: attachmentNotification.uri.path

app/src/main/java/com/kunzisoft/keepass/services/ClipboardEntryNotificationService.kt

@@ -22,6 +22,7 @@ package com.kunzisoft.keepass.services
 import android.app.PendingIntent
 import android.content.Context
 import android.content.Intent
+import android.os.Build
 import android.util.Log
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.model.EntryInfo
@@ -112,7 +113,13 @@ class ClipboardEntryNotificationService : LockNotificationService() {
             putParcelableArrayListExtra(EXTRA_CLIPBOARD_FIELDS, fieldsToAdd)
         }
         return PendingIntent.getService(
-                this, 0, copyIntent, PendingIntent.FLAG_UPDATE_CURRENT)
+            this, 0, copyIntent,
+            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+                PendingIntent.FLAG_IMMUTABLE or PendingIntent.FLAG_UPDATE_CURRENT
+            } else {
+                PendingIntent.FLAG_UPDATE_CURRENT
+            }
+        )
     }
 
     private fun newNotification(title: String?, fieldsToAdd: ArrayList<ClipboardEntryNotificationField>) {
@@ -162,7 +169,13 @@ class ClipboardEntryNotificationService : LockNotificationService() {
             val cleanIntent = Intent(this, ClipboardEntryNotificationService::class.java)
             cleanIntent.action = ACTION_CLEAN_CLIPBOARD
             val cleanPendingIntent = PendingIntent.getService(
-                    this, 0, cleanIntent, PendingIntent.FLAG_UPDATE_CURRENT)
+                this, 0, cleanIntent,
+                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+                    PendingIntent.FLAG_IMMUTABLE or PendingIntent.FLAG_UPDATE_CURRENT
+                } else {
+                    PendingIntent.FLAG_UPDATE_CURRENT
+                }
+            )
             builder.setDeleteIntent(cleanPendingIntent)
 
             //Get settings

app/src/main/java/com/kunzisoft/keepass/services/DatabaseTaskNotificationService.kt

@@ -24,6 +24,7 @@ import android.content.Intent
 import android.net.Uri
 import android.os.*
 import android.util.Log
+import androidx.media.app.NotificationCompat
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.GroupActivity
 import com.kunzisoft.keepass.app.database.CipherDatabaseEntity
@@ -407,11 +408,21 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
                         this,
                         0,
                         Intent(this, GroupActivity::class.java),
-                        PendingIntent.FLAG_UPDATE_CURRENT
+                        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+                            PendingIntent.FLAG_IMMUTABLE or PendingIntent.FLAG_UPDATE_CURRENT
+                        } else {
+                            PendingIntent.FLAG_UPDATE_CURRENT
+                        }
                     )
                     val pendingDeleteIntent = PendingIntent.getBroadcast(
                         this,
-                        4576, Intent(LOCK_ACTION), 0
+                        4576,
+                        Intent(LOCK_ACTION),
+                        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+                            PendingIntent.FLAG_IMMUTABLE
+                        } else {
+                            0
+                        }
                     )
                     // Add actions in notifications
                     notificationBuilder.apply {
@@ -420,9 +431,16 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
                         // Unfortunately swipe is disabled in lollipop+
                         setDeleteIntent(pendingDeleteIntent)
                         addAction(
-                            R.drawable.ic_lock_white_24dp, getString(R.string.lock),
+                            R.drawable.ic_lock_database_white_32dp, getString(R.string.lock),
                             pendingDeleteIntent
                         )
+                        // Won't work with Xiaomi and Kitkat
+                        if (Build.VERSION.SDK_INT > Build.VERSION_CODES.R) {
+                            setStyle(
+                                NotificationCompat.MediaStyle()
+                                    .setShowActionsInCompactView(0)
+                            )
+                        }
                     }
                 }
             }

app/src/main/java/com/kunzisoft/keepass/services/KeyboardEntryNotificationService.kt

@@ -22,6 +22,7 @@ package com.kunzisoft.keepass.services
 import android.app.PendingIntent
 import android.content.Context
 import android.content.Intent
+import android.os.Build
 import android.util.Log
 import android.widget.Toast
 import androidx.preference.PreferenceManager
@@ -93,7 +94,13 @@ class KeyboardEntryNotificationService : LockNotificationService() {
         val deleteIntent = Intent(this, KeyboardEntryNotificationService::class.java).apply {
             action = ACTION_CLEAN_KEYBOARD_ENTRY
         }
-        pendingDeleteIntent = PendingIntent.getService(this, 0, deleteIntent, PendingIntent.FLAG_UPDATE_CURRENT)
+        pendingDeleteIntent = PendingIntent.getService(this, 0, deleteIntent,
+            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+                PendingIntent.FLAG_IMMUTABLE or PendingIntent.FLAG_UPDATE_CURRENT
+            } else {
+                PendingIntent.FLAG_UPDATE_CURRENT
+            }
+        )
 
         val builder = buildNewNotification()
                 .setSmallIcon(R.drawable.notification_ic_keyboard_key_24dp)

app/src/main/java/com/kunzisoft/keepass/settings/AutofillSettingsFragment.kt

@@ -57,6 +57,7 @@ class AutofillSettingsFragment : PreferenceFragmentCompat() {
         }
 
         if (dialogFragment != null) {
+            @Suppress("DEPRECATION")
             dialogFragment.setTargetFragment(this, 0)
             dialogFragment.show(parentFragmentManager, TAG_AUTOFILL_PREF_FRAGMENT)
         }

app/src/main/java/com/kunzisoft/keepass/settings/MagikeyboardSettingsFragment.kt

@@ -48,6 +48,7 @@ class MagikeyboardSettingsFragment : PreferenceFragmentCompat() {
         }
 
         if (dialogFragment != null) {
+            @Suppress("DEPRECATION")
             dialogFragment.setTargetFragment(this, 0)
             dialogFragment.show(parentFragmentManager, TAG_PREF_FRAGMENT)
         }

app/src/main/java/com/kunzisoft/keepass/settings/NestedAppSettingsFragment.kt

@@ -40,7 +40,6 @@ import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.dialogs.ProFeatureDialogFragment
 import com.kunzisoft.keepass.activities.dialogs.UnavailableFeatureDialogFragment
 import com.kunzisoft.keepass.activities.stylish.Stylish
-import com.kunzisoft.keepass.app.database.CipherDatabaseAction
 import com.kunzisoft.keepass.app.database.FileDatabaseHistoryAction
 import com.kunzisoft.keepass.biometric.AdvancedUnlockManager
 import com.kunzisoft.keepass.education.Education
@@ -157,7 +156,7 @@ class NestedAppSettingsFragment : NestedSettingsFragment() {
                             val intent = Intent(Settings.ACTION_REQUEST_SET_AUTOFILL_SERVICE)
                             intent.data = Uri.parse("package:com.kunzisoft.keepass.autofill.KeeAutofillService")
                             Log.d(javaClass.name, "Autofill enable service: intent=$intent")
-                            startActivityForResult(intent, REQUEST_CODE_AUTOFILL)
+                            startActivity(intent)
                         } else {
                             Log.d(javaClass.name, "Autofill service already enabled.")
                         }
@@ -366,26 +365,7 @@ class NestedAppSettingsFragment : NestedSettingsFragment() {
                 ) { _, _ ->
                     validate?.invoke()
                     deleteKeysAlertDialog?.setOnDismissListener(null)
-                    if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
-                        AdvancedUnlockManager.deleteEntryKeyInKeystoreForBiometric(
-                                activity,
-                                object : AdvancedUnlockManager.AdvancedUnlockErrorCallback {
-                                    fun showException(e: Exception) {
-                                        Toast.makeText(context,
-                                                getString(R.string.advanced_unlock_scanning_error, e.localizedMessage),
-                                                Toast.LENGTH_SHORT).show()
-                                    }
-
-                                    override fun onInvalidKeyException(e: Exception) {
-                                        showException(e)
-                                    }
-
-                                    override fun onGenericException(e: Exception) {
-                                        showException(e)
-                                    }
-                                })
-                    }
-                    CipherDatabaseAction.getInstance(activity.applicationContext).deleteAll()
+                    AdvancedUnlockManager.deleteAllEntryKeysInKeystoreForBiometric(activity)
                 }
                 .setNegativeButton(resources.getString(android.R.string.cancel)
                 ) { _, _ ->}
@@ -472,7 +452,7 @@ class NestedAppSettingsFragment : NestedSettingsFragment() {
             getString(R.string.show_uuid_key),
             getString(R.string.enable_education_screens_key),
             getString(R.string.reset_education_screens_key) -> {
-                DATABASE_APPEARANCE_PREFERENCE_CHANGED = true
+                DATABASE_PREFERENCE_CHANGED = true
             }
         }
         return super.onPreferenceTreeClick(preference)
@@ -494,6 +474,7 @@ class NestedAppSettingsFragment : NestedSettingsFragment() {
         }
 
         if (dialogFragment != null) {
+            @Suppress("DEPRECATION")
             dialogFragment.setTargetFragment(this, 0)
             dialogFragment.show(parentFragmentManager, TAG_PREF_FRAGMENT)
         }
@@ -533,9 +514,8 @@ class NestedAppSettingsFragment : NestedSettingsFragment() {
     }
 
     companion object {
-        private const val REQUEST_CODE_AUTOFILL = 5201
         private const val TAG_PREF_FRAGMENT = "TAG_PREF_FRAGMENT"
 
-        var DATABASE_APPEARANCE_PREFERENCE_CHANGED = false
+        var DATABASE_PREFERENCE_CHANGED = false
     }
 }

app/src/main/java/com/kunzisoft/keepass/settings/NestedDatabaseSettingsFragment.kt

@@ -30,8 +30,8 @@ import androidx.preference.PreferenceCategory
 import androidx.preference.SwitchPreference
 import com.kunzisoft.androidclearchroma.ChromaUtil
 import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.activities.legacy.DatabaseRetrieval
 import com.kunzisoft.keepass.activities.dialogs.AssignMasterKeyDialogFragment
+import com.kunzisoft.keepass.activities.legacy.DatabaseRetrieval
 import com.kunzisoft.keepass.activities.legacy.resetAppTimeoutWhenViewTouchedOrFocused
 import com.kunzisoft.keepass.database.crypto.EncryptionAlgorithm
 import com.kunzisoft.keepass.database.crypto.kdf.KdfEngine
@@ -57,7 +57,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
 
     private var dbNamePref: InputTextPreference? = null
     private var dbDescriptionPref: InputTextPreference? = null
-    private var dbDefaultUsername: InputTextPreference? = null
+    private var dbDefaultUsernamePref: InputTextPreference? = null
     private var dbCustomColorPref: DialogColorPreference? = null
     private var dbDataCompressionPref: Preference? = null
     private var recycleBinGroupPref: DialogListExplanationPreference? = null
@@ -164,29 +164,20 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
         }
 
         // Database default username
-        dbDefaultUsername = findPreference(getString(R.string.database_default_username_key))
-        if (database.allowDefaultUsername) {
-            dbDefaultUsername?.summary = database.defaultUsername
-        } else {
-            dbDefaultUsername?.isEnabled = false
-            // TODO dbGeneralPrefCategory?.removePreference(dbDefaultUsername)
-        }
+        dbDefaultUsernamePref = findPreference(getString(R.string.database_default_username_key))
+        dbDefaultUsernamePref?.summary = database.defaultUsername
 
         // Database custom color
         dbCustomColorPref = findPreference(getString(R.string.database_custom_color_key))
-        if (database.allowCustomColor) {
-            dbCustomColorPref?.apply {
-                try {
-                    color = Color.parseColor(database.customColor)
-                    summary = database.customColor
-                } catch (e: Exception) {
-                    color = DialogColorPreference.DISABLE_COLOR
-                    summary = ""
-                }
+        dbCustomColorPref?.apply {
+            val customColor = database.customColor
+            if (customColor != null) {
+                color = customColor
+                summary = ChromaUtil.getFormattedColorString(customColor, false)
+            } else{
+                color = DialogColorPreference.DISABLE_COLOR
+                summary = ""
             }
-        } else {
-            dbCustomColorPref?.isEnabled = false
-            // TODO dbGeneralPrefCategory?.removePreference(dbCustomColorPref)
         }
 
         // Version
@@ -348,12 +339,13 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
         }
     }
 
-    private val colorSelectedListener: ((Boolean, Int)-> Unit) = { enable, color ->
-        dbCustomColorPref?.summary = ChromaUtil.getFormattedColorString(color, false)
-        if (enable) {
+    private val colorSelectedListener: ((Int?)-> Unit) = { color ->
+        if (color != null) {
             dbCustomColorPref?.color = color
+            dbCustomColorPref?.summary = ChromaUtil.getFormattedColorString(color, false)
         } else {
             dbCustomColorPref?.color = DialogColorPreference.DISABLE_COLOR
+            dbCustomColorPref?.summary = ""
         }
     }
 
@@ -416,7 +408,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                     mDatabase?.defaultUsername = oldDefaultUsername
                                     oldDefaultUsername
                                 }
-                        dbDefaultUsername?.summary = defaultUsernameToShow
+                        dbDefaultUsernamePref?.summary = defaultUsernameToShow
                     }
                     DatabaseTaskNotificationService.ACTION_DATABASE_UPDATE_COLOR_TASK -> {
                         val oldColor = data.getString(DatabaseTaskNotificationService.OLD_ELEMENT_KEY)!!
@@ -426,7 +418,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newColor
                                 } else {
-                                    mDatabase?.customColor = oldColor
+                                    mDatabase?.customColor = Color.parseColor(oldColor)
                                     oldColor
                                 }
                         dbCustomColorPref?.summary = defaultColorToShow
@@ -632,6 +624,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
         }
 
         if (dialogFragment != null && !mDatabaseReadOnly) {
+            @Suppress("DEPRECATION")
             dialogFragment.setTargetFragment(this, 0)
             dialogFragment.show(parentFragmentManager, TAG_PREF_FRAGMENT)
         }
@@ -680,6 +673,27 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
         }
     }
 
+    override fun onPreferenceTreeClick(preference: Preference?): Boolean {
+        // To reload group when database settings are modified
+        when (preference?.key) {
+            getString(R.string.database_name_key),
+            getString(R.string.database_description_key),
+            getString(R.string.database_default_username_key),
+            getString(R.string.database_custom_color_key),
+            getString(R.string.database_data_compression_key),
+            getString(R.string.database_data_remove_unlinked_attachments_key),
+            getString(R.string.recycle_bin_enable_key),
+            getString(R.string.recycle_bin_group_key),
+            getString(R.string.templates_group_enable_key),
+            getString(R.string.templates_group_uuid_key),
+            getString(R.string.max_history_items_key),
+            getString(R.string.max_history_size_key) -> {
+                NestedAppSettingsFragment.DATABASE_PREFERENCE_CHANGED = true
+            }
+        }
+        return super.onPreferenceTreeClick(preference)
+    }
+
     companion object {
         private const val TAG_PREF_FRAGMENT = "TAG_PREF_FRAGMENT"
     }

app/src/main/java/com/kunzisoft/keepass/settings/PreferencesUtil.kt

@@ -493,6 +493,12 @@ object PreferencesUtil {
                 context.resources.getBoolean(R.bool.autofill_inline_suggestions_default))
     }
 
+    fun isAutofillManualSelectionEnable(context: Context): Boolean {
+        val prefs = PreferenceManager.getDefaultSharedPreferences(context)
+        return prefs.getBoolean(context.getString(R.string.autofill_manual_selection_key),
+                context.resources.getBoolean(R.bool.autofill_manual_selection_default))
+    }
+
     fun isAutofillSaveSearchInfoEnable(context: Context): Boolean {
         val prefs = PreferenceManager.getDefaultSharedPreferences(context)
         return prefs.getBoolean(context.getString(R.string.autofill_save_search_info_key),
@@ -630,6 +636,7 @@ object PreferencesUtil {
                 context.getString(R.string.autofill_close_database_key) -> editor.putBoolean(name, value.toBoolean())
                 context.getString(R.string.autofill_auto_search_key) -> editor.putBoolean(name, value.toBoolean())
                 context.getString(R.string.autofill_inline_suggestions_key) -> editor.putBoolean(name, value.toBoolean())
+                context.getString(R.string.autofill_manual_selection_key) -> editor.putBoolean(name, value.toBoolean())
                 context.getString(R.string.autofill_save_search_info_key) -> editor.putBoolean(name, value.toBoolean())
                 context.getString(R.string.autofill_ask_to_save_data_key) -> editor.putBoolean(name, value.toBoolean())
                 context.getString(R.string.autofill_application_id_blocklist_key) -> editor.putStringSet(name, getStringSetFromProperties(value))

app/src/main/java/com/kunzisoft/keepass/settings/SettingsActivity.kt

@@ -49,7 +49,6 @@ open class SettingsActivity
 
     private var backupManager: BackupManager? = null
     private var mExternalFileHelper: ExternalFileHelper? = null
-    private var appPropertiesFileCreationRequestCode: Int? = null
 
     private var coordinatorLayout: CoordinatorLayout? = null
     private var toolbar: Toolbar? = null
@@ -64,6 +63,41 @@ open class SettingsActivity
         toolbar = findViewById(R.id.toolbar)
 
         mExternalFileHelper = ExternalFileHelper(this)
+        mExternalFileHelper?.buildOpenDocument { selectedFileUri ->
+            // Import app properties result
+            try {
+                selectedFileUri?.let { uri ->
+                    val appProperties = Properties()
+                    contentResolver?.openInputStream(uri)?.use { inputStream ->
+                        appProperties.load(inputStream)
+                    }
+                    PreferencesUtil.setAppProperties(this, appProperties)
+
+                    // Restart the current activity
+                    reloadActivity()
+                    Toast.makeText(this, R.string.success_import_app_properties, Toast.LENGTH_LONG).show()
+                }
+            } catch (e: Exception) {
+                Toast.makeText(this, R.string.error_import_app_properties, Toast.LENGTH_LONG).show()
+                Log.e(TAG, "Unable to import app properties", e)
+            }
+        }
+        mExternalFileHelper?.buildCreateDocument { createdFileUri ->
+            // Export app properties result
+            try {
+                createdFileUri?.let { uri ->
+                    contentResolver?.openOutputStream(uri)?.use { outputStream ->
+                        PreferencesUtil
+                            .getAppProperties(this)
+                            .store(outputStream, getString(R.string.description_app_properties))
+                    }
+                    Toast.makeText(this, R.string.success_export_app_properties, Toast.LENGTH_LONG).show()
+                }
+            } catch (e: Exception) {
+                Toast.makeText(this, R.string.error_export_app_properties, Toast.LENGTH_LONG).show()
+                Log.e(DatabaseLockActivity.TAG, "Unable to export app properties", e)
+            }
+        }
 
         if (savedInstanceState?.getString(TITLE_KEY).isNullOrEmpty())
             toolbar?.setTitle(R.string.settings)
@@ -217,54 +251,10 @@ open class SettingsActivity
     }
 
     fun exportAppProperties() {
-        appPropertiesFileCreationRequestCode = mExternalFileHelper?.createDocument(getString(R.string.app_properties_file_name,
+        mExternalFileHelper?.createDocument(getString(R.string.app_properties_file_name,
             DateTime.now().toLocalDateTime().toString("yyyy-MM-dd'_'HH-mm")))
     }
 
-    override fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?) {
-        super.onActivityResult(requestCode, resultCode, data)
-
-        // Import app properties result
-        try {
-            mExternalFileHelper?.onOpenDocumentResult(requestCode, resultCode, data) { selectedFileUri ->
-                selectedFileUri?.let { uri ->
-                    val appProperties = Properties()
-                    contentResolver?.openInputStream(uri)?.use { inputStream ->
-                        appProperties.load(inputStream)
-                    }
-                    PreferencesUtil.setAppProperties(this, appProperties)
-
-                    // Restart the current activity
-                    reloadActivity()
-                    Toast.makeText(this, R.string.success_import_app_properties, Toast.LENGTH_LONG).show()
-                }
-            }
-        } catch (e: Exception) {
-            Toast.makeText(this, R.string.error_import_app_properties, Toast.LENGTH_LONG).show()
-            Log.e(TAG, "Unable to import app properties", e)
-        }
-
-        // Export app properties result
-        try {
-            if (requestCode == appPropertiesFileCreationRequestCode) {
-                mExternalFileHelper?.onCreateDocumentResult(requestCode, resultCode, data) { createdFileUri ->
-                    createdFileUri?.let { uri ->
-                        contentResolver?.openOutputStream(uri)?.use { outputStream ->
-                            PreferencesUtil
-                                    .getAppProperties(this)
-                                    .store(outputStream, getString(R.string.description_app_properties))
-                        }
-                        Toast.makeText(this, R.string.success_export_app_properties, Toast.LENGTH_LONG).show()
-                    }
-                }
-                appPropertiesFileCreationRequestCode = null
-            }
-        } catch (e: Exception) {
-            Toast.makeText(this, R.string.error_export_app_properties, Toast.LENGTH_LONG).show()
-            Log.e(DatabaseLockActivity.TAG, "Unable to export app properties", e)
-        }
-    }
-
     override fun onSaveInstanceState(outState: Bundle) {
         super.onSaveInstanceState(outState)
 

app/src/main/java/com/kunzisoft/keepass/settings/preference/DialogColorPreference.kt

@@ -41,7 +41,7 @@ class DialogColorPreference @JvmOverloads constructor(context: Context,
     }
 
     override fun getDialogLayoutResource(): Int {
-        return R.layout.pref_dialog_input_color
+        return R.layout.fragment_color_picker
     }
 
     companion object {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseColorPreferenceDialogFragmentCompat.kt

@@ -30,27 +30,57 @@ import android.view.Window
 import android.widget.CompoundButton
 import androidx.annotation.ColorInt
 import androidx.appcompat.app.AlertDialog
-import com.kunzisoft.androidclearchroma.ChromaUtil
 import com.kunzisoft.androidclearchroma.IndicatorMode
 import com.kunzisoft.androidclearchroma.colormode.ColorMode
 import com.kunzisoft.androidclearchroma.fragment.ChromaColorFragment
 import com.kunzisoft.androidclearchroma.fragment.ChromaColorFragment.*
+import com.kunzisoft.androidclearchroma.view.ChromaColorView
 import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.activities.dialogs.ColorPickerDialogFragment
 import com.kunzisoft.keepass.database.element.Database
 
 class DatabaseColorPreferenceDialogFragmentCompat : DatabaseSavePreferenceDialogFragmentCompat() {
 
     private lateinit var rootView: View
     private lateinit var enableSwitchView: CompoundButton
-    private var chromaColorFragment: ChromaColorFragment? = null
+    private lateinit var chromaColorView: ChromaColorView
 
-    var onColorSelectedListener: ((enable: Boolean, color: Int) -> Unit)? = null
+    var onColorSelectedListener: ((color: Int?) -> Unit)? = null
+
+    private var mDefaultColor = Color.WHITE
+    private var mActivated = false
 
     override fun onCreateDialog(savedInstanceState: Bundle?): Dialog {
         val alertDialogBuilder = AlertDialog.Builder(requireActivity())
 
-        rootView = requireActivity().layoutInflater.inflate(R.layout.pref_dialog_input_color, null)
+        rootView = requireActivity().layoutInflater.inflate(R.layout.fragment_color_picker, null)
         enableSwitchView = rootView.findViewById(R.id.switch_element)
+        chromaColorView = rootView.findViewById(R.id.chroma_color_view)
+
+        if (savedInstanceState != null) {
+            if (savedInstanceState.containsKey(ARG_INITIAL_COLOR)) {
+                mDefaultColor = savedInstanceState.getInt(ARG_INITIAL_COLOR)
+            }
+            if (savedInstanceState.containsKey(ARG_ACTIVATED)) {
+                mActivated = savedInstanceState.getBoolean(ARG_ACTIVATED)
+            }
+        } else {
+            arguments?.apply {
+                if (containsKey(ARG_INITIAL_COLOR)) {
+                    mDefaultColor = getInt(ARG_INITIAL_COLOR)
+                }
+                if (containsKey(ARG_ACTIVATED)) {
+                    mActivated = getBoolean(ARG_ACTIVATED)
+                }
+            }
+        }
+        enableSwitchView.isChecked = mActivated
+        chromaColorView.currentColor = mDefaultColor
+
+        chromaColorView.setOnColorChangedListener {
+            if (!enableSwitchView.isChecked)
+                enableSwitchView.isChecked = true
+        }
 
         alertDialogBuilder.setPositiveButton(android.R.string.ok) { _, _ ->
             onDialogClosed(true)
@@ -68,8 +98,6 @@ class DatabaseColorPreferenceDialogFragmentCompat : DatabaseSavePreferenceDialog
         // request a window without the title
         dialog.window?.requestFeature(Window.FEATURE_NO_TITLE)
 
-        dialog.setOnShowListener { measureLayout(it as Dialog) }
-
         return dialog
     }
 
@@ -77,73 +105,48 @@ class DatabaseColorPreferenceDialogFragmentCompat : DatabaseSavePreferenceDialog
         super.onDatabaseRetrieved(database)
 
         database?.let {
-            val initColor = try {
+            var initColor = it.customColor
+            if (initColor != null) {
                 enableSwitchView.isChecked = true
-                Color.parseColor(it.customColor)
-            } catch (e: Exception) {
+            } else {
                 enableSwitchView.isChecked = false
-                DEFAULT_COLOR
+                initColor = DEFAULT_COLOR
             }
+            chromaColorView.currentColor = initColor
             arguments?.putInt(ARG_INITIAL_COLOR, initColor)
         }
-
-        val fragmentManager = childFragmentManager
-        chromaColorFragment = fragmentManager.findFragmentByTag(TAG_FRAGMENT_COLORS) as ChromaColorFragment?
-
-        if (chromaColorFragment == null) {
-            chromaColorFragment = newInstance(arguments)
-            fragmentManager.beginTransaction().apply {
-                add(com.kunzisoft.androidclearchroma.R.id.color_dialog_container, chromaColorFragment!!, TAG_FRAGMENT_COLORS)
-                commit()
-            }
-        }
     }
 
     override fun onDialogClosed(database: Database?, positiveResult: Boolean) {
         super.onDialogClosed(database, positiveResult)
         if (positiveResult) {
-            val customColorEnable = enableSwitchView.isChecked
-            chromaColorFragment?.currentColor?.let { currentColor ->
-                onColorSelectedListener?.invoke(customColorEnable, currentColor)
-                database?.let {
-                    val newColor = if (customColorEnable) {
-                        ChromaUtil.getFormattedColorString(currentColor, false)
-                    } else {
-                        ""
-                    }
-                    val oldColor = database.customColor
-                    database.customColor = newColor
-                    saveColor(oldColor, newColor)
-                }
+            val newColor: Int? = if (enableSwitchView.isChecked)
+                chromaColorView.currentColor
+            else
+                null
+            onColorSelectedListener?.invoke(newColor)
+            database?.let {
+                val oldColor = database.customColor
+                database.customColor = newColor
+                saveColor(oldColor, newColor)
             }
         }
     }
 
-    /**
-     * Set new dimensions to dialog
-     * @param ad dialog
-     */
-    private fun measureLayout(ad: Dialog) {
-        val typedValue = TypedValue()
-        resources.getValue(com.kunzisoft.androidclearchroma.R.dimen.chroma_dialog_height_multiplier, typedValue, true)
-        val heightMultiplier = typedValue.float
-        val height = (ad.context.resources.displayMetrics.heightPixels * heightMultiplier).toInt()
-
-        resources.getValue(com.kunzisoft.androidclearchroma.R.dimen.chroma_dialog_width_multiplier, typedValue, true)
-        val widthMultiplier = typedValue.float
-        val width = (ad.context.resources.displayMetrics.widthPixels * widthMultiplier).toInt()
-
-        ad.window?.setLayout(width, height)
-    }
-
     override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? {
         super.onCreateView(inflater, container, savedInstanceState)
         return rootView
     }
 
-    companion object {
-        private const val TAG_FRAGMENT_COLORS = "TAG_FRAGMENT_COLORS"
+    override fun onSaveInstanceState(outState: Bundle) {
+        super.onSaveInstanceState(outState)
+        outState.putInt(ARG_INITIAL_COLOR, chromaColorView.currentColor)
+        outState.putBoolean(ARG_ACTIVATED, mActivated)
+    }
 
+    companion object {
+        private const val ARG_INITIAL_COLOR = "ARG_INITIAL_COLOR"
+        private const val ARG_ACTIVATED = "ARG_ACTIVATED"
         @ColorInt
         const val DEFAULT_COLOR: Int = Color.WHITE
 
@@ -151,9 +154,7 @@ class DatabaseColorPreferenceDialogFragmentCompat : DatabaseSavePreferenceDialog
             val fragment = DatabaseColorPreferenceDialogFragmentCompat()
             val bundle = Bundle(1)
             bundle.putString(ARG_KEY, key)
-            bundle.putInt(ARG_INITIAL_COLOR, Color.BLACK)
-            bundle.putInt(ARG_COLOR_MODE, ColorMode.RGB.ordinal)
-            bundle.putInt(ARG_INDICATOR_MODE, IndicatorMode.HEX.ordinal)
+            bundle.putInt(ARG_INITIAL_COLOR, DEFAULT_COLOR)
             fragment.arguments = bundle
 
             return fragment

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseSavePreferenceDialogFragmentCompat.kt

@@ -22,6 +22,7 @@ package com.kunzisoft.keepass.settings.preferencedialogfragment
 import android.content.Context
 import android.os.Bundle
 import androidx.fragment.app.activityViewModels
+import com.kunzisoft.androidclearchroma.ChromaUtil
 import com.kunzisoft.keepass.activities.legacy.DatabaseRetrieval
 import com.kunzisoft.keepass.database.crypto.EncryptionAlgorithm
 import com.kunzisoft.keepass.database.crypto.kdf.KdfEngine
@@ -76,9 +77,17 @@ abstract class DatabaseSavePreferenceDialogFragmentCompat
         // To inherit to save element in database
     }
 
-    protected fun saveColor(oldColor: String,
-                            newColor: String) {
-        mDatabaseViewModel.saveColor(oldColor, newColor, mDatabaseAutoSaveEnable)
+    protected fun saveColor(oldColor: Int?,
+                            newColor: Int?) {
+        val oldColorString = if (oldColor != null)
+                ChromaUtil.getFormattedColorString(oldColor, false)
+            else
+                ""
+        val newColorString = if (newColor != null)
+            ChromaUtil.getFormattedColorString(newColor, false)
+        else
+            ""
+        mDatabaseViewModel.saveColor(oldColorString, newColorString, mDatabaseAutoSaveEnable)
     }
 
     protected fun saveCompression(oldCompression: CompressionAlgorithm,

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DurationDialogFragmentCompat.kt

@@ -19,7 +19,13 @@
  */
 package com.kunzisoft.keepass.settings.preferencedialogfragment
 
+import android.app.AlarmManager
+import android.content.Context
+import android.content.Intent
+import android.os.Build
 import android.os.Bundle
+import android.provider.Settings.ACTION_REQUEST_SCHEDULE_EXACT_ALARM
+import android.util.Log
 import android.view.View
 import android.widget.NumberPicker
 import com.kunzisoft.keepass.R
@@ -62,13 +68,39 @@ class DurationDialogFragmentCompat : InputPreferenceDialogFragmentCompat() {
         }
     }
 
+    override fun onResume() {
+        super.onResume()
+
+        (context?.applicationContext?.getSystemService(Context.ALARM_SERVICE) as AlarmManager?)?.let { alarmManager ->
+            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S
+                && !alarmManager.canScheduleExactAlarms()) {
+                setExplanationText(R.string.warning_exact_alarm)
+                setExplanationButton(R.string.permission) {
+                    // Open the exact alarm permission screen
+                    try {
+                        startActivity(Intent().apply {
+                            action = ACTION_REQUEST_SCHEDULE_EXACT_ALARM
+                        })
+                    } catch (e: Exception) {
+                        Log.e(TAG, "Unable to open exact alarm permission screen", e)
+                    }
+                }
+            } else {
+                explanationText = ""
+                setExplanationButton("") {}
+            }
+        }
+    }
+
     private fun durationToDaysHoursMinutesSeconds(duration: Long) {
         if (duration < 0) {
+            mEnabled = false
             mDays = 0
             mHours = 0
             mMinutes = 0
             mSeconds = 0
         } else {
+            mEnabled = true
             mDays = (duration / (24L * 60L * 60L * 1000L)).toInt()
             val daysMilliseconds = mDays * 24L * 60L * 60L * 1000L
             mHours = ((duration - daysMilliseconds) / (60L * 60L * 1000L)).toInt()
@@ -127,7 +159,7 @@ class DurationDialogFragmentCompat : InputPreferenceDialogFragmentCompat() {
 
         setSwitchAction({ isChecked ->
             mEnabled = isChecked
-        }, mDays + mHours + mMinutes + mSeconds > 0)
+        }, mEnabled)
 
         assignValuesInViews()
     }
@@ -162,6 +194,7 @@ class DurationDialogFragmentCompat : InputPreferenceDialogFragmentCompat() {
     }
 
     companion object {
+        private const val TAG = "DurationDialogFrgCmpt"
         private const val ENABLE_KEY = "ENABLE_KEY"
         private const val DAYS_KEY = "DAYS_KEY"
         private const val HOURS_KEY = "HOURS_KEY"

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/InputPreferenceDialogFragmentCompat.kt

@@ -22,6 +22,7 @@ package com.kunzisoft.keepass.settings.preferencedialogfragment
 import android.view.View
 import android.view.inputmethod.EditorInfo
 import android.view.inputmethod.InputMethodManager
+import android.widget.Button
 import android.widget.CompoundButton
 import android.widget.EditText
 import android.widget.TextView
@@ -35,6 +36,7 @@ abstract class InputPreferenceDialogFragmentCompat : PreferenceDialogFragmentCom
     private var inputTextView: EditText? = null
     private var textUnitView: TextView? = null
     private var textExplanationView: TextView? = null
+    private var explanationButton: Button? = null
     private var switchElementView: CompoundButton? = null
 
     private var mOnInputTextEditorActionListener: TextView.OnEditorActionListener? = null
@@ -100,6 +102,27 @@ abstract class InputPreferenceDialogFragmentCompat : PreferenceDialogFragmentCom
         explanationText = getString(explanationTextId)
     }
 
+    val explanationButtonText: String?
+        get() = explanationButton?.text?.toString() ?: ""
+
+    fun setExplanationButton(explanationButtonText: String?, clickListener: View.OnClickListener) {
+        explanationButton?.apply {
+            if (explanationButtonText != null && explanationButtonText.isNotEmpty()) {
+                text = explanationButtonText
+                visibility = View.VISIBLE
+                setOnClickListener(clickListener)
+            } else {
+                text = ""
+                visibility = View.GONE
+                setOnClickListener(null)
+            }
+        }
+    }
+
+    fun setExplanationButton(@StringRes explanationButtonTextId: Int, clickListener: View.OnClickListener) {
+        setExplanationButton(getString(explanationButtonTextId), clickListener)
+    }
+
     override fun onBindDialogView(view: View) {
         super.onBindDialogView(view)
 
@@ -128,6 +151,8 @@ abstract class InputPreferenceDialogFragmentCompat : PreferenceDialogFragmentCom
         textUnitView?.visibility = View.GONE
         textExplanationView = view.findViewById(R.id.explanation_text)
         textExplanationView?.visibility = View.GONE
+        explanationButton = view.findViewById(R.id.explanation_button)
+        explanationButton?.visibility = View.GONE
         switchElementView = view.findViewById(R.id.switch_element)
         switchElementView?.visibility = View.GONE
     }
@@ -155,6 +180,10 @@ abstract class InputPreferenceDialogFragmentCompat : PreferenceDialogFragmentCom
         }
     }
 
+    fun isSwitchActivated(): Boolean {
+        return switchElementView?.isChecked == true
+    }
+
     fun activateSwitch() {
         if (switchElementView?.isChecked != true)
             switchElementView?.isChecked = true

app/src/main/java/com/kunzisoft/keepass/tasks/ActionRunnable.kt

@@ -31,9 +31,13 @@ abstract class ActionRunnable: Runnable {
     var result: Result = Result()
 
     override fun run() {
-        onStartRun()
-        onActionRun()
-        onFinishRun()
+        try {
+            onStartRun()
+            onActionRun()
+            onFinishRun()
+        } catch (runException: Exception) {
+            setError(runException)
+        }
     }
 
     abstract fun onStartRun()

app/src/main/java/com/kunzisoft/keepass/timeout/TimeoutHelper.kt

@@ -43,9 +43,14 @@ object TimeoutHelper {
 
     private fun getLockPendingIntent(context: Context): PendingIntent {
         return PendingIntent.getBroadcast(context.applicationContext,
-                REQUEST_ID,
-                Intent(LOCK_ACTION),
-                PendingIntent.FLAG_CANCEL_CURRENT)
+            REQUEST_ID,
+            Intent(LOCK_ACTION),
+            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+                PendingIntent.FLAG_IMMUTABLE or PendingIntent.FLAG_CANCEL_CURRENT
+            } else {
+                PendingIntent.FLAG_CANCEL_CURRENT
+            }
+        )
     }
 
     /**
@@ -61,9 +66,26 @@ object TimeoutHelper {
                     val triggerTime = System.currentTimeMillis() + timeout
                     Log.d(TAG, "TimeoutHelper start")
                     if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.KITKAT) {
-                        alarmManager.setExact(AlarmManager.RTC, triggerTime, getLockPendingIntent(context))
+                        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S
+                            && !alarmManager.canScheduleExactAlarms()) {
+                            alarmManager.set(
+                                AlarmManager.RTC,
+                                triggerTime,
+                                getLockPendingIntent(context)
+                            )
+                        } else {
+                            alarmManager.setExact(
+                                AlarmManager.RTC,
+                                triggerTime,
+                                getLockPendingIntent(context)
+                            )
+                        }
                     } else {
-                        alarmManager.set(AlarmManager.RTC, triggerTime, getLockPendingIntent(context))
+                        alarmManager.set(
+                            AlarmManager.RTC,
+                            triggerTime,
+                            getLockPendingIntent(context)
+                        )
                     }
                 }
             }

app/src/main/java/com/kunzisoft/keepass/utils/BroadcastAction.kt

@@ -60,18 +60,41 @@ class LockReceiver(var lockAction: () -> Unit) : BroadcastReceiver() {
                     Intent.ACTION_SCREEN_OFF -> {
                         if (PreferencesUtil.isLockDatabaseWhenScreenShutOffEnable(context)) {
                             mLockPendingIntent = PendingIntent.getBroadcast(context,
-                                    4575,
-                                    Intent(intent).apply {
-                                        action = LOCK_ACTION
-                                    },
-                                    0)
+                                4575,
+                                Intent(intent).apply {
+                                    action = LOCK_ACTION
+                                },
+                                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+                                    PendingIntent.FLAG_IMMUTABLE
+                                } else {
+                                    0
+                                }
+                            )
                             // Launch the effective action after a small time
                             val first: Long = System.currentTimeMillis() + context.getString(R.string.timeout_screen_off).toLong()
-                            val alarmManager = context.getSystemService(ALARM_SERVICE) as AlarmManager?
-                            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.KITKAT) {
-                                alarmManager?.setExact(AlarmManager.RTC_WAKEUP, first, mLockPendingIntent)
-                            } else {
-                                alarmManager?.set(AlarmManager.RTC_WAKEUP, first, mLockPendingIntent)
+                            (context.getSystemService(ALARM_SERVICE) as AlarmManager?)?.let { alarmManager ->
+                                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.KITKAT) {
+                                    if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S
+                                        && !alarmManager.canScheduleExactAlarms()) {
+                                        alarmManager.set(
+                                            AlarmManager.RTC_WAKEUP,
+                                            first,
+                                            mLockPendingIntent
+                                        )
+                                    } else {
+                                        alarmManager.setExact(
+                                            AlarmManager.RTC_WAKEUP,
+                                            first,
+                                            mLockPendingIntent
+                                        )
+                                    }
+                                } else {
+                                    alarmManager.set(
+                                        AlarmManager.RTC_WAKEUP,
+                                        first,
+                                        mLockPendingIntent
+                                    )
+                                }
                             }
                         } else {
                             cancelLockPendingIntent(context)

app/src/main/java/com/kunzisoft/keepass/utils/DexUtil.kt

@@ -0,0 +1,27 @@
+package com.kunzisoft.keepass.utils
+
+import android.content.res.Configuration
+import android.util.Log
+
+object DexUtil {
+    private val TAG = DexUtil::class.java.name
+
+    // Determine if the current environment is in DeX mode. Always returns false on non-Samsung
+    // devices.
+    fun isDexMode(config: Configuration): Boolean {
+        // This is the documented way to check this: https://developer.samsung.com/samsung-dex/modify-optimizing.html
+        return try {
+            val configClass = config.javaClass
+            val enabledConstant = configClass.getField("SEM_DESKTOP_MODE_ENABLED").getInt(configClass)
+            val enabledField = configClass.getField("semDesktopModeEnabled").getInt(config)
+            val isEnabled = enabledConstant == enabledField
+
+            Log.d(TAG, "DeX currently enabled: $isEnabled")
+
+            isEnabled
+        } catch (e: Exception) {
+            Log.d(TAG, "Failed to check for DeX mode; likely not Samsung device: $e")
+            false
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/utils/MagikeyboardUtil.kt

@@ -0,0 +1,27 @@
+package com.kunzisoft.keepass.utils
+
+import android.content.ComponentName
+import android.content.Context
+import android.content.pm.PackageManager
+import android.util.Log
+import com.kunzisoft.keepass.magikeyboard.MagikeyboardService
+
+object MagikeyboardUtil {
+    private val TAG = MagikeyboardUtil::class.java.name
+
+    // Set whether MagikeyboardService is enabled. This change is persistent and survives app
+    // crashes and device restarts. The state is changed immediately and does not require an app
+    // restart.
+    fun setEnabled(context: Context, enabled: Boolean) {
+        val componentState = if (enabled) {
+            PackageManager.COMPONENT_ENABLED_STATE_ENABLED
+        } else {
+            PackageManager.COMPONENT_ENABLED_STATE_DISABLED
+        }
+
+        Log.d(TAG, "Setting service state: $enabled")
+
+        val component = ComponentName(context, MagikeyboardService::class.java)
+        context.packageManager.setComponentEnabledSetting(component, componentState, PackageManager.DONT_KILL_APP)
+    }
+}