Merge branch 'release/4.2.1'

Currently translated at 100.0% (3 of 3 strings)

Translation: KeePassDX/Metadata
Translate-URL: https://hosted.weblate.org/projects/keepass-dx/metadata/it/

.github/ISSUE_TEMPLATE/bug_report.yml

@@ -1,4 +1,4 @@
-name: Bug Report
+name: Bug report
 description: Report a bug.
 labels: ["bug"]
 body:

CHANGELOG

@@ -1,5 +1,24 @@
+KeePassDX(4.2.1)
+ * Fix Magikeyboard autosearch #2233
+ * Fix database merge #2223
+ * Fix dialog database action #2234
+ * Fix autofill selection #2238 #2235
+ * Small fixes
+
 KeePassDX(4.2.0)
- * Passkeys management #1421 #2097 (Thx @cali-95)
+ * Passkeys management #1421 #2097 (@cali-95)
+ * Confirm usage of passkey #2165 #2124
+ * Dialog to manage missing signature #2152 #2155 #2161 #2160
+ * Capture error #2159 #2215
+ * Change Passkey Backup Eligibility & Backup State #2135 #2150 #2212
+ * Search settings #2112 #2181 #2187 #2204
+ * Autofill refactoring #765 #2196
+ * Small fixes #2157 #2164 #2171 #2122 #2180 #2209 #2214
+
+KeePassDX(4.1.9)
+ * Fix landscape UI #2198 #2200 (@chenxiaolong)
+ * Fix start loop and flash screen #2201
+ * Small fixes
 
 KeePassDX(4.1.8)
  * Updated to API 35 minimum SDK 19 #2073 #2138 #2067 #2133 #1687 (Thx @Dev-ClayP)

README.md

@@ -6,19 +6,21 @@
 
 ### Features
 
- - Create database files / entries and groups.
- - Support for **.kdb** and **.kdbx** files (version 1 to 4) with AES - Twofish - ChaCha20 - Argon2 algorithm.
- - **Compatible** with the majority of alternative programs (KeePass, KeePassXC, KeeWeb, …).
+ - **Passkeys** for authentication and **local storage of private keys**.
+ - **Biometric recognition** for fast unlocking (fingerprint / face unlock / …).
+ - **One-Time Password** management (HOTP / TOTP) for two-factor authentication (2FA).
+ - **Autofill** for easy form filling with passwords.
+ - **Magikeyboard** to efficiently fill in any field.
+ - Create **encrypted database files**.
+ - Organisation of credentials by **entry** and in **group** trees.
  - Allows opening and **copying URI / URL fields quickly**.
- - **Biometric recognition** for fast unlocking *(fingerprint / face unlock / …)*.
- - **One-Time Password** management *(HOTP / TOTP)* for Two-factor authentication (2FA).
- - Material design with **themes**.
- - **Auto-Fill** and Integration.
- - Field filling **keyboard**.
- - Dynamic **templates** 
+ - Dynamic **templates**  for each type of entry.
  - **History** of each entry.
  - Precise management of **settings**.
- - Code written in **native languages** *(Kotlin / Java / JNI / C)*.
+ - Material design with **themes**.
+ - Support for **.kdb** and **.kdbx** files (version 1 to 4) with AES - Twofish - ChaCha20 - Argon2 algorithm.
+ - **Compatible** with the majority of alternative programs (KeePass, KeePassXC, KeeWeb, …).
+ - Code written in **native languages** (Kotlin / Java / JNI / C).
 
 KeePassDX is **open source** and **ad-free**.
 

app/build.gradle

@@ -11,8 +11,8 @@ android {
         applicationId "com.kunzisoft.keepass"
         minSdkVersion 19
         targetSdkVersion 35
-        versionCode = 142
-        versionName = "4.2.0beta02"
+        versionCode = 146
+        versionName = "4.2.1"
         multiDexEnabled true
 
         testApplicationId = "com.kunzisoft.keepass.tests"

app/src/free/assets/passkeys_privileged_apps_community.json

@@ -48,6 +48,18 @@
         ]
       }
     },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.ironfoxoss.ironfox.nightly",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "C5:E2:91:B5:A5:71:F9:C8:CD:9A:97:99:C2:C9:4E:02:EC:97:03:94:88:93:F2:CA:75:6D:67:B9:42:04:F9:04"
+          }
+        ]
+      }
+    },
     {
       "type": "android",
       "info": {

app/src/main/AndroidManifest.xml

@@ -178,18 +178,22 @@
         <activity
             android:name="com.kunzisoft.keepass.settings.AppearanceSettingsActivity" />
         <activity
-            android:name="com.kunzisoft.keepass.hardware.HardwareKeyActivity"
-            android:theme="@style/Theme.Transparent" />
+            android:name="com.kunzisoft.keepass.credentialprovider.activity.HardwareKeyActivity"
+            android:theme="@style/Theme.Transparent"
+            android:exported="false"
+            android:excludeFromRecents="true" />
         <activity
             android:name="com.kunzisoft.keepass.credentialprovider.activity.AutofillLauncherActivity"
             android:theme="@style/Theme.Transparent"
             android:configChanges="keyboardHidden"
-            android:excludeFromRecents="true"/>
+            android:exported="false"
+            android:excludeFromRecents="true" />
         <activity
             android:name="com.kunzisoft.keepass.credentialprovider.activity.EntrySelectionLauncherActivity"
             android:theme="@style/Theme.Transparent"
             android:launchMode="singleInstance"
-            android:exported="true">
+            android:exported="true"
+            android:excludeFromRecents="true">
             <intent-filter>
                 <action android:name="android.intent.action.SEND" />
                 <category android:name="android.intent.category.DEFAULT" />
@@ -208,8 +212,8 @@
             android:name="com.kunzisoft.keepass.credentialprovider.activity.PasskeyLauncherActivity"
             android:theme="@style/Theme.Transparent"
             android:configChanges="keyboardHidden"
-            android:excludeFromRecents="true"
             android:exported="false"
+            android:excludeFromRecents="true"
             tools:targetApi="upside_down_cake" />
         <service
             android:name="com.kunzisoft.keepass.services.DatabaseTaskNotificationService"

app/src/main/java/com/kunzisoft/keepass/activities/EntryActivity.kt

@@ -79,11 +79,13 @@ import com.kunzisoft.keepass.view.hideByFading
 import com.kunzisoft.keepass.view.setTransparentNavigationBar
 import com.kunzisoft.keepass.view.showActionErrorIfNeeded
 import com.kunzisoft.keepass.viewmodels.EntryViewModel
+import java.util.EnumSet
 import java.util.UUID
 
 class EntryActivity : DatabaseLockActivity() {
 
     private var footer: ViewGroup? = null
+    private var container: View? = null
     private var coordinatorLayout: CoordinatorLayout? = null
     private var collapsingToolbarLayout: CollapsingToolbarLayout? = null
     private var appBarLayout: AppBarLayout? = null
@@ -135,6 +137,7 @@ class EntryActivity : DatabaseLockActivity() {
 
         // Get views
         footer = findViewById(R.id.activity_entry_footer)
+        container = findViewById(R.id.activity_entry_container)
         coordinatorLayout = findViewById(R.id.toolbar_coordinator)
         collapsingToolbarLayout = findViewById(R.id.toolbar_layout)
         appBarLayout = findViewById(R.id.app_bar)
@@ -150,8 +153,12 @@ class EntryActivity : DatabaseLockActivity() {
         setTransparentNavigationBar {
             // To fix margin with API 27
             ViewCompat.setOnApplyWindowInsetsListener(collapsingToolbarLayout!!, null)
-            coordinatorLayout?.applyWindowInsets(WindowInsetPosition.TOP)
-            footer?.applyWindowInsets(WindowInsetPosition.BOTTOM)
+            container?.applyWindowInsets(EnumSet.of(
+                WindowInsetPosition.TOP_MARGINS,
+                WindowInsetPosition.BOTTOM_MARGINS,
+                WindowInsetPosition.START_MARGINS,
+                WindowInsetPosition.END_MARGINS,
+            ))
         }
 
         // Empty title
@@ -305,11 +312,11 @@ class EntryActivity : DatabaseLockActivity() {
         mEntryViewModel.historySelected.observe(this) { historySelected ->
             mDatabase?.let { database ->
                 launch(
-                    this,
-                    database,
-                    historySelected.nodeId,
-                    historySelected.historyPosition,
-                    mEntryActivityResultLauncher
+                    activity = this,
+                    database = database,
+                    entryId = historySelected.nodeId,
+                    historyPosition = historySelected.historyPosition,
+                    activityResultLauncher = mEntryActivityResultLauncher
                 )
             }
         }
@@ -323,9 +330,8 @@ class EntryActivity : DatabaseLockActivity() {
         return coordinatorLayout
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
-
         mEntryViewModel.loadDatabase(database)
     }
 
@@ -471,11 +477,12 @@ class EntryActivity : DatabaseLockActivity() {
             R.id.menu_edit -> {
                 mDatabase?.let { database ->
                     mMainEntryId?.let { entryId ->
-                        EntryEditActivity.launchToUpdate(
-                            this,
-                            database,
-                            entryId,
-                            mEntryActivityResultLauncher
+                        EntryEditActivity.launch(
+                            activity = this,
+                            database = database,
+                            registrationType = EntryEditActivity.RegistrationType.UPDATE,
+                            nodeId = entryId,
+                            activityResultLauncher = mEntryActivityResultLauncher
                         )
                     }
                 }
@@ -513,7 +520,7 @@ class EntryActivity : DatabaseLockActivity() {
         // Transit data in previous Activity after an update
         Intent().apply {
             putExtra(EntryEditActivity.ADD_OR_UPDATE_ENTRY_KEY, mMainEntryId)
-            setResult(Activity.RESULT_OK, this)
+            setResult(RESULT_OK, this)
         }
         super.finish()
     }
@@ -527,34 +534,22 @@ class EntryActivity : DatabaseLockActivity() {
         const val ENTRY_FRAGMENT_TAG = "ENTRY_FRAGMENT_TAG"
 
         /**
-         * Open standard Entry activity
+         * Open standard or history Entry activity
          */
-        fun launch(activity: Activity,
-                   database: ContextualDatabase,
-                   entryId: NodeId<UUID>,
-                   activityResultLauncher: ActivityResultLauncher<Intent>) {
+        fun launch(
+            activity: Activity,
+            database: ContextualDatabase,
+            entryId: NodeId<UUID>,
+            historyPosition: Int? = null,
+            activityResultLauncher: ActivityResultLauncher<Intent>
+        ) {
             if (database.loaded) {
                 if (TimeoutHelper.checkTimeAndLockIfTimeout(activity)) {
                     val intent = Intent(activity, EntryActivity::class.java)
                     intent.putExtra(KEY_ENTRY, entryId)
-                    activityResultLauncher.launch(intent)
-                }
-            }
-        }
-
-        /**
-         * Open history Entry activity
-         */
-        fun launch(activity: Activity,
-                   database: ContextualDatabase,
-                   entryId: NodeId<UUID>,
-                   historyPosition: Int,
-                   activityResultLauncher: ActivityResultLauncher<Intent>) {
-            if (database.loaded) {
-                if (TimeoutHelper.checkTimeAndLockIfTimeout(activity)) {
-                    val intent = Intent(activity, EntryActivity::class.java)
-                    intent.putExtra(KEY_ENTRY, entryId)
-                    intent.putExtra(KEY_ENTRY_HISTORY_POSITION, historyPosition)
+                    historyPosition?.let {
+                        intent.putExtra(KEY_ENTRY_HISTORY_POSITION, historyPosition)
+                    }
                     activityResultLauncher.launch(intent)
                 }
             }

app/src/main/java/com/kunzisoft/keepass/activities/EntryEditActivity.kt

@@ -36,14 +36,14 @@ import android.widget.Spinner
 import androidx.activity.result.ActivityResultLauncher
 import androidx.activity.result.contract.ActivityResultContracts
 import androidx.activity.viewModels
-import androidx.annotation.RequiresApi
 import androidx.appcompat.app.AlertDialog
-import androidx.appcompat.app.AppCompatActivity
 import androidx.coordinatorlayout.widget.CoordinatorLayout
 import androidx.core.view.isVisible
 import androidx.core.widget.NestedScrollView
-import androidx.fragment.app.Fragment
 import androidx.fragment.app.FragmentActivity
+import androidx.lifecycle.Lifecycle
+import androidx.lifecycle.lifecycleScope
+import androidx.lifecycle.repeatOnLifecycle
 import com.google.android.material.datepicker.MaterialDatePicker
 import com.google.android.material.snackbar.Snackbar
 import com.google.android.material.timepicker.MaterialTimePicker
@@ -59,10 +59,10 @@ import com.kunzisoft.keepass.activities.helpers.ExternalFileHelper
 import com.kunzisoft.keepass.activities.legacy.DatabaseLockActivity
 import com.kunzisoft.keepass.adapters.TemplatesSelectorAdapter
 import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.buildSpecialModeResponseAndSetResult
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveRegisterInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSearchInfo
 import com.kunzisoft.keepass.credentialprovider.TypeMode
-import com.kunzisoft.keepass.credentialprovider.autofill.AutofillComponent
-import com.kunzisoft.keepass.credentialprovider.autofill.AutofillHelper
-import com.kunzisoft.keepass.credentialprovider.magikeyboard.MagikeyboardService
 import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.buildPasskeyResponseAndSetResult
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.element.Attachment
@@ -101,6 +101,8 @@ import com.kunzisoft.keepass.view.showActionErrorIfNeeded
 import com.kunzisoft.keepass.view.updateLockPaddingStart
 import com.kunzisoft.keepass.viewmodels.ColorPickerViewModel
 import com.kunzisoft.keepass.viewmodels.EntryEditViewModel
+import kotlinx.coroutines.launch
+import java.util.EnumSet
 import java.util.UUID
 
 class EntryEditActivity : DatabaseLockActivity(),
@@ -155,9 +157,6 @@ class EntryEditActivity : DatabaseLockActivity(),
         }
     }
 
-    // To ask data lost only one time
-    private var backPressedAlreadyApproved = false
-
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
         setContentView(R.layout.activity_entry_edit)
@@ -181,8 +180,12 @@ class EntryEditActivity : DatabaseLockActivity(),
 
         // To apply fit window with transparency
         setTransparentNavigationBar(applyToStatusBar = true) {
-            container?.applyWindowInsets(WindowInsetPosition.TOP_BOTTOM_IME)
-            footer?.applyWindowInsets(WindowInsetPosition.BOTTOM_IME)
+            container?.applyWindowInsets(EnumSet.of(
+                WindowInsetPosition.TOP_MARGINS,
+                WindowInsetPosition.BOTTOM_MARGINS,
+                WindowInsetPosition.START_MARGINS,
+                WindowInsetPosition.END_MARGINS,
+            ))
         }
 
         stopService(Intent(this, ClipboardEntryNotificationService::class.java))
@@ -206,8 +209,8 @@ class EntryEditActivity : DatabaseLockActivity(),
             mDatabase,
             entryId,
             parentId,
-            EntrySelectionHelper.retrieveRegisterInfoFromIntent(intent),
-            EntrySelectionHelper.retrieveSearchInfoFromIntent(intent)
+            intent.retrieveRegisterInfo()
+                ?: intent.retrieveSearchInfo()?.toRegisterInfo()
         )
 
         // To retrieve attachment
@@ -374,30 +377,30 @@ class EntryEditActivity : DatabaseLockActivity(),
             } ?: run {
                 updateEntry(entrySave.oldEntry, entrySave.newEntry)
             }
+        }
 
-            // Don't wait for saving if it's to provide autofill
-            mDatabase?.let { database ->
-                EntrySelectionHelper.doSpecialAction(
-                    intent = intent,
-                    defaultAction = {},
-                    searchAction = {},
-                    saveAction = {},
-                    keyboardSelectionAction = {
-                        entryValidatedForKeyboardSelection(database, entrySave.newEntry)
-                    },
-                    autofillSelectionAction = { _, _ ->
-                        entryValidatedForAutofillSelection(database, entrySave.newEntry)
-                    },
-                    autofillRegistrationAction = {
-                        entryValidatedForAutofillRegistration(entrySave.newEntry)
-                    },
-                    passkeySelectionAction = {
-                        entryValidatedForPasskeySelection(database, entrySave.newEntry)
-                    },
-                    passkeyRegistrationAction = {
-                        entryValidatedForPasskeyRegistration(database, entrySave.newEntry)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.STARTED) {
+                mEntryEditViewModel.uiState.collect { uiState ->
+                    when (uiState) {
+                        EntryEditViewModel.UIState.Loading -> {}
+                        EntryEditViewModel.UIState.ShowOverwriteMessage -> {
+                            if (mEntryEditViewModel.warningOverwriteDataAlreadyApproved.not()) {
+                                AlertDialog.Builder(this@EntryEditActivity)
+                                    .setTitle(R.string.warning_overwrite_data_title)
+                                    .setMessage(R.string.warning_overwrite_data_description)
+                                    .setNegativeButton(android.R.string.cancel) { _, _ ->
+                                        mEntryEditViewModel.backPressedAlreadyApproved = true
+                                        onCancelSpecialMode()
+                                    }
+                                    .setPositiveButton(android.R.string.ok) { _, _ ->
+                                        mEntryEditViewModel.warningOverwriteDataAlreadyApproved = true
+                                    }
+                                    .create().show()
+                            }
+                        }
                     }
-                )
+                }
             }
         }
     }
@@ -410,13 +413,13 @@ class EntryEditActivity : DatabaseLockActivity(),
         return true
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
-        mAllowCustomFields = database?.allowEntryCustomFields() == true
-        mAllowOTP = database?.allowOTP == true
-        mEntryEditViewModel.loadDatabase(database)
+        mAllowCustomFields = database.allowEntryCustomFields() == true
+        mAllowOTP = database.allowOTP == true
+        mEntryEditViewModel.loadTemplateEntry(database)
         mTemplatesSelectorAdapter?.apply {
-            iconDrawableFactory = mDatabase?.iconDrawableFactory
+            iconDrawableFactory = database.iconDrawableFactory
             notifyDataSetChanged()
         }
     }
@@ -427,6 +430,7 @@ class EntryEditActivity : DatabaseLockActivity(),
         result: ActionRunnable.Result
     ) {
         super.onDatabaseActionFinished(database, actionTask, result)
+        mEntryEditViewModel.unlockAction()
         when (actionTask) {
             ACTION_DATABASE_CREATE_ENTRY_TASK,
             ACTION_DATABASE_UPDATE_ENTRY_TASK -> {
@@ -442,23 +446,27 @@ class EntryEditActivity : DatabaseLockActivity(),
                                 searchAction = {
                                     // Nothing when search retrieved
                                 },
-                                saveAction = {
-                                    entryValidatedForSave(entry)
+                                selectionAction = { intentSender, typeMode, searchInfo ->
+                                    when(typeMode) {
+                                        TypeMode.DEFAULT -> {}
+                                        TypeMode.MAGIKEYBOARD ->
+                                            entryValidatedForKeyboardSelection(database, entry)
+                                        TypeMode.PASSKEY ->
+                                            entryValidatedForPasskey(database, entry)
+                                        TypeMode.AUTOFILL ->
+                                            entryValidatedForAutofill(database, entry)
+                                    }
                                 },
-                                keyboardSelectionAction = {
-                                    entryValidatedForKeyboardSelection(database, entry)
-                                },
-                                autofillSelectionAction = { _, _ ->
-                                    entryValidatedForAutofillSelection(database, entry)
-                                },
-                                autofillRegistrationAction = {
-                                    entryValidatedForAutofillRegistration(entry)
-                                },
-                                passkeySelectionAction = {
-                                    entryValidatedForPasskeySelection(database, entry)
-                                },
-                                passkeyRegistrationAction = {
-                                    entryValidatedForPasskeyRegistration(database, entry)
+                                registrationAction = { _, typeMode, _ ->
+                                    when(typeMode) {
+                                        TypeMode.DEFAULT ->
+                                            entryValidatedForSave(entry)
+                                        TypeMode.MAGIKEYBOARD -> {}
+                                        TypeMode.PASSKEY ->
+                                            entryValidatedForPasskey(database, entry)
+                                        TypeMode.AUTOFILL ->
+                                            entryValidatedForAutofill(database, entry)
+                                    }
                                 }
                             )
                         }
@@ -477,46 +485,26 @@ class EntryEditActivity : DatabaseLockActivity(),
     }
 
     private fun entryValidatedForKeyboardSelection(database: ContextualDatabase, entry: Entry) {
-        // Populate Magikeyboard with entry
-        MagikeyboardService.populateKeyboardAndMoveAppToBackground(
-            this,
-            entry.getEntryInfo(database)
+        // Build Magikeyboard response with the entry selected
+        this.buildSpecialModeResponseAndSetResult(
+            entryInfo = entry.getEntryInfo(database),
+            extras = buildEntryResult(entry)
         )
         onValidateSpecialMode()
-        // Don't keep activity history for entry edition
-        finishForEntryResult(entry)
     }
 
-    private fun entryValidatedForAutofillSelection(database: ContextualDatabase, entry: Entry) {
+    private fun entryValidatedForAutofill(database: ContextualDatabase, entry: Entry) {
         // Build Autofill response with the entry selected
         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
-            AutofillHelper.buildResponseAndSetResult(this@EntryEditActivity,
-                    database,
-                    entry.getEntryInfo(database))
-        }
-        onValidateSpecialMode()
-    }
-
-    private fun entryValidatedForPasskeySelection(database: ContextualDatabase, entry: Entry) {
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.UPSIDE_DOWN_CAKE) {
-            this.buildPasskeyResponseAndSetResult(
-                entryInfo = entry.getEntryInfo(database)
+            this.buildSpecialModeResponseAndSetResult(
+                entryInfo = entry.getEntryInfo(database),
+                extras = buildEntryResult(entry)
             )
         }
         onValidateSpecialMode()
     }
 
-    private fun entryValidatedForAutofillRegistration(entry: Entry) {
-        //if (isIntentSender()) {
-            // TODO Autofill Callback #765
-        //}
-        onValidateSpecialMode()
-        if (!isIntentSender()) {
-            finishForEntryResult(entry)
-        }
-    }
-
-    private fun entryValidatedForPasskeyRegistration(database: ContextualDatabase, entry: Entry) {
+    private fun entryValidatedForPasskey(database: ContextualDatabase, entry: Entry) {
         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.UPSIDE_DOWN_CAKE) {
             this.buildPasskeyResponseAndSetResult(
                 entryInfo = entry.getEntryInfo(database),
@@ -757,13 +745,13 @@ class EntryEditActivity : DatabaseLockActivity(),
     }
 
     private fun onApprovedBackPressed(approved: () -> Unit) {
-        if (!backPressedAlreadyApproved) {
+        if (mEntryEditViewModel.backPressedAlreadyApproved.not()) {
             AlertDialog.Builder(this)
                     .setMessage(R.string.discard_changes)
                     .setNegativeButton(android.R.string.cancel, null)
                     .setPositiveButton(R.string.discard) { _, _ ->
                         mAttachmentFileBinderManager?.stopUploadAllAttachments()
-                        backPressedAlreadyApproved = true
+                        mEntryEditViewModel.backPressedAlreadyApproved = true
                         approved.invoke()
                     }.create().show()
         } else {
@@ -783,7 +771,7 @@ class EntryEditActivity : DatabaseLockActivity(),
             val bundle = buildEntryResult(entry)
             val intentEntry = Intent()
             intentEntry.putExtras(bundle)
-            setResult(Activity.RESULT_OK, intentEntry)
+            setResult(RESULT_OK, intentEntry)
             super.finish()
         } catch (e: Exception) {
             // Exception when parcelable can't be done
@@ -791,6 +779,10 @@ class EntryEditActivity : DatabaseLockActivity(),
         }
     }
 
+    enum class RegistrationType {
+        UPDATE, CREATE
+    }
+
     companion object {
 
         private val TAG = EntryEditActivity::class.java.name
@@ -800,23 +792,12 @@ class EntryEditActivity : DatabaseLockActivity(),
         const val KEY_PARENT = "parent"
         const val ADD_OR_UPDATE_ENTRY_KEY = "ADD_OR_UPDATE_ENTRY_KEY"
 
-        fun registerForEntryResult(fragment: Fragment,
-                                   entryAddedOrUpdatedListener: (NodeId<UUID>?) -> Unit): ActivityResultLauncher<Intent> {
-            return fragment.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) { result ->
-                if (result.resultCode == Activity.RESULT_OK) {
-                    entryAddedOrUpdatedListener.invoke(
-                        result.data?.getParcelableExtraCompat(ADD_OR_UPDATE_ENTRY_KEY)
-                    )
-                } else {
-                    entryAddedOrUpdatedListener.invoke(null)
-                }
-            }
-        }
-
-        fun registerForEntryResult(activity: FragmentActivity,
-                                   entryAddedOrUpdatedListener: (NodeId<UUID>?) -> Unit): ActivityResultLauncher<Intent> {
+        fun registerForEntryResult(
+            activity: FragmentActivity,
+            entryAddedOrUpdatedListener: (NodeId<UUID>?) -> Unit
+        ): ActivityResultLauncher<Intent> {
             return activity.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) { result ->
-                if (result.resultCode == Activity.RESULT_OK) {
+                if (result.resultCode == RESULT_OK) {
                     entryAddedOrUpdatedListener.invoke(
                         result.data?.getParcelableExtraCompat(ADD_OR_UPDATE_ENTRY_KEY)
                     )
@@ -827,176 +808,72 @@ class EntryEditActivity : DatabaseLockActivity(),
         }
 
         /**
-         * Launch EntryEditActivity to update an existing entry by his [entryId]
+         * Launch EntryEditActivity to update an existing entry or to add a new entry in an existing group
          */
-        fun launchToUpdate(activity: Activity,
-                           database: ContextualDatabase,
-                           entryId: NodeId<UUID>,
-                           activityResultLauncher: ActivityResultLauncher<Intent>) {
+        fun launch(
+            activity: Activity,
+            database: ContextualDatabase,
+            registrationType: RegistrationType,
+            nodeId: NodeId<*>,
+            activityResultLauncher: ActivityResultLauncher<Intent>
+        ) {
             if (database.loaded && !database.isReadOnly) {
                 if (TimeoutHelper.checkTimeAndLockIfTimeout(activity)) {
                     val intent = Intent(activity, EntryEditActivity::class.java)
-                    intent.putExtra(KEY_ENTRY, entryId)
+                    when (registrationType) {
+                        RegistrationType.UPDATE -> intent.putExtra(KEY_ENTRY, nodeId)
+                        RegistrationType.CREATE -> intent.putExtra(KEY_PARENT, nodeId)
+                    }
                     activityResultLauncher.launch(intent)
                 }
             }
         }
 
         /**
-         * Launch EntryEditActivity to add a new entry in an existent group
+         * Launch EntryEditActivity to add a new entry in special selection
          */
-        fun launchToCreate(activity: Activity,
-                           database: ContextualDatabase,
-                           groupId: NodeId<*>,
-                           activityResultLauncher: ActivityResultLauncher<Intent>) {
-            if (database.loaded && !database.isReadOnly) {
-                if (TimeoutHelper.checkTimeAndLockIfTimeout(activity)) {
-                    val intent = Intent(activity, EntryEditActivity::class.java)
-                    intent.putExtra(KEY_PARENT, groupId)
-                    activityResultLauncher.launch(intent)
-                }
-            }
-        }
-
-        fun launchToUpdateForSave(context: Context,
-                                  database: ContextualDatabase,
-                                  entryId: NodeId<UUID>,
-                                  searchInfo: SearchInfo) {
-            if (database.loaded && !database.isReadOnly) {
-                if (TimeoutHelper.checkTimeAndLockIfTimeout(context)) {
-                    val intent = Intent(context, EntryEditActivity::class.java)
-                    intent.putExtra(KEY_ENTRY, entryId)
-                    EntrySelectionHelper.startActivityForSaveModeResult(
-                        context,
-                        intent,
-                        searchInfo
-                    )
-                }
-            }
-        }
-
-        fun launchToCreateForSave(context: Context,
-                                  database: ContextualDatabase,
-                                  groupId: NodeId<*>,
-                                  searchInfo: SearchInfo) {
+        fun launchForSelection(
+            context: Context,
+            database: ContextualDatabase,
+            typeMode: TypeMode,
+            groupId: NodeId<*>,
+            searchInfo: SearchInfo? = null,
+            activityResultLauncher: ActivityResultLauncher<Intent>? = null,
+        ) {
             if (database.loaded && !database.isReadOnly) {
                 if (TimeoutHelper.checkTimeAndLockIfTimeout(context)) {
                     val intent = Intent(context, EntryEditActivity::class.java)
                     intent.putExtra(KEY_PARENT, groupId)
-                    EntrySelectionHelper.startActivityForSaveModeResult(
-                        context,
-                        intent,
-                        searchInfo
+                    EntrySelectionHelper.startActivityForSelectionModeResult(
+                        context = context,
+                        intent = intent,
+                        typeMode = typeMode,
+                        searchInfo = searchInfo,
+                        activityResultLauncher = activityResultLauncher
                     )
                 }
             }
         }
 
         /**
-         * Launch EntryEditActivity to add a new entry in keyboard selection
+         * Launch EntryEditActivity to update an updated entry or register a new entry (from autofill)
          */
-        fun launchForKeyboardSelectionResult(context: Context,
-                                             database: ContextualDatabase,
-                                             groupId: NodeId<*>,
-                                             searchInfo: SearchInfo? = null) {
+        fun launchForRegistration(
+            context: Context,
+            database: ContextualDatabase,
+            nodeId: NodeId<*>,
+            registerInfo: RegisterInfo? = null,
+            typeMode: TypeMode,
+            registrationType: RegistrationType,
+            activityResultLauncher: ActivityResultLauncher<Intent>? = null,
+        ) {
             if (database.loaded && !database.isReadOnly) {
                 if (TimeoutHelper.checkTimeAndLockIfTimeout(context)) {
                     val intent = Intent(context, EntryEditActivity::class.java)
-                    intent.putExtra(KEY_PARENT, groupId)
-                    EntrySelectionHelper.startActivityForKeyboardSelectionModeResult(
-                        context,
-                        intent,
-                        searchInfo
-                    )
-                }
-            }
-        }
-
-        /**
-         * Launch EntryEditActivity to add a new entry in autofill selection
-         */
-        @RequiresApi(api = Build.VERSION_CODES.O)
-        fun launchForAutofillResult(activity: AppCompatActivity,
-                                    database: ContextualDatabase,
-                                    activityResultLauncher: ActivityResultLauncher<Intent>?,
-                                    autofillComponent: AutofillComponent,
-                                    groupId: NodeId<*>,
-                                    searchInfo: SearchInfo? = null) {
-            if (database.loaded && !database.isReadOnly) {
-                if (TimeoutHelper.checkTimeAndLockIfTimeout(activity)) {
-                    val intent = Intent(activity, EntryEditActivity::class.java)
-                    intent.putExtra(KEY_PARENT, groupId)
-                    EntrySelectionHelper.startActivityForAutofillSelectionModeResult(
-                        activity,
-                        intent,
-                        activityResultLauncher,
-                        autofillComponent,
-                        searchInfo
-                    )
-                }
-            }
-        }
-
-        /**
-         * Launch EntryEditActivity to add a new passkey entry
-         */
-        @RequiresApi(Build.VERSION_CODES.UPSIDE_DOWN_CAKE)
-        fun launchForPasskeySelectionResult(context: Context,
-                                            database: ContextualDatabase,
-                                            activityResultLauncher: ActivityResultLauncher<Intent>?,
-                                            groupId: NodeId<*>,
-                                            searchInfo: SearchInfo? = null) {
-            if (database.loaded && !database.isReadOnly) {
-                if (TimeoutHelper.checkTimeAndLockIfTimeout(context)) {
-                    val intent = Intent(context, EntryEditActivity::class.java)
-                    intent.putExtra(KEY_PARENT, groupId)
-                    EntrySelectionHelper.startActivityForPasskeySelectionModeResult(
-                        context,
-                        intent,
-                        activityResultLauncher,
-                        searchInfo
-                    )
-                }
-            }
-        }
-
-        /**
-         * Launch EntryEditActivity to register an updated entry (from autofill)
-         */
-        fun launchToUpdateForRegistration(context: Context,
-                                          database: ContextualDatabase,
-                                          activityResultLauncher: ActivityResultLauncher<Intent>?,
-                                          entryId: NodeId<UUID>,
-                                          registerInfo: RegisterInfo?,
-                                          typeMode: TypeMode) {
-            if (database.loaded && !database.isReadOnly) {
-                if (TimeoutHelper.checkTimeAndLockIfTimeout(context)) {
-                    val intent = Intent(context, EntryEditActivity::class.java)
-                    intent.putExtra(KEY_ENTRY, entryId)
-                    EntrySelectionHelper.startActivityForRegistrationModeResult(
-                        context,
-                        activityResultLauncher,
-                        intent,
-                        registerInfo,
-                        typeMode
-                    )
-                }
-            }
-        }
-
-        /**
-         * Launch EntryEditActivity to register a new entry (from autofill)
-         */
-        fun launchToCreateForRegistration(context: Context,
-                                          database: ContextualDatabase,
-                                          activityResultLauncher: ActivityResultLauncher<Intent>?,
-                                          groupId: NodeId<*>,
-                                          registerInfo: RegisterInfo? = null,
-                                          typeMode: TypeMode) {
-            if (database.loaded && !database.isReadOnly) {
-                if (TimeoutHelper.checkTimeAndLockIfTimeout(context)) {
-                    val intent = Intent(context, EntryEditActivity::class.java)
-                    intent.putExtra(KEY_PARENT, groupId)
+                    when (registrationType) {
+                        RegistrationType.UPDATE -> intent.putExtra(KEY_ENTRY, nodeId)
+                        RegistrationType.CREATE -> intent.putExtra(KEY_PARENT, nodeId)
+                    }
                     EntrySelectionHelper.startActivityForRegistrationModeResult(
                         context,
                         activityResultLauncher,

app/src/main/java/com/kunzisoft/keepass/activities/FileDatabaseSelectActivity.kt

@@ -19,7 +19,6 @@
  */
 package com.kunzisoft.keepass.activities
 
-import android.app.Activity
 import android.content.Context
 import android.content.Intent
 import android.net.Uri
@@ -33,8 +32,6 @@ import android.view.MenuItem
 import android.view.View
 import androidx.activity.result.ActivityResultLauncher
 import androidx.activity.viewModels
-import androidx.annotation.RequiresApi
-import androidx.appcompat.app.AppCompatActivity
 import androidx.appcompat.widget.Toolbar
 import androidx.coordinatorlayout.widget.CoordinatorLayout
 import androidx.core.view.isVisible
@@ -50,10 +47,8 @@ import com.kunzisoft.keepass.activities.legacy.DatabaseModeActivity
 import com.kunzisoft.keepass.adapters.FileDatabaseHistoryAdapter
 import com.kunzisoft.keepass.app.database.FileDatabaseHistoryAction
 import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper
-import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.buildActivityResultLauncher
 import com.kunzisoft.keepass.credentialprovider.SpecialMode
 import com.kunzisoft.keepass.credentialprovider.TypeMode
-import com.kunzisoft.keepass.credentialprovider.autofill.AutofillComponent
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.MainCredential
 import com.kunzisoft.keepass.education.FileDatabaseSelectActivityEducation
@@ -99,9 +94,6 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
 
     private var mExternalFileHelper: ExternalFileHelper? = null
 
-    private var mCredentialActivityResultLauncher: ActivityResultLauncher<Intent>? =
-        this.buildActivityResultLauncher()
-
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
 
@@ -131,7 +123,7 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
         mExternalFileHelper = ExternalFileHelper(this)
         mExternalFileHelper?.buildOpenDocument { uri ->
             uri?.let {
-                launchPasswordActivityWithPath(uri)
+                launchMainCredentialActivityWithPath(uri)
             }
         }
         mExternalFileHelper?.buildCreateDocument("application/x-keepass") { databaseFileCreatedUri ->
@@ -160,7 +152,7 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
         }
         mAdapterDatabaseHistory?.setOnFileDatabaseHistoryOpenListener { fileDatabaseHistoryEntityToOpen ->
             fileDatabaseHistoryEntityToOpen.databaseUri?.let { databaseFileUri ->
-                launchPasswordActivity(
+                launchMainCredentialActivity(
                     databaseFileUri,
                     fileDatabaseHistoryEntityToOpen.keyFileUri,
                     fileDatabaseHistoryEntityToOpen.hardwareKey
@@ -179,7 +171,7 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
 
         // Load default database the first time
         databaseFilesViewModel.doForDefaultDatabase { databaseFileUri ->
-            launchPasswordActivityWithPath(databaseFileUri)
+            launchMainCredentialActivityWithPath(databaseFileUri)
         }
 
         // Retrieve the database URI provided by file manager after an orientation change
@@ -224,11 +216,8 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-        if (database != null) {
-            launchGroupActivityIfLoaded(database)
-        }
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        launchGroupActivityIfLoaded(database)
     }
 
     override fun onDatabaseActionFinished(
@@ -236,8 +225,6 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
         actionTask: String,
         result: ActionRunnable.Result
     ) {
-        super.onDatabaseActionFinished(database, actionTask, result)
-
         if (result.isSuccess) {
             // Update list
             when (actionTask) {
@@ -287,17 +274,58 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
         Snackbar.make(coordinatorLayout, error, Snackbar.LENGTH_LONG).asError().show()
     }
 
-    private fun launchPasswordActivity(databaseUri: Uri, keyFile: Uri?, hardwareKey: HardwareKey?) {
-        MainCredentialActivity.launch(this,
-                databaseUri,
-                keyFile,
-                hardwareKey,
-                { exception ->
-                    fileNoFoundAction(exception)
+    private fun launchMainCredentialActivity(databaseUri: Uri, keyFile: Uri?, hardwareKey: HardwareKey?) {
+        try {
+            EntrySelectionHelper.doSpecialAction(
+                intent = this.intent,
+                defaultAction = {
+                    MainCredentialActivity.launch(
+                        activity = this,
+                        databaseFile = databaseUri,
+                        keyFile = keyFile,
+                        hardwareKey = hardwareKey
+                    )
                 },
-                { onCancelSpecialMode() },
-                { onLaunchActivitySpecialMode() },
-                mCredentialActivityResultLauncher)
+                searchAction = { searchInfo ->
+                    MainCredentialActivity.launchForSearchResult(
+                        activity = this,
+                        databaseFile = databaseUri,
+                        keyFile = keyFile,
+                        hardwareKey = hardwareKey,
+                        searchInfo = searchInfo
+                    )
+                    onLaunchActivitySpecialMode()
+                },
+                selectionAction = { intentSenderMode, typeMode, searchInfo ->
+                    MainCredentialActivity.launchForSelection(
+                        activity = this,
+                        activityResultLauncher = if (intentSenderMode)
+                            mCredentialActivityResultLauncher else null,
+                        databaseFile = databaseUri,
+                        keyFile = keyFile,
+                        hardwareKey = hardwareKey,
+                        typeMode = typeMode,
+                        searchInfo = searchInfo
+                    )
+                    onLaunchActivitySpecialMode()
+                },
+                registrationAction = { intentSenderMode, typeMode, registerInfo ->
+                    MainCredentialActivity.launchForRegistration(
+                        activity = this,
+                        activityResultLauncher = if (intentSenderMode)
+                            mCredentialActivityResultLauncher else null,
+                        databaseFile = databaseUri,
+                        keyFile = keyFile,
+                        hardwareKey = hardwareKey,
+                        typeMode = typeMode,
+                        registerInfo = registerInfo
+                    )
+                    onLaunchActivitySpecialMode()
+                }
+            )
+        } catch (e: FileNotFoundException) {
+            fileNoFoundAction(e)
+        }
     }
 
     private fun launchGroupActivityIfLoaded(database: ContextualDatabase) {
@@ -307,12 +335,13 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
                 { onValidateSpecialMode() },
                 { onCancelSpecialMode() },
                 { onLaunchActivitySpecialMode() },
-                mCredentialActivityResultLauncher)
+                mCredentialActivityResultLauncher
+            )
         }
     }
 
-    private fun launchPasswordActivityWithPath(databaseUri: Uri) {
-        launchPasswordActivity(databaseUri, null, null)
+    private fun launchMainCredentialActivityWithPath(databaseUri: Uri) {
+        launchMainCredentialActivity(databaseUri, null, null)
         // Delete flickering for kitkat <=
         @Suppress("DEPRECATION")
         if (Build.VERSION.SDK_INT < Build.VERSION_CODES.LOLLIPOP)
@@ -336,10 +365,6 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
             }
         }
 
-        mDatabase?.let { database ->
-            launchGroupActivityIfLoaded(database)
-        }
-
         // Show recent files if allowed
         if (PreferencesUtil.showRecentFiles(this@FileDatabaseSelectActivity)) {
             databaseFilesViewModel.loadListOfDatabases()
@@ -358,7 +383,7 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
         try {
             mDatabaseFileUri?.let { databaseUri ->
                 // Create the new database
-                createDatabase(databaseUri, mainCredential)
+                mDatabaseViewModel.createDatabase(databaseUri, mainCredential)
             }
         } catch (e: Exception) {
             val error = getString(R.string.error_create_database_file)
@@ -442,71 +467,35 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
          * -------------------------
          */
 
-        fun launchForSearchResult(context: Context,
-                                  searchInfo: SearchInfo) {
-            EntrySelectionHelper.startActivityForSearchModeResult(context,
-                    Intent(context, FileDatabaseSelectActivity::class.java),
-                    searchInfo)
+        fun launchForSearch(
+            context: Context,
+            searchInfo: SearchInfo
+        ) {
+            EntrySelectionHelper.startActivityForSearchModeResult(
+                context = context,
+                intent = Intent(context, FileDatabaseSelectActivity::class.java),
+                searchInfo = searchInfo
+            )
         }
 
         /*
          * -------------------------
-         * 		Save Launch
+         * 		Selection Launch
          * -------------------------
          */
 
-        fun launchForSaveResult(context: Context,
-                                searchInfo: SearchInfo) {
-            EntrySelectionHelper.startActivityForSaveModeResult(context,
-                    Intent(context, FileDatabaseSelectActivity::class.java),
-                    searchInfo)
-        }
-
-        /*
-         * -------------------------
-         * 		Keyboard Launch
-         * -------------------------
-         */
-
-        fun launchForKeyboardSelectionResult(activity: Activity,
-                                             searchInfo: SearchInfo? = null) {
-            EntrySelectionHelper.startActivityForKeyboardSelectionModeResult(activity,
-                    Intent(activity, FileDatabaseSelectActivity::class.java),
-                    searchInfo)
-        }
-
-        /*
-         * -------------------------
-         * 		Autofill Launch
-         * -------------------------
-         */
-
-        @RequiresApi(api = Build.VERSION_CODES.O)
-        fun launchForAutofillResult(activity: AppCompatActivity,
-                                    activityResultLauncher: ActivityResultLauncher<Intent>?,
-                                    autofillComponent: AutofillComponent,
-                                    searchInfo: SearchInfo? = null) {
-            EntrySelectionHelper.startActivityForAutofillSelectionModeResult(activity,
-                    Intent(activity, FileDatabaseSelectActivity::class.java),
-                    activityResultLauncher,
-                    autofillComponent,
-                    searchInfo)
-        }
-
-        /*
-         * -------------------------
-         * 		Passkey Launch
-         * -------------------------
-         */
-        @RequiresApi(Build.VERSION_CODES.UPSIDE_DOWN_CAKE)
-        fun launchForPasskeySelectionResult(activity: Activity,
-                                            activityResultLauncher: ActivityResultLauncher<Intent>?,
-                                            searchInfo: SearchInfo? = null) {
-            EntrySelectionHelper.startActivityForPasskeySelectionModeResult(
-                activity,
-                Intent(activity, FileDatabaseSelectActivity::class.java),
-                activityResultLauncher,
-                searchInfo
+        fun launchForSelection(
+            context: Context,
+            typeMode: TypeMode,
+            searchInfo: SearchInfo? = null,
+            activityResultLauncher: ActivityResultLauncher<Intent>?,
+        ) {
+            EntrySelectionHelper.startActivityForSelectionModeResult(
+                context = context,
+                intent = Intent(context, FileDatabaseSelectActivity::class.java),
+                searchInfo = searchInfo,
+                typeMode = typeMode,
+                activityResultLauncher = activityResultLauncher
             )
         }
 
@@ -515,16 +504,18 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
          * 		Registration Launch
          * -------------------------
          */
-        fun launchForRegistration(context: Context,
-                                  activityResultLauncher: ActivityResultLauncher<Intent>?,
-                                  registerInfo: RegisterInfo? = null,
-                                  typeMode: TypeMode) {
+        fun launchForRegistration(
+            context: Context,
+            typeMode: TypeMode,
+            registerInfo: RegisterInfo? = null,
+            activityResultLauncher: ActivityResultLauncher<Intent>?,
+        ) {
             EntrySelectionHelper.startActivityForRegistrationModeResult(
-                context,
-                activityResultLauncher,
-                Intent(context, FileDatabaseSelectActivity::class.java),
-                registerInfo,
-                typeMode
+                context = context,
+                intent = Intent(context, FileDatabaseSelectActivity::class.java),
+                registerInfo = registerInfo,
+                typeMode = typeMode,
+                activityResultLauncher = activityResultLauncher
             )
         }
     }

app/src/main/java/com/kunzisoft/keepass/activities/IconPickerActivity.kt

@@ -174,10 +174,10 @@ class IconPickerActivity : DatabaseLockActivity() {
         return true
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
 
-        if (database?.allowCustomIcons == true) {
+        if (database.allowCustomIcons) {
             uploadButton.setOpenDocumentClickListener(mExternalFileHelper)
         } else {
             uploadButton.visibility = View.GONE

app/src/main/java/com/kunzisoft/keepass/activities/ImageViewerActivity.kt

@@ -101,7 +101,7 @@ class ImageViewerActivity : DatabaseLockActivity() {
         return true
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
 
         try {
@@ -119,18 +119,16 @@ class ImageViewerActivity : DatabaseLockActivity() {
                     resources.displayMetrics.heightPixels * 2
                 )
 
-                database?.let { database ->
-                    BinaryDatabaseManager.loadBitmap(
-                        database,
-                        attachment.binaryData,
-                        mImagePreviewMaxWidth
-                    ) { bitmapLoaded ->
-                        if (bitmapLoaded == null) {
-                            finish()
-                        } else {
-                            progressView.visibility = View.GONE
-                            imageView.setImageBitmap(bitmapLoaded)
-                        }
+                BinaryDatabaseManager.loadBitmap(
+                    database,
+                    attachment.binaryData,
+                    mImagePreviewMaxWidth
+                ) { bitmapLoaded ->
+                    if (bitmapLoaded == null) {
+                        finish()
+                    } else {
+                        progressView.visibility = View.GONE
+                        imageView.setImageBitmap(bitmapLoaded)
                     }
                 }
             } ?: finish()

app/src/main/java/com/kunzisoft/keepass/activities/MainCredentialActivity.kt

@@ -36,8 +36,6 @@ import android.widget.TextView
 import android.widget.Toast
 import androidx.activity.result.ActivityResultLauncher
 import androidx.activity.viewModels
-import androidx.annotation.RequiresApi
-import androidx.appcompat.app.AppCompatActivity
 import androidx.appcompat.widget.Toolbar
 import androidx.biometric.BiometricManager
 import androidx.coordinatorlayout.widget.CoordinatorLayout
@@ -56,10 +54,8 @@ import com.kunzisoft.keepass.biometric.DeviceUnlockFragment
 import com.kunzisoft.keepass.biometric.DeviceUnlockManager
 import com.kunzisoft.keepass.biometric.deviceUnlockError
 import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper
-import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.buildActivityResultLauncher
 import com.kunzisoft.keepass.credentialprovider.SpecialMode
 import com.kunzisoft.keepass.credentialprovider.TypeMode
-import com.kunzisoft.keepass.credentialprovider.autofill.AutofillComponent
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.MainCredential
 import com.kunzisoft.keepass.database.exception.DuplicateUuidDatabaseException
@@ -128,9 +124,6 @@ class MainCredentialActivity : DatabaseModeActivity() {
     private var mReadOnly: Boolean = false
     private var mForceReadOnly: Boolean = false
 
-    private var mCredentialActivityResultLauncher: ActivityResultLauncher<Intent>? =
-        this.buildActivityResultLauncher()
-
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
 
@@ -310,26 +303,20 @@ class MainCredentialActivity : DatabaseModeActivity() {
         mDatabaseFileUri?.let { databaseFileUri ->
             mDatabaseFileViewModel.loadDatabaseFile(databaseFileUri)
         }
-
-        mDatabase?.let { database ->
-            launchGroupActivityIfLoaded(database)
-        }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
-        if (database != null) {
-            // Trying to load another database
-            if (mDatabaseFileUri != null
-                && database.fileUri != null
-                && mDatabaseFileUri != database.fileUri) {
-                Toast.makeText(this,
-                    R.string.warning_database_already_opened,
-                    Toast.LENGTH_LONG
-                ).show()
-            }
-            launchGroupActivityIfLoaded(database)
+        // Trying to load another database
+        if (mDatabaseFileUri != null
+            && database.fileUri != null
+            && mDatabaseFileUri != database.fileUri) {
+            Toast.makeText(this,
+                R.string.warning_database_already_opened,
+                Toast.LENGTH_LONG
+            ).show()
         }
+        launchGroupActivityIfLoaded(database)
     }
 
     override fun onDatabaseActionFinished(
@@ -514,10 +501,11 @@ class MainCredentialActivity : DatabaseModeActivity() {
         val password = intent.getStringExtra(KEY_PASSWORD)
         // Consume the intent extra password
         intent.removeExtra(KEY_PASSWORD)
-        val launchImmediately = intent.getBooleanExtra(KEY_LAUNCH_IMMEDIATELY, false)
         if (password != null) {
             mainCredentialView?.populatePasswordTextView(password)
         }
+        val launchImmediately = intent.getBooleanExtra(KEY_LAUNCH_IMMEDIATELY, false)
+        intent.removeExtra(KEY_LAUNCH_IMMEDIATELY)
         if (launchImmediately) {
             loadDatabase()
         } else {
@@ -572,10 +560,7 @@ class MainCredentialActivity : DatabaseModeActivity() {
             clearCredentialsViews()
         }
 
-        if (mReadOnly && (
-                mSpecialMode == SpecialMode.SAVE
-                || mSpecialMode == SpecialMode.REGISTRATION)
-        ) {
+        if (mReadOnly && mSpecialMode == SpecialMode.REGISTRATION) {
             Log.e(TAG, getString(R.string.error_save_read_only))
             Snackbar.make(coordinatorLayout,
                     R.string.error_save_read_only,
@@ -599,7 +584,7 @@ class MainCredentialActivity : DatabaseModeActivity() {
                                                   readOnly: Boolean,
                                                   cipherEncryptDatabase: CipherEncryptDatabase?,
                                                   fixDuplicateUUID: Boolean) {
-        loadDatabase(
+        mDatabaseViewModel.loadDatabase(
             databaseUri,
             mainCredential,
             readOnly,
@@ -752,11 +737,13 @@ class MainCredentialActivity : DatabaseModeActivity() {
         private const val KEY_PASSWORD = "password"
         private const val KEY_LAUNCH_IMMEDIATELY = "launchImmediately"
 
-        private fun buildAndLaunchIntent(activity: Activity,
-                                         databaseFile: Uri,
-                                         keyFile: Uri?,
-                                         hardwareKey: HardwareKey?,
-                                         intentBuildLauncher: (Intent) -> Unit) {
+        private fun buildAndLaunchIntent(
+            activity: Activity,
+            databaseFile: Uri,
+            keyFile: Uri?,
+            hardwareKey: HardwareKey?,
+            intentBuildLauncher: (Intent) -> Unit
+        ) {
             val intent = Intent(activity, MainCredentialActivity::class.java)
             intent.putExtra(KEY_FILENAME, databaseFile)
             if (keyFile != null)
@@ -773,10 +760,12 @@ class MainCredentialActivity : DatabaseModeActivity() {
          */
 
         @Throws(FileNotFoundException::class)
-        fun launch(activity: Activity,
-                   databaseFile: Uri,
-                   keyFile: Uri?,
-                   hardwareKey: HardwareKey?) {
+        fun launch(
+            activity: Activity,
+            databaseFile: Uri,
+            keyFile: Uri?,
+            hardwareKey: HardwareKey?
+        ) {
             buildAndLaunchIntent(activity, databaseFile, keyFile, hardwareKey) { intent ->
                 activity.startActivity(intent)
             }
@@ -789,245 +778,73 @@ class MainCredentialActivity : DatabaseModeActivity() {
          */
 
         @Throws(FileNotFoundException::class)
-        fun launchForSearchResult(activity: Activity,
-                                  databaseFile: Uri,
-                                  keyFile: Uri?,
-                                  hardwareKey: HardwareKey?,
-                                  searchInfo: SearchInfo) {
+        fun launchForSearchResult(
+            activity: Activity,
+            databaseFile: Uri,
+            keyFile: Uri?,
+            hardwareKey: HardwareKey?,
+            searchInfo: SearchInfo
+        ) {
             buildAndLaunchIntent(activity, databaseFile, keyFile, hardwareKey) { intent ->
                 EntrySelectionHelper.startActivityForSearchModeResult(
-                        activity,
-                        intent,
-                        searchInfo)
-            }
-        }
-
-        /*
-         * -------------------------
-         * 		Save Launch
-         * -------------------------
-         */
-
-        @Throws(FileNotFoundException::class)
-        fun launchForSaveResult(activity: Activity,
-                                databaseFile: Uri,
-                                keyFile: Uri?,
-                                hardwareKey: HardwareKey?,
-                                searchInfo: SearchInfo) {
-            buildAndLaunchIntent(activity, databaseFile, keyFile, hardwareKey) { intent ->
-                EntrySelectionHelper.startActivityForSaveModeResult(
-                        activity,
-                        intent,
-                        searchInfo)
-            }
-        }
-
-        /*
-         * -------------------------
-         * 		Keyboard Launch
-         * -------------------------
-         */
-
-        @Throws(FileNotFoundException::class)
-        fun launchForKeyboardResult(activity: Activity,
-                                    databaseFile: Uri,
-                                    keyFile: Uri?,
-                                    hardwareKey: HardwareKey?,
-                                    searchInfo: SearchInfo?) {
-            buildAndLaunchIntent(activity, databaseFile, keyFile, hardwareKey) { intent ->
-                EntrySelectionHelper.startActivityForKeyboardSelectionModeResult(
-                        activity,
-                        intent,
-                        searchInfo)
-            }
-        }
-
-        /*
-         * -------------------------
-         * 		Autofill Launch
-         * -------------------------
-         */
-
-        @RequiresApi(api = Build.VERSION_CODES.O)
-        @Throws(FileNotFoundException::class)
-        fun launchForAutofillResult(activity: AppCompatActivity,
-                                    activityResultLauncher: ActivityResultLauncher<Intent>?,
-                                    databaseFile: Uri,
-                                    keyFile: Uri?,
-                                    hardwareKey: HardwareKey?,
-                                    autofillComponent: AutofillComponent,
-                                    searchInfo: SearchInfo?) {
-            buildAndLaunchIntent(activity, databaseFile, keyFile, hardwareKey) { intent ->
-                EntrySelectionHelper.startActivityForAutofillSelectionModeResult(
-                        activity,
-                        intent,
-                        activityResultLauncher,
-                        autofillComponent,
-                        searchInfo)
-            }
-        }
-
-        /*
-         * -------------------------
-         * 		Passkey Launch
-         * -------------------------
-         */
-        @RequiresApi(Build.VERSION_CODES.UPSIDE_DOWN_CAKE)
-        @Throws(FileNotFoundException::class)
-        fun launchForPasskeyResult(activity: Activity,
-                                   activityResultLauncher: ActivityResultLauncher<Intent>?,
-                                   databaseFile: Uri,
-                                   keyFile: Uri?,
-                                   hardwareKey: HardwareKey?,
-                                   searchInfo: SearchInfo?) {
-            buildAndLaunchIntent(activity, databaseFile, keyFile, hardwareKey) { intent ->
-                EntrySelectionHelper.startActivityForPasskeySelectionModeResult(
-                    activity,
-                    intent,
-                    activityResultLauncher,
-                    searchInfo
+                    context = activity,
+                    intent = intent,
+                    searchInfo = searchInfo
                 )
             }
         }
 
         /*
          * -------------------------
-         * 		Registration Launch
+         * 		Selection Launch
          * -------------------------
          */
-        fun launchForRegistration(
+
+        @Throws(FileNotFoundException::class)
+        fun launchForSelection(
             activity: Activity,
-            activityResultLauncher: ActivityResultLauncher<Intent>?,
             databaseFile: Uri,
             keyFile: Uri?,
             hardwareKey: HardwareKey?,
             typeMode: TypeMode,
-            registerInfo: RegisterInfo?
+            searchInfo: SearchInfo?,
+            activityResultLauncher: ActivityResultLauncher<Intent>?
         ) {
             buildAndLaunchIntent(activity, databaseFile, keyFile, hardwareKey) { intent ->
-                EntrySelectionHelper.startActivityForRegistrationModeResult(
+                EntrySelectionHelper.startActivityForSelectionModeResult(
                     context = activity,
-                    activityResultLauncher = activityResultLauncher,
                     intent = intent,
                     typeMode = typeMode,
-                    registerInfo = registerInfo
+                    searchInfo = searchInfo,
+                    activityResultLauncher = activityResultLauncher
                 )
             }
         }
 
         /*
          * -------------------------
-         * 		Global Launch
+         *      Registration Launch
          * -------------------------
          */
-        fun launch(activity: AppCompatActivity,
-                   databaseUri: Uri,
-                   keyFile: Uri?,
-                   hardwareKey: HardwareKey?,
-                   fileNoFoundAction: (exception: FileNotFoundException) -> Unit,
-                   onCancelSpecialMode: () -> Unit,
-                   onLaunchActivitySpecialMode: () -> Unit,
-                   activityResultLauncher: ActivityResultLauncher<Intent>?) {
 
-            try {
-                EntrySelectionHelper.doSpecialAction(
-                    intent = activity.intent,
-                    defaultAction = {
-                        launch(
-                            activity = activity,
-                            databaseFile = databaseUri,
-                            keyFile = keyFile,
-                            hardwareKey = hardwareKey
-                        )
-                    },
-                    searchAction = { searchInfo ->
-                        launchForSearchResult(
-                            activity = activity,
-                            databaseFile = databaseUri,
-                            keyFile = keyFile,
-                            hardwareKey = hardwareKey,
-                            searchInfo = searchInfo
-                        )
-                        onLaunchActivitySpecialMode()
-                    },
-                    saveAction = { searchInfo ->
-                        launchForSaveResult(
-                            activity = activity,
-                            databaseFile = databaseUri,
-                            keyFile = keyFile,
-                            hardwareKey = hardwareKey,
-                            searchInfo = searchInfo
-                        )
-                        onLaunchActivitySpecialMode()
-                    },
-                    keyboardSelectionAction = { searchInfo ->
-                        launchForKeyboardResult(
-                            activity = activity,
-                            databaseFile = databaseUri,
-                            keyFile = keyFile,
-                            hardwareKey = hardwareKey,
-                            searchInfo = searchInfo
-                        )
-                        onLaunchActivitySpecialMode()
-                    },
-                    autofillSelectionAction = { searchInfo, autofillComponent ->
-                        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
-                            launchForAutofillResult(
-                                activity = activity,
-                                activityResultLauncher = activityResultLauncher,
-                                databaseFile = databaseUri,
-                                keyFile = keyFile,
-                                hardwareKey = hardwareKey,
-                                autofillComponent = autofillComponent,
-                                searchInfo = searchInfo
-                            )
-                            onLaunchActivitySpecialMode()
-                        } else {
-                            onCancelSpecialMode()
-                        }
-                    },
-                    autofillRegistrationAction = { registerInfo ->
-                        launchForRegistration(
-                            activity = activity,
-                            activityResultLauncher = activityResultLauncher,
-                            databaseFile = databaseUri,
-                            keyFile = keyFile,
-                            hardwareKey = hardwareKey,
-                            typeMode = TypeMode.AUTOFILL,
-                            registerInfo = registerInfo
-                        )
-                        onLaunchActivitySpecialMode()
-                    },
-                    passkeySelectionAction = { searchInfo ->
-                        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.UPSIDE_DOWN_CAKE) {
-                            launchForPasskeyResult(
-                                activity = activity,
-                                activityResultLauncher = activityResultLauncher,
-                                databaseFile = databaseUri,
-                                keyFile = keyFile,
-                                hardwareKey = hardwareKey,
-                                searchInfo = searchInfo
-                            )
-                            onLaunchActivitySpecialMode()
-                        } else {
-                            onCancelSpecialMode()
-                        }
-                    },
-                    passkeyRegistrationAction = { registerInfo ->
-                        launchForRegistration(
-                            activity = activity,
-                            activityResultLauncher = activityResultLauncher,
-                            databaseFile = databaseUri,
-                            keyFile = keyFile,
-                            hardwareKey = hardwareKey,
-                            typeMode = TypeMode.PASSKEY,
-                            registerInfo = registerInfo
-                        )
-                        onLaunchActivitySpecialMode()
-                    }
+        @Throws(FileNotFoundException::class)
+        fun launchForRegistration(
+            activity: Activity,
+            databaseFile: Uri,
+            keyFile: Uri?,
+            hardwareKey: HardwareKey?,
+            typeMode: TypeMode,
+            registerInfo: RegisterInfo?,
+            activityResultLauncher: ActivityResultLauncher<Intent>?
+        ) {
+            buildAndLaunchIntent(activity, databaseFile, keyFile, hardwareKey) { intent ->
+                EntrySelectionHelper.startActivityForRegistrationModeResult(
+                    context = activity,
+                    intent = intent,
+                    typeMode = typeMode,
+                    registerInfo = registerInfo,
+                    activityResultLauncher = activityResultLauncher,
                 )
-            } catch (e: FileNotFoundException) {
-                fileNoFoundAction(e)
             }
         }
     }

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/DatabaseChangedDialogFragment.kt

@@ -67,7 +67,7 @@ class DatabaseChangedDialogFragment : DatabaseDialogFragment() {
                 }
                 builder.setMessage(stringBuilder)
                 builder.setPositiveButton(android.R.string.ok) { _, _ ->
-                    actionDatabaseListener?.validateDatabaseChanged()
+                    actionDatabaseListener?.onDatabaseChangeValidated()
                 }
                 return builder.create()
             }
@@ -76,7 +76,7 @@ class DatabaseChangedDialogFragment : DatabaseDialogFragment() {
     }
 
     interface ActionDatabaseChangedListener {
-        fun validateDatabaseChanged()
+        fun onDatabaseChangeValidated()
     }
 
     companion object {
@@ -86,9 +86,10 @@ class DatabaseChangedDialogFragment : DatabaseDialogFragment() {
         private const val NEW_FILE_DATABASE_INFO = "NEW_FILE_DATABASE_INFO"
         private const val READ_ONLY_DATABASE = "READ_ONLY_DATABASE"
 
-        fun getInstance(oldSnapFileDatabaseInfo: SnapFileDatabaseInfo,
-                        newSnapFileDatabaseInfo: SnapFileDatabaseInfo,
-                        readOnly: Boolean
+        fun getInstance(
+            oldSnapFileDatabaseInfo: SnapFileDatabaseInfo,
+            newSnapFileDatabaseInfo: SnapFileDatabaseInfo,
+            readOnly: Boolean
         )
         : DatabaseChangedDialogFragment {
             val fragment = DatabaseChangedDialogFragment()

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/DatabaseDialogFragment.kt

@@ -5,6 +5,9 @@ import android.view.View
 import android.view.WindowManager.LayoutParams.FLAG_SECURE
 import androidx.fragment.app.DialogFragment
 import androidx.fragment.app.activityViewModels
+import androidx.lifecycle.Lifecycle
+import androidx.lifecycle.lifecycleScope
+import androidx.lifecycle.repeatOnLifecycle
 import com.kunzisoft.keepass.activities.legacy.DatabaseRetrieval
 import com.kunzisoft.keepass.activities.legacy.resetAppTimeoutWhenViewTouchedOrFocused
 import com.kunzisoft.keepass.database.ContextualDatabase
@@ -12,23 +15,40 @@ import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.tasks.ActionRunnable
 import com.kunzisoft.keepass.timeout.TimeoutHelper
 import com.kunzisoft.keepass.viewmodels.DatabaseViewModel
+import kotlinx.coroutines.launch
 
 abstract class DatabaseDialogFragment : DialogFragment(), DatabaseRetrieval {
 
     private val mDatabaseViewModel: DatabaseViewModel by activityViewModels()
-    private var mDatabase: ContextualDatabase? = null
+    private val mDatabase: ContextualDatabase?
+        get() = mDatabaseViewModel.database
 
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
-
-        mDatabaseViewModel.database.observe(this) { database ->
-            this.mDatabase = database
-            resetAppTimeoutOnTouchOrFocus()
-            onDatabaseRetrieved(database)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.STARTED) {
+                mDatabaseViewModel.actionState.collect { uiState ->
+                    when (uiState) {
+                        is DatabaseViewModel.ActionState.OnDatabaseActionFinished -> {
+                            onDatabaseActionFinished(
+                                uiState.database,
+                                uiState.actionTask,
+                                uiState.result
+                            )
+                        }
+                        else -> {}
+                    }
+                }
+            }
         }
-
-        mDatabaseViewModel.actionFinished.observe(this) { result ->
-            onDatabaseActionFinished(result.database, result.actionTask, result.result)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.RESUMED) {
+                mDatabaseViewModel.databaseState.collect { database ->
+                    database?.let {
+                        onDatabaseRetrieved(database)
+                    }
+                }
+            }
         }
     }
 
@@ -52,7 +72,7 @@ abstract class DatabaseDialogFragment : DialogFragment(), DatabaseRetrieval {
         resetAppTimeoutOnTouchOrFocus()
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         // Can be overridden by a subclass
     }
 

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/GroupDialogFragment.kt

@@ -62,14 +62,14 @@ class GroupDialogFragment : DatabaseDialogFragment() {
     private lateinit var uuidContainerView: ViewGroup
     private lateinit var uuidReferenceView: TextView
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
         mPopulateIconMethod = { imageView, icon ->
-            database?.iconDrawableFactory?.assignDatabaseIcon(imageView, icon, mIconColor)
+            database.iconDrawableFactory.assignDatabaseIcon(imageView, icon, mIconColor)
         }
         mPopulateIconMethod?.invoke(iconView, mGroupInfo.icon)
 
-        if (database?.allowCustomSearchableGroup() == true) {
+        if (database.allowCustomSearchableGroup()) {
             searchableLabelView.visibility = View.VISIBLE
             searchableView.visibility = View.VISIBLE
         } else {

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/GroupEditDialogFragment.kt

@@ -112,32 +112,32 @@ class GroupEditDialogFragment : DatabaseDialogFragment() {
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
 
         mPopulateIconMethod = { imageView, icon ->
-            database?.iconDrawableFactory?.assignDatabaseIcon(imageView, icon, mIconColor)
+            database.iconDrawableFactory.assignDatabaseIcon(imageView, icon, mIconColor)
         }
         mPopulateIconMethod?.invoke(iconButtonView, mGroupInfo.icon)
 
-        searchableContainerView.visibility = if (database?.allowCustomSearchableGroup() == true) {
+        searchableContainerView.visibility = if (database.allowCustomSearchableGroup()) {
             View.VISIBLE
         } else {
             View.GONE
         }
 
-        if (database?.allowAutoType() == true) {
+        if (database.allowAutoType()) {
             autoTypeContainerView.visibility = View.VISIBLE
         } else {
             autoTypeContainerView.visibility = View.GONE
         }
 
-        tagsAdapter = TagsProposalAdapter(requireContext(), database?.tagPool)
+        tagsAdapter = TagsProposalAdapter(requireContext(), database.tagPool)
         tagsCompletionView.apply {
             threshold = 1
             setAdapter(tagsAdapter)
         }
-        tagsContainerView.visibility = if (database?.allowTags() == true) View.VISIBLE else View.GONE
+        tagsContainerView.visibility = if (database.allowTags()) View.VISIBLE else View.GONE
     }
 
     override fun onCreateDialog(savedInstanceState: Bundle?): Dialog {

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/IconEditDialogFragment.kt

@@ -45,10 +45,10 @@ class IconEditDialogFragment : DatabaseDialogFragment() {
 
     private var mCustomIcon: IconImageCustom? = null
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
         mPopulateIconMethod = { imageView, icon ->
-            database?.iconDrawableFactory?.assignDatabaseIcon(imageView, icon)
+            database.iconDrawableFactory.assignDatabaseIcon(imageView, icon)
         }
         mCustomIcon?.let { customIcon ->
             populateViewsWithCustomIcon(customIcon)

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/SetMainCredentialDialogFragment.kt

@@ -35,9 +35,9 @@ import com.google.android.material.textfield.TextInputLayout
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.helpers.ExternalFileHelper
 import com.kunzisoft.keepass.activities.helpers.setOpenDocumentClickListener
+import com.kunzisoft.keepass.credentialprovider.activity.HardwareKeyActivity
 import com.kunzisoft.keepass.database.MainCredential
 import com.kunzisoft.keepass.hardware.HardwareKey
-import com.kunzisoft.keepass.hardware.HardwareKeyActivity
 import com.kunzisoft.keepass.password.PasswordEntropy
 import com.kunzisoft.keepass.utils.UriUtil.getDocumentFile
 import com.kunzisoft.keepass.utils.UriUtil.openUrl
@@ -258,8 +258,7 @@ class SetMainCredentialDialogFragment : DatabaseDialogFragment() {
             showEmptyPasswordConfirmationDialog()
         } else if (!error
             && hardwareKey != null
-            && !HardwareKeyActivity.isHardwareKeyAvailable(
-                requireActivity(), hardwareKey, false)
+            && !HardwareKeyActivity.isHardwareKeyAvailable(requireActivity(), hardwareKey)
         ) {
             // show hardware driver dialog if required
             error = true

app/src/main/java/com/kunzisoft/keepass/activities/fragments/DatabaseFragment.kt

@@ -4,36 +4,59 @@ import android.os.Bundle
 import android.view.View
 import androidx.fragment.app.Fragment
 import androidx.fragment.app.activityViewModels
+import androidx.lifecycle.Lifecycle
+import androidx.lifecycle.lifecycleScope
+import androidx.lifecycle.repeatOnLifecycle
 import com.kunzisoft.keepass.activities.legacy.DatabaseRetrieval
 import com.kunzisoft.keepass.activities.legacy.resetAppTimeoutWhenViewTouchedOrFocused
 import com.kunzisoft.keepass.database.ContextualDatabase
-import com.kunzisoft.keepass.database.element.binary.BinaryData
 import com.kunzisoft.keepass.tasks.ActionRunnable
 import com.kunzisoft.keepass.viewmodels.DatabaseViewModel
+import kotlinx.coroutines.launch
 
 abstract class DatabaseFragment : Fragment(), DatabaseRetrieval {
 
-    private val mDatabaseViewModel: DatabaseViewModel by activityViewModels()
-    protected var mDatabase: ContextualDatabase? = null
+    protected val mDatabaseViewModel: DatabaseViewModel by activityViewModels()
+    protected val mDatabase: ContextualDatabase?
+        get() = mDatabaseViewModel.database
 
-    override fun onViewCreated(view: View, savedInstanceState: Bundle?) {
-        super.onViewCreated(view, savedInstanceState)
 
-        mDatabaseViewModel.database.observe(viewLifecycleOwner) { database ->
-            if (mDatabase == null || mDatabase != database) {
-                this.mDatabase = database
-                onDatabaseRetrieved(database)
+    override fun onCreate(savedInstanceState: Bundle?) {
+        super.onCreate(savedInstanceState)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.STARTED) {
+                mDatabaseViewModel.actionState.collect { uiState ->
+                    when (uiState) {
+                        is DatabaseViewModel.ActionState.OnDatabaseActionFinished -> {
+                            onDatabaseActionFinished(
+                                uiState.database,
+                                uiState.actionTask,
+                                uiState.result
+                            )
+                        }
+
+                        else -> {}
+                    }
+                }
             }
         }
-
-        mDatabaseViewModel.actionFinished.observe(viewLifecycleOwner) { result ->
-            onDatabaseActionFinished(result.database, result.actionTask, result.result)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.RESUMED) {
+                mDatabaseViewModel.databaseState.collect { database ->
+                    database?.let {
+                        onDatabaseRetrieved(database)
+                    }
+                }
+            }
         }
     }
 
     protected fun resetAppTimeoutWhenViewFocusedOrChanged(view: View?) {
         context?.let {
-            view?.resetAppTimeoutWhenViewTouchedOrFocused(it, mDatabase?.loaded)
+            view?.resetAppTimeoutWhenViewTouchedOrFocused(
+                context = it,
+                databaseLoaded = mDatabase?.loaded
+            )
         }
     }
 
@@ -44,8 +67,4 @@ abstract class DatabaseFragment : Fragment(), DatabaseRetrieval {
     ) {
         // Can be overridden by a subclass
     }
-
-    protected fun buildNewBinaryAttachment(): BinaryData? {
-        return mDatabase?.buildNewBinaryAttachment()
-    }
 }

app/src/main/java/com/kunzisoft/keepass/activities/fragments/EntryEditFragment.kt

@@ -230,7 +230,7 @@ class EntryEditFragment: DatabaseFragment() {
             val attachmentToUploadUri = it.attachmentToUploadUri
             val fileName = it.fileName
 
-            buildNewBinaryAttachment()?.let { binaryAttachment ->
+            mDatabaseViewModel.buildNewAttachment()?.let { binaryAttachment ->
                 val entryAttachment = Attachment(fileName, binaryAttachment)
                 // Ask to replace the current attachment
                 if ((!mAllowMultipleAttachments
@@ -273,13 +273,13 @@ class EntryEditFragment: DatabaseFragment() {
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
 
         templateView.populateIconMethod = { imageView, icon ->
-            database?.iconDrawableFactory?.assignDatabaseIcon(imageView, icon, mIconColor)
+            database.iconDrawableFactory.assignDatabaseIcon(imageView, icon, mIconColor)
         }
 
-        mAllowMultipleAttachments = database?.allowMultipleAttachments == true
+        mAllowMultipleAttachments = database.allowMultipleAttachments == true
 
         attachmentsAdapter?.database = database
         attachmentsAdapter?.onListSizeChangedListener = { previousSize, newSize ->
@@ -290,12 +290,12 @@ class EntryEditFragment: DatabaseFragment() {
             }
         }
 
-        tagsAdapter = TagsProposalAdapter(requireContext(), database?.tagPool)
+        tagsAdapter = TagsProposalAdapter(requireContext(), database.tagPool)
         tagsCompletionView.apply {
             threshold = 1
             setAdapter(tagsAdapter)
         }
-        tagsContainerView.visibility = if (database?.allowTags() == true) View.VISIBLE else View.GONE
+        tagsContainerView.visibility = if (database.allowTags()) View.VISIBLE else View.GONE
     }
 
     private fun assignEntryInfo(entryInfo: EntryInfo?) {

app/src/main/java/com/kunzisoft/keepass/activities/fragments/EntryFragment.kt

@@ -133,7 +133,7 @@ class EntryFragment: DatabaseFragment() {
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         context?.let { context ->
             attachmentsAdapter = EntryAttachmentsItemsAdapter(context)
             attachmentsAdapter?.database = database

app/src/main/java/com/kunzisoft/keepass/activities/fragments/GroupFragment.kt

@@ -36,9 +36,9 @@ import androidx.recyclerview.widget.RecyclerView
 import androidx.recyclerview.widget.RecyclerView.SCROLL_STATE_IDLE
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.dialogs.SortDialogFragment
-import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper
-import com.kunzisoft.keepass.credentialprovider.SpecialMode
 import com.kunzisoft.keepass.adapters.NodesAdapter
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSpecialMode
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.element.Group
 import com.kunzisoft.keepass.database.element.SortNodeEnum
@@ -154,46 +154,44 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
         super.onDetach()
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         context?.let { context ->
-            database?.let { database ->
-                mAdapter = NodesAdapter(context, database).apply {
-                    setOnNodeClickListener(object : NodesAdapter.NodeClickCallback {
-                        override fun onNodeClick(database: ContextualDatabase, node: Node) {
-                            if (nodeActionSelectionMode) {
-                                if (listActionNodes.contains(node)) {
-                                    // Remove selected item if already selected
-                                    listActionNodes.remove(node)
-                                } else {
-                                    // Add selected item if not already selected
-                                    listActionNodes.add(node)
-                                }
-                                nodeClickListener?.onNodeSelected(database, listActionNodes)
-                                setActionNodes(listActionNodes)
-                                notifyNodeChanged(node)
+            mAdapter = NodesAdapter(context, database).apply {
+                setOnNodeClickListener(object : NodesAdapter.NodeClickCallback {
+                    override fun onNodeClick(database: ContextualDatabase, node: Node) {
+                        if (nodeActionSelectionMode) {
+                            if (listActionNodes.contains(node)) {
+                                // Remove selected item if already selected
+                                listActionNodes.remove(node)
                             } else {
-                                nodeClickListener?.onNodeClick(database, node)
+                                // Add selected item if not already selected
+                                listActionNodes.add(node)
                             }
+                            nodeClickListener?.onNodeSelected(database, listActionNodes)
+                            setActionNodes(listActionNodes)
+                            notifyNodeChanged(node)
+                        } else {
+                            nodeClickListener?.onNodeClick(database, node)
                         }
+                    }
 
-                        override fun onNodeLongClick(database: ContextualDatabase, node: Node): Boolean {
-                            if (nodeActionPasteMode == PasteMode.UNDEFINED) {
-                                // Select the first item after a long click
-                                if (!listActionNodes.contains(node))
-                                    listActionNodes.add(node)
+                    override fun onNodeLongClick(database: ContextualDatabase, node: Node): Boolean {
+                        if (nodeActionPasteMode == PasteMode.UNDEFINED) {
+                            // Select the first item after a long click
+                            if (!listActionNodes.contains(node))
+                                listActionNodes.add(node)
 
-                                nodeClickListener?.onNodeSelected(database, listActionNodes)
+                            nodeClickListener?.onNodeSelected(database, listActionNodes)
 
-                                setActionNodes(listActionNodes)
-                                notifyNodeChanged(node)
-                                activity?.hideKeyboard()
-                            }
-                            return true
+                            setActionNodes(listActionNodes)
+                            notifyNodeChanged(node)
+                            activity?.hideKeyboard()
                         }
-                    })
-                }
-                mNodesRecyclerView?.adapter = mAdapter
+                        return true
+                    }
+                })
             }
+            mNodesRecyclerView?.adapter = mAdapter
         }
     }
 
@@ -248,7 +246,7 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
 
         mNodesRecyclerView?.addOnScrollListener(mRecycleViewScrollListener)
         activity?.intent?.let {
-            specialMode = EntrySelectionHelper.retrieveSpecialModeFromIntent(it)
+            specialMode = it.retrieveSpecialMode()
         }
     }
 
@@ -299,9 +297,9 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
         }
     }
 
-    private fun containsRecycleBin(nodes: List<Node>): Boolean {
-        return mDatabase?.isRecycleBinEnabled == true
-                && nodes.any { it == mDatabase?.recycleBin }
+    private fun containsRecycleBin(database: ContextualDatabase?, nodes: List<Node>): Boolean {
+        return database?.isRecycleBinEnabled == true
+                && nodes.any { it == database.recycleBin }
     }
 
     fun actionNodesCallback(database: ContextualDatabase,
@@ -328,7 +326,7 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
                     // Open and Edit for a single item
                     if (nodes.size == 1) {
                         // Edition
-                        if (database.isReadOnly || containsRecycleBin(nodes)) {
+                        if (database.isReadOnly || containsRecycleBin(database, nodes)) {
                             menu?.removeItem(R.id.menu_edit)
                         }
                     } else {
@@ -348,7 +346,7 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
                     }
 
                     // Deletion
-                    if (database.isReadOnly || containsRecycleBin(nodes)) {
+                    if (database.isReadOnly || containsRecycleBin(database, nodes)) {
                         menu?.removeItem(R.id.menu_delete)
                     }
                 }

app/src/main/java/com/kunzisoft/keepass/activities/fragments/IconFragment.kt

@@ -71,8 +71,8 @@ abstract class IconFragment<T: IconImageDraw> : DatabaseFragment(),
         resetAppTimeoutWhenViewFocusedOrChanged(view)
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        iconPickerAdapter.iconDrawableFactory = database?.iconDrawableFactory
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        iconPickerAdapter.iconDrawableFactory = database.iconDrawableFactory
 
         CoroutineScope(Dispatchers.IO).launch {
             val populateList = launch {

app/src/main/java/com/kunzisoft/keepass/activities/fragments/IconPickerFragment.kt

@@ -48,9 +48,9 @@ class IconPickerFragment : DatabaseFragment() {
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         iconPickerPagerAdapter = IconPickerPagerAdapter(this,
-            if (database?.allowCustomIcons == true) 2 else 1)
+            if (database.allowCustomIcons) 2 else 1)
         viewPager.adapter = iconPickerPagerAdapter
         TabLayoutMediator(tabLayout, viewPager) { tab, position ->
             tab.text = when (position) {

app/src/main/java/com/kunzisoft/keepass/activities/fragments/KeyGeneratorFragment.kt

@@ -107,7 +107,7 @@ class KeyGeneratorFragment : DatabaseFragment() {
         super.onDestroyView()
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         // Nothing here
     }
 

app/src/main/java/com/kunzisoft/keepass/activities/fragments/PassphraseGeneratorFragment.kt

@@ -244,7 +244,7 @@ class PassphraseGeneratorFragment : DatabaseFragment() {
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         // Nothing here
     }
 

app/src/main/java/com/kunzisoft/keepass/activities/fragments/PasswordGeneratorFragment.kt

@@ -293,20 +293,22 @@ class PasswordGeneratorFragment : DatabaseFragment() {
     private fun generatePassword() {
         var password = ""
         try {
-            password = PasswordGenerator(resources).generatePassword(getPasswordLength(),
-                uppercaseCompound.isChecked,
-                lowercaseCompound.isChecked,
-                digitsCompound.isChecked,
-                minusCompound.isChecked,
-                underlineCompound.isChecked,
-                spaceCompound.isChecked,
-                specialsCompound.isChecked,
-                bracketsCompound.isChecked,
-                extendedCompound.isChecked,
-                getConsiderChars(),
-                getIgnoreChars(),
-                atLeastOneCompound.isChecked,
-                excludeAmbiguousCompound.isChecked)
+            password = PasswordGenerator(resources).generatePassword(
+                length = getPasswordLength(),
+                upperCase = uppercaseCompound.isChecked,
+                lowerCase = lowercaseCompound.isChecked,
+                digits = digitsCompound.isChecked,
+                minus = minusCompound.isChecked,
+                underline = underlineCompound.isChecked,
+                space = spaceCompound.isChecked,
+                specials = specialsCompound.isChecked,
+                brackets = bracketsCompound.isChecked,
+                extended = extendedCompound.isChecked,
+                considerChars = getConsiderChars(),
+                ignoreChars = getIgnoreChars(),
+                atLeastOneFromEach = atLeastOneCompound.isChecked,
+                excludeAmbiguousChar = excludeAmbiguousCompound.isChecked
+            )
         } catch (e: Exception) {
             Log.e(TAG, "Unable to generate a password", e)
         }
@@ -318,7 +320,7 @@ class PasswordGeneratorFragment : DatabaseFragment() {
         super.onDestroy()
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         // Nothing here
     }
 

app/src/main/java/com/kunzisoft/keepass/activities/legacy/DatabaseActivity.kt

@@ -1,104 +1,229 @@
 package com.kunzisoft.keepass.activities.legacy
 
-import android.net.Uri
+import android.Manifest
+import android.content.pm.PackageManager
+import android.os.Build
 import android.os.Bundle
+import androidx.activity.result.contract.ActivityResultContracts
 import androidx.activity.viewModels
+import androidx.appcompat.app.AlertDialog
+import androidx.core.app.ActivityCompat
+import androidx.core.content.ContextCompat
+import androidx.lifecycle.Lifecycle
+import androidx.lifecycle.lifecycleScope
+import androidx.lifecycle.repeatOnLifecycle
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.activities.dialogs.DatabaseChangedDialogFragment
+import com.kunzisoft.keepass.activities.dialogs.DatabaseChangedDialogFragment.Companion.DATABASE_CHANGED_DIALOG_TAG
 import com.kunzisoft.keepass.activities.stylish.StylishActivity
 import com.kunzisoft.keepass.database.ContextualDatabase
-import com.kunzisoft.keepass.database.DatabaseTaskProvider
-import com.kunzisoft.keepass.database.MainCredential
-import com.kunzisoft.keepass.model.CipherEncryptDatabase
+import com.kunzisoft.keepass.database.DatabaseTaskProvider.Companion.startDatabaseService
+import com.kunzisoft.keepass.database.ProgressMessage
+import com.kunzisoft.keepass.model.SnapFileDatabaseInfo
 import com.kunzisoft.keepass.tasks.ActionRunnable
-import com.kunzisoft.keepass.utils.getBinaryDir
+import com.kunzisoft.keepass.tasks.ProgressTaskDialogFragment
+import com.kunzisoft.keepass.tasks.ProgressTaskDialogFragment.Companion.PROGRESS_TASK_DIALOG_TAG
 import com.kunzisoft.keepass.viewmodels.DatabaseViewModel
+import kotlinx.coroutines.launch
 
 abstract class DatabaseActivity : StylishActivity(), DatabaseRetrieval {
 
     protected val mDatabaseViewModel: DatabaseViewModel by viewModels()
-    protected var mDatabaseTaskProvider: DatabaseTaskProvider? = null
-    protected var mDatabase: ContextualDatabase? = null
+    protected val mDatabase: ContextualDatabase?
+        get() = mDatabaseViewModel.database
+
+    private var progressTaskDialogFragment: ProgressTaskDialogFragment? = null
+    private var databaseChangedDialogFragment: DatabaseChangedDialogFragment? = null
+
+    private val mActionDatabaseListener =
+        object : DatabaseChangedDialogFragment.ActionDatabaseChangedListener {
+            override fun onDatabaseChangeValidated() {
+                mDatabaseViewModel.onDatabaseChangeValidated()
+            }
+        }
+
+    private val tempServiceParameters = mutableListOf<Pair<Bundle?, String>>()
+    private val requestPermissionLauncher = registerForActivityResult(
+        ActivityResultContracts.RequestPermission()
+    ) { _ ->
+        // Whether or not the user has accepted, the service can be started,
+        // There just won't be any notification if it's not allowed.
+        tempServiceParameters.removeFirstOrNull()?.let {
+            startDatabaseService(it.first, it.second)
+        }
+    }
 
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
-
-        mDatabaseTaskProvider = DatabaseTaskProvider(this, showDatabaseDialog())
-
-        mDatabaseTaskProvider?.onDatabaseRetrieved = { database ->
-            val databaseWasReloaded = database?.wasReloaded == true
-            if (databaseWasReloaded && finishActivityIfReloadRequested()) {
-                finish()
-            } else if (mDatabase == null || mDatabase != database || databaseWasReloaded) {
-                database?.wasReloaded = false
-                onDatabaseRetrieved(database)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.STARTED) {
+                mDatabaseViewModel.actionState.collect { uiState ->
+                    when (uiState) {
+                        is DatabaseViewModel.ActionState.Loading -> {}
+                        is DatabaseViewModel.ActionState.OnDatabaseReloaded -> {
+                            if (finishActivityIfReloadRequested()) {
+                                finish()
+                            }
+                        }
+                        is DatabaseViewModel.ActionState.OnDatabaseInfoChanged -> {
+                            if (manageDatabaseInfo()) {
+                                showDatabaseChangedDialog(
+                                    uiState.previousDatabaseInfo,
+                                    uiState.newDatabaseInfo,
+                                    uiState.readOnlyDatabase
+                                )
+                            }
+                        }
+                        is DatabaseViewModel.ActionState.OnDatabaseActionRequested -> {
+                            startDatabasePermissionService(
+                                uiState.bundle,
+                                uiState.actionTask
+                            )
+                        }
+                        is DatabaseViewModel.ActionState.OnDatabaseActionStarted -> {
+                            showDialog(uiState.progressMessage)
+                        }
+                        is DatabaseViewModel.ActionState.OnDatabaseActionUpdated -> {
+                            showDialog(uiState.progressMessage)
+                        }
+                        is DatabaseViewModel.ActionState.OnDatabaseActionStopped -> {
+                            // nothing here, wait for the action to finish
+                        }
+                        is DatabaseViewModel.ActionState.OnDatabaseActionFinished -> {
+                            onDatabaseActionFinished(
+                                uiState.database,
+                                uiState.actionTask,
+                                uiState.result
+                            )
+                            stopDialog()
+                        }
+                    }
+                }
             }
         }
-        mDatabaseTaskProvider?.onActionFinish = { database, actionTask, result ->
-            onDatabaseActionFinished(database, actionTask, result)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.RESUMED) {
+                mDatabaseViewModel.databaseState.collect { database ->
+                    // Nullable function
+                    onUnknownDatabaseRetrieved(database)
+                    database?.let {
+                        onDatabaseRetrieved(database)
+                    }
+                }
+            }
         }
     }
 
-    protected open fun showDatabaseDialog(): Boolean {
-        return true
-    }
-
-
-    override fun onDestroy() {
-        mDatabaseTaskProvider?.destroy()
-        mDatabaseTaskProvider = null
-        mDatabase = null
-        super.onDestroy()
-    }
-
-
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        mDatabase = database
-        mDatabaseViewModel.defineDatabase(database)
+    /**
+     * Nullable function to retrieve a database
+     */
+    open fun onUnknownDatabaseRetrieved(database: ContextualDatabase?) {
         // optional method implementation
     }
 
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        // optional method implementation
+    }
+
+    open fun manageDatabaseInfo(): Boolean  = true
+
     override fun onDatabaseActionFinished(
         database: ContextualDatabase,
         actionTask: String,
         result: ActionRunnable.Result
     ) {
-        mDatabaseViewModel.onActionFinished(database, actionTask, result)
         // optional method implementation
     }
 
-    fun createDatabase(
-        databaseUri: Uri,
-        mainCredential: MainCredential
+    private fun startDatabasePermissionService(bundle: Bundle?, actionTask: String) {
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
+            if (ContextCompat.checkSelfPermission(this, Manifest.permission.POST_NOTIFICATIONS)
+                == PackageManager.PERMISSION_GRANTED
+            ) {
+                startDatabaseService(bundle, actionTask)
+            } else if (ActivityCompat.shouldShowRequestPermissionRationale(
+                    this,
+                    Manifest.permission.POST_NOTIFICATIONS
+                )
+            ) {
+                // it's not the first time, so the user deliberately chooses not to display the notification
+                startDatabaseService(bundle, actionTask)
+            } else {
+                AlertDialog.Builder(this)
+                    .setMessage(R.string.warning_database_notification_permission)
+                    .setNegativeButton(R.string.later) { _, _ ->
+                        // Refuses the notification, so start the service
+                        startDatabaseService(bundle, actionTask)
+                    }
+                    .setPositiveButton(R.string.ask) { _, _ ->
+                        // Save the temp parameters to ask the permission
+                        tempServiceParameters.add(Pair(bundle, actionTask))
+                        requestPermissionLauncher.launch(Manifest.permission.POST_NOTIFICATIONS)
+                    }.create().show()
+            }
+        } else {
+            startDatabaseService(bundle, actionTask)
+        }
+    }
+
+    private fun showDatabaseChangedDialog(
+        previousDatabaseInfo: SnapFileDatabaseInfo,
+        newDatabaseInfo: SnapFileDatabaseInfo,
+        readOnlyDatabase: Boolean
     ) {
-        mDatabaseTaskProvider?.startDatabaseCreate(databaseUri, mainCredential)
+        lifecycleScope.launch {
+            if (databaseChangedDialogFragment == null) {
+                databaseChangedDialogFragment = supportFragmentManager
+                    .findFragmentByTag(DATABASE_CHANGED_DIALOG_TAG) as DatabaseChangedDialogFragment?
+                databaseChangedDialogFragment?.actionDatabaseListener =
+                    mActionDatabaseListener
+            }
+            if (progressTaskDialogFragment == null) {
+                databaseChangedDialogFragment = DatabaseChangedDialogFragment.getInstance(
+                    previousDatabaseInfo,
+                    newDatabaseInfo,
+                    readOnlyDatabase
+                )
+                databaseChangedDialogFragment?.actionDatabaseListener =
+                    mActionDatabaseListener
+                databaseChangedDialogFragment?.show(
+                    supportFragmentManager,
+                    DATABASE_CHANGED_DIALOG_TAG
+                )
+            }
+        }
     }
 
-    fun loadDatabase(
-        databaseUri: Uri,
-        mainCredential: MainCredential,
-        readOnly: Boolean,
-        cipherEncryptDatabase: CipherEncryptDatabase?,
-        fixDuplicateUuid: Boolean
-    ) {
-        mDatabaseTaskProvider?.startDatabaseLoad(
-            databaseUri,
-            mainCredential,
-            readOnly,
-            cipherEncryptDatabase,
-            fixDuplicateUuid
-        )
+    private fun showDialog(progressMessage: ProgressMessage) {
+        lifecycleScope.launch {
+            if (showDatabaseDialog()) {
+                if (progressTaskDialogFragment == null) {
+                    progressTaskDialogFragment = supportFragmentManager
+                        .findFragmentByTag(PROGRESS_TASK_DIALOG_TAG) as ProgressTaskDialogFragment?
+                }
+                if (progressTaskDialogFragment == null) {
+                    progressTaskDialogFragment = ProgressTaskDialogFragment()
+                    progressTaskDialogFragment?.show(
+                        supportFragmentManager,
+                        PROGRESS_TASK_DIALOG_TAG
+                    )
+                }
+                progressTaskDialogFragment?.apply {
+                    updateTitle(progressMessage.titleId)
+                    updateMessage(progressMessage.messageId)
+                    updateWarning(progressMessage.warningId)
+                    setCancellable(progressMessage.cancelable)
+                }
+            }
+        }
     }
 
-    protected fun closeDatabase() {
-        mDatabase?.clearAndClose(this.getBinaryDir())
+    private fun stopDialog() {
+        progressTaskDialogFragment?.dismissAllowingStateLoss()
+        progressTaskDialogFragment = null
     }
 
-    override fun onResume() {
-        super.onResume()
-        mDatabaseTaskProvider?.registerProgressTask()
-    }
-    
-    override fun onPause() {
-        mDatabaseTaskProvider?.unregisterProgressTask()
-        super.onPause()
+    protected open fun showDatabaseDialog(): Boolean {
+        return true
     }
 }

app/src/main/java/com/kunzisoft/keepass/activities/legacy/DatabaseLockActivity.kt

@@ -34,7 +34,7 @@ import androidx.appcompat.app.AlertDialog
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.dialogs.DeleteNodesDialogFragment
 import com.kunzisoft.keepass.activities.dialogs.PasswordEncodingDialogFragment
-import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.removeModes
 import com.kunzisoft.keepass.credentialprovider.SpecialMode
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.MainCredential
@@ -87,128 +87,44 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
             deleteDatabaseNodes(nodes)
         }
 
-        mDatabaseViewModel.saveDatabase.observe(this) { save ->
-            mDatabaseTaskProvider?.startDatabaseSave(save)
-        }
-
-        mDatabaseViewModel.mergeDatabase.observe(this) { save ->
-            mDatabaseTaskProvider?.startDatabaseMerge(save)
-        }
-
-        mDatabaseViewModel.reloadDatabase.observe(this) { fixDuplicateUuid ->
-            mDatabaseTaskProvider?.askToStartDatabaseReload(mDatabase?.dataModifiedSinceLastLoading != false) {
-                mDatabaseTaskProvider?.startDatabaseReload(fixDuplicateUuid)
-            }
-        }
-
-        mDatabaseViewModel.saveName.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveName(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveDescription.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveDescription(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveDefaultUsername.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveDefaultUsername(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveColor.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveColor(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveCompression.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveCompression(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.removeUnlinkData.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseRemoveUnlinkedData(it)
-        }
-
-        mDatabaseViewModel.saveRecycleBin.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveRecycleBin(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveTemplatesGroup.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveTemplatesGroup(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveMaxHistoryItems.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveMaxHistoryItems(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveMaxHistorySize.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveMaxHistorySize(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveEncryption.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveEncryption(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveKeyDerivation.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveKeyDerivation(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveIterations.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveIterations(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveMemoryUsage.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveMemoryUsage(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveParallelism.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveParallelism(it.oldValue, it.newValue, it.save)
-        }
-
         mExitLock = false
     }
 
-    open fun finishActivityIfDatabaseNotLoaded(): Boolean {
-        return true
-    }
-
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         // End activity if database not loaded
-        if (finishActivityIfDatabaseNotLoaded() && (database == null || !database.loaded)) {
+        if (database.loaded.not())
             finish()
-        }
 
         // Focus view to reinitialize timeout,
         // view is not necessary loaded so retry later in resume
         viewToInvalidateTimeout()
-            ?.resetAppTimeoutWhenViewTouchedOrFocused(this, database?.loaded)
+            ?.resetAppTimeoutWhenViewTouchedOrFocused(this, database.loaded)
 
-        database?.let {
-            // check timeout
-            if (mTimeoutEnable) {
-                if (mLockReceiver == null) {
-                    mLockReceiver = LockReceiver {
-                        mDatabase = null
-                        closeDatabase(database)
-                        mExitLock = true
-                        closeOptionsMenu()
-                        finish()
-                    }
-                    registerLockReceiver(mLockReceiver)
+        // check timeout
+        if (mTimeoutEnable) {
+            if (mLockReceiver == null) {
+                mLockReceiver = LockReceiver {
+                    closeDatabase(database)
+                    mExitLock = true
+                    closeOptionsMenu()
+                    finish()
                 }
-
-                // After the first creation
-                // or If simply swipe with another application
-                // If the time is out -> close the Activity
-                TimeoutHelper.checkTimeAndLockIfTimeout(this)
-                // If onCreate already record time
-                if (!mExitLock)
-                    TimeoutHelper.recordTime(this, database.loaded)
+                registerLockReceiver(mLockReceiver)
             }
 
-            mDatabaseReadOnly = database.isReadOnly
-            mMergeDataAllowed = database.isMergeDataAllowed()
-
-            checkRegister()
+            // After the first creation
+            // or If simply swipe with another application
+            // If the time is out -> close the Activity
+            TimeoutHelper.checkTimeAndLockIfTimeout(this)
+            // If onCreate already record time
+            if (!mExitLock)
+                TimeoutHelper.recordTime(this, database.loaded)
         }
+
+        mDatabaseReadOnly = database.isReadOnly
+        mMergeDataAllowed = database.isMergeDataAllowed()
+
+        checkRegister()
     }
 
     override fun finish() {
@@ -227,7 +143,6 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
         actionTask: String,
         result: ActionRunnable.Result
     ) {
-        super.onDatabaseActionFinished(database, actionTask, result)
         when (actionTask) {
             DatabaseTaskNotificationService.ACTION_DATABASE_MERGE_TASK,
             DatabaseTaskNotificationService.ACTION_DATABASE_RELOAD_TASK -> {
@@ -249,24 +164,15 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
         databaseUri: Uri?,
         mainCredential: MainCredential
     ) {
-        assignDatabasePassword(databaseUri, mainCredential)
+        mDatabaseViewModel.assignMainCredential(databaseUri, mainCredential)
     }
 
-    private fun assignDatabasePassword(
-        databaseUri: Uri?,
-        mainCredential: MainCredential
-    ) {
-        if (databaseUri != null) {
-            mDatabaseTaskProvider?.startDatabaseAssignCredential(databaseUri, mainCredential)
-        }
-    }
-
-    fun assignPassword(mainCredential: MainCredential) {
+    fun assignMainCredential(mainCredential: MainCredential) {
         mDatabase?.let { database ->
             database.fileUri?.let { databaseUri ->
                 // Show the progress dialog now or after dialog confirmation
                 if (database.isValidCredential(mainCredential.toMasterCredential(contentResolver))) {
-                    assignDatabasePassword(databaseUri, mainCredential)
+                    mDatabaseViewModel.assignMainCredential(databaseUri, mainCredential)
                 } else {
                     PasswordEncodingDialogFragment.getInstance(databaseUri, mainCredential)
                         .show(supportFragmentManager, "passwordEncodingTag")
@@ -276,45 +182,51 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
     }
 
     fun saveDatabase() {
-        mDatabaseTaskProvider?.startDatabaseSave(true)
+        mDatabaseViewModel.saveDatabase(save = true)
     }
 
     fun saveDatabaseTo(uri: Uri) {
-        mDatabaseTaskProvider?.startDatabaseSave(true, uri)
+        mDatabaseViewModel.saveDatabase(save = true, saveToUri = uri)
     }
 
     fun mergeDatabase() {
-        mDatabaseTaskProvider?.startDatabaseMerge(mAutoSaveEnable)
+        mDatabaseViewModel.mergeDatabase(save = mAutoSaveEnable)
     }
 
     fun mergeDatabaseFrom(uri: Uri, mainCredential: MainCredential) {
-        mDatabaseTaskProvider?.startDatabaseMerge(mAutoSaveEnable, uri, mainCredential)
+        mDatabaseViewModel.mergeDatabase(mAutoSaveEnable, uri, mainCredential)
     }
 
     fun reloadDatabase() {
-        mDatabaseTaskProvider?.askToStartDatabaseReload(mDatabase?.dataModifiedSinceLastLoading != false) {
-            mDatabaseTaskProvider?.startDatabaseReload(false)
-        }
+        mDatabaseViewModel.reloadDatabase(fixDuplicateUuid = false)
     }
 
-    fun createEntry(newEntry: Entry,
-                    parent: Group) {
-        mDatabaseTaskProvider?.startDatabaseCreateEntry(newEntry, parent, mAutoSaveEnable)
+    fun createEntry(
+        newEntry: Entry,
+        parent: Group
+    ) {
+        mDatabaseViewModel.createEntry(newEntry, parent, mAutoSaveEnable)
     }
 
-    fun updateEntry(oldEntry: Entry,
-                    entryToUpdate: Entry) {
-        mDatabaseTaskProvider?.startDatabaseUpdateEntry(oldEntry, entryToUpdate, mAutoSaveEnable)
+    fun updateEntry(
+        oldEntry: Entry,
+        entryToUpdate: Entry
+    ) {
+        mDatabaseViewModel.updateEntry(oldEntry, entryToUpdate, mAutoSaveEnable)
     }
 
-    fun copyNodes(nodesToCopy: List<Node>,
-                  newParent: Group) {
-        mDatabaseTaskProvider?.startDatabaseCopyNodes(nodesToCopy, newParent, mAutoSaveEnable)
+    fun copyNodes(
+        nodesToCopy: List<Node>,
+        newParent: Group
+    ) {
+        mDatabaseViewModel.copyNodes(nodesToCopy, newParent, mAutoSaveEnable)
     }
 
-    fun moveNodes(nodesToMove: List<Node>,
-                  newParent: Group) {
-        mDatabaseTaskProvider?.startDatabaseMoveNodes(nodesToMove, newParent, mAutoSaveEnable)
+    fun moveNodes(
+        nodesToMove: List<Node>,
+        newParent: Group
+    ) {
+        mDatabaseViewModel.moveNodes(nodesToMove, newParent, mAutoSaveEnable)
     }
 
     private fun eachNodeRecyclable(database: ContextualDatabase, nodes: List<Node>): Boolean {
@@ -330,6 +242,7 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
     }
 
     fun deleteNodes(nodes: List<Node>, recycleBin: Boolean = false) {
+        // TODO Move in ViewModel
         mDatabase?.let { database ->
             // If recycle bin enabled, ensure it exists
             if (database.isRecycleBinEnabled) {
@@ -350,11 +263,14 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
     }
 
     private fun deleteDatabaseNodes(nodes: List<Node>) {
-        mDatabaseTaskProvider?.startDatabaseDeleteNodes(nodes, mAutoSaveEnable)
+        mDatabaseViewModel.deleteNodes(nodes, mAutoSaveEnable)
     }
 
-    fun createGroup(parent: Group,
-                    groupInfo: GroupInfo?) {
+    fun createGroup(
+        parent: Group,
+        groupInfo: GroupInfo?
+    ) {
+        // TODO Move in ViewModel
         // Build the group
         mDatabase?.createGroup()?.let { newGroup ->
             groupInfo?.let { info ->
@@ -362,12 +278,15 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
             }
             // Not really needed here because added in runnable but safe
             newGroup.parent = parent
-            mDatabaseTaskProvider?.startDatabaseCreateGroup(newGroup, parent, mAutoSaveEnable)
+            mDatabaseViewModel.createGroup(newGroup, parent, mAutoSaveEnable)
         }
     }
 
-    fun updateGroup(oldGroup: Group,
-                    groupInfo: GroupInfo) {
+    fun updateGroup(
+        oldGroup: Group,
+        groupInfo: GroupInfo
+    ) {
+        // TODO Move in ViewModel
         // If group updated save it in the database
         val updateGroup = Group(oldGroup).let { updateGroup ->
             updateGroup.apply {
@@ -377,27 +296,28 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
                 this.setGroupInfo(groupInfo)
             }
         }
-        mDatabaseTaskProvider?.startDatabaseUpdateGroup(oldGroup, updateGroup, mAutoSaveEnable)
+        mDatabaseViewModel.updateGroup(oldGroup, updateGroup, mAutoSaveEnable)
     }
 
-    fun restoreEntryHistory(mainEntryId: NodeId<UUID>,
-                            entryHistoryPosition: Int) {
-        mDatabaseTaskProvider
-            ?.startDatabaseRestoreEntryHistory(mainEntryId, entryHistoryPosition, mAutoSaveEnable)
+    fun restoreEntryHistory(
+        mainEntryId: NodeId<UUID>,
+        entryHistoryPosition: Int
+    ) {
+        mDatabaseViewModel.restoreEntryHistory(mainEntryId, entryHistoryPosition, mAutoSaveEnable)
     }
 
-    fun deleteEntryHistory(mainEntryId: NodeId<UUID>,
-                           entryHistoryPosition: Int) {
-        mDatabaseTaskProvider?.startDatabaseDeleteEntryHistory(mainEntryId, entryHistoryPosition, mAutoSaveEnable)
+    fun deleteEntryHistory(
+        mainEntryId: NodeId<UUID>,
+        entryHistoryPosition: Int
+    ) {
+        mDatabaseViewModel.deleteEntryHistory(mainEntryId, entryHistoryPosition, mAutoSaveEnable)
     }
 
     private fun checkRegister() {
-        // If in ave or registration mode, don't allow read only
-        if ((mSpecialMode == SpecialMode.SAVE
-                    || mSpecialMode == SpecialMode.REGISTRATION)
-            && mDatabaseReadOnly) {
+        // If in registration mode, don't allow read only
+        if (mSpecialMode == SpecialMode.REGISTRATION && mDatabaseReadOnly) {
             Toast.makeText(this, R.string.error_registration_read_only , Toast.LENGTH_LONG).show()
-            EntrySelectionHelper.removeModesFromIntent(intent)
+            intent.removeModes()
             finish()
         }
     }

app/src/main/java/com/kunzisoft/keepass/activities/legacy/DatabaseModeActivity.kt

@@ -1,12 +1,21 @@
 package com.kunzisoft.keepass.activities.legacy
 
+import android.content.Intent
 import android.os.Bundle
 import android.view.View
 import android.widget.Toast
 import androidx.activity.OnBackPressedCallback
+import androidx.activity.result.ActivityResultLauncher
+import androidx.activity.result.contract.ActivityResultContracts
 import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper
 import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.isIntentSenderMode
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.removeInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.removeModes
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveRegisterInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSearchInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSpecialMode
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveTypeMode
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.setActivityResult
 import com.kunzisoft.keepass.credentialprovider.SpecialMode
 import com.kunzisoft.keepass.credentialprovider.TypeMode
 import com.kunzisoft.keepass.model.RegisterInfo
@@ -21,10 +30,25 @@ import com.kunzisoft.keepass.view.ToolbarSpecial
 abstract class DatabaseModeActivity : DatabaseActivity() {
 
     protected var mSpecialMode: SpecialMode = SpecialMode.DEFAULT
-    private var mTypeMode: TypeMode = TypeMode.DEFAULT
+    protected var mTypeMode: TypeMode = TypeMode.DEFAULT
 
     private var mToolbarSpecial: ToolbarSpecial? = null
 
+    /**
+     * Utility activity result launcher,
+     * Used recursively, close each activity with return data
+     */
+    protected open var mCredentialActivityResultLauncher: ActivityResultLauncher<Intent>? =
+        registerForActivityResult(
+        ActivityResultContracts.StartActivityForResult()
+    ) {
+        setActivityResult(
+            lockDatabase = false,
+            resultCode = it.resultCode,
+            data = it.data
+        )
+    }
+
     open fun onDatabaseBackPressed() {
         if (mSpecialMode != SpecialMode.DEFAULT)
             onCancelSpecialMode()
@@ -50,8 +74,8 @@ abstract class DatabaseModeActivity : DatabaseActivity() {
 
     fun onLaunchActivitySpecialMode() {
         if (!isIntentSender()) {
-            EntrySelectionHelper.removeModesFromIntent(intent)
-            EntrySelectionHelper.removeInfoFromIntent(intent)
+            intent.removeModes()
+            intent.removeInfo()
             finish()
         }
     }
@@ -60,8 +84,8 @@ abstract class DatabaseModeActivity : DatabaseActivity() {
         if (isIntentSender()) {
             super.finish()
         } else {
-            EntrySelectionHelper.removeModesFromIntent(intent)
-            EntrySelectionHelper.removeInfoFromIntent(intent)
+            intent.removeModes()
+            intent.removeInfo()
             if (mSpecialMode != SpecialMode.DEFAULT) {
                 backToTheMainAppAndFinish()
             }
@@ -73,8 +97,8 @@ abstract class DatabaseModeActivity : DatabaseActivity() {
             // To get the app caller, only for IntentSender
             onRegularBackPressed()
         } else {
-            EntrySelectionHelper.removeModesFromIntent(intent)
-            EntrySelectionHelper.removeInfoFromIntent(intent)
+            intent.removeModes()
+            intent.removeInfo()
             if (mSpecialMode != SpecialMode.DEFAULT) {
                 backToTheMainAppAndFinish()
             }
@@ -105,18 +129,18 @@ abstract class DatabaseModeActivity : DatabaseActivity() {
             }
         })
 
-        mSpecialMode = EntrySelectionHelper.retrieveSpecialModeFromIntent(intent)
-        mTypeMode = EntrySelectionHelper.retrieveTypeModeFromIntent(intent)
+        mSpecialMode = intent.retrieveSpecialMode()
+        mTypeMode = intent.retrieveTypeMode()
     }
 
     override fun onResume() {
         super.onResume()
 
-        mSpecialMode = EntrySelectionHelper.retrieveSpecialModeFromIntent(intent)
-        mTypeMode = EntrySelectionHelper.retrieveTypeModeFromIntent(intent)
-        val registerInfo: RegisterInfo? = EntrySelectionHelper.retrieveRegisterInfoFromIntent(intent)
+        mSpecialMode = intent.retrieveSpecialMode()
+        mTypeMode = intent.retrieveTypeMode()
+        val registerInfo: RegisterInfo? = intent.retrieveRegisterInfo()
         val searchInfo: SearchInfo? = registerInfo?.searchInfo
-                ?: EntrySelectionHelper.retrieveSearchInfoFromIntent(intent)
+                ?: intent.retrieveSearchInfo()
 
         // To show the selection mode
         mToolbarSpecial = findViewById(R.id.special_mode_view)
@@ -125,9 +149,8 @@ abstract class DatabaseModeActivity : DatabaseActivity() {
             val selectionModeStringId = when (mSpecialMode) {
                 SpecialMode.DEFAULT, // Not important because hidden
                 SpecialMode.SEARCH -> R.string.search_mode
-                SpecialMode.SAVE -> R.string.save_mode
                 SpecialMode.SELECTION -> R.string.selection_mode
-                SpecialMode.REGISTRATION -> R.string.registration_mode
+                SpecialMode.REGISTRATION -> R.string.save_mode // Save is registration mode
             }
             val typeModeStringId = when (mTypeMode) {
                 TypeMode.DEFAULT, // Not important because hidden
@@ -145,7 +168,6 @@ abstract class DatabaseModeActivity : DatabaseActivity() {
             visible = when (mSpecialMode) {
                 SpecialMode.DEFAULT -> false
                 SpecialMode.SEARCH -> true
-                SpecialMode.SAVE -> true
                 SpecialMode.SELECTION -> true
                 SpecialMode.REGISTRATION -> true
             }

app/src/main/java/com/kunzisoft/keepass/activities/legacy/DatabaseRetrieval.kt

@@ -4,8 +4,11 @@ import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.tasks.ActionRunnable
 
 interface DatabaseRetrieval {
-    fun onDatabaseRetrieved(database: ContextualDatabase?)
-    fun onDatabaseActionFinished(database: ContextualDatabase,
-                                 actionTask: String,
-                                 result: ActionRunnable.Result)
+    fun onDatabaseRetrieved(database: ContextualDatabase)
+
+    fun onDatabaseActionFinished(
+        database: ContextualDatabase,
+        actionTask: String,
+        result: ActionRunnable.Result
+    )
 }

app/src/main/java/com/kunzisoft/keepass/credentialprovider/EntrySelectionHelper.kt

@@ -24,26 +24,31 @@ import android.content.Context
 import android.content.Intent
 import android.graphics.drawable.Icon
 import android.os.Build
+import android.os.Bundle
+import android.os.ParcelUuid
 import android.util.Log
 import android.widget.RemoteViews
 import androidx.activity.result.ActivityResultLauncher
-import androidx.activity.result.contract.ActivityResultContracts
 import androidx.annotation.RequiresApi
-import androidx.appcompat.app.AppCompatActivity
 import androidx.core.content.ContextCompat
+import androidx.core.graphics.drawable.IconCompat
 import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.credentialprovider.autofill.AutofillComponent
-import com.kunzisoft.keepass.credentialprovider.autofill.AutofillHelper
-import com.kunzisoft.keepass.credentialprovider.autofill.AutofillHelper.addAutofillComponent
 import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.database.element.node.NodeIdUUID
 import com.kunzisoft.keepass.model.EntryInfo
 import com.kunzisoft.keepass.model.RegisterInfo
 import com.kunzisoft.keepass.model.SearchInfo
-import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.utils.LOCK_ACTION
+import com.kunzisoft.keepass.utils.getEnum
 import com.kunzisoft.keepass.utils.getEnumExtra
+import com.kunzisoft.keepass.utils.getParcelableCompat
 import com.kunzisoft.keepass.utils.getParcelableExtraCompat
+import com.kunzisoft.keepass.utils.getParcelableList
+import com.kunzisoft.keepass.utils.putEnum
 import com.kunzisoft.keepass.utils.putEnumExtra
+import com.kunzisoft.keepass.utils.putParcelableList
+import java.io.IOException
+import java.util.UUID
 
 object EntrySelectionHelper {
 
@@ -51,6 +56,8 @@ object EntrySelectionHelper {
     private const val KEY_TYPE_MODE = "com.kunzisoft.keepass.extra.TYPE_MODE"
     private const val KEY_SEARCH_INFO = "com.kunzisoft.keepass.extra.SEARCH_INFO"
     private const val KEY_REGISTER_INFO = "com.kunzisoft.keepass.extra.REGISTER_INFO"
+    private const val EXTRA_NODES_IDS = "com.kunzisoft.keepass.extra.NODES_IDS"
+    private const val EXTRA_NODE_ID = "com.kunzisoft.keepass.extra.NODE_ID"
 
     /**
      * Finish the activity by passing the result code and by locking the database if necessary
@@ -58,7 +65,7 @@ object EntrySelectionHelper {
     fun Activity.setActivityResult(
         lockDatabase: Boolean = false,
         resultCode: Int,
-        data: Intent? = null,
+        data: Intent? = null
     ) {
         when (resultCode) {
             Activity.RESULT_OK ->
@@ -68,170 +75,212 @@ object EntrySelectionHelper {
         }
         this.finish()
 
-        if (lockDatabase && PreferencesUtil.isAutofillCloseDatabaseEnable(this)) {
+        if (lockDatabase) {
             // Close the database
             this.sendBroadcast(Intent(LOCK_ACTION))
         }
     }
 
-    /**
-     * Utility method to build a registerForActivityResult,
-     * Used recursively, close each activity with return data
-     */
-    fun AppCompatActivity.buildActivityResultLauncher(
-        lockDatabase: Boolean = false,
-        dataTransformation: (data: Intent?) -> Intent? = { it },
-    ): ActivityResultLauncher<Intent> {
-        return this.registerForActivityResult(
-            ActivityResultContracts.StartActivityForResult()
-        ) {
-            setActivityResult(
-                lockDatabase,
-                it.resultCode,
-                dataTransformation(it.data)
-            )
+    fun startActivityForSearchModeResult(
+        context: Context,
+        intent: Intent,
+        searchInfo: SearchInfo
+    ) {
+        intent.addSpecialMode(SpecialMode.SEARCH)
+        intent.addSearchInfo(searchInfo)
+        intent.flags = intent.flags or Intent.FLAG_ACTIVITY_CLEAR_TASK
+        context.startActivity(intent)
+    }
+
+    fun startActivityForSelectionModeResult(
+        context: Context,
+        intent: Intent,
+        typeMode: TypeMode,
+        searchInfo: SearchInfo?,
+        activityResultLauncher: ActivityResultLauncher<Intent>? = null,
+    ) {
+        intent.addSpecialMode(SpecialMode.SELECTION)
+        intent.addTypeMode(typeMode)
+        intent.addSearchInfo(searchInfo)
+        if (activityResultLauncher == null) {
+            intent.flags = intent.flags or Intent.FLAG_ACTIVITY_CLEAR_TASK
         }
-    }
-
-    fun startActivityForSearchModeResult(context: Context,
-                                         intent: Intent,
-                                         searchInfo: SearchInfo) {
-        addSpecialModeInIntent(intent, SpecialMode.SEARCH)
-        addSearchInfoInIntent(intent, searchInfo)
-        intent.flags = intent.flags or Intent.FLAG_ACTIVITY_CLEAR_TASK
-        context.startActivity(intent)
-    }
-
-    fun startActivityForSaveModeResult(context: Context,
-                                             intent: Intent,
-                                             searchInfo: SearchInfo) {
-        addSpecialModeInIntent(intent, SpecialMode.SAVE)
-        addTypeModeInIntent(intent, TypeMode.DEFAULT)
-        addSearchInfoInIntent(intent, searchInfo)
-        intent.flags = intent.flags or Intent.FLAG_ACTIVITY_CLEAR_TASK
-        context.startActivity(intent)
-    }
-
-    fun startActivityForKeyboardSelectionModeResult(context: Context,
-                                                    intent: Intent,
-                                                    searchInfo: SearchInfo?) {
-        addSpecialModeInIntent(intent, SpecialMode.SELECTION)
-        addTypeModeInIntent(intent, TypeMode.MAGIKEYBOARD)
-        addSearchInfoInIntent(intent, searchInfo)
-        intent.flags = intent.flags or Intent.FLAG_ACTIVITY_CLEAR_TASK
-        context.startActivity(intent)
-    }
-
-    /**
-     * Utility method to start an activity with an Autofill for result
-     */
-    @RequiresApi(Build.VERSION_CODES.O)
-    fun startActivityForAutofillSelectionModeResult(
-        context: Context,
-        intent: Intent,
-        activityResultLauncher: ActivityResultLauncher<Intent>?,
-        autofillComponent: AutofillComponent,
-        searchInfo: SearchInfo?
-    ) {
-        addSpecialModeInIntent(intent, SpecialMode.SELECTION)
-        addTypeModeInIntent(intent, TypeMode.AUTOFILL)
-        intent.addAutofillComponent(context, autofillComponent)
-        addSearchInfoInIntent(intent, searchInfo)
-        activityResultLauncher?.launch(intent)
-    }
-
-    @RequiresApi(Build.VERSION_CODES.UPSIDE_DOWN_CAKE)
-    fun startActivityForPasskeySelectionModeResult(
-        context: Context,
-        intent: Intent,
-        activityResultLauncher: ActivityResultLauncher<Intent>?,
-        searchInfo: SearchInfo?
-    ) {
-        addSpecialModeInIntent(intent, SpecialMode.SELECTION)
-        addTypeModeInIntent(intent, TypeMode.PASSKEY)
-        addSearchInfoInIntent(intent, searchInfo)
-        activityResultLauncher?.launch(intent)
+        activityResultLauncher?.launch(intent) ?: context.startActivity(intent)
     }
 
     fun startActivityForRegistrationModeResult(
-        context: Context?,
+        context: Context,
         activityResultLauncher: ActivityResultLauncher<Intent>?,
         intent: Intent,
         registerInfo: RegisterInfo?,
         typeMode: TypeMode
     ) {
-        addSpecialModeInIntent(intent, SpecialMode.REGISTRATION)
-        addTypeModeInIntent(intent, typeMode)
-        addRegisterInfoInIntent(intent, registerInfo)
+        intent.addSpecialMode(SpecialMode.REGISTRATION)
+        intent.addTypeMode(typeMode)
+        intent.addRegisterInfo(registerInfo)
         if (activityResultLauncher == null) {
             intent.flags = intent.flags or Intent.FLAG_ACTIVITY_CLEAR_TASK
         }
-        activityResultLauncher?.launch(intent) ?: context?.startActivity(intent) ?:
-            throw IllegalStateException("At least Context or ActivityResultLauncher must not be null")
+        activityResultLauncher?.launch(intent) ?: context.startActivity(intent)
     }
 
-    fun addSearchInfoInIntent(intent: Intent, searchInfo: SearchInfo?) {
+    /**
+     * Build the special mode response for internal entry selection for one entry
+     */
+    fun Activity.buildSpecialModeResponseAndSetResult(
+        entryInfo: EntryInfo,
+        extras: Bundle? = null
+    ) {
+        this.buildSpecialModeResponseAndSetResult(listOf(entryInfo), extras)
+    }
+
+    /**
+     * Build the special mode response for internal entry selection for multiple entries
+     */
+    fun Activity.buildSpecialModeResponseAndSetResult(
+        entriesInfo: List<EntryInfo>,
+        extras: Bundle? = null
+    ) {
+        try {
+            val mReplyIntent = Intent()
+            Log.d(javaClass.name, "Success special mode manual selection")
+            mReplyIntent.addNodesIds(entriesInfo.map { it.id })
+            extras?.let {
+                mReplyIntent.putExtras(it)
+            }
+            setResult(Activity.RESULT_OK, mReplyIntent)
+        } catch (e: Exception) {
+            Log.e(javaClass.name, "Unable to add the result", e)
+            setResult(Activity.RESULT_CANCELED)
+        }
+    }
+
+    fun Intent.addSearchInfo(searchInfo: SearchInfo?): Intent {
         searchInfo?.let {
-            intent.putExtra(KEY_SEARCH_INFO, it)
+            putExtra(KEY_SEARCH_INFO, it)
         }
+        return this
     }
 
-    fun retrieveSearchInfoFromIntent(intent: Intent): SearchInfo? {
-        return intent.getParcelableExtraCompat(KEY_SEARCH_INFO)
+    fun Bundle.addSearchInfo(searchInfo: SearchInfo?): Bundle {
+        searchInfo?.let {
+            putParcelable(KEY_SEARCH_INFO, it)
+        }
+        return this
     }
 
-    private fun addRegisterInfoInIntent(intent: Intent, registerInfo: RegisterInfo?) {
+    fun Intent.retrieveSearchInfo(): SearchInfo? {
+        return getParcelableExtraCompat(KEY_SEARCH_INFO)
+    }
+
+    fun Bundle.getSearchInfo(): SearchInfo? {
+        return getParcelableCompat(KEY_SEARCH_INFO)
+    }
+
+    fun Intent.addRegisterInfo(registerInfo: RegisterInfo?): Intent {
         registerInfo?.let {
-            intent.putExtra(KEY_REGISTER_INFO, it)
+            putExtra(KEY_REGISTER_INFO, it)
         }
+        return this
     }
 
-    fun retrieveRegisterInfoFromIntent(intent: Intent): RegisterInfo? {
-        return intent.getParcelableExtraCompat(KEY_REGISTER_INFO)
+    fun Bundle.addRegisterInfo(registerInfo: RegisterInfo?): Bundle {
+        registerInfo?.let {
+            putParcelable(KEY_REGISTER_INFO, it)
+        }
+        return this
     }
 
-    fun removeInfoFromIntent(intent: Intent) {
-        intent.removeExtra(KEY_SEARCH_INFO)
-        intent.removeExtra(KEY_REGISTER_INFO)
+    fun Intent.retrieveRegisterInfo(): RegisterInfo? {
+        return getParcelableExtraCompat(KEY_REGISTER_INFO)
     }
 
-    fun addSpecialModeInIntent(intent: Intent, specialMode: SpecialMode) {
-        // TODO Replace by Intent.addSpecialMode
-        intent.putEnumExtra(KEY_SPECIAL_MODE, specialMode)
+    fun Bundle.getRegisterInfo(): RegisterInfo? {
+        return getParcelableCompat(KEY_REGISTER_INFO)
     }
+
+    fun Intent.removeInfo() {
+        removeExtra(KEY_SEARCH_INFO)
+        removeExtra(KEY_REGISTER_INFO)
+    }
+
     fun Intent.addSpecialMode(specialMode: SpecialMode): Intent {
         this.putEnumExtra(KEY_SPECIAL_MODE, specialMode)
         return this
     }
 
-    fun retrieveSpecialModeFromIntent(intent: Intent): SpecialMode {
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
-            if (AutofillHelper.retrieveAutofillComponent(intent) != null)
-                return SpecialMode.SELECTION
-        }
-        return intent.getEnumExtra<SpecialMode>(KEY_SPECIAL_MODE) ?: SpecialMode.DEFAULT
+    fun Bundle.addSpecialMode(specialMode: SpecialMode): Bundle {
+        this.putEnum(KEY_SPECIAL_MODE, specialMode)
+        return this
     }
 
-    private fun addTypeModeInIntent(intent: Intent, typeMode: TypeMode) {
-        // TODO Replace by Intent.addTypeMode
-        intent.putEnumExtra(KEY_TYPE_MODE, typeMode)
+    fun Intent.retrieveSpecialMode(): SpecialMode {
+        return this.getEnumExtra<SpecialMode>(KEY_SPECIAL_MODE) ?: SpecialMode.DEFAULT
     }
+
+    fun Bundle.getSpecialMode(): SpecialMode {
+        return this.getEnum<SpecialMode>(KEY_SPECIAL_MODE) ?: SpecialMode.DEFAULT
+    }
+
     fun Intent.addTypeMode(typeMode: TypeMode): Intent {
         this.putEnumExtra(KEY_TYPE_MODE, typeMode)
         return this
     }
 
-    fun retrieveTypeModeFromIntent(intent: Intent): TypeMode {
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
-            if (AutofillHelper.retrieveAutofillComponent(intent) != null)
-                return TypeMode.AUTOFILL
-        }
-        return intent.getEnumExtra<TypeMode>(KEY_TYPE_MODE) ?: TypeMode.DEFAULT
+    fun Intent.retrieveTypeMode(): TypeMode {
+        return getEnumExtra<TypeMode>(KEY_TYPE_MODE) ?: TypeMode.DEFAULT
     }
 
-    fun removeModesFromIntent(intent: Intent) {
-        intent.removeExtra(KEY_SPECIAL_MODE)
-        intent.removeExtra(KEY_TYPE_MODE)
+    fun Intent.removeModes() {
+        removeExtra(KEY_SPECIAL_MODE)
+        removeExtra(KEY_TYPE_MODE)
+    }
+
+    fun Intent.addNodesIds(nodesIds: List<UUID>): Intent {
+        this.putParcelableList(EXTRA_NODES_IDS, nodesIds.map { ParcelUuid(it) })
+        return this
+    }
+
+    fun Intent.retrieveNodesIds(): List<UUID>? {
+        return getParcelableList<ParcelUuid>(EXTRA_NODES_IDS)?.map { it.uuid }
+    }
+
+    fun Intent.removeNodesIds() {
+        removeExtra(EXTRA_NODES_IDS)
+    }
+
+    /**
+     * Add the node id to the intent
+     */
+    fun Intent.addNodeId(nodeId: UUID?) {
+        nodeId?.let {
+            putExtra(EXTRA_NODE_ID, ParcelUuid(nodeId))
+        }
+    }
+
+    /**
+     * Retrieve the node id from the intent
+     */
+    fun Intent.retrieveNodeId(): UUID? {
+        return getParcelableExtraCompat<ParcelUuid>(EXTRA_NODE_ID)?.uuid
+    }
+
+    fun Intent.removeNodeId() {
+        removeExtra(EXTRA_NODE_ID)
+    }
+
+    /**
+     * Retrieve nodes ids from intent and get the corresponding entry info list in [database]
+     */
+    fun Intent.retrieveAndRemoveEntries(database: ContextualDatabase): List<EntryInfo> {
+        val nodesIds = retrieveNodesIds()
+            ?: throw IOException("NodesIds is null")
+        removeNodesIds()
+        return nodesIds.mapNotNull { nodeId ->
+            database
+                .getEntryById(NodeIdUUID(nodeId))
+                ?.getEntryInfo(database)
+        }
     }
 
     /**
@@ -239,103 +288,101 @@ object EntrySelectionHelper {
      */
     fun isIntentSenderMode(specialMode: SpecialMode, typeMode: TypeMode): Boolean {
         return (specialMode == SpecialMode.SELECTION
-                && (typeMode == TypeMode.AUTOFILL || typeMode == TypeMode.PASSKEY))
-                // TODO Autofill Registration callback #765 && Build.VERSION.SDK_INT >= Build.VERSION_CODES.P
+                && (typeMode == TypeMode.MAGIKEYBOARD || typeMode == TypeMode.AUTOFILL || typeMode == TypeMode.PASSKEY))
                 || (specialMode == SpecialMode.REGISTRATION
-                && typeMode == TypeMode.PASSKEY)
+                && (typeMode == TypeMode.AUTOFILL || typeMode == TypeMode.PASSKEY))
     }
 
-    fun doSpecialAction(intent: Intent,
-                        defaultAction: () -> Unit,
-                        searchAction: (searchInfo: SearchInfo) -> Unit,
-                        saveAction: (searchInfo: SearchInfo) -> Unit,
-                        keyboardSelectionAction: (searchInfo: SearchInfo?) -> Unit,
-                        autofillSelectionAction: (searchInfo: SearchInfo?,
-                                                  autofillComponent: AutofillComponent) -> Unit,
-                        autofillRegistrationAction: (registerInfo: RegisterInfo?) -> Unit,
-                        passkeySelectionAction: (searchInfo: SearchInfo?) -> Unit,
-                        passkeyRegistrationAction: (registerInfo: RegisterInfo?) -> Unit) {
-
-        when (retrieveSpecialModeFromIntent(intent)) {
+    fun doSpecialAction(
+        intent: Intent,
+        defaultAction: () -> Unit,
+        searchAction: (searchInfo: SearchInfo) -> Unit,
+        selectionAction: (
+            intentSenderMode: Boolean,
+            typeMode: TypeMode,
+            searchInfo: SearchInfo?
+        ) -> Unit,
+        registrationAction: (
+            intentSenderMode: Boolean,
+            typeMode: TypeMode,
+            registerInfo: RegisterInfo?
+        ) -> Unit
+    ) {
+        when (val specialMode = intent.retrieveSpecialMode()) {
             SpecialMode.DEFAULT -> {
-                removeModesFromIntent(intent)
-                removeInfoFromIntent(intent)
+                intent.removeModes()
+                intent.removeInfo()
                 defaultAction.invoke()
             }
             SpecialMode.SEARCH -> {
-                val searchInfo = retrieveSearchInfoFromIntent(intent)
-                removeModesFromIntent(intent)
-                removeInfoFromIntent(intent)
+                val searchInfo = intent.retrieveSearchInfo()
+                intent.removeModes()
+                intent.removeInfo()
                 if (searchInfo != null)
                     searchAction.invoke(searchInfo)
                 else {
                     defaultAction.invoke()
                 }
             }
-            SpecialMode.SAVE -> {
-                val searchInfo = retrieveSearchInfoFromIntent(intent)
-                removeModesFromIntent(intent)
-                removeInfoFromIntent(intent)
-                if (searchInfo != null)
-                    saveAction.invoke(searchInfo)
-                else {
-                    defaultAction.invoke()
-                }
-            }
             SpecialMode.SELECTION -> {
-                val searchInfo: SearchInfo? = retrieveSearchInfoFromIntent(intent)
-                var autofillComponentInit = false
-                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
-                    AutofillHelper.retrieveAutofillComponent(intent)?.let { autofillComponent ->
-                        autofillSelectionAction.invoke(searchInfo, autofillComponent)
-                        autofillComponentInit = true
-                    }
-                }
-                if (!autofillComponentInit) {
-                    if (intent.getEnumExtra<SpecialMode>(KEY_SPECIAL_MODE) != null) {
-                        when (retrieveTypeModeFromIntent(intent)) {
-                            TypeMode.DEFAULT -> {
-                                removeModesFromIntent(intent)
-                                if (searchInfo != null)
-                                    searchAction.invoke(searchInfo)
-                                else
-                                    defaultAction.invoke()
-                            }
-                            TypeMode.MAGIKEYBOARD -> keyboardSelectionAction.invoke(searchInfo)
-                            TypeMode.PASSKEY -> passkeySelectionAction.invoke(searchInfo)
-                            else -> {
-                                // In this case, error
-                                removeModesFromIntent(intent)
-                                removeInfoFromIntent(intent)
-                            }
+                val searchInfo: SearchInfo? = intent.retrieveSearchInfo()
+                if (intent.getEnumExtra<SpecialMode>(KEY_SPECIAL_MODE) != null) {
+                    when (val typeMode = intent.retrieveTypeMode()) {
+                        TypeMode.DEFAULT -> {
+                            intent.removeModes()
+                            if (searchInfo != null)
+                                searchAction.invoke(searchInfo)
+                            else
+                                defaultAction.invoke()
+                        }
+                        TypeMode.MAGIKEYBOARD -> selectionAction.invoke(
+                            isIntentSenderMode(specialMode, typeMode),
+                            typeMode,
+                            searchInfo
+                        )
+                        TypeMode.PASSKEY ->
+                            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.UPSIDE_DOWN_CAKE) {
+                                selectionAction.invoke(
+                                    isIntentSenderMode(specialMode, typeMode),
+                                    typeMode,
+                                    searchInfo
+                                )
+                            } else
+                                defaultAction.invoke()
+                        TypeMode.AUTOFILL -> {
+                            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
+                                selectionAction.invoke(
+                                    isIntentSenderMode(specialMode, typeMode),
+                                    typeMode,
+                                    searchInfo
+                                )
+                            } else
+                                defaultAction.invoke()
                         }
-                    } else {
-                        if (searchInfo != null)
-                            searchAction.invoke(searchInfo)
-                        else
-                            defaultAction.invoke()
                     }
+                } else {
+                    if (searchInfo != null)
+                        searchAction.invoke(searchInfo)
+                    else
+                        defaultAction.invoke()
                 }
             }
             SpecialMode.REGISTRATION -> {
-                val registerInfo: RegisterInfo? = retrieveRegisterInfoFromIntent(intent)
-                if (!isIntentSenderMode(
-                        specialMode = retrieveSpecialModeFromIntent(intent),
-                        typeMode = retrieveTypeModeFromIntent(intent))
-                    ) {
-                    removeModesFromIntent(intent)
-                    removeInfoFromIntent(intent)
+                val registerInfo: RegisterInfo? = intent.retrieveRegisterInfo()
+                val typeMode = intent.retrieveTypeMode()
+                val intentSenderMode = isIntentSenderMode(specialMode, typeMode)
+                if (!intentSenderMode) {
+                    intent.removeModes()
+                    intent.removeInfo()
                 }
-                when (retrieveTypeModeFromIntent(intent)) {
-                    TypeMode.AUTOFILL -> {
-                        autofillRegistrationAction.invoke(registerInfo)
-                    }
-                    TypeMode.PASSKEY -> {
-                        passkeyRegistrationAction.invoke(registerInfo)
-                    }
-                    else -> {
-                        // Do other registration type
-                    }
+                if (registerInfo != null)
+                    registrationAction.invoke(
+                        intentSenderMode,
+                        typeMode,
+                        registerInfo
+                    )
+                else {
+                    defaultAction.invoke()
                 }
             }
         }
@@ -367,7 +414,7 @@ object EntrySelectionHelper {
         try {
             database.iconDrawableFactory.getBitmapFromIcon(context,
                 this.icon, ContextCompat.getColor(context, R.color.green))?.let { bitmap ->
-                return Icon.createWithBitmap(bitmap)
+                return IconCompat.createWithBitmap(bitmap).toIcon(context)
             }
         } catch (e: Exception) {
             Log.e(RemoteViews::class.java.name, "Unable to assign icon in remote view", e)

app/src/main/java/com/kunzisoft/keepass/credentialprovider/SpecialMode.kt

@@ -3,7 +3,6 @@ package com.kunzisoft.keepass.credentialprovider
 enum class SpecialMode {
     DEFAULT,
     SEARCH,
-    SAVE,
     SELECTION,
     REGISTRATION;
 }

app/src/main/java/com/kunzisoft/keepass/credentialprovider/TypeMode.kt

@@ -1,5 +1,5 @@
 package com.kunzisoft.keepass.credentialprovider
 
 enum class TypeMode {
-    DEFAULT, MAGIKEYBOARD, AUTOFILL, PASSKEY
+    DEFAULT, MAGIKEYBOARD, PASSKEY, AUTOFILL
 }

app/src/main/java/com/kunzisoft/keepass/credentialprovider/activity/AutofillLauncherActivity.kt

@@ -27,34 +27,48 @@ import android.os.Bundle
 import android.util.Log
 import android.widget.Toast
 import androidx.activity.result.ActivityResultLauncher
+import androidx.activity.result.contract.ActivityResultContracts
+import androidx.activity.viewModels
 import androidx.annotation.RequiresApi
+import androidx.lifecycle.lifecycleScope
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.FileDatabaseSelectActivity
 import com.kunzisoft.keepass.activities.GroupActivity
 import com.kunzisoft.keepass.activities.legacy.DatabaseModeActivity
-import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper
-import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.buildActivityResultLauncher
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addRegisterInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addSearchInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addSpecialMode
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.getRegisterInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.getSearchInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.getSpecialMode
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.setActivityResult
 import com.kunzisoft.keepass.credentialprovider.SpecialMode
-import com.kunzisoft.keepass.credentialprovider.TypeMode
 import com.kunzisoft.keepass.credentialprovider.autofill.AutofillComponent
-import com.kunzisoft.keepass.credentialprovider.autofill.AutofillHelper
-import com.kunzisoft.keepass.credentialprovider.autofill.CompatInlineSuggestionsRequest
-import com.kunzisoft.keepass.credentialprovider.autofill.KeeAutofillService
+import com.kunzisoft.keepass.credentialprovider.autofill.AutofillHelper.addAutofillComponent
+import com.kunzisoft.keepass.credentialprovider.autofill.AutofillHelper.retrieveAutofillComponent
+import com.kunzisoft.keepass.credentialprovider.viewmodel.AutofillLauncherViewModel
+import com.kunzisoft.keepass.credentialprovider.viewmodel.CredentialLauncherViewModel
 import com.kunzisoft.keepass.database.ContextualDatabase
-import com.kunzisoft.keepass.database.exception.RegisterInReadOnlyDatabaseException
-import com.kunzisoft.keepass.database.helper.SearchHelper
 import com.kunzisoft.keepass.model.RegisterInfo
 import com.kunzisoft.keepass.model.SearchInfo
-import com.kunzisoft.keepass.utils.AppUtil
-import com.kunzisoft.keepass.utils.getParcelableCompat
-import com.kunzisoft.keepass.utils.getParcelableExtraCompat
+import com.kunzisoft.keepass.utils.AppUtil.randomRequestCode
 import com.kunzisoft.keepass.view.toastError
+import kotlinx.coroutines.launch
 
 @RequiresApi(api = Build.VERSION_CODES.O)
 class AutofillLauncherActivity : DatabaseModeActivity() {
 
-    private var mCredentialActivityResultLauncher: ActivityResultLauncher<Intent>? =
-        this.buildActivityResultLauncher(lockDatabase = true)
+    private val autofillLauncherViewModel: AutofillLauncherViewModel by viewModels()
+
+    private var mAutofillSelectionActivityResultLauncher: ActivityResultLauncher<Intent>? =
+        this.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) {
+            autofillLauncherViewModel.manageSelectionResult(it)
+        }
+
+    private var mAutofillRegistrationActivityResultLauncher: ActivityResultLauncher<Intent>? =
+        this.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) {
+            autofillLauncherViewModel.manageRegistrationResult(it)
+        }
 
     override fun applyCustomStyle(): Boolean {
         return false
@@ -64,208 +78,137 @@ class AutofillLauncherActivity : DatabaseModeActivity() {
         return true
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-
-        // Retrieve selection mode
-        EntrySelectionHelper.retrieveSpecialModeFromIntent(intent).let { specialMode ->
-            when (specialMode) {
-                SpecialMode.SELECTION -> {
-                    intent.getBundleExtra(KEY_SELECTION_BUNDLE)?.let { bundle ->
-                        // To pass extra inline request
-                        var compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest? = null
-                        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-                            compatInlineSuggestionsRequest = bundle.getParcelableCompat(
-                                KEY_INLINE_SUGGESTION
-                            )
-                        }
-                        // Build search param
-                        bundle.getParcelableCompat<SearchInfo>(KEY_SEARCH_INFO)?.let { searchInfo ->
-                            AppUtil.getConcreteWebDomain(
-                                this,
-                                searchInfo.webDomain
-                            ) { concreteWebDomain ->
-                                // Pass extra for Autofill (EXTRA_ASSIST_STRUCTURE)
-                                val assistStructure = AutofillHelper
-                                    .retrieveAutofillComponent(intent)
-                                    ?.assistStructure
-                                val newAutofillComponent = if (assistStructure != null) {
-                                    AutofillComponent(
-                                        assistStructure,
-                                        compatInlineSuggestionsRequest
-                                    )
-                                } else {
-                                    null
-                                }
-                                searchInfo.webDomain = concreteWebDomain
-                                launchSelection(database, newAutofillComponent, searchInfo)
-                            }
-                        }
+    override fun onCreate(savedInstanceState: Bundle?) {
+        // To apply the bypass https://github.com/Kunzisoft/KeePassDX/issues/2238
+        // before managing intent in super class
+        intent.retrieveSelectionBundle()?.apply {
+            intent.addSpecialMode(getSpecialMode())
+            intent.addSearchInfo(getSearchInfo())
+            intent.addRegisterInfo(getRegisterInfo())
+            intent.addAutofillComponent(retrieveAutofillComponent())
+        }
+        super.onCreate(savedInstanceState)
+        autofillLauncherViewModel.initialize()
+        lifecycleScope.launch {
+            // Initialize the parameters
+            autofillLauncherViewModel.uiState.collect { uiState ->
+                when (uiState) {
+                    AutofillLauncherViewModel.UIState.Loading -> {}
+                    is AutofillLauncherViewModel.UIState.ShowBlockRestartMessage -> {
+                        showBlockRestartMessage()
+                        autofillLauncherViewModel.cancelResult()
                     }
-                    // Remove bundle
-                    intent.removeExtra(KEY_SELECTION_BUNDLE)
-                }
-                SpecialMode.REGISTRATION -> {
-                    // To register info
-                    val registerInfo = intent.getParcelableExtraCompat<RegisterInfo>(
-                        KEY_REGISTER_INFO
-                    )
-                    val searchInfo = SearchInfo(registerInfo?.searchInfo)
-                    AppUtil.getConcreteWebDomain(this, searchInfo.webDomain) { concreteWebDomain ->
-                        searchInfo.webDomain = concreteWebDomain
-                        launchRegistration(database, searchInfo, registerInfo)
+                    is AutofillLauncherViewModel.UIState.ShowAutofillSuggestionMessage -> {
+                        showAutofillSuggestionMessage()
                     }
                 }
-                else -> {
-                    // Not an autofill call
-                    setResult(RESULT_CANCELED)
-                    finish()
+            }
+        }
+        lifecycleScope.launch {
+            // Retrieve the UI
+            autofillLauncherViewModel.credentialUiState.collect { uiState ->
+                when (uiState) {
+                    is CredentialLauncherViewModel.CredentialState.Loading -> {}
+                    is CredentialLauncherViewModel.CredentialState.LaunchGroupActivityForSelection -> {
+                        GroupActivity.launchForSelection(
+                            context = this@AutofillLauncherActivity,
+                            database = uiState.database,
+                            searchInfo = uiState.searchInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = mAutofillSelectionActivityResultLauncher,
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchGroupActivityForRegistration -> {
+                        GroupActivity.launchForRegistration(
+                            context = this@AutofillLauncherActivity,
+                            database = uiState.database,
+                            registerInfo = uiState.registerInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = mAutofillRegistrationActivityResultLauncher
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchFileDatabaseSelectActivityForSelection -> {
+                        FileDatabaseSelectActivity.launchForSelection(
+                            context = this@AutofillLauncherActivity,
+                            searchInfo = uiState.searchInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = mAutofillSelectionActivityResultLauncher
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchFileDatabaseSelectActivityForRegistration -> {
+                        FileDatabaseSelectActivity.launchForRegistration(
+                            context = this@AutofillLauncherActivity,
+                            registerInfo = uiState.registerInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = mAutofillRegistrationActivityResultLauncher,
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.SetActivityResult -> {
+                        setActivityResult(
+                            lockDatabase = uiState.lockDatabase,
+                            resultCode = uiState.resultCode,
+                            data = uiState.data
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.ShowError -> {
+                        toastError(uiState.error)
+                        autofillLauncherViewModel.cancelResult()
+                    }
                 }
             }
         }
     }
 
-    private fun launchSelection(database: ContextualDatabase?,
-                                autofillComponent: AutofillComponent?,
-                                searchInfo: SearchInfo) {
-        if (autofillComponent == null) {
-            setResult(RESULT_CANCELED)
-            finish()
-        } else if (KeeAutofillService.autofillAllowedFor(
-            applicationId = searchInfo.applicationId,
-            webDomain = searchInfo.webDomain,
-            context = this
-        )) {
-            // If database is open
-            SearchHelper.checkAutoSearchInfo(
-                context = this,
-                database = database,
-                searchInfo = searchInfo,
-                onItemsFound = { openedDatabase, items ->
-                    // Items found
-                    AutofillHelper.buildResponseAndSetResult(this, openedDatabase, items)
-                    finish()
-                },
-                onItemNotFound = { openedDatabase ->
-                    // Show the database UI to select the entry
-                    GroupActivity.launchForAutofillSelectionResult(
-                        this,
-                        openedDatabase,
-                        mCredentialActivityResultLauncher,
-                        autofillComponent,
-                        searchInfo,
-                        false
-                    )
-                },
-                onDatabaseClosed = {
-                    // If database not open
-                    FileDatabaseSelectActivity.launchForAutofillResult(
-                        this,
-                        mCredentialActivityResultLauncher,
-                        autofillComponent,
-                        searchInfo
-                    )
-                }
-            )
-        } else {
-            showBlockRestartMessage()
-            setResult(RESULT_CANCELED)
-            finish()
-        }
-    }
-
-    private fun launchRegistration(database: ContextualDatabase?,
-                                   searchInfo: SearchInfo,
-                                   registerInfo: RegisterInfo?) {
-        if (KeeAutofillService.autofillAllowedFor(
-                applicationId = searchInfo.applicationId,
-                webDomain = searchInfo.webDomain,
-                context = this
-        )) {
-            val readOnly = database?.isReadOnly != false
-            SearchHelper.checkAutoSearchInfo(
-                context = this,
-                database = database,
-                searchInfo = searchInfo,
-                onItemsFound = { openedDatabase, _ ->
-                    if (!readOnly) {
-                        // Show the database UI to select the entry
-                        GroupActivity.launchForRegistration(
-                            context = this,
-                            activityResultLauncher = null, // TODO Autofill result launcher #765
-                            database = openedDatabase,
-                            registerInfo = registerInfo,
-                            typeMode = TypeMode.AUTOFILL
-                        )
-                    } else {
-                        showReadOnlySaveMessage()
-                    }
-                },
-                onItemNotFound = { openedDatabase ->
-                    if (!readOnly) {
-                        // Show the database UI to select the entry
-                        GroupActivity.launchForRegistration(
-                            context = this,
-                            activityResultLauncher = null, // TODO Autofill result launcher #765
-                            database = openedDatabase,
-                            registerInfo = registerInfo,
-                            typeMode = TypeMode.AUTOFILL
-                        )
-                    } else {
-                        showReadOnlySaveMessage()
-                    }
-                },
-                onDatabaseClosed = {
-                    // If database not open
-                    FileDatabaseSelectActivity.launchForRegistration(
-                        context = this,
-                        activityResultLauncher = null, // TODO Autofill result launcher #765
-                        registerInfo = registerInfo,
-                        typeMode = TypeMode.AUTOFILL
-                    )
-                }
-            )
-        } else {
-            showBlockRestartMessage()
-            setResult(RESULT_CANCELED)
-        }
-        finish()
+    override fun onUnknownDatabaseRetrieved(database: ContextualDatabase?) {
+        super.onUnknownDatabaseRetrieved(database)
+        autofillLauncherViewModel.launchActionIfNeeded(intent, mSpecialMode, database)
     }
 
     private fun showBlockRestartMessage() {
         // If item not allowed, show a toast
-        Toast.makeText(this.applicationContext, R.string.autofill_block_restart, Toast.LENGTH_LONG).show()
+        Toast.makeText(
+            applicationContext,
+            R.string.autofill_block_restart,
+            Toast.LENGTH_LONG
+        ).show()
     }
 
-    private fun showReadOnlySaveMessage() {
-        toastError(RegisterInReadOnlyDatabaseException())
+    private fun showAutofillSuggestionMessage() {
+        Toast.makeText(
+            applicationContext,
+            R.string.autofill_inline_suggestions_keyboard,
+            Toast.LENGTH_SHORT
+        ).show()
     }
 
     companion object {
 
+        private const val KEY_PENDING_INTENT_BUNDLE = "com.kunzisoft.keepass.extra.BUNDLE"
         private val TAG = AutofillLauncherActivity::class.java.name
 
-        private const val KEY_SELECTION_BUNDLE = "KEY_SELECTION_BUNDLE"
-        private const val KEY_SEARCH_INFO = "KEY_SEARCH_INFO"
-        private const val KEY_INLINE_SUGGESTION = "KEY_INLINE_SUGGESTION"
+        fun Intent.retrieveSelectionBundle(): Bundle? {
+            return this.getBundleExtra(KEY_PENDING_INTENT_BUNDLE)
+        }
 
-        private const val KEY_REGISTER_INFO = "KEY_REGISTER_INFO"
-
-        fun getPendingIntentForSelection(context: Context,
-                                         searchInfo: SearchInfo? = null,
-                                         compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest? = null): PendingIntent? {
+        fun getPendingIntentForSelection(
+            context: Context,
+            searchInfo: SearchInfo? = null,
+            autofillComponent: AutofillComponent
+        ): PendingIntent? {
             try {
+                // Doesn't work with direct extra Parcelable in Android 11 (don't know why?)
+                // https://github.com/Kunzisoft/KeePassDX/issues/2238
+                // Wrap into a bundle to bypass the problem
+                val tempBundle = Bundle().apply {
+                    addSpecialMode(SpecialMode.SELECTION)
+                    addSearchInfo(searchInfo)
+                    addAutofillComponent(autofillComponent)
+                }
                 return PendingIntent.getActivity(
-                    context, 0,
-                    // Doesn't work with direct extra Parcelable (don't know why?)
-                    // Wrap into a bundle to bypass the problem
+                    context,
+                    randomRequestCode(),
                     Intent(context, AutofillLauncherActivity::class.java).apply {
-                        putExtra(KEY_SELECTION_BUNDLE, Bundle().apply {
-                            putParcelable(KEY_SEARCH_INFO, searchInfo)
-                            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-                                putParcelable(KEY_INLINE_SUGGESTION, compatInlineSuggestionsRequest)
-                            }
-                        })
+                        putExtra(KEY_PENDING_INTENT_BUNDLE, tempBundle)
                     },
                     if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S) {
                         PendingIntent.FLAG_MUTABLE or PendingIntent.FLAG_CANCEL_CURRENT
@@ -279,14 +222,21 @@ class AutofillLauncherActivity : DatabaseModeActivity() {
             }
         }
 
-        fun getPendingIntentForRegistration(context: Context,
-                                            registerInfo: RegisterInfo): PendingIntent? {
+        fun getPendingIntentForRegistration(
+            context: Context,
+            registerInfo: RegisterInfo
+        ): PendingIntent? {
             try {
+                // Bypass intent issue
+                val tempBundle = Bundle().apply {
+                    addSpecialMode(SpecialMode.REGISTRATION)
+                    addRegisterInfo(registerInfo)
+                }
                 return PendingIntent.getActivity(
-                    context, 0,
+                    context,
+                    randomRequestCode(),
                     Intent(context, AutofillLauncherActivity::class.java).apply {
-                        EntrySelectionHelper.addSpecialModeInIntent(this, SpecialMode.REGISTRATION)
-                        putExtra(KEY_REGISTER_INFO, registerInfo)
+                        putExtra(KEY_PENDING_INTENT_BUNDLE, tempBundle)
                     },
                     if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S) {
                         PendingIntent.FLAG_MUTABLE or PendingIntent.FLAG_CANCEL_CURRENT
@@ -299,14 +249,5 @@ class AutofillLauncherActivity : DatabaseModeActivity() {
                 return null
             }
         }
-
-        fun launchForRegistration(context: Context,
-                                  registerInfo: RegisterInfo) {
-            val intent = Intent(context, AutofillLauncherActivity::class.java)
-            EntrySelectionHelper.addSpecialModeInIntent(intent, SpecialMode.REGISTRATION)
-            intent.putExtra(KEY_REGISTER_INFO, registerInfo)
-            intent.addFlags(Intent.FLAG_ACTIVITY_NEW_TASK)
-            context.startActivity(intent)
-        }
     }
 }

app/src/main/java/com/kunzisoft/keepass/credentialprovider/activity/EntrySelectionLauncherActivity.kt

@@ -22,22 +22,22 @@ package com.kunzisoft.keepass.credentialprovider.activity
 import android.content.Context
 import android.content.Intent
 import android.os.Bundle
-import android.widget.Toast
-import androidx.core.net.toUri
-import com.kunzisoft.keepass.R
+import androidx.activity.result.ActivityResultLauncher
+import androidx.activity.result.contract.ActivityResultContracts
+import androidx.activity.viewModels
+import androidx.lifecycle.lifecycleScope
 import com.kunzisoft.keepass.activities.FileDatabaseSelectActivity
 import com.kunzisoft.keepass.activities.GroupActivity
 import com.kunzisoft.keepass.activities.legacy.DatabaseModeActivity
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addSearchInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.setActivityResult
 import com.kunzisoft.keepass.credentialprovider.magikeyboard.MagikeyboardService
+import com.kunzisoft.keepass.credentialprovider.viewmodel.CredentialLauncherViewModel
+import com.kunzisoft.keepass.credentialprovider.viewmodel.EntrySelectionViewModel
 import com.kunzisoft.keepass.database.ContextualDatabase
-import com.kunzisoft.keepass.database.exception.RegisterInReadOnlyDatabaseException
-import com.kunzisoft.keepass.database.helper.SearchHelper
 import com.kunzisoft.keepass.model.SearchInfo
-import com.kunzisoft.keepass.otp.OtpEntryFields
-import com.kunzisoft.keepass.utils.AppUtil
-import com.kunzisoft.keepass.utils.KeyboardUtil.isKeyboardActivatedInSettings
-import com.kunzisoft.keepass.utils.getParcelableCompat
 import com.kunzisoft.keepass.view.toastError
+import kotlinx.coroutines.launch
 
 /**
  * Activity to search or select entry in database,
@@ -45,198 +45,129 @@ import com.kunzisoft.keepass.view.toastError
  */
 class EntrySelectionLauncherActivity : DatabaseModeActivity() {
 
-    override fun applyCustomStyle(): Boolean {
-        return false
-    }
+    private val entrySelectionViewModel: EntrySelectionViewModel by viewModels()
 
-    override fun finishActivityIfReloadRequested(): Boolean {
-        return false
-    }
-
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-
-        val keySelectionBundle = intent.getBundleExtra(KEY_SELECTION_BUNDLE)
-        if (keySelectionBundle != null) {
-            // To manage package name
-            var searchInfo = SearchInfo()
-            keySelectionBundle.getParcelableCompat<SearchInfo>(KEY_SEARCH_INFO)?.let { mSearchInfo ->
-                searchInfo = mSearchInfo
-            }
-            launch(database, searchInfo)
-        } else {
-            // To manage share
-            var sharedWebDomain: String? = null
-            var otpString: String? = null
-
-            when (intent?.action) {
-                Intent.ACTION_SEND -> {
-                    if ("text/plain" == intent.type) {
-                        // Retrieve web domain or OTP
-                        intent.getStringExtra(Intent.EXTRA_TEXT)?.let { extra ->
-                            if (OtpEntryFields.isOTPUri(extra))
-                                otpString = extra
-                            else
-                                sharedWebDomain = extra.toUri().host
-                        }
-                    }
-                    launchSelection(database, sharedWebDomain, otpString)
-                }
-                Intent.ACTION_VIEW -> {
-                    // Retrieve OTP
-                    intent.dataString?.let { extra ->
-                        if (OtpEntryFields.isOTPUri(extra))
-                            otpString = extra
-                    }
-                    launchSelection(database, sharedWebDomain, otpString)
-                }
-                else -> {
-                    if (database != null) {
-                        GroupActivity.launch(this, database)
-                    } else {
-                        FileDatabaseSelectActivity.launch(this)
-                    }
-                }
-            }
-        }
-        finish()
-    }
-
-    private fun launchSelection(database: ContextualDatabase?,
-                                sharedWebDomain: String?,
-                                otpString: String?) {
-        // Build domain search param
-        val searchInfo = SearchInfo().apply {
-            this.webDomain = sharedWebDomain
-            this.otpString = otpString
+    private var mEntrySelectionActivityResultLauncher: ActivityResultLauncher<Intent>? =
+        this.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) {
+            entrySelectionViewModel.manageSelectionResult(it)
         }
 
-        AppUtil.getConcreteWebDomain(this, searchInfo.webDomain) { concreteWebDomain ->
-            searchInfo.webDomain = concreteWebDomain
-            launch(database, searchInfo)
-        }
-    }
+    override fun applyCustomStyle() = false
 
-    private fun launch(database: ContextualDatabase?,
-                       searchInfo: SearchInfo) {
+    override fun finishActivityIfReloadRequested() = false
 
-        // Setting to integrate Magikeyboard
-        val searchShareForMagikeyboard = isKeyboardActivatedInSettings()
-
-        // If database is open
-        val readOnly = database?.isReadOnly != false
-        SearchHelper.checkAutoSearchInfo(
-            context = this,
-            database = database,
-            searchInfo = searchInfo,
-            onItemsFound = { openedDatabase, items ->
-                // Items found
-                if (searchInfo.otpString != null) {
-                    if (!readOnly) {
-                        GroupActivity.launchForSaveResult(
-                            this,
-                            openedDatabase,
-                            searchInfo,
-                            false
+    override fun onCreate(savedInstanceState: Bundle?) {
+        super.onCreate(savedInstanceState)
+        entrySelectionViewModel.initialize()
+        lifecycleScope.launch {
+            // Initialize the parameters
+            entrySelectionViewModel.uiState.collect { uiState ->
+                when (uiState) {
+                    is EntrySelectionViewModel.UIState.Loading -> {}
+                    is EntrySelectionViewModel.UIState.PopulateKeyboard -> {
+                        MagikeyboardService.addEntryAndLaunchNotificationIfAllowed(
+                            context = this@EntrySelectionLauncherActivity,
+                            entry = uiState.entryInfo,
+                            toast = true
                         )
-                    } else {
-                        toastError(RegisterInReadOnlyDatabaseException())
                     }
-                } else if (searchShareForMagikeyboard) {
-                    MagikeyboardService.performSelection(
-                        items,
-                        { entryInfo ->
-                            // Automatically populate keyboard
-                            MagikeyboardService.populateKeyboardAndMoveAppToBackground(
-                                this,
-                                entryInfo
-                            )
-                        },
-                        { autoSearch ->
-                            GroupActivity.launchForKeyboardSelectionResult(
-                                this,
-                                openedDatabase,
-                                searchInfo,
-                                autoSearch
-                            )
-                        }
-                    )
-                } else {
-                    GroupActivity.launchForSearchResult(
-                        this,
-                        openedDatabase,
-                        searchInfo,
-                        true
-                    )
-                }
-            },
-            onItemNotFound = { openedDatabase ->
-                // Show the database UI to select the entry
-                if (searchInfo.otpString != null) {
-                    if (!readOnly) {
-                        GroupActivity.launchForSaveResult(
-                            this,
-                            openedDatabase,
-                            searchInfo,
-                            false
+                    is EntrySelectionViewModel.UIState.LaunchFileDatabaseSelectForSearch -> {
+                        FileDatabaseSelectActivity.launchForSearch(
+                            context = this@EntrySelectionLauncherActivity,
+                            searchInfo = uiState.searchInfo
+                        )
+                    }
+                    is EntrySelectionViewModel.UIState.LaunchGroupActivityForSearch -> {
+                        GroupActivity.launchForSearch(
+                            context = this@EntrySelectionLauncherActivity,
+                            database = uiState.database,
+                            searchInfo = uiState.searchInfo
                         )
-                    } else {
-                        toastError(RegisterInReadOnlyDatabaseException())
                     }
-                } else if (searchShareForMagikeyboard) {
-                    GroupActivity.launchForKeyboardSelectionResult(
-                        this,
-                        openedDatabase,
-                        searchInfo,
-                        false
-                    )
-                } else {
-                    GroupActivity.launchForSearchResult(
-                        this,
-                        openedDatabase,
-                        searchInfo,
-                        false
-                    )
-                }
-            },
-            onDatabaseClosed = {
-                // If database not open
-                if (searchInfo.otpString != null) {
-                    FileDatabaseSelectActivity.launchForSaveResult(
-                        this,
-                        searchInfo
-                    )
-                } else if (searchShareForMagikeyboard) {
-                    FileDatabaseSelectActivity.launchForKeyboardSelectionResult(
-                        this,
-                        searchInfo
-                    )
-                } else {
-                    FileDatabaseSelectActivity.launchForSearchResult(
-                        this,
-                        searchInfo
-                    )
                 }
             }
-        )
+        }
+        lifecycleScope.launch {
+            // Retrieve the UI
+            entrySelectionViewModel.credentialUiState.collect { uiState ->
+                when (uiState) {
+                    is CredentialLauncherViewModel.CredentialState.Loading -> {}
+                    is CredentialLauncherViewModel.CredentialState.LaunchGroupActivityForSelection -> {
+                        GroupActivity.launchForSelection(
+                            context = this@EntrySelectionLauncherActivity,
+                            database = uiState.database,
+                            searchInfo = uiState.searchInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = mEntrySelectionActivityResultLauncher
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchGroupActivityForRegistration -> {
+                        GroupActivity.launchForRegistration(
+                            context = this@EntrySelectionLauncherActivity,
+                            database = uiState.database,
+                            registerInfo = uiState.registerInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = null // Null to not get any callback
+                        )
+                        finish()
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchFileDatabaseSelectActivityForSelection -> {
+                        FileDatabaseSelectActivity.launchForSelection(
+                            context = this@EntrySelectionLauncherActivity,
+                            searchInfo = uiState.searchInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = mEntrySelectionActivityResultLauncher
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchFileDatabaseSelectActivityForRegistration -> {
+                        FileDatabaseSelectActivity.launchForRegistration(
+                            context = this@EntrySelectionLauncherActivity,
+                            registerInfo = uiState.registerInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = null // Null to not get any callback
+                        )
+                        finish()
+                    }
+                    is CredentialLauncherViewModel.CredentialState.SetActivityResult -> {
+                        setActivityResult(
+                            lockDatabase = uiState.lockDatabase,
+                            resultCode = uiState.resultCode,
+                            data = uiState.data
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.ShowError -> {
+                        toastError(uiState.error)
+                        entrySelectionViewModel.cancelResult()
+                    }
+                }
+            }
+        }
+    }
+
+    override fun onUnknownDatabaseRetrieved(database: ContextualDatabase?) {
+        super.onUnknownDatabaseRetrieved(database)
+        entrySelectionViewModel.launchActionIfNeeded(intent, mSpecialMode, database)
+    }
+
+    override fun onDestroy() {
+        super.onDestroy()
     }
 
     companion object {
 
-        private const val KEY_SELECTION_BUNDLE = "KEY_SELECTION_BUNDLE"
-        private const val KEY_SEARCH_INFO = "KEY_SEARCH_INFO"
-
-        fun launch(context: Context,
-                   searchInfo: SearchInfo? = null) {
-            val intent = Intent(context, EntrySelectionLauncherActivity::class.java).apply {
-                putExtra(KEY_SELECTION_BUNDLE, Bundle().apply {
-                    putParcelable(KEY_SEARCH_INFO, searchInfo)
-                })
-            }
-            // New task needed because don't launch from an Activity context
-            intent.flags = Intent.FLAG_ACTIVITY_NEW_TASK or
-                    Intent.FLAG_ACTIVITY_CLEAR_TASK
-            context.startActivity(intent)
+        fun launch(
+            context: Context,
+            searchInfo: SearchInfo? = null
+        ) {
+            context.startActivity(Intent(
+                context,
+                EntrySelectionLauncherActivity::class.java
+            ).apply {
+                addSearchInfo(searchInfo)
+                // New task needed because don't launch from an Activity context
+                flags = Intent.FLAG_ACTIVITY_NEW_TASK or
+                        Intent.FLAG_ACTIVITY_CLEAR_TASK
+            })
         }
     }
 }

app/src/main/java/com/kunzisoft/keepass/credentialprovider/activity/HardwareKeyActivity.kt

@@ -0,0 +1,170 @@
+package com.kunzisoft.keepass.credentialprovider.activity
+
+import android.content.Context
+import android.content.DialogInterface
+import android.content.Intent
+import android.os.Bundle
+import androidx.activity.result.ActivityResultLauncher
+import androidx.activity.result.contract.ActivityResultContracts
+import androidx.activity.viewModels
+import androidx.appcompat.app.AlertDialog
+import androidx.lifecycle.lifecycleScope
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.activities.legacy.DatabaseModeActivity
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.setActivityResult
+import com.kunzisoft.keepass.credentialprovider.viewmodel.CredentialLauncherViewModel
+import com.kunzisoft.keepass.credentialprovider.viewmodel.HardwareKeyLauncherViewModel
+import com.kunzisoft.keepass.credentialprovider.viewmodel.HardwareKeyLauncherViewModel.Companion.addHardwareKey
+import com.kunzisoft.keepass.credentialprovider.viewmodel.HardwareKeyLauncherViewModel.Companion.addSeed
+import com.kunzisoft.keepass.credentialprovider.viewmodel.HardwareKeyLauncherViewModel.Companion.buildHardwareKeyChallenge
+import com.kunzisoft.keepass.credentialprovider.viewmodel.HardwareKeyLauncherViewModel.Companion.isYubikeyDriverAvailable
+import com.kunzisoft.keepass.credentialprovider.viewmodel.HardwareKeyLauncherViewModel.UIState
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.hardware.HardwareKey
+import com.kunzisoft.keepass.tasks.ActionRunnable
+import com.kunzisoft.keepass.utils.AppUtil.openExternalApp
+import com.kunzisoft.keepass.view.toastError
+import kotlinx.coroutines.launch
+
+/**
+ * Special activity to deal with hardware key drivers,
+ * return the response to the database service once finished
+ */
+class HardwareKeyActivity: DatabaseModeActivity(){
+
+    private val mHardwareKeyLauncherViewModel: HardwareKeyLauncherViewModel by viewModels()
+
+    private var activityResultLauncher: ActivityResultLauncher<Intent> =
+        this.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) {
+            mHardwareKeyLauncherViewModel.manageSelectionResult(it)
+        }
+
+    override fun applyCustomStyle(): Boolean  = false
+
+    override fun showDatabaseDialog(): Boolean = false
+
+    override fun manageDatabaseInfo(): Boolean = false
+
+    override fun onCreate(savedInstanceState: Bundle?) {
+        super.onCreate(savedInstanceState)
+
+        lifecycleScope.launch {
+            mHardwareKeyLauncherViewModel.uiState.collect { uiState ->
+                when (uiState) {
+                    is UIState.Loading -> {}
+                    is UIState.ShowHardwareKeyDriverNeeded -> {
+                        showHardwareKeyDriverNeeded(
+                            this@HardwareKeyActivity,
+                            uiState.hardwareKey
+                        ) {
+                            mDatabaseViewModel.onChallengeResponded(null)
+                            finish()
+                        }
+                    }
+                    is UIState.LaunchChallengeActivityForResponse -> {
+                        // Send to the driver
+                        activityResultLauncher.launch(
+                            buildHardwareKeyChallenge(uiState.challenge)
+                        )
+                    }
+                    is UIState.OnChallengeResponded -> {
+                        mDatabaseViewModel.onChallengeResponded(uiState.response)
+                    }
+                }
+            }
+        }
+        lifecycleScope.launch {
+            mHardwareKeyLauncherViewModel.credentialUiState.collect { uiState ->
+                when (uiState) {
+                    is CredentialLauncherViewModel.CredentialState.SetActivityResult -> {
+                        setActivityResult(
+                            lockDatabase = uiState.lockDatabase,
+                            resultCode = uiState.resultCode,
+                            data = uiState.data
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.ShowError -> {
+                        toastError(uiState.error)
+                        mHardwareKeyLauncherViewModel.cancelResult()
+                    }
+                    else -> {}
+                }
+            }
+        }
+    }
+
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        super.onDatabaseRetrieved(database)
+        mHardwareKeyLauncherViewModel.launchActionIfNeeded(intent, mSpecialMode, database)
+    }
+
+    override fun onDatabaseActionFinished(
+        database: ContextualDatabase,
+        actionTask: String,
+        result: ActionRunnable.Result
+    ) {
+        super.onDatabaseActionFinished(database, actionTask, result)
+        finish()
+    }
+
+    private fun showHardwareKeyDriverNeeded(
+        context: Context,
+        hardwareKey: HardwareKey?,
+        onDialogDismissed: DialogInterface.OnDismissListener
+    ) {
+        val builder = AlertDialog.Builder(context)
+        builder
+            .setMessage(
+                context.getString(R.string.error_driver_required, hardwareKey.toString())
+            )
+            .setPositiveButton(R.string.download) { _, _ ->
+                context.openExternalApp(
+                    context.getString(R.string.key_driver_app_id),
+                    context.getString(R.string.key_driver_url)
+                )
+            }
+            .setNegativeButton(android.R.string.cancel) { _, _ -> }
+            .setOnDismissListener(onDialogDismissed)
+        builder.create().show()
+    }
+
+    companion object {
+        private val TAG = HardwareKeyActivity::class.java.simpleName
+
+        fun launchHardwareKeyActivity(
+            context: Context,
+            hardwareKey: HardwareKey,
+            seed: ByteArray?
+        ) {
+            context.startActivity(
+                Intent(
+                    context,
+                    HardwareKeyActivity::class.java).apply {
+                flags = Intent.FLAG_ACTIVITY_NEW_TASK or
+                        Intent.FLAG_ACTIVITY_MULTIPLE_TASK
+                addHardwareKey(hardwareKey)
+                addSeed(seed)
+            })
+        }
+
+        fun isHardwareKeyAvailable(
+            context: Context,
+            hardwareKey: HardwareKey?
+        ): Boolean {
+            if (hardwareKey == null)
+                return false
+            return when (hardwareKey) {
+                /*
+                HardwareKey.FIDO2_SECRET -> {
+                    // TODO FIDO2 under development
+                    false
+                }
+                */
+                HardwareKey.CHALLENGE_RESPONSE_YUBIKEY -> {
+                    // Check available intent
+                    isYubikeyDriverAvailable(context)
+                }
+            }
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/activity/PasskeyLauncherActivity.kt

@@ -36,6 +36,8 @@ import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.FileDatabaseSelectActivity
 import com.kunzisoft.keepass.activities.GroupActivity
 import com.kunzisoft.keepass.activities.legacy.DatabaseLockActivity
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addNodeId
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addSearchInfo
 import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addSpecialMode
 import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addTypeMode
 import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.setActivityResult
@@ -44,14 +46,14 @@ import com.kunzisoft.keepass.credentialprovider.TypeMode
 import com.kunzisoft.keepass.credentialprovider.passkey.data.AndroidPrivilegedApp
 import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.addAppOrigin
 import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.addAuthCode
-import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.addNodeId
-import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.addSearchInfo
+import com.kunzisoft.keepass.credentialprovider.viewmodel.CredentialLauncherViewModel
 import com.kunzisoft.keepass.credentialprovider.viewmodel.PasskeyLauncherViewModel
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.model.AppOrigin
 import com.kunzisoft.keepass.model.SearchInfo
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_UPDATE_ENTRY_TASK
 import com.kunzisoft.keepass.tasks.ActionRunnable
+import com.kunzisoft.keepass.utils.AppUtil.randomRequestCode
 import com.kunzisoft.keepass.view.toastError
 import kotlinx.coroutines.launch
 import java.util.UUID
@@ -79,10 +81,6 @@ class PasskeyLauncherActivity : DatabaseLockActivity() {
         return false
     }
 
-    override fun finishActivityIfDatabaseNotLoaded(): Boolean {
-        return false
-    }
-
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
         lifecycleScope.launch {
@@ -105,61 +103,69 @@ class PasskeyLauncherActivity : DatabaseLockActivity() {
                             nodeId = uiState.nodeId
                         )
                     }
-                    is PasskeyLauncherViewModel.UIState.SetActivityResult -> {
-                        setActivityResult(
-                            lockDatabase = uiState.lockDatabase,
-                            resultCode = uiState.resultCode,
-                            data = uiState.data
-                        )
-                    }
-                    is PasskeyLauncherViewModel.UIState.ShowError -> {
-                        toastError(uiState.error)
-                        passkeyLauncherViewModel.cancelResult()
-                    }
-                    is PasskeyLauncherViewModel.UIState.LaunchGroupActivityForSelection -> {
-                        GroupActivity.launchForPasskeySelectionResult(
-                            context = this@PasskeyLauncherActivity,
-                            database = uiState.database,
-                            activityResultLauncher = mPasskeySelectionActivityResultLauncher,
-                            searchInfo = null,
-                            autoSearch = false
-                        )
-                    }
-                    is PasskeyLauncherViewModel.UIState.LaunchGroupActivityForRegistration -> {
-                        GroupActivity.launchForRegistration(
-                            context = this@PasskeyLauncherActivity,
-                            activityResultLauncher = mPasskeyRegistrationActivityResultLauncher,
-                            database = uiState.database,
-                            registerInfo = uiState.registerInfo,
-                            typeMode = uiState.typeMode
-                        )
-                    }
-                    is PasskeyLauncherViewModel.UIState.LaunchFileDatabaseSelectActivityForSelection -> {
-                        FileDatabaseSelectActivity.launchForPasskeySelectionResult(
-                            activity = this@PasskeyLauncherActivity,
-                            activityResultLauncher = mPasskeySelectionActivityResultLauncher,
-                            searchInfo = uiState.searchInfo,
-                        )
-                    }
-                    is PasskeyLauncherViewModel.UIState.LaunchFileDatabaseSelectActivityForRegistration -> {
-                        FileDatabaseSelectActivity.launchForRegistration(
-                            context = this@PasskeyLauncherActivity,
-                            activityResultLauncher = mPasskeyRegistrationActivityResultLauncher,
-                            registerInfo = uiState.registerInfo,
-                            typeMode = uiState.typeMode
-                        )
-                    }
                     is PasskeyLauncherViewModel.UIState.UpdateEntry -> {
                         updateEntry(uiState.oldEntry, uiState.newEntry)
                     }
                 }
             }
         }
+        lifecycleScope.launch {
+            passkeyLauncherViewModel.credentialUiState.collect { uiState ->
+                when (uiState) {
+                    is CredentialLauncherViewModel.CredentialState.Loading -> {}
+                    is CredentialLauncherViewModel.CredentialState.SetActivityResult -> {
+                        setActivityResult(
+                            lockDatabase = uiState.lockDatabase,
+                            resultCode = uiState.resultCode,
+                            data = uiState.data
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.ShowError -> {
+                        toastError(uiState.error)
+                        passkeyLauncherViewModel.cancelResult()
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchGroupActivityForSelection -> {
+                        GroupActivity.launchForSelection(
+                            context = this@PasskeyLauncherActivity,
+                            database = uiState.database,
+                            typeMode = uiState.typeMode,
+                            searchInfo = uiState.searchInfo,
+                            activityResultLauncher = mPasskeySelectionActivityResultLauncher
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchGroupActivityForRegistration -> {
+                        GroupActivity.launchForRegistration(
+                            context = this@PasskeyLauncherActivity,
+                            database = uiState.database,
+                            typeMode = uiState.typeMode,
+                            registerInfo = uiState.registerInfo,
+                            activityResultLauncher = mPasskeyRegistrationActivityResultLauncher
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchFileDatabaseSelectActivityForSelection -> {
+                        FileDatabaseSelectActivity.launchForSelection(
+                            context = this@PasskeyLauncherActivity,
+                            typeMode = uiState.typeMode,
+                            searchInfo = uiState.searchInfo,
+                            activityResultLauncher = mPasskeySelectionActivityResultLauncher
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchFileDatabaseSelectActivityForRegistration -> {
+                        FileDatabaseSelectActivity.launchForRegistration(
+                            context = this@PasskeyLauncherActivity,
+                            typeMode = uiState.typeMode,
+                            registerInfo = uiState.registerInfo,
+                            activityResultLauncher = mPasskeyRegistrationActivityResultLauncher,
+                        )
+                    }
+                }
+            }
+        }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-        passkeyLauncherViewModel.launchPasskeyActionIfNeeded(intent, mSpecialMode, database)
+    override fun onUnknownDatabaseRetrieved(database: ContextualDatabase?) {
+        super.onUnknownDatabaseRetrieved(database)
+        passkeyLauncherViewModel.launchActionIfNeeded(intent, mSpecialMode, database)
     }
 
     override fun onDatabaseActionFinished(
@@ -170,7 +176,8 @@ class PasskeyLauncherActivity : DatabaseLockActivity() {
         super.onDatabaseActionFinished(database, actionTask, result)
         when (actionTask) {
             ACTION_DATABASE_UPDATE_ENTRY_TASK -> {
-                passkeyLauncherViewModel.autoSelectPasskey(result, database)
+                // TODO When auto save is enabled, WARNING filter by the calling activity
+                // passkeyLauncherViewModel.autoSelectPasskey(result, database)
             }
         }
     }
@@ -234,6 +241,8 @@ class PasskeyLauncherActivity : DatabaseLockActivity() {
                 )
                 .append("\n\n")
                 .append(getString(R.string.passkeys_missing_signature_app_ask_explanation))
+                .append("\n\n")
+                .append(getString(R.string.passkeys_missing_signature_app_ask_question))
                 .toString()
             )
             setPositiveButton(android.R.string.ok) { _, _ ->
@@ -273,7 +282,7 @@ class PasskeyLauncherActivity : DatabaseLockActivity() {
         ): PendingIntent? {
             return PendingIntent.getActivity(
                 context,
-                (Math.random() * Integer.MAX_VALUE).toInt(),
+                randomRequestCode(),
                 Intent(context, PasskeyLauncherActivity::class.java).apply {
                     addSpecialMode(specialMode)
                     addTypeMode(TypeMode.PASSKEY)

app/src/main/java/com/kunzisoft/keepass/credentialprovider/autofill/AutofillComponent.kt

@@ -2,5 +2,7 @@ package com.kunzisoft.keepass.credentialprovider.autofill
 
 import android.app.assist.AssistStructure
 
-data class AutofillComponent(val assistStructure: AssistStructure,
-                             val compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest?)
+data class AutofillComponent(
+    val assistStructure: AssistStructure,
+    val compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest?
+)

app/src/main/java/com/kunzisoft/keepass/credentialprovider/autofill/AutofillHelper.kt

@@ -20,7 +20,6 @@
 package com.kunzisoft.keepass.credentialprovider.autofill
 
 import android.annotation.SuppressLint
-import android.app.Activity
 import android.app.PendingIntent
 import android.app.assist.AssistStructure
 import android.content.Context
@@ -28,6 +27,7 @@ import android.content.Intent
 import android.graphics.BlendMode
 import android.graphics.drawable.Icon
 import android.os.Build
+import android.os.Bundle
 import android.service.autofill.Dataset
 import android.service.autofill.Field
 import android.service.autofill.FillResponse
@@ -38,7 +38,6 @@ import android.view.autofill.AutofillId
 import android.view.autofill.AutofillManager
 import android.view.autofill.AutofillValue
 import android.widget.RemoteViews
-import android.widget.Toast
 import android.widget.inline.InlinePresentationSpec
 import androidx.annotation.RequiresApi
 import androidx.autofill.inline.UiVersions
@@ -54,21 +53,63 @@ import com.kunzisoft.keepass.model.EntryInfo
 import com.kunzisoft.keepass.model.SearchInfo
 import com.kunzisoft.keepass.settings.AutofillSettingsActivity
 import com.kunzisoft.keepass.settings.PreferencesUtil
+import com.kunzisoft.keepass.utils.AppUtil.randomRequestCode
+import com.kunzisoft.keepass.utils.getParcelableCompat
 import com.kunzisoft.keepass.utils.getParcelableExtraCompat
+import java.io.IOException
 import kotlin.math.min
 
 
 @RequiresApi(api = Build.VERSION_CODES.O)
 object AutofillHelper {
 
-    private const val EXTRA_ASSIST_STRUCTURE = AutofillManager.EXTRA_ASSIST_STRUCTURE
+    private const val EXTRA_BASE_STRUCTURE = "com.kunzisoft.keepass.autofill.BASE_STRUCTURE"
     private const val EXTRA_INLINE_SUGGESTIONS_REQUEST = "com.kunzisoft.keepass.autofill.INLINE_SUGGESTIONS_REQUEST"
 
-    fun retrieveAutofillComponent(intent: Intent?): AutofillComponent? {
-        intent?.getParcelableExtraCompat<AssistStructure>(EXTRA_ASSIST_STRUCTURE)?.let { assistStructure ->
+    fun Intent.addAutofillComponent(autofillComponent: AutofillComponent?): Intent {
+        autofillComponent?.let {
+            this.putExtra(EXTRA_BASE_STRUCTURE, autofillComponent.assistStructure)
+            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
+                autofillComponent.compatInlineSuggestionsRequest?.let {
+                    this.putExtra(EXTRA_INLINE_SUGGESTIONS_REQUEST, it)
+                }
+            }
+        }
+        return this
+    }
+
+    fun Intent.retrieveAutofillComponent(): AutofillComponent? {
+        this.getParcelableExtraCompat<AssistStructure>(EXTRA_BASE_STRUCTURE)?.let { assistStructure ->
             return if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-                AutofillComponent(assistStructure,
-                        intent.getParcelableExtraCompat(EXTRA_INLINE_SUGGESTIONS_REQUEST))
+                AutofillComponent(
+                    assistStructure,
+                    this.getParcelableExtraCompat(EXTRA_INLINE_SUGGESTIONS_REQUEST))
+            } else {
+                AutofillComponent(assistStructure, null)
+            }
+        }
+        return null
+    }
+
+    fun Bundle.addAutofillComponent(autofillComponent: AutofillComponent?): Bundle {
+        autofillComponent?.let {
+            this.putParcelable(EXTRA_BASE_STRUCTURE, autofillComponent.assistStructure)
+            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
+                autofillComponent.compatInlineSuggestionsRequest?.let {
+                    this.putParcelable(EXTRA_INLINE_SUGGESTIONS_REQUEST, it)
+                }
+            }
+        }
+        return this
+    }
+
+    fun Bundle.retrieveAutofillComponent(): AutofillComponent? {
+        this.getParcelableCompat<AssistStructure>(EXTRA_BASE_STRUCTURE)?.let { assistStructure ->
+            return if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
+                AutofillComponent(
+                    assistStructure,
+                    this.getParcelableCompat(EXTRA_INLINE_SUGGESTIONS_REQUEST)
+                )
             } else {
                 AutofillComponent(assistStructure, null)
             }
@@ -127,11 +168,13 @@ object AutofillHelper {
         return this
     }
 
-    private fun buildDatasetForEntry(context: Context,
-                                     database: ContextualDatabase,
-                                     entryInfo: EntryInfo,
-                                     struct: StructureParser.Result,
-                                     inlinePresentation: InlinePresentation?): Dataset {
+    private fun buildDatasetForEntry(
+        context: Context,
+        database: ContextualDatabase,
+        entryInfo: EntryInfo,
+        struct: StructureParser.Result,
+        inlinePresentation: InlinePresentation?
+    ): Dataset {
         val remoteViews: RemoteViews = newRemoteViews(context, database, makeEntryTitle(entryInfo), entryInfo.icon)
 
         val datasetBuilder = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
@@ -291,11 +334,13 @@ object AutofillHelper {
 
     @SuppressLint("RestrictedApi")
     @RequiresApi(Build.VERSION_CODES.R)
-    private fun buildInlinePresentationForEntry(context: Context,
-                                                database: ContextualDatabase,
-                                                compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest,
-                                                positionItem: Int,
-                                                entryInfo: EntryInfo): InlinePresentation? {
+    private fun buildInlinePresentationForEntry(
+        context: Context,
+        database: ContextualDatabase,
+        compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest,
+        positionItem: Int,
+        entryInfo: EntryInfo
+    ): InlinePresentation? {
         compatInlineSuggestionsRequest.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
             val inlinePresentationSpecs = inlineSuggestionsRequest.inlinePresentationSpecs
             val maxSuggestion = inlineSuggestionsRequest.maxSuggestionCount
@@ -314,7 +359,7 @@ object AutofillHelper {
                 // Build the content for IME UI
                 val pendingIntent = PendingIntent.getActivity(
                     context,
-                    0,
+                    randomRequestCode(),
                     Intent(context, AutofillSettingsActivity::class.java),
                     PendingIntent.FLAG_IMMUTABLE
                 )
@@ -341,9 +386,11 @@ object AutofillHelper {
 
     @RequiresApi(Build.VERSION_CODES.R)
     @SuppressLint("RestrictedApi")
-    private fun buildInlinePresentationForManualSelection(context: Context,
-                                                          inlinePresentationSpec: InlinePresentationSpec,
-                                                          pendingIntent: PendingIntent): InlinePresentation? {
+    private fun buildInlinePresentationForManualSelection(
+        context: Context,
+        inlinePresentationSpec: InlinePresentationSpec,
+        pendingIntent: PendingIntent
+    ): InlinePresentation? {
         // Make sure that the IME spec claims support for v1 UI template.
         val imeStyle = inlinePresentationSpec.style
         if (!UiVersions.getVersions(imeStyle).contains(UiVersions.INLINE_UI_VERSION_1))
@@ -360,11 +407,13 @@ object AutofillHelper {
                 }.build().slice, inlinePresentationSpec, false)
     }
 
-    fun buildResponse(context: Context,
-                      database: ContextualDatabase,
-                      entriesInfo: List<EntryInfo>,
-                      parseResult: StructureParser.Result,
-                      compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest?): FillResponse? {
+    fun buildResponse(
+        context: Context,
+        database: ContextualDatabase,
+        entriesInfo: List<EntryInfo>,
+        parseResult: StructureParser.Result,
+        autofillComponent: AutofillComponent
+    ): FillResponse? {
         val responseBuilder = FillResponse.Builder()
         // Add Header
         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.P) {
@@ -385,7 +434,8 @@ object AutofillHelper {
         // Add inline suggestion for new IME and dataset
         var numberInlineSuggestions = 0
         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-            compatInlineSuggestionsRequest?.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
+            autofillComponent.compatInlineSuggestionsRequest
+                ?.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
                 numberInlineSuggestions = minOf(inlineSuggestionsRequest.maxSuggestionCount, entriesInfo.size)
                 if (PreferencesUtil.isAutofillManualSelectionEnable(context)) {
                     if (entriesInfo.size >= inlineSuggestionsRequest.maxSuggestionCount) {
@@ -401,21 +451,27 @@ object AutofillHelper {
                 var inlinePresentation: InlinePresentation? = null
                 if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R
                     && numberInlineSuggestions > 0
-                    && compatInlineSuggestionsRequest != null) {
+                    && autofillComponent.compatInlineSuggestionsRequest != null) {
                     inlinePresentation = buildInlinePresentationForEntry(
                         context,
                         database,
-                        compatInlineSuggestionsRequest,
+                        autofillComponent.compatInlineSuggestionsRequest,
                         numberInlineSuggestions--,
                         entry
                     )
                 }
                 // Create dataset for each entry
                 responseBuilder.addDataset(
-                    buildDatasetForEntry(context, database, entry, parseResult, inlinePresentation)
+                    buildDatasetForEntry(
+                        context = context,
+                        database = database,
+                        entryInfo = entry,
+                        struct = parseResult,
+                        inlinePresentation = inlinePresentation
+                    )
                 )
             } catch (e: Exception) {
-                Log.e(TAG, "Unable to add dataset")
+                Log.e(TAG, "Unable to add dataset", e)
             }
         }
 
@@ -427,21 +483,28 @@ object AutofillHelper {
                 webScheme = parseResult.webScheme
                 manualSelection = true
             }
-            val manualSelectionView = RemoteViews(context.packageName, R.layout.item_autofill_select_entry)
-            AutofillLauncherActivity.getPendingIntentForSelection(context,
-                    searchInfo, compatInlineSuggestionsRequest)?.let { pendingIntent ->
+            val manualSelectionView = RemoteViews(
+                context.packageName,
+                R.layout.item_autofill_select_entry
+            )
+            AutofillLauncherActivity.getPendingIntentForSelection(
+                context,
+                searchInfo,
+                autofillComponent
+            )?.let { pendingIntent ->
 
                 var inlinePresentation: InlinePresentation? = null
                 if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-                    compatInlineSuggestionsRequest?.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
-                        val inlinePresentationSpec =
-                            inlineSuggestionsRequest.inlinePresentationSpecs[0]
-                        inlinePresentation = buildInlinePresentationForManualSelection(
-                            context,
-                            inlinePresentationSpec,
-                            pendingIntent
-                        )
-                    }
+                    autofillComponent.compatInlineSuggestionsRequest
+                        ?.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
+                            val inlinePresentationSpec =
+                                inlineSuggestionsRequest.inlinePresentationSpecs[0]
+                            inlinePresentation = buildInlinePresentationForManualSelection(
+                                context,
+                                inlinePresentationSpec,
+                                pendingIntent
+                            )
+                        }
                 }
 
                 val datasetBuilder = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
@@ -486,61 +549,31 @@ object AutofillHelper {
     }
 
     /**
-     * Build the Autofill response for one entry
+     * Build the Autofill response
      */
-    fun buildResponseAndSetResult(activity: Activity,
-                                  database: ContextualDatabase,
-                                  entryInfo: EntryInfo) {
-        buildResponseAndSetResult(activity, database, ArrayList<EntryInfo>().apply { add(entryInfo) })
-    }
-
-    /**
-     * Build the Autofill response for many entry
-     */
-    fun buildResponseAndSetResult(activity: Activity,
-                                  database: ContextualDatabase,
-                                  entriesInfo: List<EntryInfo>) {
+    fun buildResponse(
+        context: Context,
+        autofillComponent: AutofillComponent,
+        database: ContextualDatabase,
+        entriesInfo: List<EntryInfo>,
+        onIntentCreated: (Intent) -> Unit
+    ) {
         if (entriesInfo.isEmpty()) {
-            activity.setResult(Activity.RESULT_CANCELED)
+            throw IOException("No entries found")
         } else {
-            var setResultOk = false
-            activity.intent?.getParcelableExtraCompat<AssistStructure>(EXTRA_ASSIST_STRUCTURE)?.let { structure ->
-                StructureParser(structure).parse()?.let { result ->
-                    // New Response
-                    val response = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-                        val compatInlineSuggestionsRequest = activity.intent?.getParcelableExtraCompat<CompatInlineSuggestionsRequest>(
-                            EXTRA_INLINE_SUGGESTIONS_REQUEST
-                        )
-                        if (compatInlineSuggestionsRequest != null) {
-                            Toast.makeText(activity.applicationContext, R.string.autofill_inline_suggestions_keyboard, Toast.LENGTH_SHORT).show()
-                        }
-                        buildResponse(activity, database, entriesInfo, result, compatInlineSuggestionsRequest)
-                    } else {
-                        buildResponse(activity, database, entriesInfo, result, null)
-                    }
-                    val mReplyIntent = Intent()
-                    Log.d(activity.javaClass.name, "Success Autofill auth.")
-                    mReplyIntent.putExtra(
-                            AutofillManager.EXTRA_AUTHENTICATION_RESULT,
-                            response)
-                    setResultOk = true
-                    activity.setResult(Activity.RESULT_OK, mReplyIntent)
-                }
-            }
-            if (!setResultOk) {
-                Log.w(activity.javaClass.name, "Failed Autofill auth.")
-                activity.setResult(Activity.RESULT_CANCELED)
-            }
-        }
-    }
-
-    fun Intent.addAutofillComponent(context: Context, autofillComponent: AutofillComponent) {
-        this.putExtra(EXTRA_ASSIST_STRUCTURE, autofillComponent.assistStructure)
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R
-            && PreferencesUtil.isAutofillInlineSuggestionsEnable(context)) {
-            autofillComponent.compatInlineSuggestionsRequest?.let {
-                this.putExtra(EXTRA_INLINE_SUGGESTIONS_REQUEST, it)
-            }
+            StructureParser(autofillComponent.assistStructure).parse()?.let { result ->
+                // New Response
+                onIntentCreated(Intent().putExtra(
+                    AutofillManager.EXTRA_AUTHENTICATION_RESULT,
+                    buildResponse(
+                        context = context,
+                        database = database,
+                        entriesInfo = entriesInfo,
+                        parseResult = result,
+                        autofillComponent = autofillComponent
+                    )
+                ))
+            } ?: throw IOException("Unable to parse the structure")
         }
     }
 

app/src/main/java/com/kunzisoft/keepass/credentialprovider/autofill/KeeAutofillService.kt

@@ -53,7 +53,7 @@ import com.kunzisoft.keepass.model.RegisterInfo
 import com.kunzisoft.keepass.model.SearchInfo
 import com.kunzisoft.keepass.settings.AutofillSettingsActivity
 import com.kunzisoft.keepass.settings.PreferencesUtil
-import com.kunzisoft.keepass.utils.AppUtil
+import com.kunzisoft.keepass.utils.AppUtil.randomRequestCode
 import org.joda.time.DateTime
 
 
@@ -92,10 +92,11 @@ class KeeAutofillService : AutofillService() {
         autofillInlineSuggestionsEnabled = PreferencesUtil.isAutofillInlineSuggestionsEnable(this)
     }
 
-    override fun onFillRequest(request: FillRequest,
-                               cancellationSignal: CancellationSignal,
-                               callback: FillCallback) {
-
+    override fun onFillRequest(
+        request: FillRequest,
+        cancellationSignal: CancellationSignal,
+        callback: FillCallback
+    ) {
         cancellationSignal.setOnCancelListener { Log.w(TAG, "Cancel autofill.") }
 
         if (request.flags and FillRequest.FLAG_COMPATIBILITY_MODE_REQUEST != 0) {
@@ -120,67 +121,64 @@ class KeeAutofillService : AutofillService() {
                     webDomain = parseResult.webDomain
                     webScheme = parseResult.webScheme
                 }
-                AppUtil.getConcreteWebDomain(this, searchInfo.webDomain) { webDomainWithoutSubDomain ->
-                    searchInfo.webDomain = webDomainWithoutSubDomain
-                    val inlineSuggestionsRequest = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R
-                            && autofillInlineSuggestionsEnabled) {
-                        CompatInlineSuggestionsRequest(request)
-                    } else {
-                        null
-                    }
-                    launchSelection(mDatabase,
-                            searchInfo,
-                            parseResult,
-                            inlineSuggestionsRequest,
-                            callback)
+                val inlineSuggestionsRequest = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R
+                        && autofillInlineSuggestionsEnabled) {
+                    CompatInlineSuggestionsRequest(request)
+                } else {
+                    null
                 }
+                val autofillComponent = AutofillComponent(
+                    latestStructure,
+                    inlineSuggestionsRequest
+                )
+                SearchHelper.checkAutoSearchInfo(
+                    context = this,
+                    database = mDatabase,
+                    searchInfo = searchInfo,
+                    onItemsFound = { openedDatabase, items ->
+                        callback.onSuccess(
+                            AutofillHelper.buildResponse(
+                                context = this,
+                                database = openedDatabase,
+                                entriesInfo = items,
+                                parseResult = parseResult,
+                                autofillComponent = autofillComponent
+                            )
+                        )
+                    },
+                    onItemNotFound = { openedDatabase ->
+                        // Show UI if no search result
+                        showUIForEntrySelection(parseResult, openedDatabase,
+                            searchInfo, autofillComponent, callback)
+                    },
+                    onDatabaseClosed = {
+                        // Show UI if database not open
+                        showUIForEntrySelection(parseResult, null,
+                            searchInfo, autofillComponent, callback)
+                    }
+                )
             }
         }
     }
 
-    private fun launchSelection(database: ContextualDatabase?,
-                                searchInfo: SearchInfo,
-                                parseResult: StructureParser.Result,
-                                inlineSuggestionsRequest: CompatInlineSuggestionsRequest?,
-                                callback: FillCallback) {
-        SearchHelper.checkAutoSearchInfo(
-            context = this,
-            database = database,
-            searchInfo = searchInfo,
-            onItemsFound = { openedDatabase, items ->
-                callback.onSuccess(
-                    AutofillHelper.buildResponse(
-                        this, openedDatabase,
-                        items, parseResult, inlineSuggestionsRequest
-                    )
-                )
-            },
-            onItemNotFound = { openedDatabase ->
-                // Show UI if no search result
-                showUIForEntrySelection(parseResult, openedDatabase,
-                        searchInfo, inlineSuggestionsRequest, callback)
-            },
-            onDatabaseClosed = {
-                // Show UI if database not open
-                showUIForEntrySelection(parseResult, null,
-                        searchInfo, inlineSuggestionsRequest, callback)
-            }
-        )
-    }
-
     @SuppressLint("RestrictedApi")
-    private fun showUIForEntrySelection(parseResult: StructureParser.Result,
-                                        database: ContextualDatabase?,
-                                        searchInfo: SearchInfo,
-                                        inlineSuggestionsRequest: CompatInlineSuggestionsRequest?,
-                                        callback: FillCallback) {
+    private fun showUIForEntrySelection(
+        parseResult: StructureParser.Result,
+        database: ContextualDatabase?,
+        searchInfo: SearchInfo,
+        autofillComponent: AutofillComponent,
+        callback: FillCallback
+    ) {
         var success = false
         parseResult.allAutofillIds().let { autofillIds ->
             if (autofillIds.isNotEmpty()) {
                 // If the entire Autofill Response is authenticated, AuthActivity is used
                 // to generate Response.
-                AutofillLauncherActivity.getPendingIntentForSelection(this,
-                        searchInfo, inlineSuggestionsRequest)?.intentSender?.let { intentSender ->
+                AutofillLauncherActivity.getPendingIntentForSelection(
+                    this,
+                    searchInfo,
+                    autofillComponent
+                )?.intentSender?.let { intentSender ->
                     val responseBuilder = FillResponse.Builder()
                     val remoteViewsUnlock: RemoteViews = if (database == null) {
                         if (!parseResult.webDomain.isNullOrEmpty()) {
@@ -271,7 +269,8 @@ class KeeAutofillService : AutofillService() {
                         && autofillInlineSuggestionsEnabled
                     ) {
                         var inlinePresentation: InlinePresentation? = null
-                        inlineSuggestionsRequest?.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
+                        autofillComponent.compatInlineSuggestionsRequest
+                            ?.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
                             val inlinePresentationSpecs =
                                 inlineSuggestionsRequest.inlinePresentationSpecs
                             if (inlineSuggestionsRequest.maxSuggestionCount > 0
@@ -289,7 +288,7 @@ class KeeAutofillService : AutofillService() {
                                         InlineSuggestionUi.newContentBuilder(
                                             PendingIntent.getActivity(
                                                 this,
-                                                0,
+                                                randomRequestCode(),
                                                 Intent(this, AutofillSettingsActivity::class.java),
                                                 PendingIntent.FLAG_IMMUTABLE
                                             )
@@ -361,7 +360,7 @@ class KeeAutofillService : AutofillService() {
 
     override fun onSaveRequest(request: SaveRequest, callback: SaveCallback) {
         var success = false
-        if (askToSaveData) {
+        if (askToSaveData && Build.VERSION.SDK_INT >= Build.VERSION_CODES.P) {
             val latestStructure = request.fillContexts.last().structure
             StructureParser(latestStructure).parse(true)?.let { parseResult ->
 
@@ -387,32 +386,32 @@ class KeeAutofillService : AutofillService() {
                     }
 
                     // Show UI to save data
+                    val searchInfo = SearchInfo().apply {
+                        applicationId = parseResult.applicationId
+                        webDomain = parseResult.webDomain
+                        webScheme = parseResult.webScheme
+                    }
                     val registerInfo = RegisterInfo(
-                        searchInfo = SearchInfo().apply {
-                            applicationId = parseResult.applicationId
-                            webDomain = parseResult.webDomain
-                            webScheme = parseResult.webScheme
-                        },
+                        searchInfo = searchInfo,
                         username = parseResult.usernameValue?.textValue?.toString(),
                         password = parseResult.passwordValue?.textValue?.toString(),
-                        creditCard =
+                        creditCard = parseResult.creditCardNumber?.let { cardNumber ->
                             CreditCard(
                                 parseResult.creditCardHolder,
-                                parseResult.creditCardNumber,
+                                cardNumber,
                                 expiration,
                                 parseResult.cardVerificationValue
                             )
-                        )
+                        }
+                    )
 
-                    // TODO Callback in each activity #765
-                    //if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.P) {
-                    //    callback.onSuccess(AutofillLauncherActivity.getAuthIntentSenderForRegistration(this,
-                    //            registerInfo))
-                    //} else {
-                    AutofillLauncherActivity.launchForRegistration(this, registerInfo)
-                    success = true
-                    callback.onSuccess()
-                    //}
+                    AutofillLauncherActivity.getPendingIntentForRegistration(
+                        this,
+                        registerInfo
+                    )?.intentSender?.let { intentSender ->
+                        success = true
+                        callback.onSuccess(intentSender)
+                    }
                 }
             }
         }

app/src/main/java/com/kunzisoft/keepass/credentialprovider/autofill/StructureParser.kt

@@ -362,8 +362,8 @@ class StructureParser(private val structure: AssistStructure) {
                 if (result?.passwordId == null) {
                     usernameIdCandidate = autofillId
                     usernameValueCandidate = node.autofillValue
+                    Log.d(TAG, "Autofill username candidate android text type: ${showHexInputType(inputType)}")
                 }
-                Log.d(TAG, "Autofill username candidate android text type: ${showHexInputType(inputType)}")
             }
             inputIsVariationType(inputType,
                 InputType.TYPE_TEXT_VARIATION_VISIBLE_PASSWORD) -> {

app/src/main/java/com/kunzisoft/keepass/credentialprovider/magikeyboard/MagikeyboardService.kt

@@ -43,6 +43,7 @@ import androidx.recyclerview.widget.RecyclerView
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.adapters.FieldsAdapter
 import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.removeModes
 import com.kunzisoft.keepass.credentialprovider.activity.EntrySelectionLauncherActivity
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.DatabaseTaskProvider
@@ -461,9 +462,11 @@ class MagikeyboardService : InputMethodService(), KeyboardView.OnKeyboardActionL
             KeyboardEntryNotificationService.launchNotificationIfAllowed(context, entry, toast)
         }
 
-        fun performSelection(items: List<EntryInfo>,
-                             actionPopulateKeyboard: (entryInfo: EntryInfo) -> Unit,
-                             actionEntrySelection: (autoSearch: Boolean) -> Unit) {
+        fun performSelection(
+            items: List<EntryInfo>,
+            actionPopulateKeyboard: (entryInfo: EntryInfo) -> Unit,
+            actionEntrySelection: (autoSearch: Boolean) -> Unit
+        ) {
             EntrySelectionHelper.performSelection(
                 items = items,
                 actionPopulateCredentialProvider = { itemFound ->
@@ -477,15 +480,5 @@ class MagikeyboardService : InputMethodService(), KeyboardView.OnKeyboardActionL
                 actionEntrySelection = actionEntrySelection
             )
         }
-
-        fun populateKeyboardAndMoveAppToBackground(activity: Activity,
-                                                   entry: EntryInfo,
-                                                   toast: Boolean = true) {
-            // Populate Magikeyboard with entry
-            addEntryAndLaunchNotificationIfAllowed(activity, entry, toast)
-            // Consume the selection mode
-            EntrySelectionHelper.removeModesFromIntent(activity.intent)
-            activity.moveTaskToBack(true)
-        }
     }
 }

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/PasskeyProviderService.kt

@@ -93,22 +93,18 @@ class PasskeyProviderService : CredentialProviderService() {
     private fun buildPasskeySearchInfo(relyingParty: String): SearchInfo {
         return SearchInfo().apply {
             this.relyingParty = relyingParty
-            this.isAPasskeySearch = true
-            this.query = relyingParty
         }
     }
 
     override fun onBeginGetCredentialRequest(
         request: BeginGetCredentialRequest,
         cancellationSignal: CancellationSignal,
-        callback: OutcomeReceiver<BeginGetCredentialResponse, GetCredentialException>,
+        callback: OutcomeReceiver<BeginGetCredentialResponse, GetCredentialException>
     ) {
         Log.d(javaClass.simpleName, "onBeginGetCredentialRequest called")
         try {
-            processGetCredentialsRequest(request)?.let { response ->
+            processGetCredentialsRequest(request) { response ->
                 callback.onResult(response)
-            } ?: run {
-                callback.onError(GetCredentialUnknownException())
             }
         } catch (e: Exception) {
             Log.e(javaClass.simpleName, "onBeginGetCredentialRequest error", e)
@@ -116,24 +112,30 @@ class PasskeyProviderService : CredentialProviderService() {
         }
     }
 
-    private fun processGetCredentialsRequest(request: BeginGetCredentialRequest): BeginGetCredentialResponse? {
-        val credentialEntries: MutableList<CredentialEntry> = mutableListOf()
-
+    private fun processGetCredentialsRequest(
+        request: BeginGetCredentialRequest,
+        callback: (BeginGetCredentialResponse?) -> Unit
+    ) {
+        var knownOption = false
         for (option in request.beginGetCredentialOptions) {
             when (option) {
                 is BeginGetPublicKeyCredentialOption -> {
-                    credentialEntries.addAll(
-                        populatePasskeyData(option)
-                    )
-                    return BeginGetCredentialResponse(credentialEntries)
+                    knownOption = true
+                    populatePasskeyData(option) { listCredentials ->
+                        callback(BeginGetCredentialResponse(listCredentials))
+                    }
                 }
             }
         }
-        Log.w(javaClass.simpleName, "unknown beginGetCredentialOption")
-        return null
+        if (knownOption.not()) {
+            throw IOException("unknown type of beginGetCredentialOption")
+        }
     }
 
-    private fun populatePasskeyData(option: BeginGetPublicKeyCredentialOption): List<CredentialEntry> {
+    private fun populatePasskeyData(
+        option: BeginGetPublicKeyCredentialOption,
+        callback: (List<CredentialEntry>) -> Unit
+    ) {
 
         val passkeyEntries: MutableList<CredentialEntry> = mutableListOf()
 
@@ -169,6 +171,7 @@ class PasskeyProviderService : CredentialProviderService() {
                         )
                     }
                 }
+                callback(passkeyEntries)
             },
             onItemNotFound = { _ ->
                 Log.w(TAG, "No passkey found in the database with this relying party : $relyingPartyId")
@@ -191,6 +194,7 @@ class PasskeyProviderService : CredentialProviderService() {
                         )
                     )
                 }
+                callback(passkeyEntries)
             },
             onDatabaseClosed = {
                 Log.d(TAG, "Add pending intent for passkey selection in closed database")
@@ -213,9 +217,9 @@ class PasskeyProviderService : CredentialProviderService() {
                         )
                     )
                 }
+                callback(passkeyEntries)
             }
         )
-        return passkeyEntries
     }
 
     override fun onBeginCreateCredentialRequest(
@@ -225,7 +229,9 @@ class PasskeyProviderService : CredentialProviderService() {
     ) {
         Log.d(javaClass.simpleName, "onBeginCreateCredentialRequest called")
         try {
-            callback.onResult(processCreateCredentialRequest(request))
+            processCreateCredentialRequest(request) {
+                callback.onResult(BeginCreateCredentialResponse(it))
+            }
         } catch (e: Exception) {
             Log.e(javaClass.simpleName, "onBeginCreateCredentialRequest error", e)
             toastError(e)
@@ -233,15 +239,20 @@ class PasskeyProviderService : CredentialProviderService() {
         }
     }
 
-    private fun processCreateCredentialRequest(request: BeginCreateCredentialRequest): BeginCreateCredentialResponse {
+    private fun processCreateCredentialRequest(
+        request: BeginCreateCredentialRequest,
+        callback: (List<CreateEntry>) -> Unit
+    ) {
         when (request) {
             is BeginCreatePublicKeyCredentialRequest -> {
                 // Request is passkey type
-                return handleCreatePasskeyQuery(request)
+                handleCreatePasskeyQuery(request, callback)
+            }
+            else -> {
+                // request type not supported
+                throw IOException("unknown type of BeginCreateCredentialRequest")
             }
         }
-        // request type not supported
-        throw IOException("unknown type of BeginCreateCredentialRequest")
     }
 
     private fun MutableList<CreateEntry>.addPendingIntentCreationNewEntry(
@@ -266,9 +277,15 @@ class PasskeyProviderService : CredentialProviderService() {
         }
     }
 
-    private fun handleCreatePasskeyQuery(request: BeginCreatePublicKeyCredentialRequest): BeginCreateCredentialResponse {
-
-        val accountName = mDatabase?.name ?: getString(R.string.passkey_database_username)
+    private fun handleCreatePasskeyQuery(
+        request: BeginCreatePublicKeyCredentialRequest,
+        callback: (List<CreateEntry>) -> Unit
+    ) {
+        val databaseName = mDatabase?.name
+        val accountName =
+            if (databaseName?.isBlank() != false)
+                getString(R.string.passkey_database_username)
+            else databaseName
         val createEntries: MutableList<CreateEntry> = mutableListOf()
         val relyingPartyId = PublicKeyCredentialCreationOptions(
             requestJson = request.requestJson,
@@ -309,6 +326,7 @@ class PasskeyProviderService : CredentialProviderService() {
                         }
                     }*/
                 }
+                callback(createEntries)
             },
             onItemNotFound = { database ->
                 // To create a new entry
@@ -317,6 +335,7 @@ class PasskeyProviderService : CredentialProviderService() {
                 } else {
                     createEntries.addPendingIntentCreationNewEntry(accountName, searchInfo)
                 }
+                callback(createEntries)
             },
             onDatabaseClosed = {
                 // Launch the passkey launcher activity to open the database
@@ -334,10 +353,9 @@ class PasskeyProviderService : CredentialProviderService() {
                         )
                     )
                 }
+                callback(createEntries)
             }
         )
-
-        return BeginCreateCredentialResponse(createEntries)
     }
 
     override fun onClearCredentialStateRequest(

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/util/PasskeyHelper.kt

@@ -24,7 +24,6 @@ import android.content.Context
 import android.content.Intent
 import android.os.Build
 import android.os.Bundle
-import android.os.ParcelUuid
 import android.security.keystore.KeyGenParameterSpec
 import android.security.keystore.KeyProperties
 import android.util.Log
@@ -44,6 +43,7 @@ import com.kunzisoft.encrypt.Base64Helper.Companion.b64Encode
 import com.kunzisoft.encrypt.Signature
 import com.kunzisoft.encrypt.Signature.getApplicationFingerprints
 import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addNodeId
 import com.kunzisoft.keepass.credentialprovider.passkey.data.AuthenticatorAssertionResponse
 import com.kunzisoft.keepass.credentialprovider.passkey.data.AuthenticatorAttestationResponse
 import com.kunzisoft.keepass.credentialprovider.passkey.data.Cbor
@@ -60,7 +60,6 @@ import com.kunzisoft.keepass.model.AndroidOrigin
 import com.kunzisoft.keepass.model.AppOrigin
 import com.kunzisoft.keepass.model.EntryInfo
 import com.kunzisoft.keepass.model.Passkey
-import com.kunzisoft.keepass.model.SearchInfo
 import com.kunzisoft.keepass.utils.AppUtil
 import com.kunzisoft.keepass.utils.StringUtil.toHexString
 import com.kunzisoft.keepass.utils.getParcelableExtraCompat
@@ -88,10 +87,7 @@ object PasskeyHelper {
 
     private const val HMAC_TYPE = "HmacSHA256"
 
-
-    private const val EXTRA_SEARCH_INFO = "com.kunzisoft.keepass.extra.searchInfo"
     private const val EXTRA_APP_ORIGIN = "com.kunzisoft.keepass.extra.appOrigin"
-    private const val EXTRA_NODE_ID = "com.kunzisoft.keepass.extra.nodeId"
     private const val EXTRA_TIMESTAMP = "com.kunzisoft.keepass.extra.timestamp"
     private const val EXTRA_AUTHENTICATION_CODE = "com.kunzisoft.keepass.extra.authenticationCode"
 
@@ -110,38 +106,6 @@ object PasskeyHelper {
 
     private val internalSecureRandom: SecureRandom = SecureRandom()
 
-    /**
-     * Build the Passkey response for one entry
-     */
-    fun Activity.buildPasskeyResponseAndSetResult(
-        entryInfo: EntryInfo,
-        extras: Bundle? = null
-    ) {
-        try {
-            entryInfo.passkey?.let { passkey ->
-                val mReplyIntent = Intent()
-                Log.d(javaClass.name, "Success Passkey manual selection")
-                mReplyIntent.addPasskey(passkey)
-                mReplyIntent.addAppOrigin(entryInfo.appOrigin)
-                mReplyIntent.addNodeId(entryInfo.id)
-                extras?.let {
-                    mReplyIntent.putExtras(it)
-                }
-                setResult(Activity.RESULT_OK, mReplyIntent)
-            } ?: run {
-                throw IOException("No passkey found")
-            }
-        } catch (e: Exception) {
-            Log.e(javaClass.name, "Unable to add the passkey as result", e)
-            Toast.makeText(
-                this,
-                getString(R.string.error_passkey_result),
-                Toast.LENGTH_SHORT
-            ).show()
-            setResult(Activity.RESULT_CANCELED)
-        }
-    }
-
     /**
      * Add an authentication code generated by an entry to the intent
      */
@@ -181,22 +145,6 @@ object PasskeyHelper {
         return this.removeExtra(EXTRA_PASSKEY)
     }
 
-    /**
-     * Add the search info to the intent
-     */
-    fun Intent.addSearchInfo(searchInfo: SearchInfo?) {
-        searchInfo?.let {
-            putExtra(EXTRA_SEARCH_INFO, searchInfo)
-        }
-    }
-
-    /**
-     * Retrieve the search info from the intent
-     */
-    fun Intent.retrieveSearchInfo(): SearchInfo? {
-        return this.getParcelableExtraCompat(EXTRA_SEARCH_INFO)
-    }
-
     /**
      * Add the app origin to the intent
      */
@@ -221,21 +169,37 @@ object PasskeyHelper {
     }
 
     /**
-     * Add the node id to the intent, useful for auto passkey selection
+     * Build the Passkey response for one entry
      */
-    fun Intent.addNodeId(nodeId: UUID?) {
-        nodeId?.let {
-            putExtra(EXTRA_NODE_ID, ParcelUuid(nodeId))
+    fun Activity.buildPasskeyResponseAndSetResult(
+        entryInfo: EntryInfo,
+        extras: Bundle? = null
+    ) {
+        try {
+            entryInfo.passkey?.let { passkey ->
+                val mReplyIntent = Intent()
+                Log.d(javaClass.name, "Success Passkey manual selection")
+                mReplyIntent.addPasskey(passkey)
+                mReplyIntent.addAppOrigin(entryInfo.appOrigin)
+                mReplyIntent.addNodeId(entryInfo.id)
+                extras?.let {
+                    mReplyIntent.putExtras(it)
+                }
+                setResult(Activity.RESULT_OK, mReplyIntent)
+            } ?: run {
+                throw IOException("No passkey found")
+            }
+        } catch (e: Exception) {
+            Log.e(javaClass.name, "Unable to add the passkey as result", e)
+            Toast.makeText(
+                this,
+                getString(R.string.error_passkey_result),
+                Toast.LENGTH_SHORT
+            ).show()
+            setResult(Activity.RESULT_CANCELED)
         }
     }
 
-    /**
-     * Retrieve the node id from the intent
-     */
-    fun Intent.retrieveNodeId(): UUID? {
-        return getParcelableExtraCompat<ParcelUuid>(EXTRA_NODE_ID)?.uuid
-    }
-
     /**
      * Check the timestamp and authentication code transmitted via PendingIntent
      */
@@ -424,11 +388,15 @@ object PasskeyHelper {
      * Utility method to create a passkey and the associated creation request parameters
      * [intent] allows to retrieve the request
      * [context] context to manage package verification files
+     * [defaultBackupEligibility] the default backup eligibility to add the the passkey entry
+     * [defaultBackupState] the default backup state to add the the passkey entry
      * [passkeyCreated] is called asynchronously when the passkey has been created
      */
     suspend fun retrievePasskeyCreationRequestParameters(
         intent: Intent,
         context: Context,
+        defaultBackupEligibility: Boolean?,
+        defaultBackupState: Boolean?,
         passkeyCreated: suspend (Passkey, AppOrigin?, PublicKeyCredentialCreationParameters) -> Unit
     ) {
         val createCredentialRequest = PendingIntentHandler.retrieveProviderCreateCredentialRequest(intent)
@@ -456,7 +424,9 @@ object PasskeyHelper {
             privateKeyPem = privateKeyPem,
             credentialId = b64Encode(credentialId),
             userHandle = b64Encode(userHandle),
-            relyingParty = relyingParty
+            relyingParty = relyingParty,
+            backupEligibility = defaultBackupEligibility,
+            backupState = defaultBackupState
         )
 
         // create new entry in database
@@ -590,8 +560,8 @@ object PasskeyHelper {
         requestOptions: PublicKeyCredentialRequestOptions,
         clientDataResponse: ClientDataResponse,
         passkey: Passkey,
-        backupEligibility: Boolean,
-        backupState: Boolean
+        defaultBackupEligibility: Boolean,
+        defaultBackupState: Boolean
     ): PublicKeyCredential {
         val getCredentialResponse = FidoPublicKeyCredential(
             id = passkey.credentialId,
@@ -599,8 +569,8 @@ object PasskeyHelper {
                 requestOptions = requestOptions,
                 userPresent = true,
                 userVerified = true,
-                backupEligibility = backupEligibility,
-                backupState = backupState,
+                backupEligibility = passkey.backupEligibility ?: defaultBackupEligibility,
+                backupState = passkey.backupState ?: defaultBackupState,
                 userHandle = passkey.userHandle,
                 privateKey = passkey.privateKeyPem,
                 clientDataResponse = clientDataResponse

app/src/main/java/com/kunzisoft/keepass/credentialprovider/viewmodel/AutofillLauncherViewModel.kt

@@ -0,0 +1,279 @@
+package com.kunzisoft.keepass.credentialprovider.viewmodel
+
+import android.app.Activity.RESULT_CANCELED
+import android.app.Activity.RESULT_OK
+import android.app.Application
+import android.content.Intent
+import android.os.Build
+import android.util.Log
+import androidx.activity.result.ActivityResult
+import androidx.annotation.RequiresApi
+import androidx.lifecycle.viewModelScope
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveAndRemoveEntries
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveRegisterInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSearchInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSpecialMode
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.TypeMode
+import com.kunzisoft.keepass.credentialprovider.autofill.AutofillComponent
+import com.kunzisoft.keepass.credentialprovider.autofill.AutofillHelper
+import com.kunzisoft.keepass.credentialprovider.autofill.AutofillHelper.retrieveAutofillComponent
+import com.kunzisoft.keepass.credentialprovider.autofill.KeeAutofillService
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.database.exception.RegisterInReadOnlyDatabaseException
+import com.kunzisoft.keepass.database.helper.SearchHelper
+import com.kunzisoft.keepass.model.RegisterInfo
+import com.kunzisoft.keepass.model.SearchInfo
+import com.kunzisoft.keepass.settings.PreferencesUtil
+import kotlinx.coroutines.CoroutineExceptionHandler
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.flow.MutableStateFlow
+import kotlinx.coroutines.flow.StateFlow
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
+import java.io.IOException
+
+@RequiresApi(api = Build.VERSION_CODES.O)
+class AutofillLauncherViewModel(application: Application): CredentialLauncherViewModel(application) {
+
+    private var mAutofillComponent: AutofillComponent? = null
+
+    private var mLockDatabaseAfterSelection: Boolean = false
+
+    private val mUiState = MutableStateFlow<UIState>(UIState.Loading)
+    val uiState: StateFlow<UIState> = mUiState
+
+    fun initialize() {
+        mLockDatabaseAfterSelection = PreferencesUtil.isAutofillCloseDatabaseEnable(getApplication())
+    }
+
+    override fun onResult() {
+        super.onResult()
+        mAutofillComponent = null
+    }
+
+    override suspend fun launchAction(
+        intent: Intent,
+        specialMode: SpecialMode,
+        database: ContextualDatabase?
+    ) {
+        // Retrieve selection mode
+        when (intent.retrieveSpecialMode()) {
+            SpecialMode.SELECTION -> {
+                val searchInfo = intent.retrieveSearchInfo()
+                if (searchInfo == null)
+                    throw IOException("Search info is null")
+                mAutofillComponent = intent.retrieveAutofillComponent()
+                // Build search param
+                launchSelection(database, mAutofillComponent, searchInfo)
+            }
+            SpecialMode.REGISTRATION -> {
+                // To register info
+                val registerInfo = intent.retrieveRegisterInfo()
+                if (registerInfo == null)
+                    throw IOException("Register info is null")
+                launchRegistration(database, registerInfo)
+            }
+            else -> {
+                // Not an autofill call
+                cancelResult()
+            }
+        }
+    }
+
+    private suspend fun launchSelection(
+        database: ContextualDatabase?,
+        autofillComponent: AutofillComponent?,
+        searchInfo: SearchInfo
+    ) {
+        withContext(Dispatchers.IO) {
+            if (autofillComponent == null) {
+                throw IOException("Autofill component is null")
+            }
+            if (KeeAutofillService.autofillAllowedFor(
+                    applicationId = searchInfo.applicationId,
+                    webDomain = searchInfo.webDomain,
+                    context = getApplication()
+                )
+            ) {
+                // If database is open
+                SearchHelper.checkAutoSearchInfo(
+                    context = getApplication(),
+                    database = database,
+                    searchInfo = searchInfo,
+                    onItemsFound = { openedDatabase, items ->
+                        // Items found
+                        if (autofillComponent.compatInlineSuggestionsRequest != null) {
+                            mUiState.value = UIState.ShowAutofillSuggestionMessage
+                        }
+                        AutofillHelper.buildResponse(
+                            context = getApplication(),
+                            autofillComponent = autofillComponent,
+                            database = openedDatabase,
+                            entriesInfo = items
+                        ) { intent ->
+                            setResult(intent, lockDatabase = mLockDatabaseAfterSelection)
+                        }
+                    },
+                    onItemNotFound = { openedDatabase ->
+                        // Show the database UI to select the entry
+                        mCredentialUiState.value =
+                            CredentialState.LaunchGroupActivityForSelection(
+                                database = openedDatabase,
+                                searchInfo = searchInfo,
+                                typeMode = TypeMode.AUTOFILL
+                            )
+                    },
+                    onDatabaseClosed = {
+                        // If database not open
+                        mCredentialUiState.value =
+                            CredentialState.LaunchFileDatabaseSelectActivityForSelection(
+                                searchInfo = searchInfo,
+                                typeMode = TypeMode.AUTOFILL
+                            )
+                    }
+                )
+            } else {
+                mUiState.value = UIState.ShowBlockRestartMessage
+            }
+        }
+    }
+
+    override fun manageSelectionResult(
+        database: ContextualDatabase,
+        activityResult: ActivityResult
+    ) {
+        super.manageSelectionResult(database, activityResult)
+        val intent = activityResult.data
+        viewModelScope.launch(CoroutineExceptionHandler { _, e ->
+            Log.e(TAG, "Unable to create selection response for autofill", e)
+            showError(e)
+        }) {
+            when (activityResult.resultCode) {
+                RESULT_OK -> {
+                    withContext(Dispatchers.IO) {
+                        Log.d(TAG, "Autofill selection result")
+                        if (intent == null)
+                            throw IOException("Intent is null")
+                        val entries = intent.retrieveAndRemoveEntries(database)
+                        val autofillComponent = mAutofillComponent
+                        if (autofillComponent == null)
+                            throw IOException("Autofill component is null")
+                        withContext(Dispatchers.Main) {
+                            AutofillHelper.buildResponse(
+                                context = getApplication(),
+                                autofillComponent = autofillComponent,
+                                database = database,
+                                entriesInfo = entries
+                            ) { intent ->
+                                setResult(intent, lockDatabase = mLockDatabaseAfterSelection)
+                            }
+                        }
+                    }
+                }
+                RESULT_CANCELED -> {
+                    withContext(Dispatchers.Main) {
+                        cancelResult()
+                    }
+                }
+            }
+        }
+    }
+
+    // -------------
+    //  Registration
+    // -------------
+
+    private fun launchRegistration(
+        database: ContextualDatabase?,
+        registerInfo: RegisterInfo
+    ) {
+        val searchInfo = registerInfo.searchInfo
+        if (KeeAutofillService.autofillAllowedFor(
+                applicationId = searchInfo.applicationId,
+                webDomain = searchInfo.webDomain,
+                context = getApplication()
+            )) {
+            val readOnly = database?.isReadOnly != false
+            SearchHelper.checkAutoSearchInfo(
+                context = getApplication(),
+                database = database,
+                searchInfo = searchInfo,
+                onItemsFound = { openedDatabase, _ ->
+                    if (!readOnly) {
+                        // Show the database UI to select the entry
+                        mCredentialUiState.value =
+                            CredentialState.LaunchGroupActivityForRegistration(
+                                database = openedDatabase,
+                                registerInfo = registerInfo,
+                                typeMode = TypeMode.AUTOFILL
+                            )
+                    } else {
+                        mCredentialUiState.value = CredentialState.ShowError(
+                            RegisterInReadOnlyDatabaseException()
+                        )
+                    }
+                },
+                onItemNotFound = { openedDatabase ->
+                    if (!readOnly) {
+                        // Show the database UI to select the entry
+                        mCredentialUiState.value =
+                            CredentialState.LaunchGroupActivityForRegistration(
+                                database = openedDatabase,
+                                registerInfo = registerInfo,
+                                typeMode = TypeMode.AUTOFILL
+                            )
+                    } else {
+                        mCredentialUiState.value = CredentialState.ShowError(
+                            RegisterInReadOnlyDatabaseException()
+                        )
+                    }
+                },
+                onDatabaseClosed = {
+                    // If database not open
+                    mCredentialUiState.value =
+                        CredentialState.LaunchFileDatabaseSelectActivityForRegistration(
+                            registerInfo = registerInfo,
+                            typeMode = TypeMode.AUTOFILL
+                        )
+                }
+            )
+        } else {
+            mUiState.value = UIState.ShowBlockRestartMessage
+        }
+    }
+
+    override fun manageRegistrationResult(activityResult: ActivityResult) {
+        isResultLauncherRegistered = false
+        viewModelScope.launch(CoroutineExceptionHandler { _, e ->
+            Log.e(TAG, "Unable to create registration response for autofill", e)
+            showError(e)
+        }) {
+            val responseIntent = Intent()
+            when (activityResult.resultCode) {
+                RESULT_OK -> {
+                    Log.d(TAG, "Autofill registration result")
+                    withContext(Dispatchers.Main) {
+                        setResult(responseIntent)
+                    }
+                }
+                RESULT_CANCELED -> {
+                    withContext(Dispatchers.Main) {
+                        cancelResult()
+                    }
+                }
+            }
+        }
+
+    }
+
+    sealed class UIState {
+        object Loading: UIState()
+        object ShowBlockRestartMessage: UIState()
+        object ShowAutofillSuggestionMessage: UIState()
+    }
+
+    companion object {
+        private val TAG = AutofillLauncherViewModel::class.java.name
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/viewmodel/CredentialLauncherViewModel.kt

@@ -0,0 +1,151 @@
+package com.kunzisoft.keepass.credentialprovider.viewmodel
+
+import android.app.Activity.RESULT_CANCELED
+import android.app.Activity.RESULT_OK
+import android.app.Application
+import android.content.Intent
+import android.util.Log
+import androidx.activity.result.ActivityResult
+import androidx.lifecycle.AndroidViewModel
+import androidx.lifecycle.viewModelScope
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.TypeMode
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.model.RegisterInfo
+import com.kunzisoft.keepass.model.SearchInfo
+import kotlinx.coroutines.CoroutineExceptionHandler
+import kotlinx.coroutines.flow.MutableStateFlow
+import kotlinx.coroutines.flow.StateFlow
+import kotlinx.coroutines.launch
+
+abstract class CredentialLauncherViewModel(application: Application): AndroidViewModel(application) {
+
+    protected var mDatabase: ContextualDatabase? = null
+
+    protected var isResultLauncherRegistered: Boolean = false
+    private var mSelectionResult: ActivityResult? = null
+
+    protected val mCredentialUiState = MutableStateFlow<CredentialState>(CredentialState.Loading)
+    val credentialUiState: StateFlow<CredentialState> = mCredentialUiState
+
+    fun showError(error: Throwable) {
+        Log.e(TAG, "Error on credential provider launch", error)
+        mCredentialUiState.value = CredentialState.ShowError(error)
+    }
+
+    open fun onResult() {
+        isResultLauncherRegistered = false
+        mSelectionResult = null
+    }
+
+    fun setResult(intent: Intent, lockDatabase: Boolean = false) {
+        // Remove the launcher register
+        onResult()
+        mCredentialUiState.value = CredentialState.SetActivityResult(
+            lockDatabase = lockDatabase,
+            resultCode = RESULT_OK,
+            data = intent
+        )
+    }
+
+    fun cancelResult(lockDatabase: Boolean = false) {
+        onResult()
+        mCredentialUiState.value = CredentialState.SetActivityResult(
+            lockDatabase = lockDatabase,
+            resultCode = RESULT_CANCELED
+        )
+    }
+
+    private fun onDatabaseRetrieved(database: ContextualDatabase) {
+        mDatabase = database
+        mSelectionResult?.let { selectionResult ->
+            manageSelectionResult(database, selectionResult)
+        }
+    }
+
+    fun manageSelectionResult(activityResult: ActivityResult) {
+        // Waiting for the database if needed
+        when (activityResult.resultCode) {
+            RESULT_OK -> {
+                mSelectionResult = activityResult
+                mDatabase?.let { database ->
+                    manageSelectionResult(database, activityResult)
+                }
+            }
+            RESULT_CANCELED -> {
+                cancelResult()
+            }
+        }
+    }
+
+    open fun manageSelectionResult(database: ContextualDatabase, activityResult: ActivityResult) {
+        mSelectionResult = null
+    }
+
+    open fun manageRegistrationResult(activityResult: ActivityResult) {}
+
+    open fun onExceptionOccurred(e: Throwable) {
+        showError(e)
+    }
+
+    open fun launchActionIfNeeded(
+        intent: Intent,
+        specialMode: SpecialMode,
+        database: ContextualDatabase?
+    ) {
+        if (database != null) {
+            onDatabaseRetrieved(database)
+        }
+        if (isResultLauncherRegistered.not()) {
+            isResultLauncherRegistered = true
+            viewModelScope.launch(CoroutineExceptionHandler { _, e ->
+                onExceptionOccurred(e)
+            }) {
+                launchAction(intent, specialMode, database)
+            }
+        }
+    }
+
+    /**
+     * Launch the main action
+     */
+    protected abstract suspend fun launchAction(
+        intent: Intent,
+        specialMode: SpecialMode,
+        database: ContextualDatabase?
+    )
+
+    sealed class CredentialState {
+        object Loading : CredentialState()
+        data class LaunchGroupActivityForSelection(
+            val database: ContextualDatabase,
+            val searchInfo: SearchInfo?,
+            val typeMode: TypeMode
+        ): CredentialState()
+        data class LaunchGroupActivityForRegistration(
+            val database: ContextualDatabase,
+            val registerInfo: RegisterInfo?,
+            val typeMode: TypeMode
+        ): CredentialState()
+        data class LaunchFileDatabaseSelectActivityForSelection(
+            val searchInfo: SearchInfo?,
+            val typeMode: TypeMode
+        ): CredentialState()
+        data class LaunchFileDatabaseSelectActivityForRegistration(
+            val registerInfo: RegisterInfo?,
+            val typeMode: TypeMode
+        ): CredentialState()
+        data class SetActivityResult(
+            val lockDatabase: Boolean,
+            val resultCode: Int,
+            val data: Intent? = null
+        ): CredentialState()
+        data class ShowError(
+            val error: Throwable
+        ): CredentialState()
+    }
+
+    companion object {
+        private val TAG = CredentialLauncherViewModel::class.java.name
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/viewmodel/EntrySelectionViewModel.kt

@@ -0,0 +1,297 @@
+package com.kunzisoft.keepass.credentialprovider.viewmodel
+
+import android.app.Activity.RESULT_CANCELED
+import android.app.Activity.RESULT_OK
+import android.app.Application
+import android.content.Intent
+import android.util.Log
+import androidx.activity.result.ActivityResult
+import androidx.core.net.toUri
+import androidx.lifecycle.viewModelScope
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveAndRemoveEntries
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveNodeId
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSearchInfo
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.TypeMode
+import com.kunzisoft.keepass.credentialprovider.magikeyboard.MagikeyboardService
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.database.exception.RegisterInReadOnlyDatabaseException
+import com.kunzisoft.keepass.database.helper.SearchHelper
+import com.kunzisoft.keepass.model.EntryInfo
+import com.kunzisoft.keepass.model.SearchInfo
+import com.kunzisoft.keepass.otp.OtpEntryFields
+import com.kunzisoft.keepass.utils.KeyboardUtil.isKeyboardActivatedInSettings
+import kotlinx.coroutines.CoroutineExceptionHandler
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.flow.MutableStateFlow
+import kotlinx.coroutines.flow.StateFlow
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
+import java.io.IOException
+
+class EntrySelectionViewModel(application: Application): CredentialLauncherViewModel(application) {
+
+    private var searchShareForMagikeyboard: Boolean = false
+    private var mLockDatabaseAfterSelection: Boolean = false
+    private val mUiState = MutableStateFlow<UIState>(UIState.Loading)
+    val uiState: StateFlow<UIState> = mUiState
+
+    fun initialize() {
+        searchShareForMagikeyboard = getApplication<Application>().isKeyboardActivatedInSettings()
+        mLockDatabaseAfterSelection = false // TODO Close database after selection
+    }
+
+    override fun launchActionIfNeeded(
+        intent: Intent,
+        specialMode: SpecialMode,
+        database: ContextualDatabase?
+    ) {
+        // Launch with database when a nodeId is present
+        if ((database != null && database.loaded) || intent.retrieveNodeId() == null) {
+            super.launchActionIfNeeded(intent, specialMode, database)
+        }
+    }
+
+    override suspend fun launchAction(
+        intent: Intent,
+        specialMode: SpecialMode,
+        database: ContextualDatabase?
+    ) {
+        val searchInfo: SearchInfo? = intent.retrieveSearchInfo()
+        if (searchInfo != null) {
+            launch(database, searchInfo)
+        } else {
+            // To manage share
+            var sharedWebDomain: String? = null
+            var otpString: String? = null
+
+            when (intent.action) {
+                Intent.ACTION_SEND -> {
+                    if ("text/plain" == intent.type) {
+                        // Retrieve web domain or OTP
+                        intent.getStringExtra(Intent.EXTRA_TEXT)?.let { extra ->
+                            if (OtpEntryFields.isOTPUri(extra))
+                                otpString = extra
+                            else
+                                sharedWebDomain = extra.toUri().host
+                        }
+                    }
+                    launchSelection(database, sharedWebDomain, otpString)
+                }
+                Intent.ACTION_VIEW -> {
+                    // Retrieve OTP
+                    intent.dataString?.let { extra ->
+                        if (OtpEntryFields.isOTPUri(extra))
+                            otpString = extra
+                    }
+                    launchSelection(database, null, otpString)
+                }
+                else -> {
+                    if (database != null && database.loaded) {
+                        mUiState.value = UIState.LaunchGroupActivityForSearch(
+                            database = database,
+                            searchInfo = SearchInfo()
+                        )
+                    } else {
+                        mUiState.value = UIState.LaunchFileDatabaseSelectForSearch(
+                            searchInfo = SearchInfo()
+                        )
+                    }
+                }
+            }
+        }
+    }
+
+    // -------------
+    //  Selection
+    // -------------
+
+    private fun launchSelection(
+        database: ContextualDatabase?,
+        sharedWebDomain: String?,
+        otpString: String?
+    ) {
+        // Build domain search param
+        val searchInfo = SearchInfo().apply {
+            this.webDomain = sharedWebDomain
+            this.otpString = otpString
+        }
+        launch(database, searchInfo)
+    }
+
+    private fun launch(
+        database: ContextualDatabase?,
+        searchInfo: SearchInfo
+    ) {
+        // If database is open
+        val readOnly = database?.isReadOnly != false
+        SearchHelper.checkAutoSearchInfo(
+            context = getApplication(),
+            database = database,
+            searchInfo = searchInfo,
+            onItemsFound = { openedDatabase, items ->
+                // Items found
+                if (searchInfo.otpString != null) {
+                    if (!readOnly) {
+                        mCredentialUiState.value =
+                            CredentialState.LaunchGroupActivityForRegistration(
+                                database = openedDatabase,
+                                registerInfo = searchInfo.toRegisterInfo(),
+                                typeMode = TypeMode.DEFAULT
+                            )
+                    } else {
+                        mCredentialUiState.value = CredentialState.ShowError(
+                            RegisterInReadOnlyDatabaseException()
+                        )
+                    }
+                } else if (searchShareForMagikeyboard) {
+                    MagikeyboardService.performSelection(
+                        items,
+                        { entryInfo ->
+                            populateKeyboard(entryInfo)
+                        },
+                        { autoSearch ->
+                            mCredentialUiState.value = CredentialState.LaunchGroupActivityForSelection(
+                                database = openedDatabase,
+                                searchInfo = searchInfo,
+                                typeMode = TypeMode.MAGIKEYBOARD
+                            )
+                        }
+                    )
+                } else {
+                    mUiState.value = UIState.LaunchGroupActivityForSearch(
+                        database = openedDatabase,
+                        searchInfo = searchInfo
+                    )
+                }
+            },
+            onItemNotFound = { openedDatabase ->
+                // Show the database UI to select the entry
+                if (searchInfo.otpString != null) {
+                    if (!readOnly) {
+                        mCredentialUiState.value =
+                            CredentialState.LaunchGroupActivityForRegistration(
+                                database = openedDatabase,
+                                registerInfo = searchInfo.toRegisterInfo(),
+                                typeMode = TypeMode.DEFAULT
+                            )
+                    } else {
+                        mCredentialUiState.value = CredentialState.ShowError(
+                            RegisterInReadOnlyDatabaseException()
+                        )
+                    }
+                } else if (searchShareForMagikeyboard) {
+                    mCredentialUiState.value = CredentialState.LaunchGroupActivityForSelection(
+                        database = openedDatabase,
+                        searchInfo = searchInfo,
+                        typeMode = TypeMode.MAGIKEYBOARD
+                    )
+                } else {
+                    mUiState.value = UIState.LaunchGroupActivityForSearch(
+                        database = openedDatabase,
+                        searchInfo = searchInfo
+                    )
+                }
+            },
+            onDatabaseClosed = {
+                // If database not open
+                if (searchInfo.otpString != null) {
+                    mCredentialUiState.value = CredentialState.LaunchFileDatabaseSelectActivityForRegistration(
+                        registerInfo = searchInfo.toRegisterInfo(),
+                        typeMode = TypeMode.DEFAULT
+                    )
+                } else if (searchShareForMagikeyboard) {
+                    mCredentialUiState.value = CredentialState.LaunchFileDatabaseSelectActivityForSelection(
+                        searchInfo = searchInfo,
+                        typeMode = TypeMode.MAGIKEYBOARD
+                    )
+                } else {
+                    mUiState.value = UIState.LaunchFileDatabaseSelectForSearch(
+                        searchInfo = searchInfo
+                    )
+                }
+            }
+        )
+    }
+
+    private fun populateKeyboard(entryInfo: EntryInfo) {
+        // Automatically populate keyboard
+        mUiState.value = UIState.PopulateKeyboard(entryInfo)
+        setResult(Intent(), lockDatabase = mLockDatabaseAfterSelection)
+    }
+
+    override fun manageSelectionResult(
+        database: ContextualDatabase,
+        activityResult: ActivityResult
+    ) {
+        super.manageSelectionResult(database, activityResult)
+        val intent = activityResult.data
+        viewModelScope.launch(CoroutineExceptionHandler { _, e ->
+            Log.e(TAG, "Unable to create selection response for Magikeyboard", e)
+            showError(e)
+        }) {
+            when (activityResult.resultCode) {
+                RESULT_OK -> {
+                    withContext(Dispatchers.IO) {
+                        Log.d(TAG, "Magikeyboard selection result")
+                        if (intent == null)
+                            throw IOException("Intent is null")
+                        val entries = intent.retrieveAndRemoveEntries(database)
+                        withContext(Dispatchers.Main) {
+                            // Populate Magikeyboard with entry
+                            entries.firstOrNull()?.let { entryInfo ->
+                                populateKeyboard(entryInfo)
+                            } // TODO Manage multiple entries in Magikeyboard
+                        }
+                    }
+                }
+                RESULT_CANCELED -> {
+                    withContext(Dispatchers.Main) {
+                        cancelResult()
+                    }
+                }
+            }
+        }
+    }
+
+    override fun manageRegistrationResult(activityResult: ActivityResult) {
+        super.manageRegistrationResult(activityResult)
+        viewModelScope.launch(CoroutineExceptionHandler { _, e ->
+            Log.e(TAG, "Unable to create selection response for Magikeyboard", e)
+            showError(e)
+        }) {
+            when (activityResult.resultCode) {
+                RESULT_OK -> {
+                    // Empty data result
+                    // TODO Show Toast indicating value is saved
+                    withContext(Dispatchers.Main) {
+                        setResult(Intent(), lockDatabase = false)
+                    }
+                }
+                RESULT_CANCELED -> {
+                    withContext(Dispatchers.Main) {
+                        cancelResult()
+                    }
+                }
+            }
+        }
+    }
+
+    sealed class UIState {
+        object Loading: UIState()
+        data class PopulateKeyboard(
+            val entryInfo: EntryInfo
+        ): UIState()
+        data class LaunchFileDatabaseSelectForSearch(
+            val searchInfo: SearchInfo
+        ): UIState()
+        data class LaunchGroupActivityForSearch(
+            val database: ContextualDatabase,
+            val searchInfo: SearchInfo
+        ): UIState()
+    }
+
+    companion object {
+        private val TAG = EntrySelectionViewModel::class.java.name
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/viewmodel/HardwareKeyLauncherViewModel.kt

@@ -0,0 +1,147 @@
+package com.kunzisoft.keepass.credentialprovider.viewmodel
+
+import android.app.Activity.RESULT_OK
+import android.app.Application
+import android.content.Context
+import android.content.Intent
+import android.util.Log
+import androidx.activity.result.ActivityResult
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.activity.HardwareKeyActivity.Companion.isHardwareKeyAvailable
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.hardware.HardwareKey
+import kotlinx.coroutines.flow.MutableStateFlow
+import kotlinx.coroutines.flow.StateFlow
+
+class HardwareKeyLauncherViewModel(application: Application): CredentialLauncherViewModel(application) {
+
+    private val mUiState = MutableStateFlow<UIState>(UIState.Loading)
+    val uiState: StateFlow<UIState> = mUiState
+
+    override suspend fun launchAction(
+        intent: Intent,
+        specialMode: SpecialMode,
+        database: ContextualDatabase?
+    ) {
+        val hardwareKey = HardwareKey.Companion.getHardwareKeyFromString(
+            intent.getStringExtra(DATA_HARDWARE_KEY)
+        )
+        if (isHardwareKeyAvailable(getApplication(), hardwareKey)) {
+            when (hardwareKey) {
+                /*
+                HardwareKey.FIDO2_SECRET -> {
+                    // TODO FIDO2 under development
+                    throw Exception("FIDO2 not implemented")
+                }
+                */
+                HardwareKey.CHALLENGE_RESPONSE_YUBIKEY -> {
+                    launchYubikeyChallengeForResponse(intent.getByteArrayExtra(DATA_SEED))
+                }
+                else -> {
+                    UIState.OnChallengeResponded(null)
+                }
+            }
+        } else {
+            mUiState.value = UIState.ShowHardwareKeyDriverNeeded(hardwareKey)
+        }
+    }
+
+    private fun launchYubikeyChallengeForResponse(seed: ByteArray?) {
+        // Transform the seed before sending
+        var challenge: ByteArray? = null
+        if (seed != null) {
+            challenge = ByteArray(64)
+            seed.copyInto(challenge, 0, 0, 32)
+            challenge.fill(32, 32, 64)
+        }
+        mUiState.value = UIState.LaunchChallengeActivityForResponse(challenge)
+        Log.d(TAG, "Challenge sent")
+    }
+
+    override fun manageSelectionResult(
+        database: ContextualDatabase,
+        activityResult: ActivityResult
+    ) {
+        super.manageSelectionResult(database, activityResult)
+
+        if (activityResult.resultCode == RESULT_OK) {
+            val challengeResponse: ByteArray? =
+                activityResult.data?.getByteArrayExtra(HARDWARE_KEY_RESPONSE_KEY)
+            Log.d(TAG, "Response form challenge")
+            mUiState.value = UIState.OnChallengeResponded(challengeResponse)
+        } else {
+            Log.e(TAG, "Response from challenge error")
+            mUiState.value = UIState.OnChallengeResponded(null)
+        }
+    }
+
+    sealed class UIState {
+        object Loading : UIState()
+        data class ShowHardwareKeyDriverNeeded(
+            val hardwareKey: HardwareKey?
+        ): UIState()
+        data class LaunchChallengeActivityForResponse(
+            val challenge: ByteArray?,
+        ): UIState() {
+            override fun equals(other: Any?): Boolean {
+                if (this === other) return true
+                if (javaClass != other?.javaClass) return false
+
+                other as LaunchChallengeActivityForResponse
+
+                return challenge.contentEquals(other.challenge)
+            }
+
+            override fun hashCode(): Int {
+                return challenge?.contentHashCode() ?: 0
+            }
+        }
+        data class OnChallengeResponded(
+            val response: ByteArray?
+        ): UIState() {
+            override fun equals(other: Any?): Boolean {
+                if (this === other) return true
+                if (javaClass != other?.javaClass) return false
+
+                other as OnChallengeResponded
+
+                return response.contentEquals(other.response)
+            }
+
+            override fun hashCode(): Int {
+                return response?.contentHashCode() ?: 0
+            }
+        }
+    }
+
+    companion object {
+        private val TAG = HardwareKeyLauncherViewModel::class.java.name
+
+        private const val DATA_HARDWARE_KEY = "DATA_HARDWARE_KEY"
+        private const val DATA_SEED = "DATA_SEED"
+
+        // Driver call
+        private const val YUBIKEY_CHALLENGE_RESPONSE_INTENT = "android.yubikey.intent.action.CHALLENGE_RESPONSE"
+        private const val HARDWARE_KEY_CHALLENGE_KEY = "challenge"
+        private const val HARDWARE_KEY_RESPONSE_KEY = "response"
+
+        fun isYubikeyDriverAvailable(context: Context): Boolean {
+            return Intent(YUBIKEY_CHALLENGE_RESPONSE_INTENT)
+                .resolveActivity(context.packageManager) != null
+        }
+
+        fun buildHardwareKeyChallenge(challenge: ByteArray?): Intent {
+            return Intent(YUBIKEY_CHALLENGE_RESPONSE_INTENT).apply {
+                putExtra(HARDWARE_KEY_CHALLENGE_KEY, challenge)
+            }
+        }
+
+        fun Intent.addHardwareKey(hardwareKey: HardwareKey) {
+            putExtra(DATA_HARDWARE_KEY, hardwareKey.value)
+        }
+
+        fun Intent.addSeed(seed: ByteArray?) {
+            putExtra(DATA_SEED, seed)
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/viewmodel/PasskeyLauncherViewModel.kt

@@ -11,8 +11,11 @@ import androidx.annotation.RequiresApi
 import androidx.credentials.GetCredentialResponse
 import androidx.credentials.exceptions.GetCredentialUnknownException
 import androidx.credentials.provider.PendingIntentHandler
-import androidx.lifecycle.AndroidViewModel
 import androidx.lifecycle.viewModelScope
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.removeInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.removeNodeId
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveNodeId
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSearchInfo
 import com.kunzisoft.keepass.credentialprovider.SpecialMode
 import com.kunzisoft.keepass.credentialprovider.TypeMode
 import com.kunzisoft.keepass.credentialprovider.passkey.data.AndroidPrivilegedApp
@@ -25,11 +28,9 @@ import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.getVe
 import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.removeAppOrigin
 import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.removePasskey
 import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.retrieveAppOrigin
-import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.retrieveNodeId
 import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.retrievePasskey
 import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.retrievePasskeyCreationRequestParameters
 import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.retrievePasskeyUsageRequestParameters
-import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.retrieveSearchInfo
 import com.kunzisoft.keepass.credentialprovider.passkey.util.PrivilegedAllowLists
 import com.kunzisoft.keepass.credentialprovider.passkey.util.PrivilegedAllowLists.saveCustomPrivilegedApps
 import com.kunzisoft.keepass.database.ContextualDatabase
@@ -56,22 +57,21 @@ import java.io.InvalidObjectException
 import java.util.UUID
 
 @RequiresApi(Build.VERSION_CODES.UPSIDE_DOWN_CAKE)
-class PasskeyLauncherViewModel(application: Application): AndroidViewModel(application) {
+class PasskeyLauncherViewModel(application: Application): CredentialLauncherViewModel(application) {
 
     private var mUsageParameters: PublicKeyCredentialUsageParameters? = null
     private var mCreationParameters: PublicKeyCredentialCreationParameters? = null
     private var mPasskey: Passkey? = null
 
+    private var mLockDatabaseAfterSelection: Boolean = false
     private var mBackupEligibility: Boolean = true
     private var mBackupState: Boolean = false
-    private var mLockDatabase: Boolean = true
 
-    private var isResultLauncherRegistered: Boolean = false
-
-    private val _uiState = MutableStateFlow<UIState>(UIState.Loading)
-    val uiState: StateFlow<UIState> = _uiState
+    private val mUiState = MutableStateFlow<UIState>(UIState.Loading)
+    val uiState: StateFlow<UIState> = mUiState
 
     fun initialize() {
+        mLockDatabaseAfterSelection = PreferencesUtil.isPasskeyCloseDatabaseEnable(getApplication())
         mBackupEligibility = PreferencesUtil.isPasskeyBackupEligibilityEnable(getApplication())
         mBackupState = PreferencesUtil.isPasskeyBackupStateEnable(getApplication())
     }
@@ -79,19 +79,14 @@ class PasskeyLauncherViewModel(application: Application): AndroidViewModel(appli
     fun showAppPrivilegedDialog(
         temptingApp: AndroidPrivilegedApp
     ) {
-        _uiState.value = UIState.ShowAppPrivilegedDialog(temptingApp)
+        mUiState.value = UIState.ShowAppPrivilegedDialog(temptingApp)
     }
 
     fun showAppSignatureDialog(
         temptingApp: AppOrigin,
         nodeId: UUID
     ) {
-        _uiState.value = UIState.ShowAppSignatureDialog(temptingApp, nodeId)
-    }
-
-    fun showError(error: Throwable) {
-        Log.e(TAG, "Error on passkey launch", error)
-        _uiState.value = UIState.ShowError(error)
+        mUiState.value = UIState.ShowAppSignatureDialog(temptingApp, nodeId)
     }
 
     fun saveCustomPrivilegedApp(
@@ -107,7 +102,7 @@ class PasskeyLauncherViewModel(application: Application): AndroidViewModel(appli
                 context = getApplication(),
                 privilegedApps = listOf(temptingApp)
             )
-            launchPasskeyAction(
+            launchAction(
                 intent = intent,
                 specialMode = specialMode,
                 database = database
@@ -139,54 +134,33 @@ class PasskeyLauncherViewModel(application: Application): AndroidViewModel(appli
             )
             entryInfo.saveAppOrigin(database, temptingApp)
             newEntry.setEntryInfo(database, entryInfo)
-            _uiState.value = UIState.UpdateEntry(
+            mUiState.value = UIState.UpdateEntry(
                 oldEntry = entry,
                 newEntry = newEntry
             )
         }
     }
 
-    fun setResult(intent: Intent) {
-        // Remove the launcher register
-        isResultLauncherRegistered = false
-        _uiState.value = UIState.SetActivityResult(
-            lockDatabase = mLockDatabase,
-            resultCode = RESULT_OK,
-            data = intent
-        )
+    override fun onExceptionOccurred(e: Throwable) {
+        if (e is PrivilegedAllowLists.PrivilegedException) {
+            showAppPrivilegedDialog(e.temptingApp)
+        } else {
+            super.onExceptionOccurred(e)
+        }
     }
 
-    fun cancelResult() {
-        isResultLauncherRegistered = false
-        _uiState.value = UIState.SetActivityResult(
-            lockDatabase = mLockDatabase,
-            resultCode = RESULT_CANCELED
-        )
-    }
-
-    fun launchPasskeyActionIfNeeded(
+    override fun launchActionIfNeeded(
         intent: Intent,
         specialMode: SpecialMode,
         database: ContextualDatabase?
     ) {
-        if (isResultLauncherRegistered.not()) {
-            isResultLauncherRegistered = true
-            viewModelScope.launch(CoroutineExceptionHandler { _, e ->
-                if (e is PrivilegedAllowLists.PrivilegedException) {
-                    showAppPrivilegedDialog(e.temptingApp)
-                } else {
-                    showError(e)
-                }
-            }) {
-                launchPasskeyAction(intent, specialMode, database)
-            }
+        // Launch with database when a nodeId is present
+        if ((database != null && database.loaded) || intent.retrieveNodeId() == null) {
+            super.launchActionIfNeeded(intent, specialMode, database)
         }
     }
 
-    /**
-     * Launch the main action to manage Passkey
-     */
-    private suspend fun launchPasskeyAction(
+    override suspend fun launchAction(
         intent: Intent,
         specialMode: SpecialMode,
         database: ContextualDatabase?
@@ -194,6 +168,9 @@ class PasskeyLauncherViewModel(application: Application): AndroidViewModel(appli
         val searchInfo = intent.retrieveSearchInfo() ?: SearchInfo()
         val appOrigin = intent.retrieveAppOrigin() ?: AppOrigin(verified = false)
         val nodeId = intent.retrieveNodeId()
+        intent.removeInfo()
+        intent.removeAppOrigin()
+        intent.removeNodeId()
         checkSecurity(intent, nodeId)
         when (specialMode) {
             SpecialMode.SELECTION -> {
@@ -260,15 +237,19 @@ class PasskeyLauncherViewModel(application: Application): AndroidViewModel(appli
                                 TAG, "No Passkey found for selection," +
                                         "launch manual selection in opened database"
                             )
-                            _uiState.value = UIState.LaunchGroupActivityForSelection(
-                                database = openedDatabase
-                            )
+                            mCredentialUiState.value =
+                                CredentialState.LaunchGroupActivityForSelection(
+                                    database = openedDatabase,
+                                    searchInfo = searchInfo,
+                                    typeMode = TypeMode.PASSKEY
+                                )
                         },
                         onDatabaseClosed = {
                             Log.d(TAG, "Manual passkey selection in closed database")
-                            _uiState.value =
-                                UIState.LaunchFileDatabaseSelectActivityForSelection(
-                                    searchInfo = searchInfo
+                            mCredentialUiState.value =
+                                CredentialState.LaunchFileDatabaseSelectActivityForSelection(
+                                    searchInfo = searchInfo,
+                                    typeMode = TypeMode.PASSKEY
                                 )
                         }
                     )
@@ -326,12 +307,12 @@ class PasskeyLauncherViewModel(application: Application): AndroidViewModel(appli
                                     appOrigin = appOrigin
                                 ),
                                 passkey = passkey,
-                                backupEligibility = mBackupEligibility,
-                                backupState = mBackupState
+                                defaultBackupEligibility = mBackupEligibility,
+                                defaultBackupState = mBackupState
                             )
                         )
                     )
-                    setResult(result)
+                    setResult(result, lockDatabase = mLockDatabaseAfterSelection)
                 } catch (e: SignatureNotFoundException) {
                     // Request the dialog if signature exception
                     showAppSignatureDialog(e.temptingApp, nodeId)
@@ -340,9 +321,11 @@ class PasskeyLauncherViewModel(application: Application): AndroidViewModel(appli
         }
     }
 
-    fun manageSelectionResult(
+    override fun manageSelectionResult(
+        database: ContextualDatabase,
         activityResult: ActivityResult
     ) {
+        super.manageSelectionResult(database, activityResult)
         val intent = activityResult.data
         viewModelScope.launch(CoroutineExceptionHandler { _, e ->
             Log.e(TAG, "Unable to create selection response for passkey", e)
@@ -380,8 +363,8 @@ class PasskeyLauncherViewModel(application: Application): AndroidViewModel(appli
                                             appOrigin = appOrigin
                                         ),
                                         passkey = passkey,
-                                        backupEligibility = mBackupEligibility,
-                                        backupState = mBackupState
+                                        defaultBackupEligibility = mBackupEligibility,
+                                        defaultBackupState = mBackupState
                                     )
                                 )
                             )
@@ -389,7 +372,7 @@ class PasskeyLauncherViewModel(application: Application): AndroidViewModel(appli
                             throw IOException("Usage parameters is null")
                         }
                         withContext(Dispatchers.Main) {
-                            setResult(responseIntent)
+                            setResult(responseIntent, lockDatabase = mLockDatabaseAfterSelection)
                         }
                     }
                 }
@@ -417,6 +400,8 @@ class PasskeyLauncherViewModel(application: Application): AndroidViewModel(appli
             retrievePasskeyCreationRequestParameters(
                 intent = intent,
                 context = getApplication(),
+                defaultBackupEligibility = mBackupEligibility,
+                defaultBackupState = mBackupState,
                 passkeyCreated = { passkey, appInfoToStore, publicKeyCredentialParameters ->
                     // Save the requested parameters
                     mPasskey = passkey
@@ -440,24 +425,26 @@ class PasskeyLauncherViewModel(application: Application): AndroidViewModel(appli
                                     TAG, "Passkey found for registration, " +
                                             "but launch manual registration for a new entry"
                                 )
-                                _uiState.value = UIState.LaunchGroupActivityForRegistration(
-                                    database = openedDatabase,
-                                    registerInfo = registerInfo,
-                                    typeMode = TypeMode.PASSKEY
-                                )
+                                mCredentialUiState.value =
+                                    CredentialState.LaunchGroupActivityForRegistration(
+                                        database = openedDatabase,
+                                        registerInfo = registerInfo,
+                                        typeMode = TypeMode.PASSKEY
+                                    )
                             },
                             onItemNotFound = { openedDatabase ->
                                 Log.d(TAG, "Launch new manual registration in opened database")
-                                _uiState.value = UIState.LaunchGroupActivityForRegistration(
-                                    database = openedDatabase,
-                                    registerInfo = registerInfo,
-                                    typeMode = TypeMode.PASSKEY
-                                )
+                                mCredentialUiState.value =
+                                    CredentialState.LaunchGroupActivityForRegistration(
+                                        database = openedDatabase,
+                                        registerInfo = registerInfo,
+                                        typeMode = TypeMode.PASSKEY
+                                    )
                             },
                             onDatabaseClosed = {
                                 Log.d(TAG, "Manual passkey registration in closed database")
-                                _uiState.value =
-                                    UIState.LaunchFileDatabaseSelectActivityForRegistration(
+                                mCredentialUiState.value =
+                                    CredentialState.LaunchFileDatabaseSelectActivityForRegistration(
                                         registerInfo = registerInfo,
                                         typeMode = TypeMode.PASSKEY
                                     )
@@ -490,7 +477,7 @@ class PasskeyLauncherViewModel(application: Application): AndroidViewModel(appli
         }
     }
 
-    fun manageRegistrationResult(activityResult: ActivityResult) {
+    override fun manageRegistrationResult(activityResult: ActivityResult) {
         val intent = activityResult.data
         viewModelScope.launch(CoroutineExceptionHandler { _, e ->
             Log.e(TAG, "Unable to create registration response for passkey", e)
@@ -518,8 +505,10 @@ class PasskeyLauncherViewModel(application: Application): AndroidViewModel(appli
                                     intent = responseIntent,
                                     response = buildCreatePublicKeyCredentialResponse(
                                         publicKeyCredentialCreationParameters = it,
-                                        backupEligibility = mBackupEligibility,
-                                        backupState = mBackupState
+                                        backupEligibility = passkey?.backupEligibility
+                                            ?: mBackupEligibility,
+                                        backupState = passkey?.backupState
+                                            ?: mBackupState
                                     )
                                 )
                             }
@@ -549,29 +538,6 @@ class PasskeyLauncherViewModel(application: Application): AndroidViewModel(appli
             val temptingApp: AppOrigin,
             val nodeId: UUID
         ): UIState()
-        data class LaunchGroupActivityForSelection(
-            val database: ContextualDatabase
-        ): UIState()
-        data class LaunchGroupActivityForRegistration(
-            val database: ContextualDatabase,
-            val registerInfo: RegisterInfo,
-            val typeMode: TypeMode
-        ): UIState()
-        data class LaunchFileDatabaseSelectActivityForSelection(
-            val searchInfo: SearchInfo
-        ): UIState()
-        data class LaunchFileDatabaseSelectActivityForRegistration(
-            val registerInfo: RegisterInfo,
-            val typeMode: TypeMode
-        ): UIState()
-        data class SetActivityResult(
-            val lockDatabase: Boolean,
-            val resultCode: Int,
-            val data: Intent? = null
-        ): UIState()
-        data class ShowError(
-            val error: Throwable
-        ): UIState()
         data class UpdateEntry(
             val oldEntry: Entry,
             val newEntry: Entry

app/src/main/java/com/kunzisoft/keepass/database/DatabaseTaskProvider.kt

@@ -19,7 +19,6 @@
  */
 package com.kunzisoft.keepass.database
 
-import android.Manifest
 import android.content.BroadcastReceiver
 import android.content.ComponentName
 import android.content.Context
@@ -29,23 +28,15 @@ import android.content.Context.BIND_IMPORTANT
 import android.content.Intent
 import android.content.IntentFilter
 import android.content.ServiceConnection
-import android.content.pm.PackageManager
 import android.net.Uri
-import android.os.Build
 import android.os.Bundle
 import android.os.IBinder
 import android.util.Log
 import android.widget.Toast
-import androidx.activity.result.contract.ActivityResultContracts
 import androidx.appcompat.app.AlertDialog
-import androidx.core.app.ActivityCompat.shouldShowRequestPermissionRationale
 import androidx.core.content.ContextCompat
 import androidx.core.content.ContextCompat.RECEIVER_NOT_EXPORTED
-import androidx.fragment.app.FragmentActivity
-import androidx.lifecycle.lifecycleScope
 import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.activities.dialogs.DatabaseChangedDialogFragment
-import com.kunzisoft.keepass.activities.dialogs.DatabaseChangedDialogFragment.Companion.DATABASE_CHANGED_DIALOG_TAG
 import com.kunzisoft.keepass.database.crypto.EncryptionAlgorithm
 import com.kunzisoft.keepass.database.crypto.kdf.KdfEngine
 import com.kunzisoft.keepass.database.element.Entry
@@ -55,7 +46,6 @@ import com.kunzisoft.keepass.database.element.node.Node
 import com.kunzisoft.keepass.database.element.node.NodeId
 import com.kunzisoft.keepass.database.element.node.Type
 import com.kunzisoft.keepass.model.CipherEncryptDatabase
-import com.kunzisoft.keepass.model.SnapFileDatabaseInfo
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_CHALLENGE_RESPONDED
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_ASSIGN_CREDENTIAL_TASK
@@ -89,13 +79,9 @@ import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_UPDATE_RECYCLE_BIN_TASK
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_UPDATE_TEMPLATES_GROUP_TASK
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.getBundleFromListNodes
-import com.kunzisoft.keepass.tasks.ActionRunnable
-import com.kunzisoft.keepass.tasks.ProgressTaskDialogFragment
-import com.kunzisoft.keepass.tasks.ProgressTaskDialogFragment.Companion.PROGRESS_TASK_DIALOG_TAG
 import com.kunzisoft.keepass.utils.DATABASE_START_TASK_ACTION
 import com.kunzisoft.keepass.utils.DATABASE_STOP_TASK_ACTION
 import com.kunzisoft.keepass.utils.putParcelableList
-import kotlinx.coroutines.launch
 import java.util.UUID
 
 /**
@@ -103,121 +89,29 @@ import java.util.UUID
  * Useful to retrieve a database instance and sending tasks commands
  */
 class DatabaseTaskProvider(
-    private var context: Context,
-    private var showDialog: Boolean = true
+    private var context: Context
 ) {
 
-    // To show dialog only if context is an activity
-    private var activity: FragmentActivity? = try {
-        context as? FragmentActivity?
-    } catch (_: Exception) {
-        null
-    }
-
     var onDatabaseRetrieved: ((database: ContextualDatabase?) -> Unit)? = null
 
-    var onActionFinish: ((
-        database: ContextualDatabase,
-        actionTask: String,
-        result: ActionRunnable.Result
-    ) -> Unit)? = null
-
-    private var intentDatabaseTask: Intent = Intent(
-        context.applicationContext,
-        DatabaseTaskNotificationService::class.java
-    )
+    var onStartActionRequested: ((bundle: Bundle?, actionTask: String) -> Unit)? = null
+    var actionTaskListener: DatabaseTaskNotificationService.ActionTaskListener? = null
+    var databaseInfoListener: DatabaseTaskNotificationService.DatabaseInfoListener? = null
 
     private var databaseTaskBroadcastReceiver: BroadcastReceiver? = null
     private var mBinder: DatabaseTaskNotificationService.ActionTaskBinder? = null
 
     private var serviceConnection: ServiceConnection? = null
 
-    private var progressTaskDialogFragment: ProgressTaskDialogFragment? = null
-    private var databaseChangedDialogFragment: DatabaseChangedDialogFragment? = null
-
     fun destroy() {
-        this.activity = null
         this.onDatabaseRetrieved = null
-        this.onActionFinish = null
         this.databaseTaskBroadcastReceiver = null
         this.mBinder = null
         this.serviceConnection = null
-        this.progressTaskDialogFragment = null
-        this.databaseChangedDialogFragment = null
     }
 
-    private val actionTaskListener = object : DatabaseTaskNotificationService.ActionTaskListener {
-        override fun onActionStarted(
-            database: ContextualDatabase,
-            progressMessage: ProgressMessage
-        ) {
-            if (showDialog)
-                startDialog(progressMessage)
-        }
-
-        override fun onActionUpdated(
-            database: ContextualDatabase,
-            progressMessage: ProgressMessage
-        ) {
-            if (showDialog)
-                updateDialog(progressMessage)
-        }
-
-        override fun onActionStopped(
-            database: ContextualDatabase
-        ) {
-            // Remove the progress task
-            stopDialog()
-        }
-
-        override fun onActionFinished(
-            database: ContextualDatabase,
-            actionTask: String,
-            result: ActionRunnable.Result
-        ) {
-            onActionFinish?.invoke(database, actionTask, result)
-            onActionStopped(database)
-        }
-    }
-
-    private val mActionDatabaseListener =
-        object : DatabaseChangedDialogFragment.ActionDatabaseChangedListener {
-            override fun validateDatabaseChanged() {
-                mBinder?.getService()?.saveDatabaseInfo()
-            }
-        }
-
-    private var databaseInfoListener = object :
-        DatabaseTaskNotificationService.DatabaseInfoListener {
-        override fun onDatabaseInfoChanged(
-            previousDatabaseInfo: SnapFileDatabaseInfo,
-            newDatabaseInfo: SnapFileDatabaseInfo,
-            readOnlyDatabase: Boolean
-        ) {
-            activity?.let { activity ->
-                activity.lifecycleScope.launch {
-                    if (databaseChangedDialogFragment == null) {
-                        databaseChangedDialogFragment = activity.supportFragmentManager
-                            .findFragmentByTag(DATABASE_CHANGED_DIALOG_TAG) as DatabaseChangedDialogFragment?
-                        databaseChangedDialogFragment?.actionDatabaseListener =
-                            mActionDatabaseListener
-                    }
-                    if (progressTaskDialogFragment == null) {
-                        databaseChangedDialogFragment = DatabaseChangedDialogFragment.getInstance(
-                            previousDatabaseInfo,
-                            newDatabaseInfo,
-                            readOnlyDatabase
-                        )
-                        databaseChangedDialogFragment?.actionDatabaseListener =
-                            mActionDatabaseListener
-                        databaseChangedDialogFragment?.show(
-                            activity.supportFragmentManager,
-                            DATABASE_CHANGED_DIALOG_TAG
-                        )
-                    }
-                }
-            }
-        }
+    fun onDatabaseChangeValidated() {
+        mBinder?.getService()?.saveDatabaseInfo()
     }
 
     private var databaseListener = object : DatabaseTaskNotificationService.DatabaseListener {
@@ -226,48 +120,18 @@ class DatabaseTaskProvider(
         }
     }
 
-    private fun startDialog(progressMessage: ProgressMessage) {
-        activity?.let { activity ->
-            activity.lifecycleScope.launch {
-                if (progressTaskDialogFragment == null) {
-                    progressTaskDialogFragment = activity.supportFragmentManager
-                        .findFragmentByTag(PROGRESS_TASK_DIALOG_TAG) as ProgressTaskDialogFragment?
-                }
-                if (progressTaskDialogFragment == null) {
-                    progressTaskDialogFragment = ProgressTaskDialogFragment()
-                    progressTaskDialogFragment?.show(
-                        activity.supportFragmentManager,
-                        PROGRESS_TASK_DIALOG_TAG
-                    )
-                }
-                updateDialog(progressMessage)
-            }
-        }
-    }
-
-    private fun updateDialog(progressMessage: ProgressMessage) {
-        progressTaskDialogFragment?.apply {
-            updateTitle(progressMessage.titleId)
-            updateMessage(progressMessage.messageId)
-            updateWarning(progressMessage.warningId)
-            setCancellable(progressMessage.cancelable)
-        }
-    }
-
-    private fun stopDialog() {
-        progressTaskDialogFragment?.dismissAllowingStateLoss()
-        progressTaskDialogFragment = null
-    }
-
     private fun initServiceConnection() {
+        actionTaskListener?.onActionStopped()
         if (serviceConnection == null) {
             serviceConnection = object : ServiceConnection {
                 override fun onBindingDied(name: ComponentName?) {
-                    stopDialog()
+                    actionTaskListener?.onActionStopped()
+                    onDatabaseRetrieved?.invoke(null)
                 }
 
                 override fun onNullBinding(name: ComponentName?) {
-                    stopDialog()
+                    actionTaskListener?.onActionStopped()
+                    onDatabaseRetrieved?.invoke(null)
                 }
 
                 override fun onServiceConnected(name: ComponentName?, serviceBinder: IBinder?) {
@@ -290,21 +154,33 @@ class DatabaseTaskProvider(
 
     private fun addServiceListeners(service: DatabaseTaskNotificationService.ActionTaskBinder?) {
         service?.addDatabaseListener(databaseListener)
-        service?.addDatabaseFileInfoListener(databaseInfoListener)
-        service?.addActionTaskListener(actionTaskListener)
+        databaseInfoListener?.let { infoListener ->
+            service?.addDatabaseFileInfoListener(infoListener)
+        }
+        actionTaskListener?.let { taskListener ->
+            service?.addActionTaskListener(taskListener)
+        }
     }
 
     private fun removeServiceListeners(service: DatabaseTaskNotificationService.ActionTaskBinder?) {
-        service?.removeActionTaskListener(actionTaskListener)
-        service?.removeDatabaseFileInfoListener(databaseInfoListener)
+        actionTaskListener?.let { taskListener ->
+            service?.removeActionTaskListener(taskListener)
+        }
+        databaseInfoListener?.let { infoListener ->
+            service?.removeDatabaseFileInfoListener(infoListener)
+        }
         service?.removeDatabaseListener(databaseListener)
+        onDatabaseRetrieved?.invoke(null)
     }
 
     private fun bindService() {
         initServiceConnection()
         serviceConnection?.let {
             context.bindService(
-                intentDatabaseTask,
+                Intent(
+                    context.applicationContext,
+                    DatabaseTaskNotificationService::class.java
+                ),
                 it,
                 BIND_AUTO_CREATE or BIND_IMPORTANT or BIND_ABOVE_CLIENT
             )
@@ -368,58 +244,9 @@ class DatabaseTaskProvider(
         }
     }
 
-    private val tempServiceParameters = mutableListOf<Pair<Bundle?, String>>()
-    private val requestPermissionLauncher = activity?.registerForActivityResult(
-        ActivityResultContracts.RequestPermission()
-    ) { _ ->
-        // Whether or not the user has accepted, the service can be started,
-        // There just won't be any notification if it's not allowed.
-        tempServiceParameters.removeFirstOrNull()?.let {
-            startService(it.first, it.second)
-        }
-    }
-
     private fun start(bundle: Bundle? = null, actionTask: String) {
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
-            val contextActivity = activity
-            if (ContextCompat.checkSelfPermission(context, Manifest.permission.POST_NOTIFICATIONS)
-                == PackageManager.PERMISSION_GRANTED
-            ) {
-                startService(bundle, actionTask)
-            } else if (contextActivity != null && shouldShowRequestPermissionRationale(
-                    contextActivity,
-                    Manifest.permission.POST_NOTIFICATIONS
-                )
-            ) {
-                // it's not the first time, so the user deliberately chooses not to display the notification
-                startService(bundle, actionTask)
-            } else {
-                AlertDialog.Builder(context)
-                    .setMessage(R.string.warning_database_notification_permission)
-                    .setNegativeButton(R.string.later) { _, _ ->
-                        // Refuses the notification, so start the service
-                        startService(bundle, actionTask)
-                    }
-                    .setPositiveButton(R.string.ask) { _, _ ->
-                        // Save the temp parameters to ask the permission
-                        tempServiceParameters.add(Pair(bundle, actionTask))
-                        requestPermissionLauncher?.launch(Manifest.permission.POST_NOTIFICATIONS)
-                    }.create().show()
-            }
-        } else {
-            startService(bundle, actionTask)
-        }
-    }
-
-    private fun startService(bundle: Bundle? = null, actionTask: String) {
-        try {
-            if (bundle != null)
-                intentDatabaseTask.putExtras(bundle)
-            intentDatabaseTask.action = actionTask
-            context.startService(intentDatabaseTask)
-        } catch (e: Exception) {
-            Log.e(TAG, "Unable to perform database action", e)
-            Toast.makeText(context, R.string.error_start_database_action, Toast.LENGTH_LONG).show()
+        onStartActionRequested?.invoke(bundle, actionTask) ?: run {
+            context.startDatabaseService(bundle, actionTask)
         }
     }
 
@@ -842,5 +669,21 @@ class DatabaseTaskProvider(
 
     companion object {
         private val TAG = DatabaseTaskProvider::class.java.name
+
+        fun Context.startDatabaseService(bundle: Bundle? = null, actionTask: String) {
+            try {
+                val intentDatabaseTask = Intent(
+                    applicationContext,
+                    DatabaseTaskNotificationService::class.java
+                )
+                if (bundle != null)
+                    intentDatabaseTask.putExtras(bundle)
+                intentDatabaseTask.action = actionTask
+                startService(intentDatabaseTask)
+            } catch (e: Exception) {
+                Log.e(TAG, "Unable to perform database action", e)
+                Toast.makeText(this, R.string.error_start_database_action, Toast.LENGTH_LONG).show()
+            }
+        }
     }
 }

app/src/main/java/com/kunzisoft/keepass/database/helper/LocalizedHelper.kt

@@ -47,6 +47,8 @@ import com.kunzisoft.keepass.database.exception.UnknownDatabaseLocationException
 import com.kunzisoft.keepass.database.exception.VersionDatabaseException
 import com.kunzisoft.keepass.database.exception.XMLMalformedDatabaseException
 import com.kunzisoft.keepass.model.PasskeyEntryFields.FIELD_CREDENTIAL_ID
+import com.kunzisoft.keepass.model.PasskeyEntryFields.FIELD_FLAG_BE
+import com.kunzisoft.keepass.model.PasskeyEntryFields.FIELD_FLAG_BS
 import com.kunzisoft.keepass.model.PasskeyEntryFields.FIELD_PRIVATE_KEY
 import com.kunzisoft.keepass.model.PasskeyEntryFields.FIELD_RELYING_PARTY
 import com.kunzisoft.keepass.model.PasskeyEntryFields.FIELD_USERNAME
@@ -146,6 +148,8 @@ fun TemplateField.getLocalizedName(context: Context?, name: String): String {
         FIELD_CREDENTIAL_ID.equals(name, true) -> context.getString(R.string.passkey_credential_id)
         FIELD_USER_HANDLE.equals(name, true) -> context.getString(R.string.passkey_user_handle)
         FIELD_RELYING_PARTY.equals(name, true) -> context.getString(R.string.passkey_relying_party)
+        FIELD_FLAG_BE.equals(name, true) -> context.getString(R.string.passkey_backup_eligibility)
+        FIELD_FLAG_BS.equals(name, true) -> context.getString(R.string.passkey_backup_state)
 
         else -> name
     }

app/src/main/java/com/kunzisoft/keepass/database/helper/SearchHelper.kt

@@ -21,9 +21,16 @@ package com.kunzisoft.keepass.database.helper
 
 import android.content.Context
 import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.database.search.SearchParameters
 import com.kunzisoft.keepass.model.EntryInfo
 import com.kunzisoft.keepass.model.SearchInfo
+import com.kunzisoft.keepass.settings.PreferencesUtil.searchSubDomains
 import com.kunzisoft.keepass.timeout.TimeoutHelper
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
+import mozilla.components.lib.publicsuffixlist.PublicSuffixList
 
 object SearchHelper {
 
@@ -40,6 +47,76 @@ object SearchHelper {
         }
     }
 
+    /**
+     * Get the concrete web domain AKA without sub domain if needed
+     */
+    private fun getConcreteWebDomain(
+        context: Context,
+        webDomain: String?,
+        concreteWebDomain: (searchSubDomains: Boolean, concreteWebDomain: String?) -> Unit
+    ) {
+        val domain = webDomain
+        val searchSubDomains = searchSubDomains(context)
+        if (domain != null) {
+            // Warning, web domain can contains IP, don't crop in this case
+            if (searchSubDomains
+                || Regex(SearchInfo.WEB_IP_REGEX).matches(domain)) {
+                concreteWebDomain.invoke(searchSubDomains, webDomain)
+            } else {
+                CoroutineScope(Dispatchers.IO).launch {
+                    val publicSuffixList = PublicSuffixList(context)
+                    val publicSuffix = publicSuffixList
+                        .getPublicSuffixPlusOne(domain).await()
+                    withContext(Dispatchers.Main) {
+                        concreteWebDomain.invoke(false, publicSuffix)
+                    }
+                }
+            }
+        } else {
+            concreteWebDomain.invoke(searchSubDomains, null)
+        }
+    }
+
+    /**
+     * Create search parameters asynchronously from [SearchInfo]
+     */
+    fun SearchInfo.getSearchParametersFromSearchInfo(
+        context: Context,
+        callback: (SearchParameters) -> Unit
+    ) {
+        getConcreteWebDomain(
+            context,
+            webDomain
+        ) { searchSubDomains, concreteDomain ->
+            var query = this.toString()
+            if (isDomainSearch && concreteDomain != null)
+                query = concreteDomain
+            callback.invoke(
+                SearchParameters().apply {
+                    searchQuery = query
+                    allowEmptyQuery = false
+                    searchInTitles = false
+                    searchInUsernames = false
+                    searchInPasswords = false
+                    searchInAppIds = isAppIdSearch
+                    searchInUrls = isDomainSearch
+                    searchByDomain = true
+                    searchBySubDomain = searchSubDomains
+                    searchInRelyingParty = isPasskeySearch
+                    searchInNotes = false
+                    searchInOTP = isOTPSearch
+                    searchInOther = false
+                    searchInUUIDs = false
+                    searchInTags = isTagSearch
+                    searchInCurrentGroup = false
+                    searchInSearchableGroup = true
+                    searchInRecycleBin = false
+                    searchInTemplates = false
+                }
+            )
+        }
+    }
+
     /**
      * Utility method to perform actions if item is found or not after an auto search in [database]
      */
@@ -52,28 +129,31 @@ object SearchHelper {
         onItemNotFound: (openedDatabase: ContextualDatabase) -> Unit,
         onDatabaseClosed: () -> Unit
     ) {
+        // Do not place coroutine at start, bug in Passkey implementation
         if (database == null || !database.loaded) {
             onDatabaseClosed.invoke()
         } else if (TimeoutHelper.checkTime(context)) {
-            var searchWithoutUI = false
             if (searchInfo != null
                 && !searchInfo.manualSelection
-                && !searchInfo.containsOnlyNullValues()) {
-                // If search provide results
-                database.createVirtualGroupFromSearchInfo(
-                        searchInfo,
-                        MAX_SEARCH_ENTRY
-                )?.let { searchGroup ->
-                    if (searchGroup.numberOfChildEntries > 0) {
-                        searchWithoutUI = true
-                        onItemsFound.invoke(database,
-                                searchGroup.getChildEntriesInfo(database))
-                    }
+                && !searchInfo.containsOnlyNullValues()
+            ) {
+                searchInfo.getSearchParametersFromSearchInfo(context) { searchParameters ->
+                    // If search provide results
+                    database.createVirtualGroupFromSearchInfo(
+                        searchParameters = searchParameters,
+                        max = MAX_SEARCH_ENTRY
+                    )?.let { searchGroup ->
+                        if (searchGroup.numberOfChildEntries > 0) {
+                            onItemsFound.invoke(
+                                database,
+                                searchGroup.getChildEntriesInfo(database)
+                            )
+                        } else
+                            onItemNotFound.invoke(database)
+                    } ?: onItemNotFound.invoke(database)
                 }
-            }
-            if (!searchWithoutUI) {
+            } else
                 onItemNotFound.invoke(database)
-            }
         }
     }
 }

app/src/main/java/com/kunzisoft/keepass/hardware/HardwareKeyActivity.kt

@@ -1,170 +0,0 @@
-package com.kunzisoft.keepass.hardware
-
-import android.app.Activity
-import android.content.Context
-import android.content.DialogInterface
-import android.content.Intent
-import android.content.Intent.FLAG_ACTIVITY_NEW_TASK
-import android.util.Log
-import androidx.activity.result.ActivityResult
-import androidx.activity.result.ActivityResultCallback
-import androidx.activity.result.ActivityResultLauncher
-import androidx.activity.result.contract.ActivityResultContracts
-import androidx.appcompat.app.AlertDialog
-import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.activities.legacy.DatabaseModeActivity
-import com.kunzisoft.keepass.database.ContextualDatabase
-import com.kunzisoft.keepass.utils.AppUtil.openExternalApp
-
-/**
- * Special activity to deal with hardware key drivers,
- * return the response to the database service once finished
- */
-class HardwareKeyActivity: DatabaseModeActivity(){
-
-    // To manage hardware key challenge response
-    private val resultCallback = ActivityResultCallback<ActivityResult> { result ->
-        if (result.resultCode == Activity.RESULT_OK) {
-            val challengeResponse: ByteArray? = result.data?.getByteArrayExtra(HARDWARE_KEY_RESPONSE_KEY)
-            Log.d(TAG, "Response form challenge")
-            mDatabaseTaskProvider?.startChallengeResponded(challengeResponse ?: ByteArray(0))
-        } else {
-            Log.e(TAG, "Response from challenge error")
-            mDatabaseTaskProvider?.startChallengeResponded(ByteArray(0))
-        }
-        finish()
-    }
-
-    private var activityResultLauncher: ActivityResultLauncher<Intent> = registerForActivityResult(
-        ActivityResultContracts.StartActivityForResult(),
-        resultCallback
-    )
-
-    override fun applyCustomStyle(): Boolean {
-        return false
-    }
-
-    override fun showDatabaseDialog(): Boolean {
-        return false
-    }
-
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-
-        val hardwareKey = HardwareKey.getHardwareKeyFromString(
-            intent.getStringExtra(DATA_HARDWARE_KEY)
-        )
-        if (isHardwareKeyAvailable(this, hardwareKey, true) {
-                mDatabaseTaskProvider?.startChallengeResponded(ByteArray(0))
-            }) {
-            when (hardwareKey) {
-                /*
-                HardwareKey.FIDO2_SECRET -> {
-                    // TODO FIDO2 under development
-                    throw Exception("FIDO2 not implemented")
-                }
-                */
-                HardwareKey.CHALLENGE_RESPONSE_YUBIKEY -> {
-                    launchYubikeyChallengeForResponse(intent.getByteArrayExtra(DATA_SEED))
-                }
-                else -> {
-                    finish()
-                }
-            }
-        }
-    }
-
-    private fun launchYubikeyChallengeForResponse(seed: ByteArray?) {
-        // Transform the seed before sending
-        var challenge: ByteArray? = null
-        if (seed != null) {
-            challenge = ByteArray(64)
-            seed.copyInto(challenge, 0, 0, 32)
-            challenge.fill(32, 32, 64)
-        }
-        // Send to the driver
-        activityResultLauncher.launch(
-            Intent(YUBIKEY_CHALLENGE_RESPONSE_INTENT).apply {
-                putExtra(HARDWARE_KEY_CHALLENGE_KEY, challenge)
-            }
-        )
-        Log.d(TAG, "Challenge sent")
-    }
-
-    companion object {
-        private val TAG = HardwareKeyActivity::class.java.simpleName
-
-        private const val DATA_HARDWARE_KEY = "DATA_HARDWARE_KEY"
-        private const val DATA_SEED = "DATA_SEED"
-        private const val YUBIKEY_CHALLENGE_RESPONSE_INTENT = "android.yubikey.intent.action.CHALLENGE_RESPONSE"
-        private const val HARDWARE_KEY_CHALLENGE_KEY = "challenge"
-        private const val HARDWARE_KEY_RESPONSE_KEY = "response"
-
-        fun launchHardwareKeyActivity(
-            context: Context,
-            hardwareKey: HardwareKey,
-            seed: ByteArray?
-        ) {
-            context.startActivity(Intent(context, HardwareKeyActivity::class.java).apply {
-                flags = FLAG_ACTIVITY_NEW_TASK
-                putExtra(DATA_HARDWARE_KEY, hardwareKey.value)
-                putExtra(DATA_SEED, seed)
-            })
-        }
-
-        fun isHardwareKeyAvailable(
-            context: Context,
-            hardwareKey: HardwareKey?,
-            showDialog: Boolean = true,
-            onDialogDismissed: DialogInterface.OnDismissListener? = null
-        ): Boolean {
-            if (hardwareKey == null)
-                return false
-            return when (hardwareKey) {
-                /*
-                HardwareKey.FIDO2_SECRET -> {
-                    // TODO FIDO2 under development
-                    if (showDialog)
-                        UnderDevelopmentFeatureDialogFragment()
-                            .show(activity.supportFragmentManager, "underDevFeatureDialog")
-                    false
-                }
-                */
-                HardwareKey.CHALLENGE_RESPONSE_YUBIKEY -> {
-                    // Check available intent
-                    val yubikeyDriverAvailable =
-                        Intent(YUBIKEY_CHALLENGE_RESPONSE_INTENT)
-                            .resolveActivity(context.packageManager) != null
-                    if (showDialog && !yubikeyDriverAvailable
-                        && context is Activity)
-                        showHardwareKeyDriverNeeded(context, hardwareKey) {
-                            onDialogDismissed?.onDismiss(it)
-                            context.finish()
-                        }
-                    yubikeyDriverAvailable
-                }
-            }
-        }
-
-        private fun showHardwareKeyDriverNeeded(
-            context: Context,
-            hardwareKey: HardwareKey,
-            onDialogDismissed: DialogInterface.OnDismissListener
-        ) {
-            val builder = AlertDialog.Builder(context)
-            builder
-                .setMessage(
-                    context.getString(R.string.error_driver_required, hardwareKey.toString())
-                )
-                .setPositiveButton(R.string.download) { _, _ ->
-                    context.openExternalApp(
-                        context.getString(R.string.key_driver_app_id),
-                        context.getString(R.string.key_driver_url)
-                    )
-                }
-                .setNegativeButton(android.R.string.cancel) { _, _ -> }
-                .setOnDismissListener(onDialogDismissed)
-            builder.create().show()
-        }
-    }
-}

app/src/main/java/com/kunzisoft/keepass/password/PasswordGenerator.kt

@@ -33,20 +33,22 @@ import java.util.*
 class PasswordGenerator(private val resources: Resources) {
 
     @Throws(IllegalArgumentException::class)
-    fun generatePassword(length: Int,
-                         upperCase: Boolean,
-                         lowerCase: Boolean,
-                         digits: Boolean,
-                         minus: Boolean,
-                         underline: Boolean,
-                         space: Boolean,
-                         specials: Boolean,
-                         brackets: Boolean,
-                         extended: Boolean,
-                         considerChars: String,
-                         ignoreChars: String,
-                         atLeastOneFromEach: Boolean,
-                         excludeAmbiguousChar: Boolean): String {
+    fun generatePassword(
+        length: Int,
+        upperCase: Boolean,
+        lowerCase: Boolean,
+        digits: Boolean,
+        minus: Boolean,
+        underline: Boolean,
+        space: Boolean,
+        specials: Boolean,
+        brackets: Boolean,
+        extended: Boolean,
+        considerChars: String,
+        ignoreChars: String,
+        atLeastOneFromEach: Boolean,
+        excludeAmbiguousChar: Boolean
+    ): String {
         // Desired password length is 0 or less
         if (length <= 0) {
             throw IllegalArgumentException(resources.getString(R.string.error_wrong_length))
@@ -228,7 +230,7 @@ class PasswordGenerator(private val resources: Resources) {
         private const val MINUS_CHAR = "-"
         private const val UNDERLINE_CHAR = "_"
         private const val SPACE_CHAR = " "
-        private const val SPECIAL_CHARS = "!\"#$%&'*+,./:;=?@\\^`"
+        private const val SPECIAL_CHARS = "&/,^@.#:%\\='$!?*`;+\"|~"
         private const val BRACKET_CHARS = "[]{}()<>"
         private const val AMBIGUOUS_CHARS = "iI|lLoO01"
 

app/src/main/java/com/kunzisoft/keepass/services/AttachmentFileNotificationService.kt

@@ -36,6 +36,7 @@ import com.kunzisoft.keepass.model.AttachmentState
 import com.kunzisoft.keepass.model.EntryAttachmentState
 import com.kunzisoft.keepass.model.StreamDirection
 import com.kunzisoft.keepass.tasks.BinaryDatabaseManager
+import com.kunzisoft.keepass.utils.AppUtil.randomRequestCode
 import com.kunzisoft.keepass.utils.UriUtil.getDocumentFile
 import com.kunzisoft.keepass.utils.getParcelableExtraCompat
 import kotlinx.coroutines.CoroutineScope
@@ -194,7 +195,7 @@ class AttachmentFileNotificationService: LockNotificationService() {
     private fun newNotification(attachmentNotification: AttachmentNotification) {
 
         val pendingContentIntent = PendingIntent.getActivity(this,
-            0,
+            randomRequestCode(),
             Intent().apply {
                 action = Intent.ACTION_VIEW
                 setDataAndType(attachmentNotification.uri,
@@ -208,7 +209,7 @@ class AttachmentFileNotificationService: LockNotificationService() {
         )
 
         val pendingDeleteIntent =  PendingIntent.getService(this,
-                0,
+            randomRequestCode(),
                 Intent(this, AttachmentFileNotificationService::class.java).apply {
                     // No action to delete the service
                     putExtra(FILE_URI_KEY, attachmentNotification.uri)

app/src/main/java/com/kunzisoft/keepass/services/DatabaseTaskNotificationService.kt

@@ -61,13 +61,14 @@ import com.kunzisoft.keepass.database.element.node.Node
 import com.kunzisoft.keepass.database.element.node.NodeId
 import com.kunzisoft.keepass.database.element.node.Type
 import com.kunzisoft.keepass.hardware.HardwareKey
-import com.kunzisoft.keepass.hardware.HardwareKeyActivity
+import com.kunzisoft.keepass.credentialprovider.activity.HardwareKeyActivity
 import com.kunzisoft.keepass.model.CipherEncryptDatabase
 import com.kunzisoft.keepass.model.SnapFileDatabaseInfo
 import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.tasks.ActionRunnable
 import com.kunzisoft.keepass.tasks.ProgressTaskUpdater
 import com.kunzisoft.keepass.timeout.TimeoutHelper
+import com.kunzisoft.keepass.utils.AppUtil.randomRequestCode
 import com.kunzisoft.keepass.utils.DATABASE_START_TASK_ACTION
 import com.kunzisoft.keepass.utils.DATABASE_STOP_TASK_ACTION
 import com.kunzisoft.keepass.utils.LOCK_ACTION
@@ -175,7 +176,7 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
             progressMessage: ProgressMessage
         )
         fun onActionStopped(
-            database: ContextualDatabase
+            database: ContextualDatabase? = null
         )
         fun onActionFinished(
             database: ContextualDatabase,
@@ -550,7 +551,7 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
                     // Build Intents for notification action
                     val pendingDatabaseIntent = PendingIntent.getActivity(
                         this,
-                        0,
+                        randomRequestCode(),
                         Intent(this, GroupActivity::class.java),
                         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
                             PendingIntent.FLAG_IMMUTABLE or PendingIntent.FLAG_UPDATE_CURRENT
@@ -675,6 +676,12 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
     override fun actionOnLock() {
         if (!TimeoutHelper.temporarilyDisableLock) {
             closeDatabase(mDatabase)
+            // Remove the database during the lock
+            // And notify each subscriber
+            mDatabase = null
+            mDatabaseListeners.forEach { listener ->
+                listener.onDatabaseRetrieved(null)
+            }
             // Remove the lock timer (no more needed if it exists)
             TimeoutHelper.cancelLockTimer(this)
             // Service is stopped after receive the broadcast
@@ -709,9 +716,9 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
             notifyProgressMessage()
             HardwareKeyActivity
                 .launchHardwareKeyActivity(
-                    this@DatabaseTaskNotificationService,
-                    hardwareKey,
-                    seed
+                    context = this@DatabaseTaskNotificationService,
+                    hardwareKey = hardwareKey,
+                    seed = seed
                 )
             // Wait the response
             mProgressMessage.apply {

app/src/main/java/com/kunzisoft/keepass/settings/AutofillSettingsFragment.kt

@@ -41,6 +41,11 @@ class AutofillSettingsFragment : PreferenceFragmentCompat() {
         if (Build.VERSION.SDK_INT < Build.VERSION_CODES.R) {
             autofillInlineSuggestionsPreference?.isVisible = false
         }
+
+        val autofillAskSaveDataPreference: TwoStatePreference? = findPreference(getString(R.string.autofill_ask_to_save_data_key))
+        if (Build.VERSION.SDK_INT < Build.VERSION_CODES.P) {
+            autofillAskSaveDataPreference?.isVisible = false
+        }
     }
 
     override fun onDisplayPreferenceDialog(preference: Preference) {

app/src/main/java/com/kunzisoft/keepass/settings/MainPreferenceFragment.kt

@@ -21,20 +21,25 @@ package com.kunzisoft.keepass.settings
 
 import android.content.Context
 import android.os.Bundle
-import android.view.View
 import androidx.fragment.app.activityViewModels
+import androidx.lifecycle.Lifecycle
+import androidx.lifecycle.lifecycleScope
+import androidx.lifecycle.repeatOnLifecycle
 import androidx.preference.Preference
 import androidx.preference.PreferenceCategory
 import androidx.preference.PreferenceFragmentCompat
 import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.viewmodels.DatabaseViewModel
+import kotlinx.coroutines.launch
 
 class MainPreferenceFragment : PreferenceFragmentCompat() {
 
     private var mCallback: Callback? = null
 
     private val mDatabaseViewModel: DatabaseViewModel by activityViewModels()
-    private var mDatabaseLoaded: Boolean = false
+    private val mDatabase: ContextualDatabase?
+        get() = mDatabaseViewModel.database
 
     override fun onAttach(context: Context) {
         super.onAttach(context)
@@ -50,20 +55,24 @@ class MainPreferenceFragment : PreferenceFragmentCompat() {
         mCallback = null
         super.onDetach()
     }
-    override fun onViewCreated(view: View, savedInstanceState: Bundle?) {
-        mDatabaseViewModel.database.observe(viewLifecycleOwner) { database ->
-            mDatabaseLoaded = database?.loaded == true
-            checkDatabaseLoaded()
+
+    override fun onCreate(savedInstanceState: Bundle?) {
+        super.onCreate(savedInstanceState)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.RESUMED) {
+                mDatabaseViewModel.databaseState.collect { database ->
+                    checkDatabaseLoaded(database?.loaded == true)
+                }
+            }
         }
-        super.onViewCreated(view, savedInstanceState)
     }
 
-    private fun checkDatabaseLoaded() {
+    private fun checkDatabaseLoaded(isDatabaseLoaded: Boolean) {
         findPreference<Preference>(getString(R.string.settings_database_key))
-            ?.isEnabled = mDatabaseLoaded
+            ?.isEnabled = isDatabaseLoaded
 
         findPreference<PreferenceCategory>(getString(R.string.settings_database_category_key))
-            ?.isVisible = mDatabaseLoaded
+            ?.isVisible = isDatabaseLoaded
     }
 
     override fun onCreatePreferences(savedInstanceState: Bundle?, rootKey: String?) {
@@ -119,7 +128,7 @@ class MainPreferenceFragment : PreferenceFragmentCompat() {
             }
         }
 
-        checkDatabaseLoaded()
+        checkDatabaseLoaded(mDatabase?.loaded == true)
     }
 
     interface Callback {

app/src/main/java/com/kunzisoft/keepass/settings/NestedDatabaseSettingsFragment.kt

@@ -19,13 +19,21 @@
  */
 package com.kunzisoft.keepass.settings
 
-import android.graphics.Color
 import android.os.Bundle
 import android.util.Log
-import android.view.*
+import android.view.LayoutInflater
+import android.view.Menu
+import android.view.MenuInflater
+import android.view.MenuItem
+import android.view.View
+import android.view.ViewGroup
+import androidx.core.graphics.toColorInt
 import androidx.core.view.MenuProvider
 import androidx.fragment.app.DialogFragment
 import androidx.fragment.app.activityViewModels
+import androidx.lifecycle.Lifecycle
+import androidx.lifecycle.lifecycleScope
+import androidx.lifecycle.repeatOnLifecycle
 import androidx.preference.Preference
 import androidx.preference.PreferenceCategory
 import androidx.preference.TwoStatePreference
@@ -39,19 +47,40 @@ import com.kunzisoft.keepass.database.crypto.EncryptionAlgorithm
 import com.kunzisoft.keepass.database.crypto.kdf.KdfEngine
 import com.kunzisoft.keepass.database.element.Group
 import com.kunzisoft.keepass.database.element.database.CompressionAlgorithm
-import com.kunzisoft.keepass.database.helper.*
+import com.kunzisoft.keepass.database.helper.getLocalizedName
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService
-import com.kunzisoft.keepass.settings.preference.*
-import com.kunzisoft.keepass.settings.preferencedialogfragment.*
+import com.kunzisoft.keepass.settings.preference.DialogColorPreference
+import com.kunzisoft.keepass.settings.preference.DialogListExplanationPreference
+import com.kunzisoft.keepass.settings.preference.InputKdfNumberPreference
+import com.kunzisoft.keepass.settings.preference.InputKdfSizePreference
+import com.kunzisoft.keepass.settings.preference.InputNumberPreference
+import com.kunzisoft.keepass.settings.preference.InputTextPreference
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseColorPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseDataCompressionPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseDefaultUsernamePreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseDescriptionPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseEncryptionAlgorithmPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseKeyDerivationPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseMaxHistoryItemsPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseMaxHistorySizePreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseMemoryUsagePreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseNamePreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseParallelismPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseRecycleBinGroupPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseRemoveUnlinkedDataPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseRoundsPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseTemplatesGroupPreferenceDialogFragmentCompat
 import com.kunzisoft.keepass.tasks.ActionRunnable
 import com.kunzisoft.keepass.utils.getParcelableCompat
 import com.kunzisoft.keepass.utils.getSerializableCompat
 import com.kunzisoft.keepass.viewmodels.DatabaseViewModel
+import kotlinx.coroutines.launch
 
 class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetrieval {
 
     private val mDatabaseViewModel: DatabaseViewModel by activityViewModels()
-    private var mDatabase: ContextualDatabase? = null
+    private val mDatabase: ContextualDatabase?
+        get() = mDatabaseViewModel.database
     private var mDatabaseReadOnly: Boolean = false
     private var mMergeDataAllowed: Boolean = false
     private var mDatabaseAutoSaveEnabled: Boolean = true
@@ -114,19 +143,46 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
         }
     }
 
+    override fun onCreate(savedInstanceState: Bundle?) {
+        super.onCreate(savedInstanceState)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.STARTED) {
+                mDatabaseViewModel.actionState.collect { uiState ->
+                    when (uiState) {
+                        is DatabaseViewModel.ActionState.OnDatabaseActionFinished -> {
+                            onDatabaseActionFinished(
+                                uiState.database,
+                                uiState.actionTask,
+                                uiState.result
+                            )
+                        }
+
+                        else -> {}
+                    }
+                }
+            }
+        }
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.RESUMED) {
+                mDatabaseViewModel.databaseState.collect { database ->
+                    database?.let {
+                        onDatabaseRetrieved(database)
+                    }
+                }
+            }
+        }
+    }
+
     override fun onViewCreated(view: View, savedInstanceState: Bundle?) {
         super.onViewCreated(view, savedInstanceState)
-
         activity?.addMenuProvider(menuProvider, viewLifecycleOwner)
-
-        mDatabaseViewModel.database.observe(viewLifecycleOwner) { database ->
-            mDatabase = database
-            view.resetAppTimeoutWhenViewTouchedOrFocused(requireContext(), database?.loaded)
-            onDatabaseRetrieved(database)
-        }
-
-        mDatabaseViewModel.actionFinished.observe(viewLifecycleOwner) {
-            onDatabaseActionFinished(it.database, it.actionTask, it.result)
+        viewLifecycleOwner.lifecycleScope.launch {
+            mDatabaseViewModel.databaseState.collect { database ->
+                view.resetAppTimeoutWhenViewTouchedOrFocused(
+                    context = requireContext(),
+                    databaseLoaded = database?.loaded
+                )
+            }
         }
     }
 
@@ -167,29 +223,26 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
         mDatabaseViewModel.reloadDatabase(false)
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        mDatabase = database
-        mDatabaseReadOnly = database?.isReadOnly == true
-        mMergeDataAllowed = database?.isMergeDataAllowed() == true
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        mDatabaseReadOnly = database.isReadOnly
+        mMergeDataAllowed = database.isMergeDataAllowed()
 
-        mDatabase?.let {
-            if (it.loaded) {
-                when (mScreen) {
-                    Screen.DATABASE -> {
-                        onCreateDatabasePreference(it)
-                    }
-                    Screen.DATABASE_SECURITY -> {
-                        onCreateDatabaseSecurityPreference(it)
-                    }
-                    Screen.DATABASE_MASTER_KEY -> {
-                        onCreateDatabaseMasterKeyPreference(it)
-                    }
-                    else -> {
-                    }
+        if (database.loaded) {
+            when (mScreen) {
+                Screen.DATABASE -> {
+                    onCreateDatabasePreference(database)
+                }
+                Screen.DATABASE_SECURITY -> {
+                    onCreateDatabaseSecurityPreference(database)
+                }
+                Screen.DATABASE_MASTER_KEY -> {
+                    onCreateDatabaseMasterKeyPreference(database)
+                }
+                else -> {
                 }
-            } else {
-                Log.e(javaClass.name, "Database isn't ready")
             }
+        } else {
+            Log.e(javaClass.name, "Database isn't ready")
         }
     }
 
@@ -458,7 +511,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newDefaultUsername
                                 } else {
-                                    mDatabase?.defaultUsername = oldDefaultUsername
+                                    database.defaultUsername = oldDefaultUsername
                                     oldDefaultUsername
                                 }
                         dbDefaultUsernamePref?.summary = defaultUsernameToShow
@@ -471,7 +524,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newColor
                                 } else {
-                                    mDatabase?.customColor = Color.parseColor(oldColor)
+                                    database.customColor = oldColor.toColorInt()
                                     oldColor
                                 }
                         dbCustomColorPref?.summary = defaultColorToShow
@@ -483,7 +536,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newCompression
                                 } else {
-                                    mDatabase?.compressionAlgorithm = oldCompression
+                                    database.compressionAlgorithm = oldCompression
                                     oldCompression
                                 }
                         dbDataCompressionPref?.summary = algorithmToShow?.getLocalizedName(resources)
@@ -497,7 +550,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 } else {
                                     oldRecycleBin
                                 }
-                        mDatabase?.setRecycleBin(recycleBinToShow)
+                        database.setRecycleBin(recycleBinToShow)
                         refreshRecycleBinGroup(database)
                     }
                     DatabaseTaskNotificationService.ACTION_DATABASE_UPDATE_TEMPLATES_GROUP_TASK -> {
@@ -509,7 +562,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                             } else {
                                 oldTemplatesGroup
                             }
-                        mDatabase?.setTemplatesGroup(templatesGroupToShow)
+                        database.setTemplatesGroup(templatesGroupToShow)
                         refreshTemplatesGroup(database)
                     }
                     DatabaseTaskNotificationService.ACTION_DATABASE_UPDATE_MAX_HISTORY_ITEMS_TASK -> {
@@ -519,7 +572,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newMaxHistoryItems
                                 } else {
-                                    mDatabase?.historyMaxItems = oldMaxHistoryItems
+                                    database.historyMaxItems = oldMaxHistoryItems
                                     oldMaxHistoryItems
                                 }
                         dbMaxHistoryItemsPref?.summary = maxHistoryItemsToShow.toString()
@@ -531,7 +584,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newMaxHistorySize
                                 } else {
-                                    mDatabase?.historyMaxSize = oldMaxHistorySize
+                                    database.historyMaxSize = oldMaxHistorySize
                                     oldMaxHistorySize
                                 }
                         dbMaxHistorySizePref?.summary = maxHistorySizeToShow.toString()
@@ -549,7 +602,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newEncryption
                                 } else {
-                                    mDatabase?.encryptionAlgorithm = oldEncryption
+                                    database.encryptionAlgorithm = oldEncryption
                                     oldEncryption
                                 }
                         mEncryptionAlgorithmPref?.summary = algorithmToShow.toString()
@@ -561,7 +614,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newKeyDerivationEngine
                                 } else {
-                                    mDatabase?.kdfEngine = oldKeyDerivationEngine
+                                    database.kdfEngine = oldKeyDerivationEngine
                                     oldKeyDerivationEngine
                                 }
                         mKeyDerivationPref?.summary = kdfEngineToShow.toString()
@@ -578,7 +631,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newIterations
                                 } else {
-                                    mDatabase?.numberKeyEncryptionRounds = oldIterations
+                                    database.numberKeyEncryptionRounds = oldIterations
                                     oldIterations
                                 }
                         mRoundPref?.summary = roundsToShow.toString()
@@ -590,7 +643,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newMemoryUsage
                                 } else {
-                                    mDatabase?.memoryUsage = oldMemoryUsage
+                                    database.memoryUsage = oldMemoryUsage
                                     oldMemoryUsage
                                 }
                         mMemoryPref?.summary = memoryToShow.toString()
@@ -602,7 +655,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newParallelism
                                 } else {
-                                    mDatabase?.parallelism = oldParallelism
+                                    database.parallelism = oldParallelism
                                     oldParallelism
                                 }
                         mParallelismPref?.summary = parallelismToShow.toString()

app/src/main/java/com/kunzisoft/keepass/settings/PreferencesUtil.kt

@@ -108,7 +108,7 @@ object PreferencesUtil {
             context.resources.getBoolean(R.bool.auto_focus_search_default))
     }
 
-    fun searchSubdomains(context: Context): Boolean {
+    fun searchSubDomains(context: Context): Boolean {
         val prefs = PreferenceManager.getDefaultSharedPreferences(context)
         return prefs.getBoolean(context.getString(R.string.subdomain_search_key),
             context.resources.getBoolean(R.bool.subdomain_search_default))
@@ -352,6 +352,8 @@ object PreferencesUtil {
                 context.resources.getBoolean(R.bool.search_option_username_default))
             searchInPasswords = prefs.getBoolean(context.getString(R.string.search_option_password_key),
                 context.resources.getBoolean(R.bool.search_option_password_default))
+            searchInAppIds = prefs.getBoolean(context.getString(R.string.search_option_application_id_key),
+                context.resources.getBoolean(R.bool.search_option_application_id_default))
             searchInUrls = prefs.getBoolean(context.getString(R.string.search_option_url_key),
                 context.resources.getBoolean(R.bool.search_option_url_default))
             searchInExpired = prefs.getBoolean(context.getString(R.string.search_option_expired_key),
@@ -389,6 +391,8 @@ object PreferencesUtil {
                 searchParameters.searchInUsernames)
             putBoolean(context.getString(R.string.search_option_password_key),
                 searchParameters.searchInPasswords)
+            putBoolean(context.getString(R.string.search_option_application_id_key),
+                searchParameters.searchInAppIds)
             putBoolean(context.getString(R.string.search_option_url_key),
                 searchParameters.searchInUrls)
             putBoolean(context.getString(R.string.search_option_expired_key),
@@ -686,6 +690,12 @@ object PreferencesUtil {
             context.resources.getBoolean(R.bool.keyboard_previous_lock_default))
     }
 
+    fun isPasskeyCloseDatabaseEnable(context: Context): Boolean {
+        val prefs = PreferenceManager.getDefaultSharedPreferences(context)
+        return prefs.getBoolean(context.getString(R.string.passkeys_close_database_key),
+            context.resources.getBoolean(R.bool.passkeys_close_database_default))
+    }
+
     fun isPasskeyBackupEligibilityEnable(context: Context): Boolean {
         val prefs = PreferenceManager.getDefaultSharedPreferences(context)
         return prefs.getBoolean(context.getString(R.string.passkeys_backup_eligibility_key),
@@ -854,6 +864,10 @@ object PreferencesUtil {
                 context.getString(R.string.keyboard_previous_search_key) -> editor.putBoolean(name, value.toBoolean())
                 context.getString(R.string.keyboard_previous_fill_in_key) -> editor.putBoolean(name, value.toBoolean())
                 context.getString(R.string.keyboard_previous_lock_key) -> editor.putBoolean(name, value.toBoolean())
+                context.getString(R.string.passkeys_close_database_key) -> editor.putBoolean(name, value.toBoolean())
+                context.getString(R.string.passkeys_auto_select_key) -> editor.putBoolean(name, value.toBoolean())
+                context.getString(R.string.passkeys_backup_eligibility_key) -> editor.putBoolean(name, value.toBoolean())
+                context.getString(R.string.passkeys_backup_state_key) -> editor.putBoolean(name, value.toBoolean())
                 context.getString(R.string.autofill_close_database_key) -> editor.putBoolean(name, value.toBoolean())
                 context.getString(R.string.autofill_inline_suggestions_key) -> editor.putBoolean(name, value.toBoolean())
                 context.getString(R.string.autofill_manual_selection_key) -> editor.putBoolean(name, value.toBoolean())

app/src/main/java/com/kunzisoft/keepass/settings/SettingsActivity.kt

@@ -70,8 +70,12 @@ open class SettingsActivity
         // To apply navigation bar with background color
         /* TODO Settings nav bar
         setTransparentNavigationBar {
-            coordinatorLayout?.applyWindowInsets(WindowInsetPosition.TOP)
-            footer?.applyWindowInsets(WindowInsetPosition.BOTTOM)
+            coordinatorLayout?.applyWindowInsets(EnumSet.of(
+                WindowInsetPosition.TOP_MARGINS,
+                WindowInsetPosition.BOTTOM_MARGINS,
+                WindowInsetPosition.START_MARGINS,
+                WindowInsetPosition.END_MARGINS,
+            ))
         }*/
 
         mExternalFileHelper = ExternalFileHelper(this)
@@ -155,10 +159,6 @@ open class SettingsActivity
         return coordinatorLayout
     }
 
-    override fun finishActivityIfDatabaseNotLoaded(): Boolean {
-        return false
-    }
-
     override fun onDatabaseActionFinished(
         database: ContextualDatabase,
         actionTask: String,
@@ -188,7 +188,7 @@ open class SettingsActivity
     }
 
     override fun onAssignKeyDialogPositiveClick(mainCredential: MainCredential) {
-        assignPassword(mainCredential)
+        assignMainCredential(mainCredential)
     }
 
     override fun onAssignKeyDialogNegativeClick(mainCredential: MainCredential) {}

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseColorPreferenceDialogFragmentCompat.kt

@@ -95,20 +95,16 @@ class DatabaseColorPreferenceDialogFragmentCompat : DatabaseSavePreferenceDialog
         return dialog
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-
-        database?.let {
-            var initColor = it.customColor
-            if (initColor != null) {
-                enableSwitchView.isChecked = true
-            } else {
-                enableSwitchView.isChecked = false
-                initColor = DEFAULT_COLOR
-            }
-            chromaColorView.currentColor = initColor
-            arguments?.putInt(ARG_INITIAL_COLOR, initColor)
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        var initColor = database.customColor
+        if (initColor != null) {
+            enableSwitchView.isChecked = true
+        } else {
+            enableSwitchView.isChecked = false
+            initColor = DEFAULT_COLOR
         }
+        chromaColorView.currentColor = initColor
+        arguments?.putInt(ARG_INITIAL_COLOR, initColor)
     }
 
     override fun onDialogClosed(database: ContextualDatabase?, positiveResult: Boolean) {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseDataCompressionPreferenceDialogFragmentCompat.kt

@@ -50,16 +50,14 @@ class DatabaseDataCompressionPreferenceDialogFragmentCompat
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         setExplanationText(R.string.database_data_compression_summary)
-
         mRecyclerView?.adapter = mCompressionAdapter
-
-        database?.let {
-            compressionSelected = it.compressionAlgorithm
-            mCompressionAdapter?.setItems(it.availableCompressionAlgorithms, compressionSelected)
-        }
+        compressionSelected = database.compressionAlgorithm
+        mCompressionAdapter?.setItems(
+            items = database.availableCompressionAlgorithms,
+            itemUsed = compressionSelected
+        )
     }
 
     override fun onDialogClosed(database: ContextualDatabase?, positiveResult: Boolean) {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseDefaultUsernamePreferenceDialogFragmentCompat.kt

@@ -24,9 +24,8 @@ import com.kunzisoft.keepass.database.ContextualDatabase
 
 class DatabaseDefaultUsernamePreferenceDialogFragmentCompat : DatabaseSavePreferenceDialogFragmentCompat() {
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-        inputText = database?.defaultUsername?: ""
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        inputText = database.defaultUsername
     }
 
     override fun onDialogClosed(database: ContextualDatabase?, positiveResult: Boolean) {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseDescriptionPreferenceDialogFragmentCompat.kt

@@ -24,9 +24,8 @@ import com.kunzisoft.keepass.database.ContextualDatabase
 
 class DatabaseDescriptionPreferenceDialogFragmentCompat : DatabaseSavePreferenceDialogFragmentCompat() {
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-        inputText = database?.description ?: ""
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        inputText = database.description
     }
 
     override fun onDialogClosed(database: ContextualDatabase?, positiveResult: Boolean) {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseEncryptionAlgorithmPreferenceDialogFragmentCompat.kt

@@ -51,12 +51,9 @@ class DatabaseEncryptionAlgorithmPreferenceDialogFragmentCompat
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-        database?.let {
-            algorithmSelected = database.encryptionAlgorithm
-            mEncryptionAlgorithmAdapter?.setItems(database.availableEncryptionAlgorithms, algorithmSelected)
-        }
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        algorithmSelected = database.encryptionAlgorithm
+        mEncryptionAlgorithmAdapter?.setItems(database.availableEncryptionAlgorithms, algorithmSelected)
     }
 
     override fun onDialogClosed(database: ContextualDatabase?, positiveResult: Boolean) {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseKeyDerivationPreferenceDialogFragmentCompat.kt

@@ -54,12 +54,12 @@ class DatabaseKeyDerivationPreferenceDialogFragmentCompat
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-        database?.let {
-            kdfEngineSelected = database.kdfEngine
-            mKdfAdapter?.setItems(database.availableKdfEngines, kdfEngineSelected)
-        }
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        kdfEngineSelected = database.kdfEngine
+        mKdfAdapter?.setItems(
+            items = database.availableKdfEngines,
+            itemUsed = kdfEngineSelected
+        )
     }
 
     override fun onDialogClosed(database: ContextualDatabase?, positiveResult: Boolean) {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseMaxHistoryItemsPreferenceDialogFragmentCompat.kt

@@ -31,19 +31,17 @@ class DatabaseMaxHistoryItemsPreferenceDialogFragmentCompat : DatabaseSavePrefer
         setExplanationText(R.string.max_history_items_summary)
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-        database?.historyMaxItems?.let { maxItemsDatabase ->
-            inputText = maxItemsDatabase.toString()
-            setSwitchAction({ isChecked ->
-                inputText = if (!isChecked) {
-                    NONE_MAX_HISTORY_ITEMS.toString()
-                } else {
-                    DEFAULT_MAX_HISTORY_ITEMS.toString()
-                }
-                showInputText(isChecked)
-            }, maxItemsDatabase > NONE_MAX_HISTORY_ITEMS)
-        }
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        val maxItemsDatabase = database.historyMaxItems
+        inputText = maxItemsDatabase.toString()
+        setSwitchAction({ isChecked ->
+            inputText = if (!isChecked) {
+                NONE_MAX_HISTORY_ITEMS.toString()
+            } else {
+                DEFAULT_MAX_HISTORY_ITEMS.toString()
+            }
+            showInputText(isChecked)
+        }, maxItemsDatabase > NONE_MAX_HISTORY_ITEMS)
     }
 
     override fun onDialogClosed(database: ContextualDatabase?, positiveResult: Boolean) {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseMaxHistorySizePreferenceDialogFragmentCompat.kt

@@ -34,31 +34,29 @@ class DatabaseMaxHistorySizePreferenceDialogFragmentCompat : DatabaseSavePrefere
         setExplanationText(R.string.max_history_size_summary)
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-        database?.historyMaxSize?.let { maxItemsDatabase ->
-            dataByte = DataByte(maxItemsDatabase, DataByte.ByteFormat.BYTE)
-                .toBetterByteFormat()
-            inputText = dataByte.number.toString()
-            if (dataByte.number >= 0) {
-                setUnitText(dataByte.format.stringId)
-            } else {
-                unitText = null
-            }
-
-            setSwitchAction({ isChecked ->
-                if (!isChecked) {
-                    dataByte = INFINITE_MAX_HISTORY_SIZE_DATA_BYTE
-                    inputText = INFINITE_MAX_HISTORY_SIZE.toString()
-                    unitText = null
-                } else {
-                    dataByte = DEFAULT_MAX_HISTORY_SIZE_DATA_BYTE
-                    inputText = dataByte.number.toString()
-                    setUnitText(dataByte.format.stringId)
-                }
-                showInputText(isChecked)
-            }, maxItemsDatabase > INFINITE_MAX_HISTORY_SIZE)
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        val maxItemsDatabase = database.historyMaxSize
+        dataByte = DataByte(maxItemsDatabase, DataByte.ByteFormat.BYTE)
+            .toBetterByteFormat()
+        inputText = dataByte.number.toString()
+        if (dataByte.number >= 0) {
+            setUnitText(dataByte.format.stringId)
+        } else {
+            unitText = null
         }
+
+        setSwitchAction({ isChecked ->
+            if (!isChecked) {
+                dataByte = INFINITE_MAX_HISTORY_SIZE_DATA_BYTE
+                inputText = INFINITE_MAX_HISTORY_SIZE.toString()
+                unitText = null
+            } else {
+                dataByte = DEFAULT_MAX_HISTORY_SIZE_DATA_BYTE
+                inputText = dataByte.number.toString()
+                setUnitText(dataByte.format.stringId)
+            }
+            showInputText(isChecked)
+        }, maxItemsDatabase > INFINITE_MAX_HISTORY_SIZE)
     }
 
     override fun onDialogClosed(database: ContextualDatabase?, positiveResult: Boolean) {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseMemoryUsagePreferenceDialogFragmentCompat.kt

@@ -34,15 +34,12 @@ class DatabaseMemoryUsagePreferenceDialogFragmentCompat : DatabaseSavePreference
         setExplanationText(R.string.memory_usage_explanation)
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-        database?.let {
-            val memoryBytes = database.memoryUsage
-            dataByte = DataByte(memoryBytes, DataByte.ByteFormat.BYTE)
-                .toBetterByteFormat()
-            inputText = dataByte.number.toString()
-            setUnitText(dataByte.format.stringId)
-        }
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        val memoryBytes = database.memoryUsage
+        dataByte = DataByte(memoryBytes, DataByte.ByteFormat.BYTE)
+            .toBetterByteFormat()
+        inputText = dataByte.number.toString()
+        setUnitText(dataByte.format.stringId)
     }
 
     override fun onDialogClosed(database: ContextualDatabase?, positiveResult: Boolean) {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseNamePreferenceDialogFragmentCompat.kt

@@ -24,9 +24,8 @@ import com.kunzisoft.keepass.database.ContextualDatabase
 
 class DatabaseNamePreferenceDialogFragmentCompat : DatabaseSavePreferenceDialogFragmentCompat() {
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-        inputText = database?.name ?: ""
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        inputText = database.name
     }
 
     override fun onDialogClosed(database: ContextualDatabase?, positiveResult: Boolean) {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseParallelismPreferenceDialogFragmentCompat.kt

@@ -31,9 +31,8 @@ class DatabaseParallelismPreferenceDialogFragmentCompat : DatabaseSavePreference
         setExplanationText(R.string.parallelism_explanation)
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-        inputText = database?.parallelism?.toString() ?: MIN_PARALLELISM.toString()
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        inputText = database.parallelism.toString()
     }
 
     override fun onDialogClosed(database: ContextualDatabase?, positiveResult: Boolean) {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseRecycleBinGroupPreferenceDialogFragmentCompat.kt

@@ -48,12 +48,9 @@ class DatabaseRecycleBinGroupPreferenceDialogFragmentCompat
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-        database?.let {
-            mGroupRecycleBin = database.recycleBin
-            mGroupsAdapter?.setItems(database.getAllGroupsWithoutRoot(), mGroupRecycleBin)
-        }
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        mGroupRecycleBin = database.recycleBin
+        mGroupsAdapter?.setItems(database.getAllGroupsWithoutRoot(), mGroupRecycleBin)
     }
 
     override fun onItemSelected(item: Group) {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseRemoveUnlinkedDataPreferenceDialogFragmentCompat.kt

@@ -46,6 +46,8 @@ class DatabaseRemoveUnlinkedDataPreferenceDialogFragmentCompat : DatabaseSavePre
         }
     }
 
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {}
+
     companion object {
 
         fun newInstance(key: String): DatabaseRemoveUnlinkedDataPreferenceDialogFragmentCompat {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseRoundsPreferenceDialogFragmentCompat.kt

@@ -32,9 +32,8 @@ class DatabaseRoundsPreferenceDialogFragmentCompat : DatabaseSavePreferenceDialo
         explanationText = getString(R.string.rounds_explanation)
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-        inputText = database?.numberKeyEncryptionRounds?.toString() ?: MIN_ITERATIONS.toString()
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        inputText = database.numberKeyEncryptionRounds.toString()
     }
 
     override fun onDialogClosed(database: ContextualDatabase?, positiveResult: Boolean) {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseSavePreferenceDialogFragmentCompat.kt

@@ -22,6 +22,9 @@ package com.kunzisoft.keepass.settings.preferencedialogfragment
 import android.content.Context
 import android.os.Bundle
 import androidx.fragment.app.activityViewModels
+import androidx.lifecycle.Lifecycle
+import androidx.lifecycle.lifecycleScope
+import androidx.lifecycle.repeatOnLifecycle
 import com.kunzisoft.androidclearchroma.ChromaUtil
 import com.kunzisoft.keepass.activities.legacy.DatabaseRetrieval
 import com.kunzisoft.keepass.database.ContextualDatabase
@@ -32,13 +35,15 @@ import com.kunzisoft.keepass.database.element.database.CompressionAlgorithm
 import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.tasks.ActionRunnable
 import com.kunzisoft.keepass.viewmodels.DatabaseViewModel
+import kotlinx.coroutines.launch
 
 abstract class DatabaseSavePreferenceDialogFragmentCompat
     : InputPreferenceDialogFragmentCompat(), DatabaseRetrieval {
 
     private var mDatabaseAutoSaveEnable = true
     private val mDatabaseViewModel: DatabaseViewModel by activityViewModels()
-    private var mDatabase: ContextualDatabase? = null
+    protected val mDatabase: ContextualDatabase?
+        get() = mDatabaseViewModel.database
 
     override fun onAttach(context: Context) {
         super.onAttach(context)
@@ -47,18 +52,32 @@ abstract class DatabaseSavePreferenceDialogFragmentCompat
 
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
-        mDatabaseViewModel.database.observe(this) { database ->
-            onDatabaseRetrieved(database)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.STARTED) {
+                mDatabaseViewModel.actionState.collect { uiState ->
+                    when (uiState) {
+                        is DatabaseViewModel.ActionState.OnDatabaseActionFinished -> {
+                            onDatabaseActionFinished(
+                                uiState.database,
+                                uiState.actionTask,
+                                uiState.result
+                            )
+                        }
+
+                        else -> {}
+                    }
+                }
+            }
+        }
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.RESUMED) {
+                mDatabaseViewModel.databaseState.collect { database ->
+                    database?.let {
+                        onDatabaseRetrieved(database)
+                    }
+                }
+            }
         }
-    }
-
-    override fun onResume() {
-        super.onResume()
-        onDatabaseRetrieved(mDatabase)
-    }
-
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        this.mDatabase = database
     }
 
     override fun onDatabaseActionFinished(
@@ -77,8 +96,10 @@ abstract class DatabaseSavePreferenceDialogFragmentCompat
         // To inherit to save element in database
     }
 
-    protected fun saveColor(oldColor: Int?,
-                            newColor: Int?) {
+    protected fun saveColor(
+        oldColor: Int?,
+        newColor: Int?
+    ) {
         val oldColorString = if (oldColor != null)
                 ChromaUtil.getFormattedColorString(oldColor, false)
             else
@@ -87,77 +108,158 @@ abstract class DatabaseSavePreferenceDialogFragmentCompat
             ChromaUtil.getFormattedColorString(newColor, false)
         else
             ""
-        mDatabaseViewModel.saveColor(oldColorString, newColorString, mDatabaseAutoSaveEnable)
+        mDatabaseViewModel.saveColor(
+            oldColorString,
+            newColorString,
+            mDatabaseAutoSaveEnable
+        )
     }
 
-    protected fun saveCompression(oldCompression: CompressionAlgorithm,
-                                  newCompression: CompressionAlgorithm
+    protected fun saveCompression(
+        oldCompression: CompressionAlgorithm,
+        newCompression: CompressionAlgorithm
     ) {
-        mDatabaseViewModel.saveCompression(oldCompression, newCompression, mDatabaseAutoSaveEnable)
+        mDatabaseViewModel.saveCompression(
+            oldCompression,
+            newCompression,
+            mDatabaseAutoSaveEnable
+        )
     }
 
-    protected fun saveDefaultUsername(oldUsername: String,
-                                      newUsername: String) {
-        mDatabaseViewModel.saveDefaultUsername(oldUsername, newUsername, mDatabaseAutoSaveEnable)
+    protected fun saveDefaultUsername(
+        oldUsername: String,
+        newUsername: String
+    ) {
+        mDatabaseViewModel.saveDefaultUsername(
+            oldUsername,
+            newUsername,
+            mDatabaseAutoSaveEnable
+        )
     }
 
-    protected fun saveDescription(oldDescription: String,
-                                  newDescription: String) {
-        mDatabaseViewModel.saveDescription(oldDescription, newDescription, mDatabaseAutoSaveEnable)
+    protected fun saveDescription(
+        oldDescription: String,
+        newDescription: String
+    ) {
+        mDatabaseViewModel.saveDescription(
+            oldDescription,
+            newDescription,
+            mDatabaseAutoSaveEnable
+        )
     }
 
-    protected fun saveEncryption(oldEncryption: EncryptionAlgorithm,
-                                 newEncryptionAlgorithm: EncryptionAlgorithm) {
-        mDatabaseViewModel.saveEncryption(oldEncryption, newEncryptionAlgorithm, mDatabaseAutoSaveEnable)
+    protected fun saveEncryption(
+        oldEncryption: EncryptionAlgorithm,
+        newEncryptionAlgorithm: EncryptionAlgorithm
+    ) {
+        mDatabaseViewModel.saveEncryption(
+            oldEncryption,
+            newEncryptionAlgorithm,
+            mDatabaseAutoSaveEnable
+        )
     }
 
-    protected fun saveKeyDerivation(oldKeyDerivation: KdfEngine,
-                                    newKeyDerivation: KdfEngine) {
-        mDatabaseViewModel.saveKeyDerivation(oldKeyDerivation, newKeyDerivation, mDatabaseAutoSaveEnable)
+    protected fun saveKeyDerivation(
+        oldKeyDerivation: KdfEngine,
+        newKeyDerivation: KdfEngine
+    ) {
+        mDatabaseViewModel.saveKeyDerivation(
+            oldKeyDerivation,
+            newKeyDerivation,
+            mDatabaseAutoSaveEnable
+        )
     }
 
-    protected fun saveName(oldName: String,
-                           newName: String) {
-        mDatabaseViewModel.saveName(oldName, newName, mDatabaseAutoSaveEnable)
+    protected fun saveName(
+        oldName: String,
+        newName: String
+    ) {
+        mDatabaseViewModel.saveName(
+            oldName,
+            newName,
+            mDatabaseAutoSaveEnable
+        )
     }
 
-    protected fun saveRecycleBin(oldGroup: Group?,
-                                 newGroup: Group?) {
-        mDatabaseViewModel.saveRecycleBin(oldGroup, newGroup, mDatabaseAutoSaveEnable)
+    protected fun saveRecycleBin(
+        oldGroup: Group?,
+        newGroup: Group?
+    ) {
+        mDatabaseViewModel.saveRecycleBin(
+            oldGroup,
+            newGroup,
+            mDatabaseAutoSaveEnable
+        )
     }
 
     protected fun removeUnlinkedData() {
         mDatabaseViewModel.removeUnlinkedData(mDatabaseAutoSaveEnable)
     }
 
-    protected fun saveTemplatesGroup(oldGroup: Group?,
-                                     newGroup: Group?) {
-        mDatabaseViewModel.saveTemplatesGroup(oldGroup, newGroup, mDatabaseAutoSaveEnable)
+    protected fun saveTemplatesGroup(
+        oldGroup: Group?,
+        newGroup: Group?
+    ) {
+        mDatabaseViewModel.saveTemplatesGroup(
+            oldGroup,
+            newGroup,
+            mDatabaseAutoSaveEnable
+        )
     }
 
-    protected fun saveMaxHistoryItems(oldNumber: Int,
-                                      newNumber: Int) {
-        mDatabaseViewModel.saveMaxHistoryItems(oldNumber, newNumber, mDatabaseAutoSaveEnable)
+    protected fun saveMaxHistoryItems(
+        oldNumber: Int,
+        newNumber: Int
+    ) {
+        mDatabaseViewModel.saveMaxHistoryItems(
+            oldNumber,
+            newNumber,
+            mDatabaseAutoSaveEnable
+        )
     }
 
-    protected fun saveMaxHistorySize(oldNumber: Long,
-                                     newNumber: Long) {
-        mDatabaseViewModel.saveMaxHistorySize(oldNumber, newNumber, mDatabaseAutoSaveEnable)
+    protected fun saveMaxHistorySize(
+        oldNumber: Long,
+        newNumber: Long
+    ) {
+        mDatabaseViewModel.saveMaxHistorySize(
+            oldNumber,
+            newNumber,
+            mDatabaseAutoSaveEnable
+        )
     }
 
-    protected fun saveMemoryUsage(oldNumber: Long,
-                                  newNumber: Long) {
-        mDatabaseViewModel.saveMemoryUsage(oldNumber, newNumber, mDatabaseAutoSaveEnable)
+    protected fun saveMemoryUsage(
+        oldNumber: Long,
+        newNumber: Long
+    ) {
+        mDatabaseViewModel.saveMemoryUsage(
+            oldNumber,
+            newNumber,
+            mDatabaseAutoSaveEnable
+        )
     }
 
-    protected fun saveParallelism(oldNumber: Long,
-                                  newNumber: Long) {
-        mDatabaseViewModel.saveParallelism(oldNumber, newNumber, mDatabaseAutoSaveEnable)
+    protected fun saveParallelism(
+        oldNumber: Long,
+        newNumber: Long
+    ) {
+        mDatabaseViewModel.saveParallelism(
+            oldNumber,
+            newNumber,
+            mDatabaseAutoSaveEnable
+        )
     }
 
-    protected fun saveIterations(oldNumber: Long,
-                                 newNumber: Long) {
-        mDatabaseViewModel.saveIterations(oldNumber, newNumber, mDatabaseAutoSaveEnable)
+    protected fun saveIterations(
+        oldNumber: Long,
+        newNumber: Long
+    ) {
+        mDatabaseViewModel.saveIterations(
+            oldNumber,
+            newNumber,
+            mDatabaseAutoSaveEnable
+        )
     }
 
     companion object {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseTemplatesGroupPreferenceDialogFragmentCompat.kt

@@ -48,12 +48,9 @@ class DatabaseTemplatesGroupPreferenceDialogFragmentCompat
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-        database?.let {
-            mGroupTemplates = database.templatesGroup
-            mGroupsAdapter?.setItems(database.getAllGroupsWithoutRoot(), mGroupTemplates)
-        }
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        mGroupTemplates = database.templatesGroup
+        mGroupsAdapter?.setItems(database.getAllGroupsWithoutRoot(), mGroupTemplates)
     }
 
     override fun onItemSelected(item: Group) {

app/src/main/java/com/kunzisoft/keepass/utils/AppUtil.kt

@@ -13,15 +13,13 @@ import com.kunzisoft.keepass.BuildConfig
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.credentialprovider.passkey.data.AndroidPrivilegedApp
 import com.kunzisoft.keepass.education.Education
-import com.kunzisoft.keepass.model.SearchInfo
-import com.kunzisoft.keepass.settings.PreferencesUtil
-import kotlinx.coroutines.CoroutineScope
-import kotlinx.coroutines.Dispatchers
-import kotlinx.coroutines.launch
-import mozilla.components.lib.publicsuffixlist.PublicSuffixList
 
 object AppUtil {
 
+    fun randomRequestCode(): Int {
+        return (Math.random() * Integer.MAX_VALUE).toInt()
+    }
+
     fun Context.isExternalAppInstalled(packageName: String, showError: Boolean = true): Boolean {
         try {
             this.applicationContext.packageManager.getPackageInfoCompat(
@@ -79,29 +77,6 @@ object AppUtil {
                 )
     }
 
-    /**
-     * Get the concrete web domain AKA without sub domain if needed
-     */
-    fun getConcreteWebDomain(context: Context,
-                             webDomain: String?,
-                             concreteWebDomain: (String?) -> Unit) {
-        CoroutineScope(Dispatchers.Main).launch {
-            if (webDomain != null) {
-                // Warning, web domain can contains IP, don't crop in this case
-                if (PreferencesUtil.searchSubdomains(context)
-                    || Regex(SearchInfo.WEB_IP_REGEX).matches(webDomain)) {
-                    concreteWebDomain.invoke(webDomain)
-                } else {
-                    val publicSuffixList = PublicSuffixList(context)
-                    concreteWebDomain.invoke(publicSuffixList
-                        .getPublicSuffixPlusOne(webDomain).await())
-                }
-            } else {
-                concreteWebDomain.invoke(null)
-            }
-        }
-    }
-
     @RequiresApi(Build.VERSION_CODES.P)
     fun getInstalledBrowsersWithSignatures(context: Context): List<AndroidPrivilegedApp> {
         val packageManager = context.packageManager

app/src/main/java/com/kunzisoft/keepass/utils/IOActionTask.kt

@@ -19,30 +19,39 @@
  */
 package com.kunzisoft.keepass.utils
 
-import kotlinx.coroutines.*
+import kotlinx.coroutines.CoroutineExceptionHandler
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.Deferred
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.async
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
+import kotlin.coroutines.EmptyCoroutineContext
 
 /**
  * Class to invoke action in a separate IO thread
  */
 class IOActionTask<T>(
-        private val action: () -> T ,
-        private val afterActionListener: ((T?) -> Unit)? = null) {
-
-    private val mainScope = CoroutineScope(Dispatchers.Main)
-
+    private val action: () -> T,
+    private val onActionComplete: ((T?) -> Unit)? = null,
+    private val scope: CoroutineScope = CoroutineScope(Dispatchers.Main),
+    private val exceptionHandler: CoroutineExceptionHandler? = null
+) {
     fun execute() {
-        mainScope.launch {
+        scope.launch(exceptionHandler ?: EmptyCoroutineContext) {
             withContext(Dispatchers.IO) {
                 val asyncResult: Deferred<T?> = async {
-                        try {
-                            action.invoke()
-                        } catch (e: Exception) {
-                            e.printStackTrace()
-                            null
-                        }
+                    exceptionHandler?.let {
+                        action.invoke()
+                    } ?: try {
+                        action.invoke()
+                    } catch (e: Exception) {
+                        e.printStackTrace()
+                        null
+                    }
                 }
                 withContext(Dispatchers.Main) {
-                    afterActionListener?.invoke(asyncResult.await())
+                    onActionComplete?.invoke(asyncResult.await())
                 }
             }
         }

app/src/main/java/com/kunzisoft/keepass/view/SearchFiltersView.kt

@@ -3,7 +3,6 @@ package com.kunzisoft.keepass.view
 import android.content.Context
 import android.util.AttributeSet
 import android.view.LayoutInflater
-import android.view.View
 import android.view.ViewGroup
 import android.widget.CompoundButton
 import android.widget.ImageView
@@ -30,8 +29,10 @@ class SearchFiltersView @JvmOverloads constructor(context: Context,
     private var searchTitle: CompoundButton
     private var searchUsername: CompoundButton
     private var searchPassword: CompoundButton
+    private var searchApplicationId: CompoundButton
     private var searchURL: CompoundButton
     private var searchByURLDomain: Boolean = false
+    private var searchByURLSubDomain: Boolean = false
     private var searchExpired: CompoundButton
     private var searchNotes: CompoundButton
     private var searchOther: CompoundButton
@@ -50,8 +51,10 @@ class SearchFiltersView @JvmOverloads constructor(context: Context,
                 this.searchInTitles = searchTitle.isChecked
                 this.searchInUsernames = searchUsername.isChecked
                 this.searchInPasswords = searchPassword.isChecked
+                this.searchInAppIds = searchApplicationId.isChecked
                 this.searchInUrls = searchURL.isChecked
                 this.searchByDomain = searchByURLDomain
+                this.searchBySubDomain = searchByURLSubDomain
                 this.searchInExpired = searchExpired.isChecked
                 this.searchInNotes = searchNotes.isChecked
                 this.searchInOther = searchOther.isChecked
@@ -71,8 +74,10 @@ class SearchFiltersView @JvmOverloads constructor(context: Context,
             searchTitle.isChecked = value.searchInTitles
             searchUsername.isChecked = value.searchInUsernames
             searchPassword.isChecked = value.searchInPasswords
+            searchApplicationId.isChecked = value.searchInAppIds
             searchURL.isChecked = value.searchInUrls
             searchByURLDomain = value.searchByDomain
+            searchByURLSubDomain = value.searchBySubDomain
             searchExpired.isChecked = value.searchInExpired
             searchNotes.isChecked = value.searchInNotes
             searchOther.isChecked = value.searchInOther
@@ -87,7 +92,7 @@ class SearchFiltersView @JvmOverloads constructor(context: Context,
     var onParametersChangeListener: ((searchParameters: SearchParameters) -> Unit)? = null
     private var mOnParametersChangeListener: ((searchParameters: SearchParameters) -> Unit)? = {
         // To recalculate height
-        if (searchAdvanceFiltersContainer?.visibility == View.VISIBLE) {
+        if (searchAdvanceFiltersContainer?.visibility == VISIBLE) {
             searchAdvanceFiltersContainer?.expand(
                 false,
                 searchAdvanceFiltersContainer?.getFullHeight()
@@ -110,6 +115,7 @@ class SearchFiltersView @JvmOverloads constructor(context: Context,
         searchTitle = findViewById(R.id.search_chip_title)
         searchUsername = findViewById(R.id.search_chip_username)
         searchPassword = findViewById(R.id.search_chip_password)
+        searchApplicationId = findViewById(R.id.search_chip_application_id)
         searchURL = findViewById(R.id.search_chip_url)
         searchExpired = findViewById(R.id.search_chip_expires)
         searchNotes = findViewById(R.id.search_chip_note)
@@ -125,7 +131,7 @@ class SearchFiltersView @JvmOverloads constructor(context: Context,
 
         // Expand menu with button
         searchExpandButton.setOnClickListener {
-            val isVisible = searchAdvanceFiltersContainer?.visibility == View.VISIBLE
+            val isVisible = searchAdvanceFiltersContainer?.visibility == VISIBLE
             if (isVisible)
                 closeAdvancedFilters()
             else
@@ -156,6 +162,10 @@ class SearchFiltersView @JvmOverloads constructor(context: Context,
             searchParameters.searchInPasswords = isChecked
             mOnParametersChangeListener?.invoke(searchParameters)
         }
+        searchApplicationId.setOnCheckedChangeListener { _, isChecked ->
+            searchParameters.searchInAppIds = isChecked
+            mOnParametersChangeListener?.invoke(searchParameters)
+        }
         searchURL.setOnCheckedChangeListener { _, isChecked ->
             searchParameters.searchInUrls = isChecked
             mOnParametersChangeListener?.invoke(searchParameters)
@@ -200,10 +210,10 @@ class SearchFiltersView @JvmOverloads constructor(context: Context,
         searchNumbers.text = SearchHelper.showNumberOfSearchResults(numbers)
     }
 
-    fun setCurrentGroupText(text: String) {
+    fun setCurrentGroupText(text: String?) {
         val maxChars = 12
         searchCurrentGroup.text = when {
-            text.isEmpty() -> context.getString(R.string.current_group)
+            text.isNullOrEmpty() -> context.getString(R.string.current_group)
             text.length > maxChars -> text.substring(0, maxChars) + "…"
             else -> text
         }
@@ -213,6 +223,10 @@ class SearchFiltersView @JvmOverloads constructor(context: Context,
         searchOther.isVisible = available
     }
 
+    fun availableApplicationIds(available: Boolean) {
+        searchApplicationId.isVisible = available
+    }
+
     fun availableTags(available: Boolean) {
         searchTag.isVisible = available
     }
@@ -243,16 +257,20 @@ class SearchFiltersView @JvmOverloads constructor(context: Context,
         )
     }
 
+    fun showSearchExpandButton(show: Boolean) {
+        searchExpandButton.isVisible = show
+    }
+
     override fun setVisibility(visibility: Int) {
         when (visibility) {
-            View.VISIBLE -> {
-                searchAdvanceFiltersContainer?.visibility = View.GONE
+            VISIBLE -> {
+                searchAdvanceFiltersContainer?.visibility = GONE
                 searchContainer.showByFading()
             }
             else -> {
                 searchContainer.hideByFading()
-                if (searchAdvanceFiltersContainer?.visibility == View.VISIBLE) {
-                    searchAdvanceFiltersContainer?.visibility = View.INVISIBLE
+                if (searchAdvanceFiltersContainer?.visibility == VISIBLE) {
+                    searchAdvanceFiltersContainer?.visibility = INVISIBLE
                     searchAdvanceFiltersContainer?.collapse()
                 }
             }

app/src/main/java/com/kunzisoft/keepass/view/ViewUtil.kt

@@ -24,7 +24,6 @@ import android.animation.AnimatorSet
 import android.animation.ValueAnimator
 import android.app.Activity
 import android.content.Context
-import android.content.res.Configuration
 import android.graphics.Color
 import android.graphics.Paint
 import android.graphics.PorterDuff
@@ -66,6 +65,7 @@ import com.kunzisoft.keepass.database.exception.LocalizedException
 import com.kunzisoft.keepass.database.helper.getLocalizedMessage
 import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.tasks.ActionRunnable
+import java.util.EnumSet
 
 
 /**
@@ -317,9 +317,7 @@ fun CollapsingToolbarLayout.changeTitleColor(color: Int) {
 
 @Suppress("DEPRECATION")
 fun Activity.setTransparentNavigationBar(applyToStatusBar: Boolean = false, applyWindowInsets: () -> Unit) {
-    // Only in portrait
-    if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O_MR1
-        && resources.configuration.orientation == Configuration.ORIENTATION_PORTRAIT) {
+    if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O_MR1) {
         WindowCompat.setDecorFitsSystemWindows(window, false)
         window.navigationBarColor = ContextCompat.getColor(this, R.color.surface_selector)
         if (applyToStatusBar) {
@@ -335,7 +333,7 @@ fun Activity.setTransparentNavigationBar(applyToStatusBar: Boolean = false, appl
 /**
  * Apply a margin to a view to fix the window inset
  */
-fun View.applyWindowInsets(position: WindowInsetPosition = WindowInsetPosition.BOTTOM) {
+fun View.applyWindowInsets(positions: EnumSet<WindowInsetPosition>) {
     ViewCompat.setOnApplyWindowInsetsListener(this) { view, windowInsets ->
         var consumed = false
 
@@ -351,52 +349,78 @@ fun View.applyWindowInsets(position: WindowInsetPosition = WindowInsetPosition.B
             }
         }
 
-        val insets = windowInsets.getInsets(WindowInsetsCompat.Type.systemBars())
-        when (position) {
-            WindowInsetPosition.TOP -> {
-                if (view.layoutParams is ViewGroup.MarginLayoutParams) {
-                    view.updateLayoutParams<ViewGroup.MarginLayoutParams> {
-                        topMargin = insets.top
+        val insets = windowInsets.getInsets(WindowInsetsCompat.Type.systemBars()
+                or WindowInsetsCompat.Type.displayCutout()
+                or WindowInsetsCompat.Type.ime())
+
+        val isRtl = layoutDirection == View.LAYOUT_DIRECTION_RTL
+
+        val wantTopMargins = positions.contains(WindowInsetPosition.TOP_MARGINS)
+        val wantBottomMargins = positions.contains(WindowInsetPosition.BOTTOM_MARGINS)
+        val wantStartMargins = positions.contains(WindowInsetPosition.START_MARGINS)
+        val wantEndMargins = positions.contains(WindowInsetPosition.END_MARGINS)
+
+        if (view.layoutParams is ViewGroup.MarginLayoutParams
+                && (wantTopMargins || wantBottomMargins || wantStartMargins || wantEndMargins)) {
+            view.updateLayoutParams<ViewGroup.MarginLayoutParams> {
+                if (wantTopMargins) {
+                    topMargin = insets.top
+                }
+                if (wantBottomMargins) {
+                    bottomMargin = insets.bottom
+                }
+                if (wantStartMargins) {
+                    if (isRtl) {
+                        rightMargin = insets.right
+                    } else {
+                        leftMargin = insets.left
                     }
                 }
-            }
-            WindowInsetPosition.LEGIT_TOP -> {
-                if (view.layoutParams is ViewGroup.MarginLayoutParams) {
-                    view.updateLayoutParams<ViewGroup.MarginLayoutParams> {
-                        topMargin = 0
-                    }
-                }
-            }
-            WindowInsetPosition.BOTTOM -> {
-                if (view.layoutParams is ViewGroup.MarginLayoutParams) {
-                    view.updateLayoutParams<ViewGroup.MarginLayoutParams> {
-                        bottomMargin = insets.bottom
-                    }
-                }
-            }
-            WindowInsetPosition.BOTTOM_IME -> {
-                val imeHeight = windowInsets.getInsets(WindowInsetsCompat.Type.ime()).bottom
-                if (view.layoutParams is ViewGroup.MarginLayoutParams) {
-                    view.updateLayoutParams<ViewGroup.MarginLayoutParams> {
-                        bottomMargin = if (imeHeight > 1) 0 else insets.bottom
-                    }
-                }
-            }
-            WindowInsetPosition.TOP_BOTTOM_IME -> {
-                val imeHeight = windowInsets.getInsets(WindowInsetsCompat.Type.ime()).bottom
-                if (view.layoutParams is ViewGroup.MarginLayoutParams) {
-                    view.updateLayoutParams<ViewGroup.MarginLayoutParams> {
-                        topMargin = insets.top
-                        bottomMargin = if (imeHeight > 1) imeHeight else 0
+                if (wantEndMargins) {
+                    if (isRtl) {
+                        leftMargin = insets.left
+                    } else {
+                        rightMargin = insets.right
                     }
                 }
             }
         }
+
+        val wantTopPadding = positions.contains(WindowInsetPosition.TOP_PADDING)
+        val wantBottomPadding = positions.contains(WindowInsetPosition.BOTTOM_PADDING)
+        val wantStartPadding = positions.contains(WindowInsetPosition.START_PADDING)
+        val wantEndPadding = positions.contains(WindowInsetPosition.END_PADDING)
+
+        if (wantTopPadding || wantBottomPadding || wantStartPadding || wantEndPadding) {
+            val topPadding = if (wantTopPadding) insets.top else 0
+            val bottomPadding = if (wantBottomPadding) insets.bottom else 0
+            var leftPadding = 0
+            var rightPadding = 0
+
+            if (wantStartPadding) {
+                if (isRtl) {
+                    rightPadding = insets.right
+                } else {
+                    leftPadding = insets.left
+                }
+            }
+            if (wantEndPadding) {
+                if (isRtl) {
+                    leftPadding = insets.left
+                } else {
+                    rightPadding = insets.right
+                }
+            }
+
+            setPadding(leftPadding, topPadding, rightPadding, bottomPadding)
+        }
+
         // If any of the children consumed the insets, return an appropriate value
         if (consumed) WindowInsetsCompat.CONSUMED else windowInsets
     }
 }
 
 enum class WindowInsetPosition {
-    TOP, BOTTOM, LEGIT_TOP, BOTTOM_IME, TOP_BOTTOM_IME
+    TOP_MARGINS, BOTTOM_MARGINS, START_MARGINS, END_MARGINS,
+    TOP_PADDING, BOTTOM_PADDING, START_PADDING, END_PADDING,
 }

app/src/main/java/com/kunzisoft/keepass/viewmodels/DatabaseViewModel.kt

@@ -1,214 +1,500 @@
 package com.kunzisoft.keepass.viewmodels
 
-import androidx.lifecycle.LiveData
-import androidx.lifecycle.MutableLiveData
-import androidx.lifecycle.ViewModel
+import android.app.Application
+import android.net.Uri
+import android.os.Bundle
+import androidx.lifecycle.AndroidViewModel
 import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.database.DatabaseTaskProvider
+import com.kunzisoft.keepass.database.MainCredential
+import com.kunzisoft.keepass.database.ProgressMessage
 import com.kunzisoft.keepass.database.crypto.EncryptionAlgorithm
 import com.kunzisoft.keepass.database.crypto.kdf.KdfEngine
+import com.kunzisoft.keepass.database.element.Entry
 import com.kunzisoft.keepass.database.element.Group
+import com.kunzisoft.keepass.database.element.binary.BinaryData
 import com.kunzisoft.keepass.database.element.database.CompressionAlgorithm
+import com.kunzisoft.keepass.database.element.node.Node
+import com.kunzisoft.keepass.database.element.node.NodeId
+import com.kunzisoft.keepass.model.CipherEncryptDatabase
+import com.kunzisoft.keepass.model.SnapFileDatabaseInfo
+import com.kunzisoft.keepass.services.DatabaseTaskNotificationService
 import com.kunzisoft.keepass.tasks.ActionRunnable
+import kotlinx.coroutines.flow.MutableStateFlow
+import kotlinx.coroutines.flow.StateFlow
+import java.util.UUID
 
-class DatabaseViewModel: ViewModel() {
+class DatabaseViewModel(application: Application): AndroidViewModel(application) {
 
-    val database : LiveData<ContextualDatabase?> get() = _database
-    private val _database = MutableLiveData<ContextualDatabase?>()
+    private val mDatabaseState = MutableStateFlow<ContextualDatabase?>(null)
+    val databaseState: StateFlow<ContextualDatabase?> = mDatabaseState
 
-    val actionFinished : LiveData<ActionResult> get() = _actionFinished
-    private val _actionFinished = SingleLiveEvent<ActionResult>()
+    val database: ContextualDatabase?
+        get() = databaseState.value
 
-    val saveDatabase : LiveData<Boolean> get() = _saveDatabase
-    private val _saveDatabase = SingleLiveEvent<Boolean>()
+    private val mActionState = MutableStateFlow<ActionState>(ActionState.Loading)
+    val actionState: StateFlow<ActionState> = mActionState
 
-    val mergeDatabase : LiveData<Boolean> get() = _mergeDatabase
-    private val _mergeDatabase = SingleLiveEvent<Boolean>()
+    private var mDatabaseTaskProvider: DatabaseTaskProvider = DatabaseTaskProvider(
+        context = application
+    )
 
-    val reloadDatabase : LiveData<Boolean> get() = _reloadDatabase
-    private val _reloadDatabase = SingleLiveEvent<Boolean>()
+    init {
+        mDatabaseTaskProvider.onDatabaseRetrieved = { databaseRetrieved ->
+            val databaseWasReloaded = databaseRetrieved?.wasReloaded == true
+            if (databaseWasReloaded) {
+                mActionState.value = ActionState.OnDatabaseReloaded
+            }
+            if (database == null || database != databaseRetrieved || databaseWasReloaded) {
+                databaseRetrieved?.wasReloaded = false
+                mDatabaseState.value = databaseRetrieved
+            }
+        }
+        mDatabaseTaskProvider.onStartActionRequested = { bundle, actionTask ->
+            mActionState.value = ActionState.OnDatabaseActionRequested(bundle, actionTask)
+        }
+        mDatabaseTaskProvider.databaseInfoListener = object : DatabaseTaskNotificationService.DatabaseInfoListener {
+            override fun onDatabaseInfoChanged(
+                previousDatabaseInfo: SnapFileDatabaseInfo,
+                newDatabaseInfo: SnapFileDatabaseInfo,
+                readOnlyDatabase: Boolean
+            ) {
+                mActionState.value = ActionState.OnDatabaseInfoChanged(
+                    previousDatabaseInfo,
+                    newDatabaseInfo,
+                    readOnlyDatabase
+                )
+            }
+        }
+        mDatabaseTaskProvider.actionTaskListener = object : DatabaseTaskNotificationService.ActionTaskListener {
+            override fun onActionStarted(
+                database: ContextualDatabase,
+                progressMessage: ProgressMessage
+            ) {
+                mActionState.value = ActionState.OnDatabaseActionStarted(database, progressMessage)
+            }
 
-    val saveName : LiveData<SuperString> get() = _saveName
-    private val _saveName = SingleLiveEvent<SuperString>()
+            override fun onActionUpdated(
+                database: ContextualDatabase,
+                progressMessage: ProgressMessage
+            ) {
+                mActionState.value = ActionState.OnDatabaseActionUpdated(database, progressMessage)
+            }
 
-    val saveDescription : LiveData<SuperString> get() = _saveDescription
-    private val _saveDescription = SingleLiveEvent<SuperString>()
+            override fun onActionStopped(database: ContextualDatabase?) {
+                mActionState.value = ActionState.OnDatabaseActionStopped(database)
+            }
 
-    val saveDefaultUsername : LiveData<SuperString> get() = _saveDefaultUsername
-    private val _saveDefaultUsername = SingleLiveEvent<SuperString>()
+            override fun onActionFinished(
+                database: ContextualDatabase,
+                actionTask: String,
+                result: ActionRunnable.Result
+            ) {
+                mActionState.value = ActionState.OnDatabaseActionFinished(database, actionTask, result)
+            }
+        }
 
-    val saveColor : LiveData<SuperString> get() = _saveColor
-    private val _saveColor = SingleLiveEvent<SuperString>()
-
-    val saveCompression : LiveData<SuperCompression> get() = _saveCompression
-    private val _saveCompression = SingleLiveEvent<SuperCompression>()
-
-    val removeUnlinkData : LiveData<Boolean> get() = _removeUnlinkData
-    private val _removeUnlinkData = SingleLiveEvent<Boolean>()
-
-    val saveRecycleBin : LiveData<SuperGroup> get() = _saveRecycleBin
-    private val _saveRecycleBin = SingleLiveEvent<SuperGroup>()
-
-    val saveTemplatesGroup : LiveData<SuperGroup> get() = _saveTemplatesGroup
-    private val _saveTemplatesGroup = SingleLiveEvent<SuperGroup>()
-
-    val saveMaxHistoryItems : LiveData<SuperInt> get() = _saveMaxHistoryItems
-    private val _saveMaxHistoryItems = SingleLiveEvent<SuperInt>()
-
-    val saveMaxHistorySize : LiveData<SuperLong> get() = _saveMaxHistorySize
-    private val _saveMaxHistorySize = SingleLiveEvent<SuperLong>()
-
-    val saveEncryption : LiveData<SuperEncryption> get() = _saveEncryption
-    private val _saveEncryption = SingleLiveEvent<SuperEncryption>()
-
-    val saveKeyDerivation : LiveData<SuperKeyDerivation> get() = _saveKeyDerivation
-    private val _saveKeyDerivation = SingleLiveEvent<SuperKeyDerivation>()
-
-    val saveIterations : LiveData<SuperLong> get() = _saveIterations
-    private val _saveIterations = SingleLiveEvent<SuperLong>()
-
-    val saveMemoryUsage : LiveData<SuperLong> get() = _saveMemoryUsage
-    private val _saveMemoryUsage = SingleLiveEvent<SuperLong>()
-
-    val saveParallelism : LiveData<SuperLong> get() = _saveParallelism
-    private val _saveParallelism = SingleLiveEvent<SuperLong>()
-
-
-    fun defineDatabase(database: ContextualDatabase?) {
-        this._database.value = database
+        mDatabaseTaskProvider.registerProgressTask()
     }
 
-    fun onActionFinished(database: ContextualDatabase,
-                         actionTask: String,
-                         result: ActionRunnable.Result) {
-        this._actionFinished.value = ActionResult(database, actionTask, result)
+    /*
+     * Main database actions
+     */
+
+    fun loadDatabase(
+        databaseUri: Uri,
+        mainCredential: MainCredential,
+        readOnly: Boolean,
+        cipherEncryptDatabase: CipherEncryptDatabase?,
+        fixDuplicateUuid: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseLoad(
+            databaseUri,
+            mainCredential,
+            readOnly,
+            cipherEncryptDatabase,
+            fixDuplicateUuid
+        )
     }
 
-    fun saveDatabase(save: Boolean) {
-        _saveDatabase.value = save
+    fun createDatabase(
+        databaseUri: Uri,
+        mainCredential: MainCredential
+    ) {
+        mDatabaseTaskProvider.startDatabaseCreate(databaseUri, mainCredential)
     }
 
-    fun mergeDatabase(save: Boolean) {
-        _mergeDatabase.value = save
+    fun assignMainCredential(
+        databaseUri: Uri?,
+        mainCredential: MainCredential
+    ) {
+        if (databaseUri != null) {
+            mDatabaseTaskProvider.startDatabaseAssignCredential(databaseUri, mainCredential)
+        }
+    }
+
+    fun saveDatabase(save: Boolean, saveToUri: Uri? = null) {
+        mDatabaseTaskProvider.startDatabaseSave(save, saveToUri)
+    }
+
+    fun mergeDatabase(
+        save: Boolean,
+        fromDatabaseUri: Uri? = null,
+        mainCredential: MainCredential? = null
+    ) {
+        mDatabaseTaskProvider.startDatabaseMerge(save, fromDatabaseUri, mainCredential)
     }
 
     fun reloadDatabase(fixDuplicateUuid: Boolean) {
-        _reloadDatabase.value = fixDuplicateUuid
+        mDatabaseTaskProvider.askToStartDatabaseReload(
+            conditionToAsk = database?.dataModifiedSinceLastLoading != false
+        ) {
+            mDatabaseTaskProvider.startDatabaseReload(fixDuplicateUuid)
+        }
     }
 
-    fun saveName(oldValue: String,
-                 newValue: String,
-                 save: Boolean) {
-        _saveName.value = SuperString(oldValue, newValue, save)
+    fun onDatabaseChangeValidated() {
+        mDatabaseTaskProvider.onDatabaseChangeValidated()
     }
 
-    fun saveDescription(oldValue: String,
-                        newValue: String,
-                        save: Boolean) {
-        _saveDescription.value = SuperString(oldValue, newValue, save)
+    /*
+     * Nodes actions
+     */
+
+    fun createEntry(
+        newEntry: Entry,
+        parent: Group,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseCreateEntry(
+            newEntry,
+            parent,
+            save
+        )
     }
 
-    fun saveDefaultUsername(oldValue: String,
-                            newValue: String,
-                            save: Boolean) {
-        _saveDefaultUsername.value = SuperString(oldValue, newValue, save)
+    fun updateEntry(
+        oldEntry: Entry,
+        entryToUpdate: Entry,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseUpdateEntry(
+            oldEntry,
+            entryToUpdate,
+            save
+        )
     }
 
-    fun saveColor(oldValue: String,
-                  newValue: String,
-                  save: Boolean) {
-        _saveColor.value = SuperString(oldValue, newValue, save)
+    fun restoreEntryHistory(
+        mainEntryId: NodeId<UUID>,
+        entryHistoryPosition: Int,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseRestoreEntryHistory(
+            mainEntryId,
+            entryHistoryPosition,
+            save
+        )
     }
 
-    fun saveCompression(oldValue: CompressionAlgorithm,
-                        newValue: CompressionAlgorithm,
-                        save: Boolean) {
-        _saveCompression.value = SuperCompression(oldValue, newValue, save)
+    fun deleteEntryHistory(
+        mainEntryId: NodeId<UUID>,
+        entryHistoryPosition: Int,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseDeleteEntryHistory(
+            mainEntryId,
+            entryHistoryPosition,
+            save
+        )
+    }
+
+    fun createGroup(
+        newGroup: Group,
+        parent: Group,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseCreateGroup(
+            newGroup,
+            parent,
+            save
+        )
+    }
+
+    fun updateGroup(
+        oldGroup: Group,
+        groupToUpdate: Group,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseUpdateGroup(
+            oldGroup,
+            groupToUpdate,
+            save
+        )
+    }
+
+    fun copyNodes(
+        nodesToCopy: List<Node>,
+        newParent: Group,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseCopyNodes(
+            nodesToCopy,
+            newParent,
+            save
+        )
+    }
+
+    fun moveNodes(
+        nodesToMove: List<Node>,
+        newParent: Group,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseMoveNodes(
+            nodesToMove,
+            newParent,
+            save
+        )
+    }
+
+    fun deleteNodes(
+        nodes: List<Node>,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseDeleteNodes(
+            nodes,
+            save
+        )
+    }
+
+    /*
+     * Attributes
+     */
+
+    fun buildNewAttachment(): BinaryData? {
+        return database?.buildNewBinaryAttachment()
+    }
+
+    /*
+     * Settings actions
+     */
+
+    fun saveName(
+        oldValue: String,
+        newValue: String,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseSaveName(
+            oldValue,
+            newValue,
+            save
+        )
+    }
+
+    fun saveDescription(
+        oldValue: String,
+        newValue: String,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseSaveDescription(
+            oldValue,
+            newValue,
+            save
+        )
+    }
+
+    fun saveDefaultUsername(
+        oldValue: String,
+        newValue: String,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseSaveDefaultUsername(
+            oldValue,
+            newValue,
+            save
+        )
+    }
+
+    fun saveColor(
+        oldValue: String,
+        newValue: String,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseSaveColor(
+            oldValue,
+            newValue,
+            save
+        )
+    }
+
+    fun saveCompression(
+        oldValue: CompressionAlgorithm,
+        newValue: CompressionAlgorithm,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseSaveCompression(
+            oldValue,
+            newValue,
+            save
+        )
     }
 
     fun removeUnlinkedData(save: Boolean) {
-        _removeUnlinkData.value = save
+        mDatabaseTaskProvider.startDatabaseRemoveUnlinkedData(save)
     }
 
-    fun saveRecycleBin(oldValue: Group?,
-                       newValue: Group?,
-                       save: Boolean) {
-        _saveRecycleBin.value = SuperGroup(oldValue, newValue, save)
+    fun saveRecycleBin(
+        oldValue: Group?,
+        newValue: Group?,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseSaveRecycleBin(
+            oldValue,
+            newValue,
+            save
+        )
     }
 
-    fun saveTemplatesGroup(oldValue: Group?,
-                           newValue: Group?,
-                           save: Boolean) {
-        _saveTemplatesGroup.value = SuperGroup(oldValue, newValue, save)
+    fun saveTemplatesGroup(
+        oldValue: Group?,
+        newValue: Group?,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseSaveTemplatesGroup(
+            oldValue,
+            newValue,
+            save
+        )
     }
 
-    fun saveMaxHistoryItems(oldValue: Int,
-                            newValue: Int,
-                            save: Boolean) {
-        _saveMaxHistoryItems.value = SuperInt(oldValue, newValue, save)
+    fun saveMaxHistoryItems(
+        oldValue: Int,
+        newValue: Int,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseSaveMaxHistoryItems(
+            oldValue,
+            newValue,
+            save
+        )
     }
 
-    fun saveMaxHistorySize(oldValue: Long,
-                           newValue: Long,
-                           save: Boolean) {
-        _saveMaxHistorySize.value = SuperLong(oldValue, newValue, save)
+    fun saveMaxHistorySize(
+        oldValue: Long,
+        newValue: Long,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseSaveMaxHistorySize(
+            oldValue,
+            newValue,
+            save
+        )
     }
 
 
-    fun saveEncryption(oldValue: EncryptionAlgorithm,
-                       newValue: EncryptionAlgorithm,
-                       save: Boolean) {
-        _saveEncryption.value = SuperEncryption(oldValue, newValue, save)
+    fun saveEncryption(
+        oldValue: EncryptionAlgorithm,
+        newValue: EncryptionAlgorithm,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseSaveEncryption(
+            oldValue,
+            newValue,
+            save
+        )
     }
 
-    fun saveKeyDerivation(oldValue: KdfEngine,
-                          newValue: KdfEngine,
-                          save: Boolean) {
-        _saveKeyDerivation.value = SuperKeyDerivation(oldValue, newValue, save)
+    fun saveKeyDerivation(
+        oldValue: KdfEngine,
+        newValue: KdfEngine,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseSaveKeyDerivation(
+            oldValue,
+            newValue,
+            save
+        )
     }
 
-    fun saveIterations(oldValue: Long,
-                       newValue: Long,
-                       save: Boolean) {
-        _saveIterations.value = SuperLong(oldValue, newValue, save)
+    fun saveIterations(
+        oldValue: Long,
+        newValue: Long,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseSaveIterations(
+            oldValue,
+            newValue,
+            save
+        )
     }
 
-    fun saveMemoryUsage(oldValue: Long,
-                           newValue: Long,
-                           save: Boolean) {
-        _saveMemoryUsage.value = SuperLong(oldValue, newValue, save)
+    fun saveMemoryUsage(
+        oldValue: Long,
+        newValue: Long,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseSaveMemoryUsage(
+            oldValue,
+            newValue,
+            save
+        )
     }
 
-    fun saveParallelism(oldValue: Long,
-                        newValue: Long,
-                        save: Boolean) {
-        _saveParallelism.value = SuperLong(oldValue, newValue, save)
+    fun saveParallelism(
+        oldValue: Long,
+        newValue: Long,
+        save: Boolean
+    ) {
+        mDatabaseTaskProvider.startDatabaseSaveParallelism(
+            oldValue,
+            newValue,
+            save
+        )
     }
 
-    data class ActionResult(val database: ContextualDatabase,
-                            val actionTask: String,
-                            val result: ActionRunnable.Result)
-    data class SuperString(val oldValue: String,
-                           val newValue: String,
-                           val save: Boolean)
-    data class SuperInt(val oldValue: Int,
-                        val newValue: Int,
-                        val save: Boolean)
-    data class SuperLong(val oldValue: Long,
-                         val newValue: Long,
-                         val save: Boolean)
-    data class SuperMerge(val fixDuplicateUuid: Boolean,
-                          val save: Boolean)
-    data class SuperCompression(val oldValue: CompressionAlgorithm,
-                                val newValue: CompressionAlgorithm,
-                                val save: Boolean)
-    data class SuperEncryption(val oldValue: EncryptionAlgorithm,
-                               val newValue: EncryptionAlgorithm,
-                               val save: Boolean)
-    data class SuperKeyDerivation(val oldValue: KdfEngine,
-                                  val newValue: KdfEngine,
-                                  val save: Boolean)
-    data class SuperGroup(val oldValue: Group?,
-                          val newValue: Group?,
-                          val save: Boolean)
+    /*
+     * Hardware Key
+     */
 
+    fun onChallengeResponded(challengeResponse: ByteArray?) {
+        mDatabaseTaskProvider.startChallengeResponded(
+            challengeResponse ?: ByteArray(0)
+        )
+    }
+
+    override fun onCleared() {
+        super.onCleared()
+        mDatabaseTaskProvider.unregisterProgressTask()
+        mDatabaseTaskProvider.destroy()
+    }
+
+    sealed class ActionState {
+        object Loading: ActionState()
+        object OnDatabaseReloaded: ActionState()
+        data class OnDatabaseActionRequested(
+            val bundle: Bundle? = null,
+            val actionTask: String
+        ): ActionState()
+        data class OnDatabaseInfoChanged(
+            val previousDatabaseInfo: SnapFileDatabaseInfo,
+            val newDatabaseInfo: SnapFileDatabaseInfo,
+            val readOnlyDatabase: Boolean
+        ): ActionState()
+        data class OnDatabaseActionStarted(
+            var database: ContextualDatabase,
+            val progressMessage: ProgressMessage
+        ): ActionState()
+        data class OnDatabaseActionUpdated(
+            var database: ContextualDatabase,
+            val progressMessage: ProgressMessage
+        ): ActionState()
+        data class OnDatabaseActionStopped(
+            var database: ContextualDatabase?
+        ): ActionState()
+        data class OnDatabaseActionFinished(
+            var database: ContextualDatabase,
+            val actionTask: String,
+            val result: ActionRunnable.Result
+        ): ActionState()
+    }
 }

app/src/main/java/com/kunzisoft/keepass/viewmodels/EntryEditViewModel.kt

@@ -3,6 +3,7 @@ package com.kunzisoft.keepass.viewmodels
 import android.net.Uri
 import androidx.lifecycle.LiveData
 import androidx.lifecycle.MutableLiveData
+import androidx.lifecycle.viewModelScope
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.element.Attachment
 import com.kunzisoft.keepass.database.element.Entry
@@ -16,10 +17,11 @@ import com.kunzisoft.keepass.model.AttachmentState
 import com.kunzisoft.keepass.model.EntryAttachmentState
 import com.kunzisoft.keepass.model.EntryInfo
 import com.kunzisoft.keepass.model.RegisterInfo
-import com.kunzisoft.keepass.model.SearchInfo
 import com.kunzisoft.keepass.model.StreamDirection
 import com.kunzisoft.keepass.otp.OtpElement
 import com.kunzisoft.keepass.utils.IOActionTask
+import kotlinx.coroutines.flow.MutableStateFlow
+import kotlinx.coroutines.flow.StateFlow
 import java.util.UUID
 
 
@@ -28,12 +30,18 @@ class EntryEditViewModel: NodeEditViewModel() {
     private var mEntryId: NodeId<UUID>? = null
     private var mParentId: NodeId<*>? = null
     private var mRegisterInfo: RegisterInfo? = null
-    private var mSearchInfo: SearchInfo? = null
     private var mParent: Group? = null
     private var mEntry: Entry? = null
     private var mIsTemplate: Boolean = false
     private val mTempAttachments = mutableListOf<EntryAttachmentState>()
 
+    // To show dialog only one time
+    var backPressedAlreadyApproved = false
+    var warningOverwriteDataAlreadyApproved = false
+
+    // Useful to not relaunch a current action
+    private var actionLocked: Boolean = false
+
     val templatesEntry : LiveData<TemplatesEntry?> get() = _templatesEntry
     private val _templatesEntry = MutableLiveData<TemplatesEntry?>()
 
@@ -73,24 +81,28 @@ class EntryEditViewModel: NodeEditViewModel() {
     val onBinaryPreviewLoaded : LiveData<AttachmentPosition> get() = _onBinaryPreviewLoaded
     private val _onBinaryPreviewLoaded = SingleLiveEvent<AttachmentPosition>()
 
-    fun loadDatabase(database: ContextualDatabase?) {
-        loadTemplateEntry(database, mEntryId, mParentId, mRegisterInfo, mSearchInfo)
+    private val mUiState = MutableStateFlow<UIState>(UIState.Loading)
+    val uiState: StateFlow<UIState> = mUiState
+
+    fun loadTemplateEntry(database: ContextualDatabase?) {
+        loadTemplateEntry(database, mEntryId, mParentId, mRegisterInfo)
     }
 
-    fun loadTemplateEntry(database: ContextualDatabase?,
-                          entryId: NodeId<UUID>?,
-                          parentId: NodeId<*>?,
-                          registerInfo: RegisterInfo?,
-                          searchInfo: SearchInfo?) {
+    fun loadTemplateEntry(
+        database: ContextualDatabase?,
+        entryId: NodeId<UUID>?,
+        parentId: NodeId<*>?,
+        registerInfo: RegisterInfo?
+    ) {
         this.mEntryId = entryId
         this.mParentId = parentId
         this.mRegisterInfo = registerInfo
-        this.mSearchInfo = searchInfo
 
         database?.let {
             mEntryId?.let {
                 IOActionTask(
-                    {
+                    scope = viewModelScope,
+                    action = {
                         // Create an Entry copy to modify from the database entry
                         mEntry = database.getEntryById(it)
                         // Retrieve the parent
@@ -105,21 +117,24 @@ class EntryEditViewModel: NodeEditViewModel() {
                                 database,
                                 entry,
                                 mIsTemplate,
-                                registerInfo,
-                                searchInfo
+                                registerInfo
                             )
                         }
                     },
-                    { templatesEntry ->
+                    onActionComplete = { templatesEntry ->
                         mEntryId = null
                         _templatesEntry.value = templatesEntry
+                        if (templatesEntry?.overwrittenData == true) {
+                            mUiState.value = UIState.ShowOverwriteMessage
+                        }
                     }
                 ).execute()
             }
 
             mParentId?.let {
                 IOActionTask(
-                    {
+                    scope = viewModelScope,
+                    action = {
                         mParent = database.getGroupById(it)
                         mParent?.let { parentGroup ->
                             mEntry = database.createEntry()?.apply {
@@ -145,12 +160,11 @@ class EntryEditViewModel: NodeEditViewModel() {
                                 database,
                                 mEntry,
                                 mIsTemplate,
-                                registerInfo,
-                                searchInfo
+                                registerInfo
                             )
                         }
                     },
-                    { templatesEntry ->
+                    onActionComplete = { templatesEntry ->
                         mParentId = null
                         _templatesEntry.value = templatesEntry
                     }
@@ -159,33 +173,37 @@ class EntryEditViewModel: NodeEditViewModel() {
         }
     }
 
-    private fun decodeTemplateEntry(database: ContextualDatabase,
-                                    entry: Entry?,
-                                    isTemplate: Boolean,
-                                    registerInfo: RegisterInfo?,
-                                    searchInfo: SearchInfo?): TemplatesEntry {
+    private fun decodeTemplateEntry(
+        database: ContextualDatabase,
+        entry: Entry?,
+        isTemplate: Boolean,
+        registerInfo: RegisterInfo?
+    ): TemplatesEntry {
         val templates = database.getTemplates(isTemplate)
         val entryTemplate = entry?.let { database.getTemplate(it) }
                 ?: Template.STANDARD
         var entryInfo: EntryInfo? = null
+        var overwrittenData = false
         // Decode the entry / load entry info
         entry?.let {
             database.decodeEntryWithTemplateConfiguration(it).let { entry ->
                 // Load entry info
                 entry.getEntryInfo(database, true).let { tempEntryInfo ->
                     // Retrieve data from registration
-                    // TODO only save registration
-                    searchInfo?.let { tempSearchInfo ->
-                        tempEntryInfo.saveSearchInfo(database, tempSearchInfo)
-                    }
                     registerInfo?.let { regInfo ->
-                        tempEntryInfo.saveRegisterInfo(database, regInfo)
+                        overwrittenData = tempEntryInfo.saveRegisterInfo(database, regInfo)
                     }
                     entryInfo = tempEntryInfo
                 }
             }
         }
-        return TemplatesEntry(isTemplate, templates, entryTemplate, entryInfo)
+        return TemplatesEntry(
+            isTemplate,
+            templates,
+            entryTemplate,
+            entryInfo,
+            overwrittenData
+        )
     }
 
     fun changeTemplate(template: Template) {
@@ -198,44 +216,52 @@ class EntryEditViewModel: NodeEditViewModel() {
         _requestEntryInfoUpdate.value = EntryUpdate(database, mEntry, mParent)
     }
 
+    fun unlockAction() {
+        actionLocked = false
+    }
+
     fun saveEntryInfo(database: ContextualDatabase?, entry: Entry?, parent: Group?, entryInfo: EntryInfo) {
-        IOActionTask(
-            {
-                removeTempAttachmentsNotCompleted(entryInfo)
-                entry?.let { oldEntry ->
-                    // Create a clone
-                    var newEntry = Entry(oldEntry)
+        if (actionLocked.not()) {
+            actionLocked = true
+            IOActionTask(
+                scope = viewModelScope,
+                action = {
+                    removeTempAttachmentsNotCompleted(entryInfo)
+                    entry?.let { oldEntry ->
+                        // Create a clone
+                        var newEntry = Entry(oldEntry)
 
-                    // Build info
-                    newEntry.setEntryInfo(database, entryInfo)
+                        // Build info
+                        newEntry.setEntryInfo(database, entryInfo)
 
-                    // Encode entry properties for template
-                    _onTemplateChanged.value?.let { template ->
-                        newEntry =
-                            database?.encodeEntryWithTemplateConfiguration(newEntry, template)
-                                ?: newEntry
-                    }
+                        // Encode entry properties for template
+                        _onTemplateChanged.value?.let { template ->
+                            newEntry =
+                                database?.encodeEntryWithTemplateConfiguration(newEntry, template)
+                                    ?: newEntry
+                        }
 
-                    // Delete temp attachment if not used
-                    mTempAttachments.forEach { tempAttachmentState ->
-                        val tempAttachment = tempAttachmentState.attachment
-                        database?.attachmentPool?.let { binaryPool ->
-                            if (!newEntry.getAttachments(binaryPool).contains(tempAttachment)) {
-                                database.removeAttachmentIfNotUsed(tempAttachment)
+                        // Delete temp attachment if not used
+                        mTempAttachments.forEach { tempAttachmentState ->
+                            val tempAttachment = tempAttachmentState.attachment
+                            database?.attachmentPool?.let { binaryPool ->
+                                if (!newEntry.getAttachments(binaryPool).contains(tempAttachment)) {
+                                    database.removeAttachmentIfNotUsed(tempAttachment)
+                                }
                             }
                         }
-                    }
 
-                    // Return entry to save
-                    EntrySave(oldEntry, newEntry, parent)
+                        // Return entry to save
+                        EntrySave(oldEntry, newEntry, parent)
+                    }
+                },
+                onActionComplete = { entrySave ->
+                    entrySave?.let {
+                        _onEntrySaved.value = it
+                    }
                 }
-            },
-            { entrySave ->
-                entrySave?.let {
-                    _onEntrySaved.value = it
-                }
-            }
-        ).execute()
+            ).execute()
+        }
     }
 
     private fun removeTempAttachmentsNotCompleted(entryInfo: EntryInfo) {
@@ -322,10 +348,13 @@ class EntryEditViewModel: NodeEditViewModel() {
         _onBinaryPreviewLoaded.value = AttachmentPosition(entryAttachmentState, viewPosition)
     }
 
-    data class TemplatesEntry(val isTemplate: Boolean,
-                              val templates: List<Template>,
-                              val defaultTemplate: Template,
-                              val entryInfo: EntryInfo?)
+    data class TemplatesEntry(
+        val isTemplate: Boolean,
+        val templates: List<Template>,
+        val defaultTemplate: Template,
+        val entryInfo: EntryInfo?,
+        val overwrittenData: Boolean = false
+    )
     data class EntryUpdate(val database: ContextualDatabase?, val entry: Entry?, val parent: Group?)
     data class EntrySave(val oldEntry: Entry, val newEntry: Entry, val parent: Group?)
     data class FieldEdition(val oldField: Field?, val newField: Field?)
@@ -333,6 +362,11 @@ class EntryEditViewModel: NodeEditViewModel() {
     data class AttachmentUpload(val attachmentToUploadUri: Uri, val attachment: Attachment)
     data class AttachmentPosition(val entryAttachmentState: EntryAttachmentState, val viewPosition: Float)
 
+    sealed class UIState {
+        object Loading: UIState()
+        object ShowOverwriteMessage: UIState()
+    }
+
     companion object {
         private val TAG = EntryEditViewModel::class.java.name
     }

app/src/main/res/layout/activity_entry.xml

@@ -20,6 +20,7 @@
 <androidx.constraintlayout.widget.ConstraintLayout xmlns:android="http://schemas.android.com/apk/res/android"
     xmlns:app="http://schemas.android.com/apk/res-auto"
     xmlns:tools="http://schemas.android.com/tools"
+    android:id="@+id/activity_entry_container"
     android:layout_width="match_parent"
     android:layout_height="match_parent"
     android:filterTouchesWhenObscured="true">

app/src/main/res/layout/view_search_filters.xml

@@ -101,6 +101,13 @@
                 android:checked="false"
                 style="@style/KeepassDXStyle.Chip.Filter"
                 android:text="@string/entry_password"/>
+            <com.google.android.material.chip.Chip
+                android:id="@+id/search_chip_application_id"
+                android:layout_width="wrap_content"
+                android:layout_height="wrap_content"
+                android:checked="false"
+                style="@style/KeepassDXStyle.Chip.Filter"
+                android:text="@string/entry_application_id"/>
             <com.google.android.material.chip.Chip
                 android:id="@+id/search_chip_url"
                 android:layout_width="wrap_content"

app/src/main/res/values-ar/strings.xml

@@ -335,7 +335,7 @@
     <string name="device_unlock_explanation_summary">استخدم إلغاء القفل الجهاز لفتح قاعدة البيانات بسهولة</string>
     <string name="lock_database_show_button_summary">يعرض زر القَفل في الواجهة</string>
     <string name="lock_database_show_button_title">أظهر زر القفل</string>
-    <string name="lock_database_back_root_summary">قفل قاعدة البيانات عند النقر على زر الرجوع في الشاشة الرئيسية</string>
+    <string name="lock_database_back_root_summary">اضغط على \"رجوع\" لقفل قاعدة البيانات إذا كنت في الشاشة الجذر لقاعدة البيانات</string>
     <string name="lock_database_back_root_title">اضغط على \"رجوع\" للإقفال</string>
     <string name="clipboard_explanation_summary">انسخ حقول المدخل باستخدام الحافظة</string>
     <string name="database_opened">قاعدة البيانات مفتوحة</string>
@@ -452,7 +452,6 @@
     <string name="menu_form_filling_settings">ملء النموذج</string>
     <string name="menu_reload_database">أعد تحميل البيانات</string>
     <string name="menu_external_icon">أيقونة خارجية</string>
-    <string name="registration_mode">وضع التسجيل</string>
     <string name="import_app_properties_title">استورد خصائص التطبيق</string>
     <string name="import_app_properties_summary">اختر ملفًا لاستيراد إعدادات التطبيق</string>
     <string name="export_app_properties_title">صدّر إعدادات التطبيق</string>
@@ -643,8 +642,8 @@
     <string name="show_uuid_title">أظهر \"المعرّف العام المميز\" UUID</string>
     <string name="unlock_and_link_biometric">رابط فتح الجهاز</string>
     <string name="device_unlock_invalid_key">لا يمكن قراءة مفتاح فتح الجهاز. يرجى حذفه وتكرار إجراء التعرف على الفتح.</string>
-    <string name="menu_appearance_settings_summary">المظاهر والألوان والسمات</string>
-    <string name="autofill_explanation_summary">تمكين الملء التلقائي لملء النماذج بسرعة في التطبيقات الأخرى</string>
+    <string name="menu_appearance_settings_summary">المظاهر والألوان والأيقونات والخطوط والسمات</string>
+    <string name="autofill_explanation_summary">اضبط الملء التلقائي لملء النماذج بسرعة في التطبيقات الأخرى</string>
     <string name="device_credential_unlock_enable_summary">يتيح لك استخدام بيانات اعتماد جهازك لفتح قاعدة البيانات</string>
     <string name="unlock">فتح</string>
     <string name="menu_app_settings_summary">البحث، القفل، التاريخ، الخصائص</string>
@@ -692,4 +691,45 @@
     <string name="warning_large_keyfile">لا يُنصح بإضافة ملف مفتاحي كبير، فقد يؤدي هذا إلى منع فتح قاعدة البيانات.</string>
     <string name="hide_templates_title">أخفِ القوالب</string>
     <string name="error_otp_secret_length">يجب أن يتكوّن المفتاح السري من %1$d أحرف على الأقل.</string>
+    <string name="entry_application_id">معرّف التطبيق</string>
+    <string name="warning_overwrite_data_title">أتريد الكتابة فوق البيانات الموجودة؟</string>
+    <string name="warning_overwrite_data_description">سيؤدي هذا الإجراء إلى استبدال البيانات الموجودة في الإدخال، ويمكنك استرداد البيانات القديمة إذا كانت المحفوظات مفعلة.</string>
+    <string name="credential_provider">موفّر بيانات الاعتماد</string>
+    <string name="passkeys">مفاتيح المرور</string>
+    <string name="passkeys_explanation_summary">اضبط مفاتيح المرور لتسجيل دخول سريع وآمن بدون كلمة سر</string>
+    <string name="passkeys_preference_title">إعدادات مفاتيح المرور</string>
+    <string name="passkeys_close_database_title">أغلق قاعدة البيانات</string>
+    <string name="passkeys_close_database_summary">أغلق قاعدة البيانات بعد اختيار مفتاح المرور</string>
+    <string name="passkeys_privileged_apps_title">التطبيقات المتميزة</string>
+    <string name="passkeys_privileged_apps_summary">أدر المتصفحات في القائمة المخصّصة للتطبيقات المتميزة</string>
+    <string name="passkeys_privileged_apps_explanation">تحذير: يعمل تطبيق مميز كبوابة لاسترداد أصل الاستيثاق. تأكد من شرعيته لتجنب المشكلات الأمنية.</string>
+    <string name="passkeys_privileged_apps_ask_title">التطبيق غير معروف</string>
+    <string name="passkeys_privileged_apps_ask_message">يحاول %1$s تنفيذ إجراء مفتاح المرور.\n\nأتريد إضافته إلى قائمة التطبيقات المتميزة؟</string>
+    <string name="passkeys_missing_signature_app_ask_title">التوقيع مفقود</string>
+    <string name="passkeys_missing_signature_app_ask_explanation">تحذير: أُنشئ مفتاح المرور من عميل آخر أو حُذف التوقيع. تأكد من أن التطبيق الذي تريد الاستيثاق عليه جزء من نفس الخدمة وأنه شرعي لتجنب المشكلات الأمنية.\nإذا كان التطبيق متصفحًا، فلا تضف توقيعه إلى الإدخال، بل إلى قائمة التطبيقات الموثوقة في الإعدادات.</string>
+    <string name="passkeys_missing_signature_app_ask_message">%1$s غير معروف ويحاول الاستيثاق باستخدام مفتاح مرور موجود.</string>
+    <string name="passkeys_missing_signature_app_ask_question">إضافة توقيع التطبيق إلى إدخال مفتاح المرور؟</string>
+    <string name="passkeys_auto_select_title">تحديد تلقائي</string>
+    <string name="passkeys_auto_select_summary">حدّد تلقائي إذا كان هناك إدخال واحد فقط وقاعدة البيانات مفتوحة، فقط إذا كان التطبيق الطالب متوافقًا</string>
+    <string name="passkeys_backup_eligibility_title">أهلية النسخ الاحتياطي</string>
+    <string name="passkeys_backup_eligibility_summary">تحديد وقت الإنشاء ما إذا كان مسموحًا بنسخ مصدر بيانات اعتماد المفتاح العام احتياطيًا</string>
+    <string name="passkeys_backup_state_title">حالة النسخ الاحتياطي</string>
+    <string name="passkeys_backup_state_summary">أشر إلى أن بيانات الاعتماد مدعومة ومحمية ضد فقدان جهاز واحد</string>
+    <string name="credential_provider_service_subtitle">مفاتيح المرور، موفّر بيانات اعتماد الملء التلقائي</string>
+    <string name="passkey">مفتاح المرور</string>
+    <string name="passkey_service_name">موفّر بيانات اعتماد KeePassDX</string>
+    <string name="passkey_creation_description">احفظ مفتاح المرور في مدخل جديد</string>
+    <string name="passkey_update_description">حدِّث مفتاح المرور في %1$s</string>
+    <string name="passkey_selection_username">لم يُعثر على مفتاح مرور</string>
+    <string name="passkey_selection_description">حدّد مفتاح مرور موجود</string>
+    <string name="passkey_database_username">قاعدة بيانات KeePassDX</string>
+    <string name="passkey_locked_database_description">حدّد لفتح القفل</string>
+    <string name="passkey_username">اسم مستخدم مفتاح المرور</string>
+    <string name="passkey_private_key">المفتاح الخاص لمفتاح المرور</string>
+    <string name="passkey_credential_id">معرّف بيانات مفتاح المرور</string>
+    <string name="passkey_user_handle">معرّف مستخدم مفتاح المرور</string>
+    <string name="passkey_relying_party">الطرف المعتمد لمفتاح المرور</string>
+    <string name="passkey_backup_eligibility">أهلية النسخ الاحتياطي لمفتاح المرور</string>
+    <string name="passkey_backup_state">حالة النسخ الاحتياطي لمفتاح المرور</string>
+    <string name="error_passkey_result">تعذر إرجاع مفتاح المرور</string>
 </resources>

app/src/main/res/values-az/strings.xml

@@ -485,7 +485,6 @@
     <string name="search_mode">Axtarış modu</string>
     <string name="save_mode">Yadda saxlama modu</string>
     <string name="selection_mode">Seçim modu</string>
-    <string name="registration_mode">Qeydiyyat modu</string>
     <string name="remember_database_locations_title">Məlumat bazalarının yerlərini xatırlayın</string>
     <string name="remember_database_locations_summary">Məlumat bazalarının harada saxlanıldığını izlə</string>
     <string name="remember_hardware_key_summary">Aparat-təchizat açarlarının harada istifadə olunduğunu izlə</string>

app/src/main/res/values-b+sr+Latn/strings.xml

@@ -336,7 +336,6 @@
     <string name="menu_keystore_remove_key">Izbrišite ključ za otključavanje uređaja</string>
     <string name="subdomain_search_summary">Pretražujte veb domene sa ograničenjima poddomena</string>
     <string name="export_app_properties_title">Izvezite podešavanja aplikacije</string>
-    <string name="registration_mode">Režim registracije</string>
     <string name="remember_database_locations_title">Zapamtite lokacije baza podataka</string>
     <string name="remember_hardware_key_title">Zapamtite hardverske ključeve</string>
     <string name="remember_hardware_key_summary">Vodi evidenciju o korišćenim hardverskim ključevima</string>

app/src/main/res/values-be/strings.xml

@@ -296,7 +296,6 @@
     <string name="search_mode">Рэжым пошуку</string>
     <string name="save_mode">Рэжым захавання</string>
     <string name="selection_mode">Рэжым выбару</string>
-    <string name="registration_mode">Рэжым рэгістрацыі</string>
     <string name="remember_database_locations_title">Запамінаць размяшчэнне баз дадзеных</string>
     <string name="remember_database_locations_summary">Адсочвае, дзе захоўваюцца базы дадзеных</string>
     <string name="remember_keyfile_locations_title">Запамінаць размяшчэнне файлаў ключоў</string>

app/src/main/res/values-bg/strings.xml

@@ -232,7 +232,7 @@
     <string name="auto_focus_search_title">Бързо търсене</string>
     <string name="subdomain_search_title">Търсене на поддомейни</string>
     <string name="menu_delete">Изтриване</string>
-    <string name="menu_appearance_settings_summary">Теми, цветове, атрибути</string>
+    <string name="menu_appearance_settings_summary">Теми, цветове, икони, шрифтове, атрибути</string>
     <string name="download_initialization">Подготвяне…</string>
     <string name="content_description_entry_background_color">Цвят на фона на запис</string>
     <string name="html_about_licence">KeePassDX © %1$d Kunzisoft е приложение с &lt;strong&gt;отворен код&lt;/strong&gt; и &lt;strong&gt;без реклами&lt;/strong&gt;. \nРазпространява се под лиценза &lt;strong&gt;GPLv3&lt;/strong&gt; без каквато и да е гаранция.</string>
@@ -283,11 +283,11 @@
     <string name="search">Търсене</string>
     <string name="uppercase">Горен регистър</string>
     <string name="warning">Внимание</string>
-    <string name="lock_database_back_root_summary">Заключва хранилището при докосване на бутона „Назад“ на началния екран</string>
+    <string name="lock_database_back_root_summary">Бутонът „Назад“ в кореновата папка заключва хранилището</string>
     <string name="read_only">Само за четене</string>
     <string name="contains_duplicate_uuid">Хранилището съдържа повтарящ се идентификатор.</string>
     <string name="biometric">Биометричен ключ</string>
-    <string name="set_credential_provider_service_title">Задаване на подразбирана услуга за автоматично попълване</string>
+    <string name="set_credential_provider_service_title">Услуга за автоматично попълване на регистрации</string>
     <string name="password_size_title">Дължина на създаваните пароли</string>
     <string name="lock_database_back_root_title">Заключване при „Назад“</string>
     <string name="content">Съдържание</string>
@@ -398,7 +398,7 @@
     <string name="education_search_summary">Търсете по заглавие, потребител или съдържание на други полета, за да намерите своите пароли.</string>
     <string name="html_about_contribution">За &lt;strong&gt;запазване на нашата независимост&lt;/strong&gt;, &lt;strong&gt;отстраняване на дефекти&lt;/strong&gt;, &lt;strong&gt;добавяне на нови възможности&lt;/strong&gt; и &lt;strong&gt;поддържане на активна разработка&lt;/strong&gt;, разчитаме на вашата &lt;strong&gt;поддръжка&lt;/strong&gt;.</string>
     <string name="lock_database_show_button_title">Бутон за заключване</string>
-    <string name="autofill_explanation_summary">Включете услугата за попълване на формуляри в други приложения</string>
+    <string name="autofill_explanation_summary">Настройки на услугата за попълване на формуляри в други приложения</string>
     <string name="properties">Свойства</string>
     <string name="education_validate_entry_summary">Не забравяйте да потвърдите записа и да го запазите в хранилището.
 \n
@@ -462,7 +462,6 @@
     <string name="error_invalid_OTP">Неприемлива тайна за OTP.</string>
     <string name="error_no_name">Въведете име.</string>
     <string name="hide_broken_locations_summary">Скрива вече несъществуващи хранилища от списъка с последно отваряните</string>
-    <string name="registration_mode">Режим регистрация</string>
     <string name="remember_database_locations_title">Запомняне използваните хранилища</string>
     <string name="show_recent_files_title">Показване на последните хранилища</string>
     <string name="search_mode">Режим търсене</string>
@@ -654,7 +653,7 @@
     <string name="biometric_auto_open_prompt_summary">Автоматична заявка за отключване на устройството ако хранилището се отключва с устройството</string>
     <string name="allow_copy_password_summary">Разрешава копиране на паролите и защитените полета от записите в междинната памет</string>
     <string name="error_rebuild_list">Списъкът не може да бъде изграден отново.</string>
-    <string name="error_otp_type">Формулярът не разпознава този вид OTP и може да не създава правилни кодове за достъп.</string>
+    <string name="error_otp_type">Формулярът не разпознава този вид OTP и може да не създава верни кодове за достъп.</string>
     <string name="warning_keyfile_integrity">Отпечатъкът от файла не е сигурен, защото Андроид може да променя данните в движение. Променете разширението на файла на .bin, за бъде невредим.</string>
     <string name="allow_copy_password_title">Доверяване на междинната памет</string>
     <string name="warning_exact_alarm">Приложението няма права за използване на точен будилник. В резултат на това дейностите, които зависят от него няма да се изпълняват на време.</string>
@@ -682,4 +681,45 @@
     <string name="hide_templates_summary">Шаблоните не се показват</string>
     <string name="hide_templates_title">Скриване на шаблоните</string>
     <string name="error_otp_secret_length">Тайният ключ трябва да бъде най-малко %1$d знаци.</string>
+    <string name="entry_application_id">Идент. приложение</string>
+    <string name="warning_overwrite_data_title">Презаписване на информация?</string>
+    <string name="warning_overwrite_data_description">Чрез това действие ще бъде презаоисана информация на записа. Може да намерите старите данни ако историята е включена.</string>
+    <string name="credential_provider">Доставчик на регистрации</string>
+    <string name="passkeys">Ключове за достъп</string>
+    <string name="passkeys_explanation_summary">Настройки на ключове за достъп за бърз и сигурен вход без парола</string>
+    <string name="passkeys_preference_title">Настройки на ключове за достъп</string>
+    <string name="passkeys_close_database_title">Затваряне на хранилище</string>
+    <string name="passkeys_close_database_summary">Затваряне на хранилището след избор на ключ за достъп</string>
+    <string name="passkeys_privileged_apps_explanation">ВНИМАНИЕ: Привилегированото приложение работи като шлюз, който получава източника на удостоверяването. За да избегнете проблеми със сигурността се уверете в неговата автентичност.</string>
+    <string name="passkeys_privileged_apps_title">Привилегировани приложения</string>
+    <string name="passkeys_privileged_apps_summary">Управление на мрежови четци в потребителския списък с привилегировани приложения</string>
+    <string name="passkeys_privileged_apps_ask_title">Неразпознато приложение</string>
+    <string name="passkeys_privileged_apps_ask_message">Приложението „%1$s“ опитва да извърши действия с ключ за достъп .\n\nДа бъде ли добавено в списъка с привилегировани приложения?</string>
+    <string name="passkeys_missing_signature_app_ask_title">Липсващ подпис</string>
+    <string name="passkeys_missing_signature_app_ask_message">Приложението „%1$s“ не е разпознато, но се опитва да извърши удостоверяване с ключ за достъп.</string>
+    <string name="passkeys_missing_signature_app_ask_question">Добавяне на подпис към запис на ключ за достъп?</string>
+    <string name="passkeys_auto_select_title">Автоматичен избор</string>
+    <string name="passkeys_auto_select_summary">Работи при отключено хранилище, съвпадение на един запис и съвместимо запитващо приложение</string>
+    <string name="passkeys_backup_eligibility_title">Възможност за резервно копие</string>
+    <string name="passkeys_backup_eligibility_summary">Настройка, определяща още при създаване разрешението за резервно копие на публичния ключ на източника на регистрацията</string>
+    <string name="passkeys_backup_state_title">Наличие на резервно копие</string>
+    <string name="passkeys_backup_state_summary">Указва дали регистрацията е включена в резервно копие и е защитена от загуба на едно устройство</string>
+    <string name="credential_provider_service_subtitle">Услуга за автоматично попълване на ключове за достъп и регистрации</string>
+    <string name="passkey">Ключ за достъп</string>
+    <string name="passkey_service_name">Доставчик на регистрации на KeePassDX</string>
+    <string name="passkey_creation_description">Запазване ключа за достъп в друг запис</string>
+    <string name="passkey_update_description">Обновяване ключа за достъп в/ъв %1$s</string>
+    <string name="passkey_selection_username">Ключ за достъп не е намерен</string>
+    <string name="passkey_selection_description">Изберете съществуващ ключ за достъп</string>
+    <string name="passkey_database_username">Хранилище на KeePassDX</string>
+    <string name="passkey_locked_database_description">Изберете за отключване</string>
+    <string name="passkey_username">Потребител на ключа за достъп</string>
+    <string name="passkey_private_key">Частен ключ на ключа за достъп</string>
+    <string name="passkey_credential_id">Идент. на регистрация на ключа за достъп</string>
+    <string name="passkey_user_handle">Идент. на потребител на ключа за достъп</string>
+    <string name="passkey_backup_eligibility">Възможност за резервно копие на ключа за достъп</string>
+    <string name="passkey_backup_state">Състояние на резервно копие на ключа за достъп</string>
+    <string name="error_passkey_result">Грешка при връщане на ключ за достъп</string>
+    <string name="passkey_relying_party">Доверяваща страна на ключа за достъп</string>
+    <string name="passkeys_missing_signature_app_ask_explanation">ВНИМАНИЕ: Ключът за достъп е създаден от друг клиент или подписът е премахнат. За да избегнете проблеми със сигурността се уверете, че приложението, което удостоверявате е част от същата услуга и е автентично.\nАко приложението е мрежов четец не добавяйте подписа му към записа, а в настройките го добавете в списъка с привилегировани приложения.</string>
 </resources>

app/src/main/res/values-bn/strings.xml

@@ -209,7 +209,6 @@
     <string name="search_mode">অনুসন্ধান মোড</string>
     <string name="save_mode">সেভ মোড</string>
     <string name="selection_mode">নির্বাচন মোড</string>
-    <string name="registration_mode">রেজিস্ট্রেশন মোড</string>
     <string name="remember_keyfile_locations_summary">কী ফাইলগুলি কোথায় সংরক্ষণ করা হয় তা ট্র্যাক রাখে</string>
     <string name="show_recent_files_title">সাম্প্রতিক ফাইল দেখান</string>
     <string name="show_recent_files_summary">সাম্প্রতিক ডাটাবেসের অবস্থান দেখান</string>

app/src/main/res/values-ca/strings.xml

@@ -347,7 +347,6 @@
     <string name="place_of_issue">Lloc d\'expedició</string>
     <string name="style_brightness_summary">Escull tema clar o fosc</string>
     <string name="hardware_key">Clau física</string>
-    <string name="registration_mode">Mode de registre</string>
     <string name="ignore_chars_filter">Ignora caràcters</string>
     <string name="ask">Pregunta</string>
     <string name="searchable">Cercable</string>

app/src/main/res/values-cs/strings.xml

@@ -180,8 +180,8 @@
     <string name="general">Obecné</string>
     <string name="autofill">Samovyplnění</string>
     <string name="autofill_sign_in_prompt">Přihlásit se s KeePassDX</string>
-    <string name="set_credential_provider_service_title">Nastavit výchozí službu samovyplnění</string>
-    <string name="autofill_explanation_summary">Zapnout samovyplnění formulářů za účelem rychlého vyplnění v ostatních aplikacích</string>
+    <string name="set_credential_provider_service_title">Služba poskytovatele údajů</string>
+    <string name="autofill_explanation_summary">Nastavit automatické vyplnění formulářů za účelem rychlého vyplnění v ostatních aplikacích</string>
     <string name="password_size_title">Délka generovaného hesla</string>
     <string name="password_size_summary">Nastavení výchozí délky generovaných hesel</string>
     <string name="list_password_generator_options_title">Znaky hesla</string>
@@ -206,7 +206,7 @@
     <string name="assign_master_key">Přiřadit hlavní klíč</string>
     <string name="create_keepass_file">Vytvořit nový trezor</string>
     <string name="recycle_bin_title">Využití koše</string>
-    <string name="recycle_bin_summary">Před smazáním přesune vybrané položky do skupiny s názvem \"Koš\"</string>
+    <string name="recycle_bin_summary">Před smazáním přesune vybrané záznamy do skupiny s názvem „Koš“</string>
     <string name="monospace_font_fields_enable_title">Písmo kolonek</string>
     <string name="monospace_font_fields_enable_summary">Čitelnost znaků v kolonkách můžete přizpůsobit změnou písma</string>
     <string name="allow_copy_password_title">Důvěřovat schránce</string>
@@ -283,9 +283,9 @@
     <string name="keyboard_setting_label">Magikeyboard nastavení</string>
     <string name="keyboard_entry_category">Záznam</string>
     <string name="keyboard_entry_timeout_title">Časový limit</string>
-    <string name="keyboard_entry_timeout_summary">Doba uchování položky v Magikeyboardu</string>
+    <string name="keyboard_entry_timeout_summary">Doba uchování položky v klávesnici</string>
     <string name="keyboard_notification_entry_title">Informace o oznámení</string>
-    <string name="keyboard_notification_entry_summary">Zobrazit oznámení, když je položka dostupná</string>
+    <string name="keyboard_notification_entry_summary">Zobrazit oznámení, když je záznam dostupný</string>
     <string name="keyboard_notification_entry_content_title_text">Záznam</string>
     <string name="keyboard_notification_entry_content_title">%1$s dostupné v Magikeyboardu</string>
     <string name="keyboard_notification_entry_content_text">%1$s</string>
@@ -299,7 +299,7 @@
     <string name="selection_mode">Režim výběru</string>
     <string name="do_not_kill_app">Nezavírejte aplikaci…</string>
     <string name="lock_database_back_root_title">K uzamknutí stiskněte Zpět</string>
-    <string name="lock_database_back_root_summary">Zamknout obrazovku, pokud uživatel stiskne tlačítko Zpět v hlavním panelu</string>
+    <string name="lock_database_back_root_summary">Stiskněte „Zpět“ pro uzamčení databáze, pokud se nacházíte na hlavní obrazovce databáze</string>
     <string name="clear_clipboard_notification_title">Vymazat při ukončení</string>
     <string name="clear_clipboard_notification_summary">Uzamknout databázi, jakmile trvání schránky vyprší nebo po uzavření oznámení</string>
     <string name="recycle_bin">Koš</string>
@@ -480,7 +480,6 @@
     <string name="biometric_security_update_required">Vyžadována aktualizace biometrického zabezpečení.</string>
     <string name="configure_biometric">Žádné přihlašovací ani biometrické údaje nejsou registrovány.</string>
     <string name="warning_empty_recycle_bin">Trvale odstranit všechny uzly z koše\?</string>
-    <string name="registration_mode">Registrace</string>
     <string name="save_mode">Režim ukládání</string>
     <string name="search_mode">Vyhledávání</string>
     <string name="error_field_name_already_exists">Jméno kolonky již existuje.</string>
@@ -525,7 +524,7 @@
     <string name="unit_mebibyte">MiB</string>
     <string name="unit_kibibyte">KiB</string>
     <string name="unit_byte">B</string>
-    <string name="error_otp_type">Nemohu rozpoznat existující typ OTP v této formě, jeho validace patrně nebude generovat správný token.</string>
+    <string name="error_otp_type">Nemohu rozpoznat existující typ OTP v této formě a jeho validace patrně nebude generovat správný token.</string>
     <string name="download_canceled">Zrušeno!</string>
     <string name="icon_section_custom">Vlastní</string>
     <string name="icon_section_standard">Standardní</string>
@@ -680,7 +679,7 @@
     <string name="ask">Zeptat se</string>
     <string name="configure">Nastavit</string>
     <string name="unlock_and_link_biometric">Propojení s odemykáním zařízení</string>
-    <string name="menu_appearance_settings_summary">Motivy, barvy, atributy</string>
+    <string name="menu_appearance_settings_summary">Motivy, barvy, ikony, písma, atributy</string>
     <string name="unlock">Odemknout</string>
     <string name="education_validate_entry_title">Ověřit vstup</string>
     <string name="education_validate_entry_summary">Nezapomeňte ověřit svůj vstup a uložit databázi.
@@ -706,4 +705,45 @@
     <string name="hide_templates_title">Skrýt šablony</string>
     <string name="hide_templates_summary">Šablony nejsou zobrazeny</string>
     <string name="error_otp_secret_length">Tajný klíč musí obsahovat alespoň %1$d znaků.</string>
+    <string name="entry_application_id">ID aplikace</string>
+    <string name="warning_overwrite_data_title">Přepsat existující data?</string>
+    <string name="warning_overwrite_data_description">Tato akce nahradí existující data v položce, pokud je povolena historie, můžete původní data získat.</string>
+    <string name="credential_provider">Poskytovatel údajů</string>
+    <string name="passkeys">Přístupové klíče</string>
+    <string name="passkeys_explanation_summary">Nastavte přístupové klíče pro rychlé a bezpečné přihlášení bez hesla</string>
+    <string name="passkeys_preference_title">Nastavení přístupových klíčů</string>
+    <string name="passkeys_close_database_title">Zavřít databázi</string>
+    <string name="passkeys_close_database_summary">Zavřít databázi po výběru přístupového klíče</string>
+    <string name="passkeys_privileged_apps_title">Privilegované aplikace</string>
+    <string name="passkeys_privileged_apps_summary">Spravovat prohlížeče ve vlastním seznamu privilegovaných aplikací</string>
+    <string name="passkeys_privileged_apps_explanation">VAROVÁNÍ: Privilegovaná aplikace funguje jako brána k získání původu autentifikace. Ujistěte se, že se jedná o důvěryhodnou aplikaci, pro zabránění bezpečnostním problémům.</string>
+    <string name="passkeys_privileged_apps_ask_title">Aplikace nerozpoznána</string>
+    <string name="passkeys_privileged_apps_ask_message">%1$s se pokouší provést akci přísupového klíče.\n\nChcete ji přidat do seznamu privilegovaných aplikací?</string>
+    <string name="passkeys_missing_signature_app_ask_title">Chybějící podpis</string>
+    <string name="passkeys_missing_signature_app_ask_explanation">VAROVÁNÍ: Přístupový klíč byl vytvořen z jiného klienta nebo byl vymazán podpis. Ujistěte se, že aplikace, kterou chcete autentifikovat, je součástí stejné služby a že je legitimní pro zabránění bezpečnostním problémům.\nPokud je aplikace prohlížeč, nepřidávejte její podpis do záznamu, ale do seznamu privilegovaných aplikací v nastavení.</string>
+    <string name="passkeys_missing_signature_app_ask_message">%1$s je nerozpoznaná a pokouší se o autentifikaci s existujícím přístupovým klíčem.</string>
+    <string name="passkeys_missing_signature_app_ask_question">Přidat podpis aplikace do záznamu přístupového klíče?</string>
+    <string name="passkeys_auto_select_title">Automatický výběr</string>
+    <string name="passkeys_auto_select_summary">Automaticky vybrat, pokud existuje pouze jeden záznam a aplikace je otevřená, pouze pokud je žádající aplikace kompatibilní</string>
+    <string name="passkeys_backup_eligibility_title">Možnost zálohy</string>
+    <string name="passkeys_backup_eligibility_summary">Při vytváření určit, zda je povoleno zálohovat zdroj ověřovacích údajů veřejného klíče</string>
+    <string name="passkeys_backup_state_title">Stav zálohy</string>
+    <string name="passkeys_backup_state_summary">Uvést, že přihlašovací údaje jsou zálohovány a chráněny proti ztrátě jednoho zařízení</string>
+    <string name="credential_provider_service_subtitle">Přístupové klíče, poskytovatel automatického vyplnění</string>
+    <string name="passkey">Přístupový klíč</string>
+    <string name="passkey_service_name">Poskytovatel údajů KeePassDX</string>
+    <string name="passkey_creation_description">Uložit přístupový klíč do nového záznamu</string>
+    <string name="passkey_update_description">Aktualizovat přístupový klíč v %1$s</string>
+    <string name="passkey_selection_username">Nenalezeny žádné přístupové klíče</string>
+    <string name="passkey_selection_description">Vyberte existující přístupový klíč</string>
+    <string name="passkey_database_username">Databáze KeePassDX</string>
+    <string name="passkey_locked_database_description">Vyberte k odemčení</string>
+    <string name="passkey_username">Uživatelské jméno přístupového klíče</string>
+    <string name="passkey_private_key">Soukromý klíč přístupového klíče</string>
+    <string name="passkey_credential_id">ID údaje přístupového klíče</string>
+    <string name="passkey_user_handle">Uživatelská adresa přístupového klíče</string>
+    <string name="passkey_relying_party">Strana předávající přístupový klíč</string>
+    <string name="passkey_backup_eligibility">Způsobilost přístupového klíče k zálohování</string>
+    <string name="passkey_backup_state">Stav zálohy přístupového klíče</string>
+    <string name="error_passkey_result">Nepodařilo se vrátit přístupový klíč</string>
 </resources>

app/src/main/res/values-da/strings.xml

@@ -475,7 +475,6 @@
 \n
 \nDatabasen kan blive meget stor og reducere ydeevnen med denne overførelse.</string>
     <string name="warning_empty_recycle_bin">Slet alle noder permanent fra papirkurven\?</string>
-    <string name="registration_mode">Registreringstilstand</string>
     <string name="save_mode">Gem-tilstand</string>
     <string name="search_mode">Søgetilstand</string>
     <string name="error_registration_read_only">Det er ikke tilladt at gemme et nyt element i en skrivebeskyttet database.</string>

app/src/main/res/values-de/strings.xml

@@ -153,7 +153,7 @@
     <string name="menu_appearance_settings">Erscheinungsbild</string>
     <string name="password_size_title">Generierte Passwortlänge</string>
     <string name="password_size_summary">Legt die Standardlänge des generierten Passworts fest</string>
-    <string name="clipboard_notifications_title">Kopier-Benachrichtigung</string>
+    <string name="clipboard_notifications_title">Kopierbenachrichtigung</string>
     <string name="clipboard_notifications_summary">Benachrichtigung anzeigen, um beim Betrachten eines Eintrags Felder kopieren zu können</string>
     <string name="lock_database_screen_off_title">Bildschirmsperre</string>
     <string name="lock_database_screen_off_summary">Datenbank wenige Sekunden nach Bildschirmabschaltung sperren</string>
@@ -197,7 +197,7 @@
     <string name="autofill">Automatisches Ausfüllen</string>
     <string name="autofill_sign_in_prompt">Mit KeePassDX anmelden</string>
     <string name="set_credential_provider_service_title">Standard-Autofill-Service festlegen</string>
-    <string name="autofill_explanation_summary">Automatisches Ausfüllen aktivieren, um Formulare in anderen Apps schnell auszufüllen</string>
+    <string name="autofill_explanation_summary">Automatisches Ausfüllen konfigurieren, um Formulare in anderen Apps schnell auszufüllen</string>
     <string name="autofill_select_entry">Eintrag auswählen …</string>
     <string name="clipboard">Zwischenablage</string>
     <string name="biometric_delete_all_key_title">Verschlüsselungsschlüssel löschen</string>
@@ -223,8 +223,8 @@
     <string name="reset_education_screens_summary">Alle Hilfsinfos nochmal anzeigen</string>
     <string name="reset_education_screens_text">Hilfeanzeige zurückgesetzt</string>
     <string name="education_create_database_title">Datenbankdatei erstellen</string>
-    <string name="education_create_database_summary">Erste Datei zur Passwortverwaltung erstellen.</string>
-    <string name="education_select_database_title">Existierende Datenbank öffnen</string>
+    <string name="education_create_database_summary">Eine erste Datei zur Passwortverwaltung erstellen.</string>
+    <string name="education_select_database_title">Vorhandene Datenbank öffnen</string>
     <string name="education_select_database_summary">Öffnet über den Dateimanager eine früher erstellte Datenbankdatei, um sie weiterzuverwenden.</string>
     <string name="education_new_node_title">Datenbankelemente hinzufügen</string>
     <string name="education_new_node_summary">Einträge helfen, digitale Konten zu verwalten.
@@ -257,7 +257,7 @@
     <string name="html_text_dev_feature_buy_pro">Durch den Kauf der &lt;strong&gt;Pro-Version&lt;/strong&gt;,</string>
     <string name="html_text_dev_feature_contibute">Durch deinen &lt;strong&gt;Beitrag&lt;/strong&gt;,</string>
     <string name="html_text_dev_feature_encourage">ermutigst du die Entwickler, &lt;strong&gt;neue Funktionen&lt;/strong&gt; einzuführen und gemäß deinen Anmerkungen &lt;strong&gt;Fehler zu beheben&lt;/strong&gt;.</string>
-    <string name="html_text_dev_feature_thanks">Vielen Dank für deine Unterstützung.</string>
+    <string name="html_text_dev_feature_thanks">Vielen Dank für die Unterstützung.</string>
     <string name="html_text_dev_feature_work_hard">Wir bemühen uns, diese Funktion bald zu veröffentlichen.</string>
     <string name="html_text_dev_feature_upgrade">Denke daran, die App durch die Installation neuer Versionen auf dem aktuellsten Stand zu halten.</string>
     <string name="download">Download</string>
@@ -312,7 +312,7 @@
     <string name="hide_broken_locations_title">Defekte Datenbankverknüpfungen ausblenden</string>
     <string name="hide_broken_locations_summary">Defekte Verknüpfungen in der Liste der zuletzt verwendeten Datenbanken ausblenden</string>
     <string name="do_not_kill_app">App nicht beenden …</string>
-    <string name="lock_database_back_root_summary">Datenbank sperren, wenn auf dem Hauptbildschirm die Taste „Zurück“ gedrückt wird</string>
+    <string name="lock_database_back_root_summary">„Zurück“ drücken, um die Datenbank zu sperren, wenn man sich auf dem Hauptbildschirm der Datenbank befindet</string>
     <string name="clear_clipboard_notification_title">Beim Schließen löschen</string>
     <string name="recycle_bin">Papierkorb</string>
     <string name="keyboard_selection_entry_title">Eintragsauswahl</string>
@@ -486,7 +486,6 @@
     <string name="notification">Benachrichtigung</string>
     <string name="biometric_security_update_required">Biometrische Sicherheitsaktualisierung erforderlich.</string>
     <string name="configure_biometric">Es sind weder Biometrie- noch Geräteanmeldedaten registriert.</string>
-    <string name="registration_mode">Registrierungsmodus</string>
     <string name="save_mode">Speichermodus</string>
     <string name="search_mode">Suchmodus</string>
     <string name="error_registration_read_only">Speichern eines neuen Elements in einer schreibgeschützten Datenbank ist unzulässig.</string>
@@ -509,7 +508,7 @@
     <string name="temp_device_unlock_timeout_title">Ablauf der Geräteentsperrung</string>
     <string name="temp_device_unlock_enable_summary">Bei Nutzung der Geräteentsperrung keine verschlüsselten Inhalte speichern</string>
     <string name="temp_device_unlock_enable_title">Zeitlich begrenzte Geräteentsperrung</string>
-    <string name="device_credential_unlock_enable_summary">Ermöglicht das Öffnen der Datenbank mit deinen Geräteanmeldedaten</string>
+    <string name="device_credential_unlock_enable_summary">Ermöglicht das Öffnen der Datenbank mit den persönlichen Geräteanmeldedaten</string>
     <string name="device_unlock_tap_delete">Drücken, um alle Geräteentsperrschlüssel zu löschen</string>
     <string name="content">Inhalt</string>
     <string name="device_unlock_prompt_extract_credential_title">Datenbank mit Geräteentsperrdaten öffnen</string>
@@ -537,7 +536,7 @@
     <string name="error_upload_file">Beim Hochladen der Datei ist ein Fehler aufgetreten.</string>
     <string name="import_app_properties_title">App-Einstellungen importieren</string>
     <string name="error_start_database_action">Beim Ausführen einer Aktion in der Datenbank ist ein Fehler aufgetreten.</string>
-    <string name="error_otp_type">Der vorhandene OTP-Typ wird von diesem Formular nicht erkannt, seine Validierung kann Token möglicherweise nicht mehr korrekt erzeugen.</string>
+    <string name="error_otp_type">Der vorhandene OTP-Typ wird von diesem Formular nicht erkannt, und seine Validierung kann Token möglicherweise nicht mehr korrekt erzeugen.</string>
     <string name="content_description_otp_information">Informationen zu Einmalpasswörtern</string>
     <string name="warning_database_revoked">Auf die Datei kann nicht zugegriffen werden. Bitte die Datenbank schließen und von ihrem Speicherort aus erneut öffnen.</string>
     <string name="error_export_app_properties">Fehler beim Exportieren der App-Einstellungen.</string>
@@ -683,7 +682,7 @@
     <string name="ask">Fragen</string>
     <string name="later">Später</string>
     <string name="unlock_and_link_biometric">Geräteentsperrverknüpfung</string>
-    <string name="menu_appearance_settings_summary">Design, Farben, Attribute</string>
+    <string name="menu_appearance_settings_summary">Design, Farben, Symbole, Schriftarten, Attribute</string>
     <string name="warning_database_notification_permission">Die Benachrichtigungsberechtigung ermöglicht es, den Status der Datenbank anzuzeigen und sie mit einer leicht zugänglichen Taste zu sperren.
 \n
 \nWird diese Berechtigung nicht aktiviert, ist die im Hintergrund geöffnete Datenbank nicht sichtbar, wenn eine Anwendung im Vordergrund läuft.</string>
@@ -705,4 +704,28 @@
     <string name="recursive_number_entries_title">Rekursive Anzahl der Einträge</string>
     <string name="generate_keyfile">Schlüsseldatei generieren</string>
     <string name="error_otp_secret_length">Geheimschlüssel muss mindestens %1$d Zeichen lang sein.</string>
+    <string name="entry_application_id">App-ID</string>
+    <string name="warning_overwrite_data_title">Bestehende Daten überschreiben?</string>
+    <string name="warning_overwrite_data_description">Diese Aktion ersetzt die bestehenden Daten im Eintrag. Die alten Daten können wiederhergestellt werden, wenn der Verlauf aktiviert ist.</string>
+    <string name="passkeys">Passkeys</string>
+    <string name="passkeys_preference_title">Passkeys-Einstellungen</string>
+    <string name="passkeys_close_database_title">Datenbank schließen</string>
+    <string name="passkeys_privileged_apps_title">Vertrauliche Apps</string>
+    <string name="passkeys_missing_signature_app_ask_title">Signatur fehlt</string>
+    <string name="passkeys_auto_select_title">Automatische Auswahl</string>
+    <string name="passkeys_backup_eligibility_title">Backup-Erlaubnis</string>
+    <string name="passkeys_backup_state_title">Backup-Status</string>
+    <string name="passkeys_privileged_apps_ask_title">App nicht erkannt</string>
+    <string name="passkey">Passkey</string>
+    <string name="passkey_selection_username">Kein Passkey gefunden</string>
+    <string name="passkey_creation_description">Passkey in neuem Eintrag speichern</string>
+    <string name="passkey_update_description">Passkey in %1$s aktualisieren</string>
+    <string name="passkey_selection_description">Vorhandenen Passkey auswählen</string>
+    <string name="passkey_database_username">KeePassDX-Datenbank</string>
+    <string name="passkey_username">Passkey-Benutzername</string>
+    <string name="passkey_backup_state">Passkey-Backup-Status</string>
+    <string name="passkey_backup_eligibility">Passkey-Backup-Erlaubnis</string>
+    <string name="passkeys_close_database_summary">Datenbank nach der Passwortauswahl schließen</string>
+    <string name="credential_provider">Anmeldeinformationsanbieter</string>
+    <string name="passkeys_explanation_summary">Passkeys für eine schnelle und sichere Anmeldung ohne Passwort konfigurieren</string>
 </resources>

app/src/main/res/values-el/strings.xml

@@ -19,7 +19,7 @@
 --><resources>
     <string name="feedback">Σχόλια</string>
     <string name="homepage">Αρχική Σελίδα</string>
-    <string name="about_description">Το KeePassDX είναι μία εφαρμογή Android του διαχειριστή κωδικών KeePass</string>
+    <string name="about_description">Υλοποίηση του διαχειριστή κωδικών πρόσβασης KeePass για Android.</string>
     <string name="accept">Αποδοχή</string>
     <string name="add_entry">Προσθήκη καταχώρησης</string>
     <string name="add_group">Προσθήκη ομάδας</string>
@@ -479,7 +479,6 @@
     <string name="biometric_security_update_required">Απαιτείται ενημέρωση βιομετρικής ασφάλειας.</string>
     <string name="configure_biometric">Κανένα πιστοποιητικό βιομετρίας ή συσκευής δεν είναι εγγεγραμμένο.</string>
     <string name="warning_empty_recycle_bin">Να διαγραφούν οριστικά όλοι οι κόμβοι από τον κάδο ανακύκλωσης;</string>
-    <string name="registration_mode">Τρόπος εγγραφής</string>
     <string name="save_mode">Λειτουργία αποθήκευσης</string>
     <string name="search_mode">Λειτουργία αναζήτησης</string>
     <string name="error_registration_read_only">Η αποθήκευση ενός νέου αντικειμένου δεν επιτρέπεται σε μια βάση δεδομένων μόνο για ανάγνωση.</string>

app/src/main/res/values-es/strings.xml

@@ -21,7 +21,7 @@
 --><resources>
     <string name="feedback">Comentarios</string>
     <string name="homepage">Página de inicio</string>
-    <string name="about_description">Implementación para Android del gestor de contraseñas KeePass</string>
+    <string name="about_description">Implementación para Android del gestor de contraseñas KeePass.</string>
     <string name="accept">Aceptar</string>
     <string name="add_entry">Añadir apunte</string>
     <string name="add_group">Añadir grupo</string>
@@ -452,7 +452,6 @@
     <string name="configure_biometric">No se ha inscrito ninguna credencial biométrica o del dispositivo.</string>
     <string name="warning_empty_keyfile_explanation">El contenido del archivo de clave nunca debe modificarse y, en el mejor de los casos, debe contener datos generados al azar.</string>
     <string name="warning_empty_recycle_bin">¿Borrar permanentemente todos los nodos de la papelera de reciclaje\?</string>
-    <string name="registration_mode">Modo de registro</string>
     <string name="save_mode">Modo de guardado</string>
     <string name="search_mode">Modo de búsqueda</string>
     <string name="contains_duplicate_uuid_procedure">¿Solucionar el problema generando nuevos UUID para que los duplicados continúen?</string>
@@ -690,4 +689,5 @@
     <string name="generate_keyfile">Generar archivo de claves</string>
     <string name="recursive_number_entries_title">Número recursivo de entradas</string>
     <string name="hide_templates_summary">Las plantillas no se muestran</string>
+    <string name="error_otp_secret_length">La clave secreta debe tener al menos %1$d caracteres.</string>
 </resources>

app/src/main/res/values-et/strings.xml

@@ -383,7 +383,6 @@
     <string name="search_mode">Otsinguviis</string>
     <string name="save_mode">Salvestusviis</string>
     <string name="selection_mode">Valikuviis</string>
-    <string name="registration_mode">Registreerimisviis</string>
     <string name="invalid_credentials">Salasõna või võtmefaili ei õnnestunud lugeda.</string>
     <string name="protection">Kaitse</string>
     <string name="underline">Allajoonitud</string>
@@ -404,7 +403,7 @@
     <string name="database_history">Ajalugu</string>
     <string name="properties">Omadused</string>
     <string name="menu_appearance_settings">Välimus</string>
-    <string name="menu_appearance_settings_summary">Välimus, värvid, omadused</string>
+    <string name="menu_appearance_settings_summary">Välimus, värvid, ikoonid, kirjatüübid, omadused</string>
     <string name="html_text_dev_feature_upgrade">Ära unusta paigaldada viimaseid versioone ja tagada, et rakendus on alati uuendatud.</string>
     <string name="at_least_one_char">Vähemalt üks tähemärk igast</string>
     <string name="exclude_ambiguous_chars">Välista mitmetähenduslikud tähemärgid</string>
@@ -453,7 +452,7 @@
     <string name="lock_database_screen_off_summary">Mõni sekund peale ekraani väljalülitumist lukusta andmebaas</string>
     <string name="lock_database_back_root_title">Vajuta nuppu „Tagasi“</string>
     <string name="lock_database_show_button_title">Näita lukustuse nuppu</string>
-    <string name="lock_database_back_root_summary">Lukusta andmebaas peale juurkaustas „Tagasi“ nupu klõpsimist</string>
+    <string name="lock_database_back_root_summary">Kui sa pole andmebaasi juurkasutas, siis lukusta andmebaas peale „Tagasi“ nupu klõpsimist</string>
     <string name="allow_copy_password_title">Lõikelaua usaldamine</string>
     <string name="allow_copy_password_summary">Luba sisestatud salasõna ja kaitstud väljade kopeerimise lõikelauale</string>
     <string name="education_unlock_title">Eemalda oma andmebaasi lukustus</string>
@@ -471,7 +470,7 @@
     <string name="allow_copy_password_warning">Hoiatus: süsteemiülene lõikelaud on kõikide rakenduste kasutuses. Kui sa kopeerid sinna delikaatseid andmeid, siis muu tarkvara võib seda seal näha. Kui sa kasutad KDE Connecti või muud lõikelaua jagamise teenust, siis sõltuvalt seadistustest võivad need delikaatsed andmed olla nähtavad ka muudes seadmetes.</string>
     <string name="warning_database_revoked">Failihaldur on blokeerinud ligipääsu failile. Sulge andmebaas ja ava ta uuesti oma asukohast.</string>
     <string name="autofill_sign_in_prompt">Logi sisse KeePassDX abil</string>
-    <string name="autofill_explanation_summary">Täitmaks andmevorme teistes rakenduses, luba automaattäite teenus</string>
+    <string name="autofill_explanation_summary">Täitmaks andmevorme teistes rakenduses, seadista automaattäite teenus</string>
     <string name="autofill_select_entry">Vali kirje…</string>
     <string name="set_credential_provider_service_title">Vali vaikimisi kasutatav automaattäite teenus</string>
     <string name="autofill_preference_title">Automaattäite teenuse seadistused</string>
@@ -663,4 +662,8 @@
     <string name="keyboard_previous_fill_in_summary">Peale tegevust „Automaatne võtmetoiming“ lülita automaatselt tagasi eelmisele klahvistikule</string>
     <string name="education_read_only_summary">Saad juhtida sessioonil kasutatavat avamisviisi.\n\n„Kirjutuskaitstud“ tagab, et juhuslike muudatustega ei läheks andmeid kaotsi.\n„Muudetav“ võimaldab sul lisada, kustutada või muuta kõiki andmebaasi kirjeid.</string>
     <string name="error_otp_secret_length">Salavõti peab olema vähemalt %1$d tähemärki pikk.</string>
+    <string name="entry_application_id">Rakenduse tunnus</string>
+    <string name="passkeys_close_database_title">Sulge andmebaas</string>
+    <string name="passkeys_privileged_apps_ask_title">Rakendust ei õnnestu tuvastada</string>
+    <string name="warning_overwrite_data_title">Kas soovid olemasolevad andmed üle kirjutada?</string>
 </resources>