Merge branch 'release/4.2.4'

Currently translated at 100.0% (3 of 3 strings)

Translation: KeePassDX/Metadata
Translate-URL: https://hosted.weblate.org/projects/keepass-dx/metadata/ru/

.gitignore

@@ -19,6 +19,9 @@ bin/
 gen/
 out/
 
+# Kotlin folder
+.kotlin/
+
 # Gradle files
 .gradle/
 build/

CHANGELOG

@@ -1,3 +1,35 @@
+KeePassDX(4.2.4)
+ * Fix remembering database location #2262
+
+KeePassDX(4.2.3)
+ * Fix multiple Passkey selection #2253
+ * Fix database dialog subtitle #2254
+ * Fix save search info if URL present #2255
+ * Small fixes
+
+KeePassDX(4.2.2)
+ * Fix database merge algorithm #2223
+ * Fix save search info #2243
+ * Fix Play Service as privileged app for Passkey Cross Device Authentication #2244
+ * Small fixes
+
+KeePassDX(4.2.1)
+ * Fix Magikeyboard autosearch #2233
+ * Fix database merge #2223
+ * Fix dialog database action #2234
+ * Fix autofill selection #2238 #2235
+ * Small fixes
+
+KeePassDX(4.2.0)
+ * Passkeys management #1421 #2097 (@cali-95)
+ * Confirm usage of passkey #2165 #2124
+ * Dialog to manage missing signature #2152 #2155 #2161 #2160
+ * Capture error #2159 #2215
+ * Change Passkey Backup Eligibility & Backup State #2135 #2150 #2212
+ * Search settings #2112 #2181 #2187 #2204
+ * Autofill refactoring #765 #2196
+ * Small fixes #2157 #2164 #2171 #2122 #2180 #2209 #2214
+
 KeePassDX(4.1.9)
  * Fix landscape UI #2198 #2200 (@chenxiaolong)
  * Fix start loop and flash screen #2201

README.md

@@ -6,19 +6,21 @@
 
 ### Features
 
- - Create database files / entries and groups.
- - Support for **.kdb** and **.kdbx** files (version 1 to 4) with AES - Twofish - ChaCha20 - Argon2 algorithm.
- - **Compatible** with the majority of alternative programs (KeePass, KeePassXC, KeeWeb, …).
+ - **Passkeys** for authentication and **local storage of private keys**.
+ - **Biometric recognition** for fast unlocking (fingerprint / face unlock / …).
+ - **One-Time Password** management (HOTP / TOTP) for two-factor authentication (2FA).
+ - **Autofill** for easy form filling with passwords.
+ - **Magikeyboard** to efficiently fill in any field.
+ - Create **encrypted database files**.
+ - Organisation of credentials by **entry** and in **group** trees.
  - Allows opening and **copying URI / URL fields quickly**.
- - **Biometric recognition** for fast unlocking *(fingerprint / face unlock / …)*.
- - **One-Time Password** management *(HOTP / TOTP)* for Two-factor authentication (2FA).
- - Material design with **themes**.
- - **Auto-Fill** and Integration.
- - Field filling **keyboard**.
- - Dynamic **templates** 
+ - Dynamic **templates**  for each type of entry.
  - **History** of each entry.
  - Precise management of **settings**.
- - Code written in **native languages** *(Kotlin / Java / JNI / C)*.
+ - Material design with **themes**.
+ - Support for **.kdb** and **.kdbx** files (version 1 to 4) with AES - Twofish - ChaCha20 - Argon2 algorithm.
+ - **Compatible** with the majority of alternative programs (KeePass, KeePassXC, KeeWeb, …).
+ - Code written in **native languages** (Kotlin / Java / JNI / C).
 
 KeePassDX is **open source** and **ad-free**.
 

app/build.gradle

@@ -11,8 +11,8 @@ android {
         applicationId "com.kunzisoft.keepass"
         minSdkVersion 19
         targetSdkVersion 35
-        versionCode = 143
-        versionName = "4.1.9"
+        versionCode = 149
+        versionName = "4.2.4"
         multiDexEnabled true
 
         testApplicationId = "com.kunzisoft.keepass.tests"
@@ -35,6 +35,10 @@ android {
         }
     }
 
+    buildFeatures {
+        buildConfig true
+    }
+
     dependenciesInfo {
         // Disables dependency metadata when building APKs.
         includeInApk = false
@@ -101,6 +105,11 @@ android {
     buildFeatures {
         buildConfig true
     }
+
+    packaging {
+        // Bouncy castle bug https://github.com/bcgit/bc-java/issues/1685
+        resources.pickFirsts.add('META-INF/versions/9/OSGI-INF/MANIFEST.MF')
+    }
 }
 
 def room_version = "2.5.1"
@@ -140,7 +149,10 @@ dependencies {
     implementation 'commons-codec:commons-codec:1.15'
     // Password generator
     implementation 'me.gosimple:nbvcxz:1.5.0'
-    
+
+    // Credentials Provider
+    implementation "androidx.credentials:credentials:1.2.2"
+
     // Modules import
     implementation project(path: ':database')
     implementation project(path: ':icon-pack')

app/src/free/assets/passkeys_privileged_apps_community.json

@@ -0,0 +1,76 @@
+{
+  "apps": [
+    {
+      "type": "android",
+      "info": {
+        "package_name": "io.github.forkmaintainers.iceraven",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "9C:0D:22:37:9F:48:7B:70:A4:F9:F8:BE:C0:17:3C:F9:1A:16:44:F0:8F:93:38:5B:5B:78:2C:E3:76:60:BA:81"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.chromium.chrome",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "A8:56:48:50:79:BC:B3:57:BF:BE:69:BA:19:A9:BA:43:CD:0A:D9:AB:22:67:52:C7:80:B6:88:8A:FD:48:21:6B"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.cromite.cromite",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "63:3F:A4:1D:82:11:D6:D0:91:6A:81:9B:89:66:8C:6D:E9:2E:64:23:2D:A6:7F:9D:16:FD:81:C3:B7:E9:23:FF"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.ironfoxoss.ironfox",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "C5:E2:91:B5:A5:71:F9:C8:CD:9A:97:99:C2:C9:4E:02:EC:97:03:94:88:93:F2:CA:75:6D:67:B9:42:04:F9:04"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.ironfoxoss.ironfox.nightly",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "C5:E2:91:B5:A5:71:F9:C8:CD:9A:97:99:C2:C9:4E:02:EC:97:03:94:88:93:F2:CA:75:6D:67:B9:42:04:F9:04"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.mozilla.fennec_fdroid",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "06:66:53:58:EF:D8:BA:05:BE:23:6A:47:A1:2C:B0:95:8D:7D:75:DD:93:9D:77:C2:B3:1F:53:98:53:7E:BD:C5"
+          }
+        ]
+      }
+    }
+  ]
+}

app/src/free/assets/passkeys_privileged_apps_google.json

@@ -0,0 +1,820 @@
+{
+  "apps": [
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.android.chrome",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "F0:FD:6C:5B:41:0F:25:CB:25:C3:B5:33:46:C8:97:2F:AE:30:F8:EE:74:11:DF:91:04:80:AD:6B:2D:60:DB:83"
+          },
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "19:75:B2:F1:71:77:BC:89:A5:DF:F3:1F:9E:64:A6:CA:E2:81:A5:3D:C1:D1:D5:9B:1D:14:7F:E1:C8:2A:FA:00"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.chrome.beta",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "DA:63:3D:34:B6:9E:63:AE:21:03:B4:9D:53:CE:05:2F:C5:F7:F3:C5:3A:AB:94:FD:C2:A2:08:BD:FD:14:24:9C"
+          },
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "3D:7A:12:23:01:9A:A3:9D:9E:A0:E3:43:6A:B7:C0:89:6B:FB:4F:B6:79:F4:DE:5F:E7:C2:3F:32:6C:8F:99:4A"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.chrome.dev",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "90:44:EE:5F:EE:4B:BC:5E:21:DD:44:66:54:31:C4:EB:1F:1F:71:A3:27:16:A0:BC:92:7B:CB:B3:92:33:CA:BF"
+          },
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "3D:7A:12:23:01:9A:A3:9D:9E:A0:E3:43:6A:B7:C0:89:6B:FB:4F:B6:79:F4:DE:5F:E7:C2:3F:32:6C:8F:99:4A"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.chrome.canary",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "20:19:DF:A1:FB:23:EF:BF:70:C5:BC:D1:44:3C:5B:EA:B0:4F:3F:2F:F4:36:6E:9A:C1:E3:45:76:39:A2:4C:FC"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.chromium.chrome",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "C6:AD:B8:B8:3C:6D:4C:17:D2:92:AF:DE:56:FD:48:8A:51:D3:16:FF:8F:2C:11:C5:41:02:23:BF:F8:A7:DB:B3"
+          },
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "19:75:B2:F1:71:77:BC:89:A5:DF:F3:1F:9E:64:A6:CA:E2:81:A5:3D:C1:D1:D5:9B:1D:14:7F:E1:C8:2A:FA:00"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.google.android.apps.chrome",
+        "signatures": [
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "19:75:B2:F1:71:77:BC:89:A5:DF:F3:1F:9E:64:A6:CA:E2:81:A5:3D:C1:D1:D5:9B:1D:14:7F:E1:C8:2A:FA:00"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.mozilla.fennec_webauthndebug",
+        "signatures": [
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "BD:AE:82:02:80:D2:AF:B7:74:94:EF:22:58:AA:78:A9:AE:A1:36:41:7E:8B:C2:3D:C9:87:75:2E:6F:48:E8:48"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.mozilla.firefox",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "A7:8B:62:A5:16:5B:44:94:B2:FE:AD:9E:76:A2:80:D2:2D:93:7F:EE:62:51:AE:CE:59:94:46:B2:EA:31:9B:04"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.mozilla.firefox_beta",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "A7:8B:62:A5:16:5B:44:94:B2:FE:AD:9E:76:A2:80:D2:2D:93:7F:EE:62:51:AE:CE:59:94:46:B2:EA:31:9B:04"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.mozilla.focus",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "62:03:A4:73:BE:36:D6:4E:E3:7F:87:FA:50:0E:DB:C7:9E:AB:93:06:10:AB:9B:9F:A4:CA:7D:5C:1F:1B:4F:FC"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.mozilla.fennec_aurora",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "BC:04:88:83:8D:06:F4:CA:6B:F3:23:86:DA:AB:0D:D8:EB:CF:3E:77:30:78:74:59:F6:2F:B3:CD:14:A1:BA:AA"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.mozilla.rocket",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "86:3A:46:F0:97:39:32:B7:D0:19:9B:54:91:12:74:1C:2D:27:31:AC:72:EA:11:B7:52:3A:A9:0A:11:BF:56:91"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.mozilla.fenix",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "50:04:77:90:88:E7:F9:88:D5:BC:5C:C5:F8:79:8F:EB:F4:F8:CD:08:4A:1B:2A:46:EF:D4:C8:EE:4A:EA:F2:11"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.mozilla.fenix.debug",
+        "signatures": [
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "BD:AE:82:02:80:D2:AF:B7:74:94:EF:22:58:AA:78:A9:AE:A1:36:41:7E:8B:C2:3D:C9:87:75:2E:6F:48:E8:48"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.mozilla.focus.beta",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "62:03:A4:73:BE:36:D6:4E:E3:7F:87:FA:50:0E:DB:C7:9E:AB:93:06:10:AB:9B:9F:A4:CA:7D:5C:1F:1B:4F:FC"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.mozilla.focus.nightly",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "62:03:A4:73:BE:36:D6:4E:E3:7F:87:FA:50:0E:DB:C7:9E:AB:93:06:10:AB:9B:9F:A4:CA:7D:5C:1F:1B:4F:FC"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.mozilla.klar",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "62:03:A4:73:BE:36:D6:4E:E3:7F:87:FA:50:0E:DB:C7:9E:AB:93:06:10:AB:9B:9F:A4:CA:7D:5C:1F:1B:4F:FC"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "org.mozilla.reference.browser",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "B0:09:90:E3:0F:9D:81:5D:2E:BC:7B:9B:B2:21:CE:47:E5:C9:D5:17:AA:C7:0E:7F:D5:95:B1:E5:3E:9A:4B:14"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.microsoft.emmx.canary",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "01:E1:99:97:10:A8:2C:27:49:B4:D5:0C:44:5D:C8:5D:67:0B:61:36:08:9D:0A:76:6A:73:82:7C:82:A1:EA:C9"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.microsoft.emmx.dev",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "01:E1:99:97:10:A8:2C:27:49:B4:D5:0C:44:5D:C8:5D:67:0B:61:36:08:9D:0A:76:6A:73:82:7C:82:A1:EA:C9"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.microsoft.emmx.beta",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "01:E1:99:97:10:A8:2C:27:49:B4:D5:0C:44:5D:C8:5D:67:0B:61:36:08:9D:0A:76:6A:73:82:7C:82:A1:EA:C9"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.microsoft.emmx",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "01:E1:99:97:10:A8:2C:27:49:B4:D5:0C:44:5D:C8:5D:67:0B:61:36:08:9D:0A:76:6A:73:82:7C:82:A1:EA:C9"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.microsoft.emmx.rolling",
+        "signatures": [
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "32:A2:FC:74:D7:31:10:58:59:E5:A8:5D:F1:6D:95:F1:02:D8:5B:22:09:9B:80:64:C5:D8:91:5C:61:DA:D1:E0"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.microsoft.emmx.local",
+        "signatures": [
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "32:A2:FC:74:D7:31:10:58:59:E5:A8:5D:F1:6D:95:F1:02:D8:5B:22:09:9B:80:64:C5:D8:91:5C:61:DA:D1:E0"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.brave.browser",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "9C:2D:B7:05:13:51:5F:DB:FB:BC:58:5B:3E:DF:3D:71:23:D4:DC:67:C9:4F:FD:30:63:61:C1:D7:9B:BF:18:AC"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.brave.browser_beta",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "9C:2D:B7:05:13:51:5F:DB:FB:BC:58:5B:3E:DF:3D:71:23:D4:DC:67:C9:4F:FD:30:63:61:C1:D7:9B:BF:18:AC"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.brave.browser_nightly",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "9C:2D:B7:05:13:51:5F:DB:FB:BC:58:5B:3E:DF:3D:71:23:D4:DC:67:C9:4F:FD:30:63:61:C1:D7:9B:BF:18:AC"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "app.vanadium.browser",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "C6:AD:B8:B8:3C:6D:4C:17:D2:92:AF:DE:56:FD:48:8A:51:D3:16:FF:8F:2C:11:C5:41:02:23:BF:F8:A7:DB:B3"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.vivaldi.browser",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "E8:A7:85:44:65:5B:A8:C0:98:17:F7:32:76:8F:56:89:B1:66:2E:C4:B2:BC:5A:0B:C0:EC:13:8D:33:CA:3D:1E"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.vivaldi.browser.snapshot",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "E8:A7:85:44:65:5B:A8:C0:98:17:F7:32:76:8F:56:89:B1:66:2E:C4:B2:BC:5A:0B:C0:EC:13:8D:33:CA:3D:1E"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.vivaldi.browser.sopranos",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "E8:A7:85:44:65:5B:A8:C0:98:17:F7:32:76:8F:56:89:B1:66:2E:C4:B2:BC:5A:0B:C0:EC:13:8D:33:CA:3D:1E"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.citrix.Receiver",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "3D:D1:12:67:10:69:AB:36:4E:F9:BE:73:9A:B7:B5:EE:15:E1:CD:E9:D8:75:7B:1B:F0:64:F5:0C:55:68:9A:49"
+          },
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "CE:B2:23:D7:77:09:F2:B6:BC:0B:3A:78:36:F5:A5:AF:4C:E1:D3:55:F4:A7:28:86:F7:9D:F8:0D:C9:D6:12:2E"
+          },
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "AA:D0:D4:57:E6:33:C3:78:25:77:30:5B:C1:B2:D9:E3:81:41:C7:21:DF:0D:AA:6E:29:07:2F:C4:1D:34:F0:AB"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.android.browser",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "C9:00:9D:01:EB:F9:F5:D0:30:2B:C7:1B:2F:E9:AA:9A:47:A4:32:BB:A1:73:08:A3:11:1B:75:D7:B2:14:90:25"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.sec.android.app.sbrowser",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "C8:A2:E9:BC:CF:59:7C:2F:B6:DC:66:BE:E2:93:FC:13:F2:FC:47:EC:77:BC:6B:2B:0D:52:C1:1F:51:19:2A:B8"
+          },
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "34:DF:0E:7A:9F:1C:F1:89:2E:45:C0:56:B4:97:3C:D8:1C:CF:14:8A:40:50:D1:1A:EA:4A:C5:A6:5F:90:0A:42"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.sec.android.app.sbrowser.beta",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "C8:A2:E9:BC:CF:59:7C:2F:B6:DC:66:BE:E2:93:FC:13:F2:FC:47:EC:77:BC:6B:2B:0D:52:C1:1F:51:19:2A:B8"
+          },
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "34:DF:0E:7A:9F:1C:F1:89:2E:45:C0:56:B4:97:3C:D8:1C:CF:14:8A:40:50:D1:1A:EA:4A:C5:A6:5F:90:0A:42"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.google.android.gms",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "7C:E8:3C:1B:71:F3:D5:72:FE:D0:4C:8D:40:C5:CB:10:FF:75:E6:D8:7D:9D:F6:FB:D5:3F:04:68:C2:90:50:53"
+          },
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "D2:2C:C5:00:29:9F:B2:28:73:A0:1A:01:0D:E1:C8:2F:BE:4D:06:11:19:B9:48:14:DD:30:1D:AB:50:CB:76:78"
+          },
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "F0:FD:6C:5B:41:0F:25:CB:25:C3:B5:33:46:C8:97:2F:AE:30:F8:EE:74:11:DF:91:04:80:AD:6B:2D:60:DB:83"
+          },
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "19:75:B2:F1:71:77:BC:89:A5:DF:F3:1F:9E:64:A6:CA:E2:81:A5:3D:C1:D1:D5:9B:1D:14:7F:E1:C8:2A:FA:00"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.yandex.browser",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "AC:A4:05:DE:D8:B2:5C:B2:E8:C6:DA:69:42:5D:2B:43:07:D0:87:C1:27:6F:C0:6A:D5:94:27:31:CC:C5:1D:BA"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.yandex.browser.beta",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "AC:A4:05:DE:D8:B2:5C:B2:E8:C6:DA:69:42:5D:2B:43:07:D0:87:C1:27:6F:C0:6A:D5:94:27:31:CC:C5:1D:BA"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.yandex.browser.alpha",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "AC:A4:05:DE:D8:B2:5C:B2:E8:C6:DA:69:42:5D:2B:43:07:D0:87:C1:27:6F:C0:6A:D5:94:27:31:CC:C5:1D:BA"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.yandex.browser.corp",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "AC:A4:05:DE:D8:B2:5C:B2:E8:C6:DA:69:42:5D:2B:43:07:D0:87:C1:27:6F:C0:6A:D5:94:27:31:CC:C5:1D:BA"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.yandex.browser.canary",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "1D:A9:CB:AE:2D:CC:C6:A5:8D:6C:94:7B:E9:4C:DB:B7:33:D6:5D:A4:D1:77:0F:A1:4A:53:64:CB:4A:28:EB:49"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.yandex.browser.broteam",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "1D:A9:CB:AE:2D:CC:C6:A5:8D:6C:94:7B:E9:4C:DB:B7:33:D6:5D:A4:D1:77:0F:A1:4A:53:64:CB:4A:28:EB:49"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.talonsec.talon",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "A3:66:03:44:A6:F6:AF:CA:81:8C:BF:43:96:A2:3C:CF:D5:ED:7A:78:1B:B4:A3:D1:85:03:01:E2:F4:6D:23:83"
+          },
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "E2:A5:64:74:EA:23:7B:06:67:B6:F5:2C:DC:E9:04:5E:24:88:3B:AE:D0:82:59:9A:A2:DF:0B:60:3A:CF:6A:3B"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.talonsec.talon_beta",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "F5:86:62:7A:32:C8:9F:E6:7E:00:6D:B1:8C:34:31:9E:01:7F:B3:B2:BE:D6:9D:01:01:B7:F9:43:E7:7C:48:AE"
+          },
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "9A:A1:25:D5:E5:5E:3F:B0:DE:96:72:D9:A9:5D:04:65:3F:49:4A:1E:C3:EE:76:1E:94:C4:4E:5D:2F:65:8E:2F"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.duckduckgo.mobile.android.debug",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "C4:F0:9E:2B:D7:25:AD:F5:AD:92:0B:A2:80:27:66:AC:16:4A:C1:53:B3:EA:9E:08:48:B0:57:98:37:F7:6A:29"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.duckduckgo.mobile.android",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "BB:7B:B3:1C:57:3C:46:A1:DA:7F:C5:C5:28:A6:AC:F4:32:10:84:56:FE:EC:50:81:0C:7F:33:69:4E:B3:D2:D4"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.naver.whale",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "0B:8B:85:23:BB:4A:EF:FA:34:6E:4B:DD:4F:BF:7D:19:34:50:56:9A:A1:4A:AA:D4:AD:FD:94:A3:F7:B2:27:BB"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.fido.fido2client",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "FC:98:DA:E6:3A:D3:96:26:C8:C6:7F:BE:83:F2:F0:6F:74:93:2A:9C:D1:46:B9:2C:EC:FC:6A:04:7A:90:43:86"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.heytap.browser",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "AF:F8:A7:49:CF:0E:7D:75:44:65:D0:FB:FA:7B:8D:0C:64:5E:22:5C:10:C6:E2:32:AD:A0:D9:74:88:36:B8:E5"
+          },
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "A8:FE:A4:CA:FB:93:32:DA:26:B8:E6:81:08:17:C1:DA:90:A5:03:0E:35:A6:0A:79:E0:6C:90:97:AA:C6:A4:42"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "io.island.Island",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "D9:C3:39:AC:9C:3A:EE:E1:75:1D:85:8C:35:D9:BA:C5:CC:87:B3:CE:76:30:93:F0:F5:10:64:F5:A2:F6:9B:04"
+          },
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "6C:65:BD:B0:33:F5:CE:B1:74:09:EF:F9:99:48:D5:58:9F:55:63:9A:63:78:D5:A5:00:EB:95:FC:01:BC:6D:44"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "io.island.IslandCanary",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "90:17:13:23:45:6E:6F:39:CB:FD:CF:B2:56:BE:1D:CF:F3:BC:1C:59:8A:15:93:30:E4:97:73:D0:4C:B9:C9:05"
+          },
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "6C:65:BD:B0:33:F5:CE:B1:74:09:EF:F9:99:48:D5:58:9F:55:63:9A:63:78:D5:A5:00:EB:95:FC:01:BC:6D:44"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "io.island.IslandBeta",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "35:31:83:1A:9E:2B:21:1D:E6:AA:C3:69:4B:45:83:6E:56:09:B9:D7:D0:04:C3:1B:21:87:40:FB:77:17:38:D1"
+          },
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "6C:65:BD:B0:33:F5:CE:B1:74:09:EF:F9:99:48:D5:58:9F:55:63:9A:63:78:D5:A5:00:EB:95:FC:01:BC:6D:44"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "io.island.IslandDev",
+        "signatures": [
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "6C:65:BD:B0:33:F5:CE:B1:74:09:EF:F9:99:48:D5:58:9F:55:63:9A:63:78:D5:A5:00:EB:95:FC:01:BC:6D:44"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "io.island.island.intune",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "C2:38:24:15:41:20:A0:8F:C3:95:42:AC:D8:2A:E9:24:94:78:80:1E:47:FD:6C:66:2B:18:1C:28:CA:7E:59:4E"
+          },
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "6C:65:BD:B0:33:F5:CE:B1:74:09:EF:F9:99:48:D5:58:9F:55:63:9A:63:78:D5:A5:00:EB:95:FC:01:BC:6D:44"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "io.island.island.canary.intune",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "1E:16:74:BB:79:EA:09:FB:37:CF:9F:1B:07:1B:1D:51:8D:46:03:0E:D3:EE:F2:C1:4E:AD:93:9E:C6:EE:3A:4C"
+          },
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "6C:65:BD:B0:33:F5:CE:B1:74:09:EF:F9:99:48:D5:58:9F:55:63:9A:63:78:D5:A5:00:EB:95:FC:01:BC:6D:44"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "io.island.island.beta.intune",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "D2:5E:AD:F6:1C:E6:36:6C:A4:23:A4:7F:C4:DB:9B:8C:9C:8A:35:B4:B0:19:E8:D9:82:FB:D0:8A:D9:DB:49:5A"
+          },
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "6C:65:BD:B0:33:F5:CE:B1:74:09:EF:F9:99:48:D5:58:9F:55:63:9A:63:78:D5:A5:00:EB:95:FC:01:BC:6D:44"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "io.island.island.dev.intune",
+        "signatures": [
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "6C:65:BD:B0:33:F5:CE:B1:74:09:EF:F9:99:48:D5:58:9F:55:63:9A:63:78:D5:A5:00:EB:95:FC:01:BC:6D:44"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "net.quetta.browser",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "BE:FE:E7:31:12:6A:A5:6E:7E:FD:AE:AF:5E:F3:FA:EA:44:1C:19:CC:E0:CA:EC:42:6B:65:BB:F8:2C:59:46:80"
+          },
+          {
+            "build": "userdebug",
+            "cert_fingerprint_sha256": "F1:38:00:4F:38:04:51:D4:8A:05:2B:B3:A3:EF:17:24:23:D4:B0:D0:C8:A3:AA:DD:FB:DB:66:30:31:48:EC:A4"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "cz.seznam.sbrowser",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "DB:95:40:66:10:78:83:6E:4E:B1:66:F6:9E:F4:07:30:9E:8D:AE:33:34:68:5E:C8:F6:FA:2F:13:81:B9:AC:F6"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.opera.mini.native",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "57:AC:BC:52:5F:1B:2E:BD:19:19:6C:D6:F0:14:39:7C:C9:10:FD:18:84:1E:0A:E8:50:FE:BC:3E:1E:59:3F:F2"
+          }
+        ]
+      }
+    },
+    {
+      "type": "android",
+      "info": {
+        "package_name": "com.opera.mini.native.beta",
+        "signatures": [
+          {
+            "build": "release",
+            "cert_fingerprint_sha256": "57:AC:BC:52:5F:1B:2E:BD:19:19:6C:D6:F0:14:39:7C:C9:10:FD:18:84:1E:0A:E8:50:FE:BC:3E:1E:59:3F:F2"
+          }
+        ]
+      }
+    }
+  ]
+}

app/src/main/AndroidManifest.xml

@@ -45,7 +45,8 @@
         android:resizeableActivity="true"
         android:supportsRtl="true"
         android:theme="@style/KeepassDXStyle.Night"
-        tools:targetApi="s">
+        tools:targetApi="s"
+        tools:ignore="CredentialDependency">
         <meta-data
             android:name="com.google.android.backup.api_key"
             android:value="${googleAndroidBackupAPIKey}" />
@@ -158,25 +159,41 @@
             android:label="@string/about" />
         <activity
             android:name="com.kunzisoft.keepass.settings.SettingsActivity" />
-        <activity
-            android:name="com.kunzisoft.keepass.activities.AutofillLauncherActivity"
-            android:theme="@style/Theme.Transparent"
-            android:configChanges="keyboardHidden"
-            android:excludeFromRecents="true"/>
         <activity
             android:name="com.kunzisoft.keepass.settings.DeviceUnlockSettingsActivity" />
         <activity
-            android:name="com.kunzisoft.keepass.settings.AutofillSettingsActivity" />
+            android:name="com.kunzisoft.keepass.settings.MagikeyboardSettingsActivity"
+            android:label="@string/keyboard_setting_label"
+            android:exported="true">
+            <intent-filter>
+                <action android:name="android.intent.action.MAIN"/>
+            </intent-filter>
+        </activity>
+        <activity
+            android:name="com.kunzisoft.keepass.settings.AutofillSettingsActivity"
+            tools:targetApi="26" />
+        <activity
+            android:name="com.kunzisoft.keepass.settings.PasskeysSettingsActivity"
+            tools:targetApi="34" />
         <activity
             android:name="com.kunzisoft.keepass.settings.AppearanceSettingsActivity" />
         <activity
-            android:name="com.kunzisoft.keepass.hardware.HardwareKeyActivity"
-            android:theme="@style/Theme.Transparent" />
+            android:name="com.kunzisoft.keepass.credentialprovider.activity.HardwareKeyActivity"
+            android:theme="@style/Theme.Transparent"
+            android:exported="false"
+            android:excludeFromRecents="true" />
         <activity
-            android:name="com.kunzisoft.keepass.activities.EntrySelectionLauncherActivity"
+            android:name="com.kunzisoft.keepass.credentialprovider.activity.AutofillLauncherActivity"
+            android:theme="@style/Theme.Transparent"
+            android:configChanges="keyboardHidden"
+            android:exported="false"
+            android:excludeFromRecents="true" />
+        <activity
+            android:name="com.kunzisoft.keepass.credentialprovider.activity.EntrySelectionLauncherActivity"
             android:theme="@style/Theme.Transparent"
             android:launchMode="singleInstance"
-            android:exported="true">
+            android:exported="true"
+            android:excludeFromRecents="true">
             <intent-filter>
                 <action android:name="android.intent.action.SEND" />
                 <category android:name="android.intent.category.DEFAULT" />
@@ -192,14 +209,12 @@
             </intent-filter>
         </activity>
         <activity
-            android:name="com.kunzisoft.keepass.settings.MagikeyboardSettingsActivity"
-            android:label="@string/keyboard_setting_label"
-            android:exported="true">
-            <intent-filter>
-                <action android:name="android.intent.action.MAIN"/>
-            </intent-filter>
-        </activity>
-
+            android:name="com.kunzisoft.keepass.credentialprovider.activity.PasskeyLauncherActivity"
+            android:theme="@style/Theme.Transparent"
+            android:configChanges="keyboardHidden"
+            android:exported="false"
+            android:excludeFromRecents="true"
+            tools:targetApi="upside_down_cake" />
         <service
             android:name="com.kunzisoft.keepass.services.DatabaseTaskNotificationService"
             android:foregroundServiceType="dataSync"
@@ -227,8 +242,8 @@
             android:exported="false" />
         <!-- Receiver for Autofill -->
         <service
-            android:name="com.kunzisoft.keepass.autofill.KeeAutofillService"
-            android:label="@string/autofill_service_name"
+            android:name="com.kunzisoft.keepass.credentialprovider.autofill.KeeAutofillService"
+            android:label="@string/app_name"
             android:exported="true"
             android:permission="android.permission.BIND_AUTOFILL_SERVICE">
             <meta-data
@@ -239,7 +254,7 @@
             </intent-filter>
         </service>
         <service
-            android:name="com.kunzisoft.keepass.magikeyboard.MagikeyboardService"
+            android:name="com.kunzisoft.keepass.credentialprovider.magikeyboard.MagikeyboardService"
             android:label="@string/keyboard_label"
             android:exported="true"
             android:permission="android.permission.BIND_INPUT_METHOD" >
@@ -249,6 +264,22 @@
                 <action android:name="android.view.InputMethod" />
             </intent-filter>
         </service>
+        <service
+            android:name="com.kunzisoft.keepass.credentialprovider.passkey.PasskeyProviderService"
+            android:enabled="true"
+            android:exported="true"
+            android:label="@string/passkey_service_name"
+            android:icon="@mipmap/ic_launcher"
+            android:permission="android.permission.BIND_CREDENTIAL_PROVIDER_SERVICE"
+            tools:targetApi="upside_down_cake">
+            <intent-filter>
+                <action android:name="android.service.credentials.CredentialProviderService" />
+            </intent-filter>
+            <meta-data
+                android:name="android.credentials.provider"
+                android:resource="@xml/provider" />
+        </service>
+
         <receiver
             android:name="com.kunzisoft.keepass.receivers.DexModeReceiver"
             android:exported="true">

app/src/main/java/com/kunzisoft/keepass/activities/AboutActivity.kt

@@ -20,7 +20,6 @@
 package com.kunzisoft.keepass.activities
 
 import android.content.pm.PackageManager.NameNotFoundException
-import android.os.Build
 import android.os.Bundle
 import android.text.method.LinkMovementMethod
 import android.util.Log
@@ -32,7 +31,7 @@ import androidx.core.text.HtmlCompat
 import com.kunzisoft.keepass.BuildConfig
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.stylish.StylishActivity
-import com.kunzisoft.keepass.utils.UriUtil.isContributingUser
+import com.kunzisoft.keepass.utils.AppUtil.isContributingUser
 import com.kunzisoft.keepass.utils.getPackageInfoCompat
 import org.joda.time.DateTime
 

app/src/main/java/com/kunzisoft/keepass/activities/AutofillLauncherActivity.kt

@@ -1,287 +0,0 @@
-/*
- * Copyright 2019 Jeremy Jamet / Kunzisoft.
- *
- * This file is part of KeePassDX.
- *
- *  KeePassDX is free software: you can redistribute it and/or modify
- *  it under the terms of the GNU General Public License as published by
- *  the Free Software Foundation, either version 3 of the License, or
- *  (at your option) any later version.
- *
- *  KeePassDX is distributed in the hope that it will be useful,
- *  but WITHOUT ANY WARRANTY; without even the implied warranty of
- *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
- *  GNU General Public License for more details.
- *
- *  You should have received a copy of the GNU General Public License
- *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
- *
- */
-package com.kunzisoft.keepass.activities
-
-import android.app.Activity
-import android.app.PendingIntent
-import android.content.Context
-import android.content.Intent
-import android.os.Build
-import android.os.Bundle
-import android.util.Log
-import android.widget.Toast
-import androidx.activity.result.ActivityResultLauncher
-import androidx.annotation.RequiresApi
-import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
-import com.kunzisoft.keepass.activities.helpers.SpecialMode
-import com.kunzisoft.keepass.activities.legacy.DatabaseModeActivity
-import com.kunzisoft.keepass.autofill.AutofillComponent
-import com.kunzisoft.keepass.autofill.AutofillHelper
-import com.kunzisoft.keepass.autofill.CompatInlineSuggestionsRequest
-import com.kunzisoft.keepass.autofill.KeeAutofillService
-import com.kunzisoft.keepass.database.ContextualDatabase
-import com.kunzisoft.keepass.database.helper.SearchHelper
-import com.kunzisoft.keepass.model.RegisterInfo
-import com.kunzisoft.keepass.model.SearchInfo
-import com.kunzisoft.keepass.utils.WebDomain
-import com.kunzisoft.keepass.utils.getParcelableCompat
-import com.kunzisoft.keepass.utils.getParcelableExtraCompat
-
-@RequiresApi(api = Build.VERSION_CODES.O)
-class AutofillLauncherActivity : DatabaseModeActivity() {
-
-    private var mAutofillActivityResultLauncher: ActivityResultLauncher<Intent>? =
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O)
-            AutofillHelper.buildActivityResultLauncher(this, true)
-        else null
-
-    override fun applyCustomStyle(): Boolean {
-        return false
-    }
-
-    override fun finishActivityIfReloadRequested(): Boolean {
-        return true
-    }
-
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-
-        // Retrieve selection mode
-        EntrySelectionHelper.retrieveSpecialModeFromIntent(intent).let { specialMode ->
-            when (specialMode) {
-                SpecialMode.SELECTION -> {
-                    intent.getBundleExtra(KEY_SELECTION_BUNDLE)?.let { bundle ->
-                        // To pass extra inline request
-                        var compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest? = null
-                        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-                            compatInlineSuggestionsRequest = bundle.getParcelableCompat(KEY_INLINE_SUGGESTION)
-                        }
-                        // Build search param
-                        bundle.getParcelableCompat<SearchInfo>(KEY_SEARCH_INFO)?.let { searchInfo ->
-                            WebDomain.getConcreteWebDomain(
-                                this,
-                                searchInfo.webDomain
-                            ) { concreteWebDomain ->
-                                // Pass extra for Autofill (EXTRA_ASSIST_STRUCTURE)
-                                val assistStructure = AutofillHelper
-                                    .retrieveAutofillComponent(intent)
-                                    ?.assistStructure
-                                val newAutofillComponent = if (assistStructure != null) {
-                                    AutofillComponent(
-                                        assistStructure,
-                                        compatInlineSuggestionsRequest
-                                    )
-                                } else {
-                                    null
-                                }
-                                searchInfo.webDomain = concreteWebDomain
-                                launchSelection(database, newAutofillComponent, searchInfo)
-                            }
-                        }
-                    }
-                    // Remove bundle
-                    intent.removeExtra(KEY_SELECTION_BUNDLE)
-                }
-                SpecialMode.REGISTRATION -> {
-                    // To register info
-                    val registerInfo = intent.getParcelableExtraCompat<RegisterInfo>(KEY_REGISTER_INFO)
-                    val searchInfo = SearchInfo(registerInfo?.searchInfo)
-                    WebDomain.getConcreteWebDomain(this, searchInfo.webDomain) { concreteWebDomain ->
-                        searchInfo.webDomain = concreteWebDomain
-                        launchRegistration(database, searchInfo, registerInfo)
-                    }
-                }
-                else -> {
-                    // Not an autofill call
-                    setResult(Activity.RESULT_CANCELED)
-                    finish()
-                }
-            }
-        }
-    }
-
-    private fun launchSelection(database: ContextualDatabase?,
-                                autofillComponent: AutofillComponent?,
-                                searchInfo: SearchInfo) {
-        if (autofillComponent == null) {
-            setResult(Activity.RESULT_CANCELED)
-            finish()
-        } else if (KeeAutofillService.autofillAllowedFor(
-            applicationId = searchInfo.applicationId,
-            webDomain = searchInfo.webDomain,
-            context = this
-        )) {
-            // If database is open
-            SearchHelper.checkAutoSearchInfo(this,
-                database,
-                searchInfo,
-                { openedDatabase, items ->
-                    // Items found
-                    AutofillHelper.buildResponseAndSetResult(this, openedDatabase, items)
-                    finish()
-                },
-                { openedDatabase ->
-                    // Show the database UI to select the entry
-                    GroupActivity.launchForAutofillResult(this,
-                        openedDatabase,
-                        mAutofillActivityResultLauncher,
-                        autofillComponent,
-                        searchInfo,
-                        false)
-                },
-                {
-                    // If database not open
-                    FileDatabaseSelectActivity.launchForAutofillResult(this,
-                        mAutofillActivityResultLauncher,
-                        autofillComponent,
-                        searchInfo)
-                }
-            )
-        } else {
-            showBlockRestartMessage()
-            setResult(Activity.RESULT_CANCELED)
-            finish()
-        }
-    }
-
-    private fun launchRegistration(database: ContextualDatabase?,
-                                   searchInfo: SearchInfo,
-                                   registerInfo: RegisterInfo?) {
-        if (KeeAutofillService.autofillAllowedFor(
-                applicationId = searchInfo.applicationId,
-                webDomain = searchInfo.webDomain,
-                context = this
-        )) {
-            val readOnly = database?.isReadOnly != false
-            SearchHelper.checkAutoSearchInfo(this,
-                database,
-                searchInfo,
-                { openedDatabase, _ ->
-                    if (!readOnly) {
-                        // Show the database UI to select the entry
-                        GroupActivity.launchForRegistration(this,
-                            openedDatabase,
-                            registerInfo)
-                    } else {
-                        showReadOnlySaveMessage()
-                    }
-                },
-                { openedDatabase ->
-                    if (!readOnly) {
-                        // Show the database UI to select the entry
-                        GroupActivity.launchForRegistration(this,
-                            openedDatabase,
-                            registerInfo)
-                    } else {
-                        showReadOnlySaveMessage()
-                    }
-                },
-                {
-                    // If database not open
-                    FileDatabaseSelectActivity.launchForRegistration(this,
-                        registerInfo)
-                }
-            )
-        } else {
-            showBlockRestartMessage()
-            setResult(Activity.RESULT_CANCELED)
-        }
-        finish()
-    }
-
-    private fun showBlockRestartMessage() {
-        // If item not allowed, show a toast
-        Toast.makeText(this.applicationContext, R.string.autofill_block_restart, Toast.LENGTH_LONG).show()
-    }
-
-    private fun showReadOnlySaveMessage() {
-        Toast.makeText(this.applicationContext, R.string.autofill_read_only_save, Toast.LENGTH_LONG).show()
-    }
-
-    companion object {
-
-        private val TAG = AutofillLauncherActivity::class.java.name
-
-        private const val KEY_SELECTION_BUNDLE = "KEY_SELECTION_BUNDLE"
-        private const val KEY_SEARCH_INFO = "KEY_SEARCH_INFO"
-        private const val KEY_INLINE_SUGGESTION = "KEY_INLINE_SUGGESTION"
-
-        private const val KEY_REGISTER_INFO = "KEY_REGISTER_INFO"
-
-        fun getPendingIntentForSelection(context: Context,
-                                         searchInfo: SearchInfo? = null,
-                                         compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest? = null): PendingIntent? {
-            try {
-                return PendingIntent.getActivity(
-                    context, 0,
-                    // Doesn't work with direct extra Parcelable (don't know why?)
-                    // Wrap into a bundle to bypass the problem
-                    Intent(context, AutofillLauncherActivity::class.java).apply {
-                        putExtra(KEY_SELECTION_BUNDLE, Bundle().apply {
-                            putParcelable(KEY_SEARCH_INFO, searchInfo)
-                            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-                                putParcelable(KEY_INLINE_SUGGESTION, compatInlineSuggestionsRequest)
-                            }
-                        })
-                    },
-                    if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S) {
-                        PendingIntent.FLAG_MUTABLE or PendingIntent.FLAG_CANCEL_CURRENT
-                    } else {
-                        PendingIntent.FLAG_CANCEL_CURRENT
-                    }
-                )
-            } catch (e: RuntimeException) {
-                Log.e(TAG, "Unable to create pending intent for selection", e)
-                return null
-            }
-        }
-
-        fun getPendingIntentForRegistration(context: Context,
-                                            registerInfo: RegisterInfo): PendingIntent? {
-            try {
-                return PendingIntent.getActivity(
-                    context, 0,
-                    Intent(context, AutofillLauncherActivity::class.java).apply {
-                        EntrySelectionHelper.addSpecialModeInIntent(this, SpecialMode.REGISTRATION)
-                        putExtra(KEY_REGISTER_INFO, registerInfo)
-                    },
-                    if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S) {
-                        PendingIntent.FLAG_MUTABLE or PendingIntent.FLAG_CANCEL_CURRENT
-                    } else {
-                        PendingIntent.FLAG_CANCEL_CURRENT
-                    }
-                )
-            } catch (e: RuntimeException) {
-                Log.e(TAG, "Unable to create pending intent for registration", e)
-                return null
-            }
-        }
-
-        fun launchForRegistration(context: Context,
-                                  registerInfo: RegisterInfo) {
-            val intent = Intent(context, AutofillLauncherActivity::class.java)
-            EntrySelectionHelper.addSpecialModeInIntent(intent, SpecialMode.REGISTRATION)
-            intent.putExtra(KEY_REGISTER_INFO, registerInfo)
-            intent.addFlags(Intent.FLAG_ACTIVITY_NEW_TASK)
-            context.startActivity(intent)
-        }
-    }
-}

app/src/main/java/com/kunzisoft/keepass/activities/EntryActivity.kt

@@ -50,15 +50,15 @@ import com.google.android.material.tabs.TabLayout
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.fragments.EntryFragment
 import com.kunzisoft.keepass.activities.helpers.ExternalFileHelper
-import com.kunzisoft.keepass.activities.helpers.SpecialMode
 import com.kunzisoft.keepass.activities.legacy.DatabaseLockActivity
 import com.kunzisoft.keepass.adapters.TagsAdapter
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.magikeyboard.MagikeyboardService
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.element.Attachment
 import com.kunzisoft.keepass.database.element.icon.IconImage
 import com.kunzisoft.keepass.database.element.node.NodeId
 import com.kunzisoft.keepass.education.EntryActivityEducation
-import com.kunzisoft.keepass.magikeyboard.MagikeyboardService
 import com.kunzisoft.keepass.model.EntryAttachmentState
 import com.kunzisoft.keepass.otp.OtpType
 import com.kunzisoft.keepass.services.AttachmentFileNotificationService
@@ -69,7 +69,7 @@ import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.tasks.ActionRunnable
 import com.kunzisoft.keepass.tasks.AttachmentFileBinderManager
 import com.kunzisoft.keepass.timeout.TimeoutHelper
-import com.kunzisoft.keepass.utils.UuidUtil
+import com.kunzisoft.keepass.utils.UUIDUtils.asHexString
 import com.kunzisoft.keepass.utils.getParcelableExtraCompat
 import com.kunzisoft.keepass.view.WindowInsetPosition
 import com.kunzisoft.keepass.view.applyWindowInsets
@@ -125,6 +125,8 @@ class EntryActivity : DatabaseLockActivity() {
     private var mBackgroundColor: Int? = null
     private var mForegroundColor: Int? = null
 
+    override fun manageDatabaseInfo(): Boolean = true
+
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
 
@@ -264,7 +266,7 @@ class EntryActivity : DatabaseLockActivity() {
                 mIcon = entryInfo.icon
                 // Assign title text
                 val entryTitle =
-                    if (entryInfo.title.isNotEmpty()) entryInfo.title else UuidUtil.toHexString(entryInfo.id)
+                    entryInfo.title.ifEmpty { entryInfo.id.asHexString() }
                 collapsingToolbarLayout?.title = entryTitle
                 toolbar?.title = entryTitle
                 // Assign tags
@@ -312,11 +314,11 @@ class EntryActivity : DatabaseLockActivity() {
         mEntryViewModel.historySelected.observe(this) { historySelected ->
             mDatabase?.let { database ->
                 launch(
-                    this,
-                    database,
-                    historySelected.nodeId,
-                    historySelected.historyPosition,
-                    mEntryActivityResultLauncher
+                    activity = this,
+                    database = database,
+                    entryId = historySelected.nodeId,
+                    historyPosition = historySelected.historyPosition,
+                    activityResultLauncher = mEntryActivityResultLauncher
                 )
             }
         }
@@ -330,9 +332,8 @@ class EntryActivity : DatabaseLockActivity() {
         return coordinatorLayout
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
-
         mEntryViewModel.loadDatabase(database)
     }
 
@@ -478,11 +479,12 @@ class EntryActivity : DatabaseLockActivity() {
             R.id.menu_edit -> {
                 mDatabase?.let { database ->
                     mMainEntryId?.let { entryId ->
-                        EntryEditActivity.launchToUpdate(
-                            this,
-                            database,
-                            entryId,
-                            mEntryActivityResultLauncher
+                        EntryEditActivity.launch(
+                            activity = this,
+                            database = database,
+                            registrationType = EntryEditActivity.RegistrationType.UPDATE,
+                            nodeId = entryId,
+                            activityResultLauncher = mEntryActivityResultLauncher
                         )
                     }
                 }
@@ -520,7 +522,7 @@ class EntryActivity : DatabaseLockActivity() {
         // Transit data in previous Activity after an update
         Intent().apply {
             putExtra(EntryEditActivity.ADD_OR_UPDATE_ENTRY_KEY, mMainEntryId)
-            setResult(Activity.RESULT_OK, this)
+            setResult(RESULT_OK, this)
         }
         super.finish()
     }
@@ -534,34 +536,22 @@ class EntryActivity : DatabaseLockActivity() {
         const val ENTRY_FRAGMENT_TAG = "ENTRY_FRAGMENT_TAG"
 
         /**
-         * Open standard Entry activity
+         * Open standard or history Entry activity
          */
-        fun launch(activity: Activity,
-                   database: ContextualDatabase,
-                   entryId: NodeId<UUID>,
-                   activityResultLauncher: ActivityResultLauncher<Intent>) {
+        fun launch(
+            activity: Activity,
+            database: ContextualDatabase,
+            entryId: NodeId<UUID>,
+            historyPosition: Int? = null,
+            activityResultLauncher: ActivityResultLauncher<Intent>
+        ) {
             if (database.loaded) {
                 if (TimeoutHelper.checkTimeAndLockIfTimeout(activity)) {
                     val intent = Intent(activity, EntryActivity::class.java)
                     intent.putExtra(KEY_ENTRY, entryId)
-                    activityResultLauncher.launch(intent)
-                }
-            }
-        }
-
-        /**
-         * Open history Entry activity
-         */
-        fun launch(activity: Activity,
-                   database: ContextualDatabase,
-                   entryId: NodeId<UUID>,
-                   historyPosition: Int,
-                   activityResultLauncher: ActivityResultLauncher<Intent>) {
-            if (database.loaded) {
-                if (TimeoutHelper.checkTimeAndLockIfTimeout(activity)) {
-                    val intent = Intent(activity, EntryActivity::class.java)
-                    intent.putExtra(KEY_ENTRY, entryId)
-                    intent.putExtra(KEY_ENTRY_HISTORY_POSITION, historyPosition)
+                    historyPosition?.let {
+                        intent.putExtra(KEY_ENTRY_HISTORY_POSITION, historyPosition)
+                    }
                     activityResultLauncher.launch(intent)
                 }
             }

app/src/main/java/com/kunzisoft/keepass/activities/EntryEditActivity.kt

@@ -36,14 +36,14 @@ import android.widget.Spinner
 import androidx.activity.result.ActivityResultLauncher
 import androidx.activity.result.contract.ActivityResultContracts
 import androidx.activity.viewModels
-import androidx.annotation.RequiresApi
 import androidx.appcompat.app.AlertDialog
-import androidx.appcompat.app.AppCompatActivity
 import androidx.coordinatorlayout.widget.CoordinatorLayout
 import androidx.core.view.isVisible
 import androidx.core.widget.NestedScrollView
-import androidx.fragment.app.Fragment
 import androidx.fragment.app.FragmentActivity
+import androidx.lifecycle.Lifecycle
+import androidx.lifecycle.lifecycleScope
+import androidx.lifecycle.repeatOnLifecycle
 import com.google.android.material.datepicker.MaterialDatePicker
 import com.google.android.material.snackbar.Snackbar
 import com.google.android.material.timepicker.MaterialTimePicker
@@ -55,22 +55,23 @@ import com.kunzisoft.keepass.activities.dialogs.FileTooBigDialogFragment.Compani
 import com.kunzisoft.keepass.activities.dialogs.ReplaceFileDialogFragment
 import com.kunzisoft.keepass.activities.dialogs.SetOTPDialogFragment
 import com.kunzisoft.keepass.activities.fragments.EntryEditFragment
-import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
 import com.kunzisoft.keepass.activities.helpers.ExternalFileHelper
 import com.kunzisoft.keepass.activities.legacy.DatabaseLockActivity
 import com.kunzisoft.keepass.adapters.TemplatesSelectorAdapter
-import com.kunzisoft.keepass.autofill.AutofillComponent
-import com.kunzisoft.keepass.autofill.AutofillHelper
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.buildSpecialModeResponseAndSetResult
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveRegisterInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSearchInfo
+import com.kunzisoft.keepass.credentialprovider.TypeMode
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.buildPasskeyResponseAndSetResult
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.element.Attachment
 import com.kunzisoft.keepass.database.element.DateInstant
 import com.kunzisoft.keepass.database.element.Entry
 import com.kunzisoft.keepass.database.element.Field
-import com.kunzisoft.keepass.database.element.node.Node
 import com.kunzisoft.keepass.database.element.node.NodeId
 import com.kunzisoft.keepass.database.element.template.Template
 import com.kunzisoft.keepass.education.EntryEditActivityEducation
-import com.kunzisoft.keepass.magikeyboard.MagikeyboardService
 import com.kunzisoft.keepass.model.AttachmentState
 import com.kunzisoft.keepass.model.DataTime
 import com.kunzisoft.keepass.model.EntryAttachmentState
@@ -79,9 +80,9 @@ import com.kunzisoft.keepass.model.SearchInfo
 import com.kunzisoft.keepass.otp.OtpElement
 import com.kunzisoft.keepass.services.AttachmentFileNotificationService
 import com.kunzisoft.keepass.services.ClipboardEntryNotificationService
-import com.kunzisoft.keepass.services.DatabaseTaskNotificationService
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_CREATE_ENTRY_TASK
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_UPDATE_ENTRY_TASK
+import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.getNewEntry
 import com.kunzisoft.keepass.services.KeyboardEntryNotificationService
 import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.tasks.ActionRunnable
@@ -100,6 +101,7 @@ import com.kunzisoft.keepass.view.showActionErrorIfNeeded
 import com.kunzisoft.keepass.view.updateLockPaddingStart
 import com.kunzisoft.keepass.viewmodels.ColorPickerViewModel
 import com.kunzisoft.keepass.viewmodels.EntryEditViewModel
+import kotlinx.coroutines.launch
 import java.util.EnumSet
 import java.util.UUID
 
@@ -155,8 +157,7 @@ class EntryEditActivity : DatabaseLockActivity(),
         }
     }
 
-    // To ask data lost only one time
-    private var backPressedAlreadyApproved = false
+    override fun manageDatabaseInfo(): Boolean = true
 
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
@@ -210,8 +211,8 @@ class EntryEditActivity : DatabaseLockActivity(),
             mDatabase,
             entryId,
             parentId,
-            EntrySelectionHelper.retrieveRegisterInfoFromIntent(intent),
-            EntrySelectionHelper.retrieveSearchInfoFromIntent(intent)
+            intent.retrieveRegisterInfo()
+                ?: intent.retrieveSearchInfo()?.toRegisterInfo()
         )
 
         // To retrieve attachment
@@ -378,23 +379,30 @@ class EntryEditActivity : DatabaseLockActivity(),
             } ?: run {
                 updateEntry(entrySave.oldEntry, entrySave.newEntry)
             }
+        }
 
-            // Don't wait for saving if it's to provide autofill
-            mDatabase?.let { database ->
-                EntrySelectionHelper.doSpecialAction(intent,
-                    {},
-                    {},
-                    {},
-                    {
-                        entryValidatedForKeyboardSelection(database, entrySave.newEntry)
-                    },
-                    { _, _ ->
-                        entryValidatedForAutofillSelection(database, entrySave.newEntry)
-                    },
-                    {
-                        entryValidatedForAutofillRegistration(entrySave.newEntry)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.STARTED) {
+                mEntryEditViewModel.uiState.collect { uiState ->
+                    when (uiState) {
+                        EntryEditViewModel.UIState.Loading -> {}
+                        EntryEditViewModel.UIState.ShowOverwriteMessage -> {
+                            if (mEntryEditViewModel.warningOverwriteDataAlreadyApproved.not()) {
+                                AlertDialog.Builder(this@EntryEditActivity)
+                                    .setTitle(R.string.warning_overwrite_data_title)
+                                    .setMessage(R.string.warning_overwrite_data_description)
+                                    .setNegativeButton(android.R.string.cancel) { _, _ ->
+                                        mEntryEditViewModel.backPressedAlreadyApproved = true
+                                        onCancelSpecialMode()
+                                    }
+                                    .setPositiveButton(android.R.string.ok) { _, _ ->
+                                        mEntryEditViewModel.warningOverwriteDataAlreadyApproved = true
+                                    }
+                                    .create().show()
+                            }
+                        }
                     }
-                )
+                }
             }
         }
     }
@@ -407,13 +415,13 @@ class EntryEditActivity : DatabaseLockActivity(),
         return true
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
-        mAllowCustomFields = database?.allowEntryCustomFields() == true
-        mAllowOTP = database?.allowOTP == true
-        mEntryEditViewModel.loadDatabase(database)
+        mAllowCustomFields = database.allowEntryCustomFields() == true
+        mAllowOTP = database.allowOTP == true
+        mEntryEditViewModel.loadTemplateEntry(database)
         mTemplatesSelectorAdapter?.apply {
-            iconDrawableFactory = mDatabase?.iconDrawableFactory
+            iconDrawableFactory = database.iconDrawableFactory
             notifyDataSetChanged()
         }
     }
@@ -424,39 +432,45 @@ class EntryEditActivity : DatabaseLockActivity(),
         result: ActionRunnable.Result
     ) {
         super.onDatabaseActionFinished(database, actionTask, result)
+        mEntryEditViewModel.unlockAction()
         when (actionTask) {
             ACTION_DATABASE_CREATE_ENTRY_TASK,
             ACTION_DATABASE_UPDATE_ENTRY_TASK -> {
                 try {
                     if (result.isSuccess) {
-                        var newNodes: List<Node> = ArrayList()
-                        result.data?.getBundle(DatabaseTaskNotificationService.NEW_NODES_KEY)?.let { newNodesBundle ->
-                            newNodes = DatabaseTaskNotificationService.getListNodesFromBundle(database, newNodesBundle)
-                        }
-                        if (newNodes.size == 1) {
-                            (newNodes[0] as? Entry?)?.let { entry ->
-                                EntrySelectionHelper.doSpecialAction(intent,
-                                    {
-                                        // Finish naturally
-                                        finishForEntryResult(entry)
-                                    },
-                                    {
-                                        // Nothing when search retrieved
-                                    },
-                                    {
-                                        entryValidatedForSave(entry)
-                                    },
-                                    {
-                                        entryValidatedForKeyboardSelection(database, entry)
-                                    },
-                                    { _, _ ->
-                                        entryValidatedForAutofillSelection(database, entry)
-                                    },
-                                    {
-                                        entryValidatedForAutofillRegistration(entry)
+                        result.data?.getNewEntry(database)?.let { entry ->
+                            EntrySelectionHelper.doSpecialAction(
+                                intent = intent,
+                                defaultAction = {
+                                    // Finish naturally
+                                    finishForEntryResult(entry)
+                                },
+                                searchAction = {
+                                    // Nothing when search retrieved
+                                },
+                                selectionAction = { intentSender, typeMode, searchInfo ->
+                                    when(typeMode) {
+                                        TypeMode.DEFAULT -> {}
+                                        TypeMode.MAGIKEYBOARD ->
+                                            entryValidatedForKeyboardSelection(database, entry)
+                                        TypeMode.PASSKEY ->
+                                            entryValidatedForPasskey(database, entry)
+                                        TypeMode.AUTOFILL ->
+                                            entryValidatedForAutofill(database, entry)
                                     }
-                                )
-                            }
+                                },
+                                registrationAction = { _, typeMode, _ ->
+                                    when(typeMode) {
+                                        TypeMode.DEFAULT ->
+                                            entryValidatedForSave(entry)
+                                        TypeMode.MAGIKEYBOARD -> {}
+                                        TypeMode.PASSKEY ->
+                                            entryValidatedForPasskey(database, entry)
+                                        TypeMode.AUTOFILL ->
+                                            entryValidatedForAutofill(database, entry)
+                                    }
+                                }
+                            )
                         }
                     }
                 } catch (e: Exception) {
@@ -473,29 +487,33 @@ class EntryEditActivity : DatabaseLockActivity(),
     }
 
     private fun entryValidatedForKeyboardSelection(database: ContextualDatabase, entry: Entry) {
-        // Populate Magikeyboard with entry
-        MagikeyboardService.populateKeyboardAndMoveAppToBackground(
-            this,
-            entry.getEntryInfo(database)
+        // Build Magikeyboard response with the entry selected
+        this.buildSpecialModeResponseAndSetResult(
+            entryInfo = entry.getEntryInfo(database),
+            extras = buildEntryResult(entry)
         )
         onValidateSpecialMode()
-        // Don't keep activity history for entry edition
-        finishForEntryResult(entry)
     }
 
-    private fun entryValidatedForAutofillSelection(database: ContextualDatabase, entry: Entry) {
+    private fun entryValidatedForAutofill(database: ContextualDatabase, entry: Entry) {
         // Build Autofill response with the entry selected
         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
-            AutofillHelper.buildResponseAndSetResult(this@EntryEditActivity,
-                    database,
-                    entry.getEntryInfo(database))
+            this.buildSpecialModeResponseAndSetResult(
+                entryInfo = entry.getEntryInfo(database),
+                extras = buildEntryResult(entry)
+            )
         }
         onValidateSpecialMode()
     }
 
-    private fun entryValidatedForAutofillRegistration(entry: Entry) {
+    private fun entryValidatedForPasskey(database: ContextualDatabase, entry: Entry) {
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.UPSIDE_DOWN_CAKE) {
+            this.buildPasskeyResponseAndSetResult(
+                entryInfo = entry.getEntryInfo(database),
+                extras = buildEntryResult(entry) // To update the previous screen
+            )
+        }
         onValidateSpecialMode()
-        finishForEntryResult(entry)
     }
 
     override fun onResume() {
@@ -729,13 +747,13 @@ class EntryEditActivity : DatabaseLockActivity(),
     }
 
     private fun onApprovedBackPressed(approved: () -> Unit) {
-        if (!backPressedAlreadyApproved) {
+        if (mEntryEditViewModel.backPressedAlreadyApproved.not()) {
             AlertDialog.Builder(this)
                     .setMessage(R.string.discard_changes)
                     .setNegativeButton(android.R.string.cancel, null)
                     .setPositiveButton(R.string.discard) { _, _ ->
                         mAttachmentFileBinderManager?.stopUploadAllAttachments()
-                        backPressedAlreadyApproved = true
+                        mEntryEditViewModel.backPressedAlreadyApproved = true
                         approved.invoke()
                     }.create().show()
         } else {
@@ -743,14 +761,19 @@ class EntryEditActivity : DatabaseLockActivity(),
         }
     }
 
+    private fun buildEntryResult(entry: Entry): Bundle {
+        return Bundle().apply {
+            putParcelable(ADD_OR_UPDATE_ENTRY_KEY, entry.nodeId)
+        }
+    }
+
     private fun finishForEntryResult(entry: Entry) {
         // Assign entry callback as a result
         try {
-            val bundle = Bundle()
+            val bundle = buildEntryResult(entry)
             val intentEntry = Intent()
-            bundle.putParcelable(ADD_OR_UPDATE_ENTRY_KEY, entry.nodeId)
             intentEntry.putExtras(bundle)
-            setResult(Activity.RESULT_OK, intentEntry)
+            setResult(RESULT_OK, intentEntry)
             super.finish()
         } catch (e: Exception) {
             // Exception when parcelable can't be done
@@ -758,6 +781,10 @@ class EntryEditActivity : DatabaseLockActivity(),
         }
     }
 
+    enum class RegistrationType {
+        UPDATE, CREATE
+    }
+
     companion object {
 
         private val TAG = EntryEditActivity::class.java.name
@@ -767,23 +794,12 @@ class EntryEditActivity : DatabaseLockActivity(),
         const val KEY_PARENT = "parent"
         const val ADD_OR_UPDATE_ENTRY_KEY = "ADD_OR_UPDATE_ENTRY_KEY"
 
-        fun registerForEntryResult(fragment: Fragment,
-                                   entryAddedOrUpdatedListener: (NodeId<UUID>?) -> Unit): ActivityResultLauncher<Intent> {
-            return fragment.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) { result ->
-                if (result.resultCode == Activity.RESULT_OK) {
-                    entryAddedOrUpdatedListener.invoke(
-                        result.data?.getParcelableExtraCompat(ADD_OR_UPDATE_ENTRY_KEY)
-                    )
-                } else {
-                    entryAddedOrUpdatedListener.invoke(null)
-                }
-            }
-        }
-
-        fun registerForEntryResult(activity: FragmentActivity,
-                                   entryAddedOrUpdatedListener: (NodeId<UUID>?) -> Unit): ActivityResultLauncher<Intent> {
+        fun registerForEntryResult(
+            activity: FragmentActivity,
+            entryAddedOrUpdatedListener: (NodeId<UUID>?) -> Unit
+        ): ActivityResultLauncher<Intent> {
             return activity.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) { result ->
-                if (result.resultCode == Activity.RESULT_OK) {
+                if (result.resultCode == RESULT_OK) {
                     entryAddedOrUpdatedListener.invoke(
                         result.data?.getParcelableExtraCompat(ADD_OR_UPDATE_ENTRY_KEY)
                     )
@@ -794,151 +810,78 @@ class EntryEditActivity : DatabaseLockActivity(),
         }
 
         /**
-         * Launch EntryEditActivity to update an existing entry by his [entryId]
+         * Launch EntryEditActivity to update an existing entry or to add a new entry in an existing group
          */
-        fun launchToUpdate(activity: Activity,
-                           database: ContextualDatabase,
-                           entryId: NodeId<UUID>,
-                           activityResultLauncher: ActivityResultLauncher<Intent>) {
+        fun launch(
+            activity: Activity,
+            database: ContextualDatabase,
+            registrationType: RegistrationType,
+            nodeId: NodeId<*>,
+            activityResultLauncher: ActivityResultLauncher<Intent>
+        ) {
             if (database.loaded && !database.isReadOnly) {
                 if (TimeoutHelper.checkTimeAndLockIfTimeout(activity)) {
                     val intent = Intent(activity, EntryEditActivity::class.java)
-                    intent.putExtra(KEY_ENTRY, entryId)
+                    when (registrationType) {
+                        RegistrationType.UPDATE -> intent.putExtra(KEY_ENTRY, nodeId)
+                        RegistrationType.CREATE -> intent.putExtra(KEY_PARENT, nodeId)
+                    }
                     activityResultLauncher.launch(intent)
                 }
             }
         }
 
         /**
-         * Launch EntryEditActivity to add a new entry in an existent group
+         * Launch EntryEditActivity to add a new entry in special selection
          */
-        fun launchToCreate(activity: Activity,
-                           database: ContextualDatabase,
-                           groupId: NodeId<*>,
-                           activityResultLauncher: ActivityResultLauncher<Intent>) {
-            if (database.loaded && !database.isReadOnly) {
-                if (TimeoutHelper.checkTimeAndLockIfTimeout(activity)) {
-                    val intent = Intent(activity, EntryEditActivity::class.java)
-                    intent.putExtra(KEY_PARENT, groupId)
-                    activityResultLauncher.launch(intent)
-                }
-            }
-        }
-
-        fun launchToUpdateForSave(context: Context,
-                                  database: ContextualDatabase,
-                                  entryId: NodeId<UUID>,
-                                  searchInfo: SearchInfo) {
-            if (database.loaded && !database.isReadOnly) {
-                if (TimeoutHelper.checkTimeAndLockIfTimeout(context)) {
-                    val intent = Intent(context, EntryEditActivity::class.java)
-                    intent.putExtra(KEY_ENTRY, entryId)
-                    EntrySelectionHelper.startActivityForSaveModeResult(
-                        context,
-                        intent,
-                        searchInfo
-                    )
-                }
-            }
-        }
-
-        fun launchToCreateForSave(context: Context,
-                                  database: ContextualDatabase,
-                                  groupId: NodeId<*>,
-                                  searchInfo: SearchInfo) {
+        fun launchForSelection(
+            context: Context,
+            database: ContextualDatabase,
+            typeMode: TypeMode,
+            groupId: NodeId<*>,
+            searchInfo: SearchInfo? = null,
+            activityResultLauncher: ActivityResultLauncher<Intent>? = null,
+        ) {
             if (database.loaded && !database.isReadOnly) {
                 if (TimeoutHelper.checkTimeAndLockIfTimeout(context)) {
                     val intent = Intent(context, EntryEditActivity::class.java)
                     intent.putExtra(KEY_PARENT, groupId)
-                    EntrySelectionHelper.startActivityForSaveModeResult(
-                        context,
-                        intent,
-                        searchInfo
+                    EntrySelectionHelper.startActivityForSelectionModeResult(
+                        context = context,
+                        intent = intent,
+                        typeMode = typeMode,
+                        searchInfo = searchInfo,
+                        activityResultLauncher = activityResultLauncher
                     )
                 }
             }
         }
 
         /**
-         * Launch EntryEditActivity to add a new entry in keyboard selection
+         * Launch EntryEditActivity to update an updated entry or register a new entry (from autofill)
          */
-        fun launchForKeyboardSelectionResult(context: Context,
-                                             database: ContextualDatabase,
-                                             groupId: NodeId<*>,
-                                             searchInfo: SearchInfo? = null) {
+        fun launchForRegistration(
+            context: Context,
+            database: ContextualDatabase,
+            nodeId: NodeId<*>,
+            registerInfo: RegisterInfo? = null,
+            typeMode: TypeMode,
+            registrationType: RegistrationType,
+            activityResultLauncher: ActivityResultLauncher<Intent>? = null,
+        ) {
             if (database.loaded && !database.isReadOnly) {
                 if (TimeoutHelper.checkTimeAndLockIfTimeout(context)) {
                     val intent = Intent(context, EntryEditActivity::class.java)
-                    intent.putExtra(KEY_PARENT, groupId)
-                    EntrySelectionHelper.startActivityForKeyboardSelectionModeResult(
+                    when (registrationType) {
+                        RegistrationType.UPDATE -> intent.putExtra(KEY_ENTRY, nodeId)
+                        RegistrationType.CREATE -> intent.putExtra(KEY_PARENT, nodeId)
+                    }
+                    EntrySelectionHelper.startActivityForRegistrationModeResult(
                         context,
-                        intent,
-                        searchInfo
-                    )
-                }
-            }
-        }
-
-        /**
-         * Launch EntryEditActivity to add a new entry in autofill selection
-         */
-        @RequiresApi(api = Build.VERSION_CODES.O)
-        fun launchForAutofillResult(activity: AppCompatActivity,
-                                    database: ContextualDatabase,
-                                    activityResultLauncher: ActivityResultLauncher<Intent>?,
-                                    autofillComponent: AutofillComponent,
-                                    groupId: NodeId<*>,
-                                    searchInfo: SearchInfo? = null) {
-            if (database.loaded && !database.isReadOnly) {
-                if (TimeoutHelper.checkTimeAndLockIfTimeout(activity)) {
-                    val intent = Intent(activity, EntryEditActivity::class.java)
-                    intent.putExtra(KEY_PARENT, groupId)
-                    AutofillHelper.startActivityForAutofillResult(
-                        activity,
-                        intent,
                         activityResultLauncher,
-                        autofillComponent,
-                        searchInfo
-                    )
-                }
-            }
-        }
-
-        /**
-         * Launch EntryEditActivity to register an updated entry (from autofill)
-         */
-        fun launchToUpdateForRegistration(context: Context,
-                                          database: ContextualDatabase,
-                                          entryId: NodeId<UUID>,
-                                          registerInfo: RegisterInfo? = null) {
-            if (database.loaded && !database.isReadOnly) {
-                if (TimeoutHelper.checkTimeAndLockIfTimeout(context)) {
-                    val intent = Intent(context, EntryEditActivity::class.java)
-                    intent.putExtra(KEY_ENTRY, entryId)
-                    EntrySelectionHelper.startActivityForRegistrationModeResult(
-                        context,
                         intent,
-                        registerInfo
-                    )
-                }
-            }
-        }
-
-        /**
-         * Launch EntryEditActivity to register a new entry (from autofill)
-         */
-        fun launchToCreateForRegistration(context: Context,
-                                          database: ContextualDatabase,
-                                          groupId: NodeId<*>,
-                                          registerInfo: RegisterInfo? = null) {
-            if (database.loaded && !database.isReadOnly) {
-                if (TimeoutHelper.checkTimeAndLockIfTimeout(context)) {
-                    val intent = Intent(context, EntryEditActivity::class.java)
-                    intent.putExtra(KEY_PARENT, groupId)
-                    EntrySelectionHelper.startActivityForRegistrationModeResult(
-                        context,
-                        intent,
-                        registerInfo
+                        registerInfo,
+                        typeMode
                     )
                 }
             }

app/src/main/java/com/kunzisoft/keepass/activities/EntrySelectionLauncherActivity.kt

@@ -1,226 +0,0 @@
-/*
- * Copyright 2019 Jeremy Jamet / Kunzisoft.
- *
- * This file is part of KeePassDX.
- *
- *  KeePassDX is free software: you can redistribute it and/or modify
- *  it under the terms of the GNU General Public License as published by
- *  the Free Software Foundation, either version 3 of the License, or
- *  (at your option) any later version.
- *
- *  KeePassDX is distributed in the hope that it will be useful,
- *  but WITHOUT ANY WARRANTY; without even the implied warranty of
- *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
- *  GNU General Public License for more details.
- *
- *  You should have received a copy of the GNU General Public License
- *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
- *
- */
-package com.kunzisoft.keepass.activities
-
-import android.content.Context
-import android.content.Intent
-import android.net.Uri
-import android.os.Bundle
-import android.widget.Toast
-import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.activities.legacy.DatabaseModeActivity
-import com.kunzisoft.keepass.database.ContextualDatabase
-import com.kunzisoft.keepass.database.helper.SearchHelper
-import com.kunzisoft.keepass.magikeyboard.MagikeyboardService
-import com.kunzisoft.keepass.model.SearchInfo
-import com.kunzisoft.keepass.otp.OtpEntryFields
-import com.kunzisoft.keepass.utils.KeyboardUtil.isKeyboardActivatedInSettings
-import com.kunzisoft.keepass.utils.getParcelableCompat
-import com.kunzisoft.keepass.utils.WebDomain
-
-/**
- * Activity to search or select entry in database,
- * Commonly used with Magikeyboard
- */
-class EntrySelectionLauncherActivity : DatabaseModeActivity() {
-
-    override fun applyCustomStyle(): Boolean {
-        return false
-    }
-
-    override fun finishActivityIfReloadRequested(): Boolean {
-        return false
-    }
-
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-
-        val keySelectionBundle = intent.getBundleExtra(KEY_SELECTION_BUNDLE)
-        if (keySelectionBundle != null) {
-            // To manage package name
-            var searchInfo = SearchInfo()
-            keySelectionBundle.getParcelableCompat<SearchInfo>(KEY_SEARCH_INFO)?.let { mSearchInfo ->
-                searchInfo = mSearchInfo
-            }
-            launch(database, searchInfo)
-        } else {
-            // To manage share
-            var sharedWebDomain: String? = null
-            var otpString: String? = null
-
-            when (intent?.action) {
-                Intent.ACTION_SEND -> {
-                    if ("text/plain" == intent.type) {
-                        // Retrieve web domain or OTP
-                        intent.getStringExtra(Intent.EXTRA_TEXT)?.let { extra ->
-                            if (OtpEntryFields.isOTPUri(extra))
-                                otpString = extra
-                            else
-                                sharedWebDomain = Uri.parse(extra).host
-                        }
-                    }
-                    launchSelection(database, sharedWebDomain, otpString)
-                }
-                Intent.ACTION_VIEW -> {
-                    // Retrieve OTP
-                    intent.dataString?.let { extra ->
-                        if (OtpEntryFields.isOTPUri(extra))
-                            otpString = extra
-                    }
-                    launchSelection(database, sharedWebDomain, otpString)
-                }
-                else -> {
-                    if (database != null) {
-                        GroupActivity.launch(this, database)
-                    } else {
-                        FileDatabaseSelectActivity.launch(this)
-                    }
-                }
-            }
-        }
-        finish()
-    }
-
-    private fun launchSelection(database: ContextualDatabase?,
-                                sharedWebDomain: String?,
-                                otpString: String?) {
-        // Build domain search param
-        val searchInfo = SearchInfo().apply {
-            this.webDomain = sharedWebDomain
-            this.otpString = otpString
-        }
-
-        WebDomain.getConcreteWebDomain(this, searchInfo.webDomain) { concreteWebDomain ->
-            searchInfo.webDomain = concreteWebDomain
-            launch(database, searchInfo)
-        }
-    }
-
-    private fun launch(database: ContextualDatabase?,
-                       searchInfo: SearchInfo) {
-
-        // Setting to integrate Magikeyboard
-        val searchShareForMagikeyboard = isKeyboardActivatedInSettings()
-
-        // If database is open
-        val readOnly = database?.isReadOnly != false
-        SearchHelper.checkAutoSearchInfo(this,
-                database,
-                searchInfo,
-                { openedDatabase, items ->
-                    // Items found
-                    if (searchInfo.otpString != null) {
-                        if (!readOnly) {
-                            GroupActivity.launchForSaveResult(
-                                this,
-                                openedDatabase,
-                                searchInfo,
-                                false)
-                        } else {
-                            Toast.makeText(applicationContext,
-                                    R.string.autofill_read_only_save,
-                                    Toast.LENGTH_LONG)
-                                    .show()
-                        }
-                    } else if (searchShareForMagikeyboard) {
-                        MagikeyboardService.performSelection(
-                            items,
-                            { entryInfo ->
-                                // Automatically populate keyboard
-                                MagikeyboardService.populateKeyboardAndMoveAppToBackground(
-                                    this,
-                                    entryInfo
-                                )
-                            },
-                            { autoSearch ->
-                                GroupActivity.launchForKeyboardSelectionResult(this,
-                                    openedDatabase,
-                                    searchInfo,
-                                    autoSearch)
-                            }
-                        )
-                    } else {
-                        GroupActivity.launchForSearchResult(this,
-                            openedDatabase,
-                            searchInfo,
-                            true)
-                    }
-                },
-                { openedDatabase ->
-                    // Show the database UI to select the entry
-                    if (searchInfo.otpString != null) {
-                        if (!readOnly) {
-                            GroupActivity.launchForSaveResult(this,
-                                openedDatabase,
-                                searchInfo,
-                                false)
-                        } else {
-                            Toast.makeText(applicationContext,
-                                    R.string.autofill_read_only_save,
-                                    Toast.LENGTH_LONG)
-                                    .show()
-                        }
-                    } else if (searchShareForMagikeyboard) {
-                        GroupActivity.launchForKeyboardSelectionResult(this,
-                            openedDatabase,
-                            searchInfo,
-                            false)
-                    } else {
-                        GroupActivity.launchForSearchResult(this,
-                            openedDatabase,
-                            searchInfo,
-                            false)
-                    }
-                },
-                {
-                    // If database not open
-                    if (searchInfo.otpString != null) {
-                        FileDatabaseSelectActivity.launchForSaveResult(this,
-                                searchInfo)
-                    } else if (searchShareForMagikeyboard) {
-                        FileDatabaseSelectActivity.launchForKeyboardSelectionResult(this,
-                                searchInfo)
-                    } else {
-                        FileDatabaseSelectActivity.launchForSearchResult(this,
-                                searchInfo)
-                    }
-                }
-        )
-    }
-
-    companion object {
-
-        private const val KEY_SELECTION_BUNDLE = "KEY_SELECTION_BUNDLE"
-        private const val KEY_SEARCH_INFO = "KEY_SEARCH_INFO"
-
-        fun launch(context: Context,
-                   searchInfo: SearchInfo? = null) {
-            val intent = Intent(context, EntrySelectionLauncherActivity::class.java).apply {
-                putExtra(KEY_SELECTION_BUNDLE, Bundle().apply {
-                    putParcelable(KEY_SEARCH_INFO, searchInfo)
-                })
-            }
-            // New task needed because don't launch from an Activity context
-            intent.flags = Intent.FLAG_ACTIVITY_NEW_TASK or
-                    Intent.FLAG_ACTIVITY_CLEAR_TASK
-            context.startActivity(intent)
-        }
-    }
-}

app/src/main/java/com/kunzisoft/keepass/activities/FileDatabaseSelectActivity.kt

@@ -19,7 +19,6 @@
  */
 package com.kunzisoft.keepass.activities
 
-import android.app.Activity
 import android.content.Context
 import android.content.Intent
 import android.net.Uri
@@ -33,8 +32,6 @@ import android.view.MenuItem
 import android.view.View
 import androidx.activity.result.ActivityResultLauncher
 import androidx.activity.viewModels
-import androidx.annotation.RequiresApi
-import androidx.appcompat.app.AppCompatActivity
 import androidx.appcompat.widget.Toolbar
 import androidx.coordinatorlayout.widget.CoordinatorLayout
 import androidx.core.view.isVisible
@@ -44,31 +41,28 @@ import androidx.recyclerview.widget.SimpleItemAnimator
 import com.google.android.material.snackbar.Snackbar
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.dialogs.SetMainCredentialDialogFragment
-import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
 import com.kunzisoft.keepass.activities.helpers.ExternalFileHelper
-import com.kunzisoft.keepass.activities.helpers.SpecialMode
 import com.kunzisoft.keepass.activities.helpers.setOpenDocumentClickListener
 import com.kunzisoft.keepass.activities.legacy.DatabaseModeActivity
 import com.kunzisoft.keepass.adapters.FileDatabaseHistoryAdapter
 import com.kunzisoft.keepass.app.database.FileDatabaseHistoryAction
-import com.kunzisoft.keepass.autofill.AutofillComponent
-import com.kunzisoft.keepass.autofill.AutofillHelper
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.TypeMode
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.MainCredential
 import com.kunzisoft.keepass.education.FileDatabaseSelectActivityEducation
 import com.kunzisoft.keepass.hardware.HardwareKey
 import com.kunzisoft.keepass.model.RegisterInfo
 import com.kunzisoft.keepass.model.SearchInfo
-import com.kunzisoft.keepass.services.DatabaseTaskNotificationService
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_CREATE_TASK
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_LOAD_TASK
-import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.DATABASE_URI_KEY
 import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.tasks.ActionRunnable
+import com.kunzisoft.keepass.utils.AppUtil.isContributingUser
 import com.kunzisoft.keepass.utils.DexUtil
 import com.kunzisoft.keepass.utils.MagikeyboardUtil
 import com.kunzisoft.keepass.utils.MenuUtil
-import com.kunzisoft.keepass.utils.UriUtil.isContributingUser
 import com.kunzisoft.keepass.utils.UriUtil.openUrl
 import com.kunzisoft.keepass.utils.getParcelableCompat
 import com.kunzisoft.keepass.view.asError
@@ -98,10 +92,7 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
 
     private var mExternalFileHelper: ExternalFileHelper? = null
 
-    private var mAutofillActivityResultLauncher: ActivityResultLauncher<Intent>? =
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O)
-            AutofillHelper.buildActivityResultLauncher(this)
-        else null
+    override fun manageDatabaseInfo(): Boolean  = false
 
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
@@ -132,7 +123,7 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
         mExternalFileHelper = ExternalFileHelper(this)
         mExternalFileHelper?.buildOpenDocument { uri ->
             uri?.let {
-                launchPasswordActivityWithPath(uri)
+                launchMainCredentialActivityWithPath(uri)
             }
         }
         mExternalFileHelper?.buildCreateDocument("application/x-keepass") { databaseFileCreatedUri ->
@@ -161,7 +152,7 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
         }
         mAdapterDatabaseHistory?.setOnFileDatabaseHistoryOpenListener { fileDatabaseHistoryEntityToOpen ->
             fileDatabaseHistoryEntityToOpen.databaseUri?.let { databaseFileUri ->
-                launchPasswordActivity(
+                launchMainCredentialActivity(
                     databaseFileUri,
                     fileDatabaseHistoryEntityToOpen.keyFileUri,
                     fileDatabaseHistoryEntityToOpen.hardwareKey
@@ -180,7 +171,7 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
 
         // Load default database the first time
         databaseFilesViewModel.doForDefaultDatabase { databaseFileUri ->
-            launchPasswordActivityWithPath(databaseFileUri)
+            launchMainCredentialActivityWithPath(databaseFileUri)
         }
 
         // Retrieve the database URI provided by file manager after an orientation change
@@ -223,13 +214,16 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
             // Retrieve settings for default database
             mAdapterDatabaseHistory?.setDefaultDatabase(it)
         }
+
+        // Remove all the remember locations if needed
+        if (PreferencesUtil.rememberDatabaseLocations(applicationContext).not()) {
+            FileDatabaseHistoryAction.getInstance(applicationContext)
+                .deleteAll()
+        }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-        if (database != null) {
-            launchGroupActivityIfLoaded(database)
-        }
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        launchGroupActivityIfLoaded(database)
     }
 
     override fun onDatabaseActionFinished(
@@ -237,25 +231,7 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
         actionTask: String,
         result: ActionRunnable.Result
     ) {
-        super.onDatabaseActionFinished(database, actionTask, result)
-
         if (result.isSuccess) {
-            // Update list
-            when (actionTask) {
-                ACTION_DATABASE_CREATE_TASK,
-                ACTION_DATABASE_LOAD_TASK -> {
-                    result.data?.getParcelableCompat<Uri>(DATABASE_URI_KEY)?.let { databaseUri ->
-                        val mainCredential =
-                            result.data?.getParcelableCompat(DatabaseTaskNotificationService.MAIN_CREDENTIAL_KEY)
-                                ?: MainCredential()
-                        databaseFilesViewModel.addDatabaseFile(
-                            databaseUri,
-                            mainCredential.keyFileUri,
-                            mainCredential.hardwareKey
-                        )
-                    }
-                }
-            }
             // Launch activity
             when (actionTask) {
                 ACTION_DATABASE_CREATE_TASK -> {
@@ -264,13 +240,13 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
                         database,
                         false
                     )
+                    coordinatorLayout.showActionErrorIfNeeded(result)
                 }
                 ACTION_DATABASE_LOAD_TASK -> {
                     launchGroupActivityIfLoaded(database)
                 }
             }
         }
-        coordinatorLayout.showActionErrorIfNeeded(result)
     }
 
     /**
@@ -288,17 +264,58 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
         Snackbar.make(coordinatorLayout, error, Snackbar.LENGTH_LONG).asError().show()
     }
 
-    private fun launchPasswordActivity(databaseUri: Uri, keyFile: Uri?, hardwareKey: HardwareKey?) {
-        MainCredentialActivity.launch(this,
-                databaseUri,
-                keyFile,
-                hardwareKey,
-                { exception ->
-                    fileNoFoundAction(exception)
+    private fun launchMainCredentialActivity(databaseUri: Uri, keyFile: Uri?, hardwareKey: HardwareKey?) {
+        try {
+            EntrySelectionHelper.doSpecialAction(
+                intent = this.intent,
+                defaultAction = {
+                    MainCredentialActivity.launch(
+                        activity = this,
+                        databaseFile = databaseUri,
+                        keyFile = keyFile,
+                        hardwareKey = hardwareKey
+                    )
                 },
-                { onCancelSpecialMode() },
-                { onLaunchActivitySpecialMode() },
-                mAutofillActivityResultLauncher)
+                searchAction = { searchInfo ->
+                    MainCredentialActivity.launchForSearchResult(
+                        activity = this,
+                        databaseFile = databaseUri,
+                        keyFile = keyFile,
+                        hardwareKey = hardwareKey,
+                        searchInfo = searchInfo
+                    )
+                    onLaunchActivitySpecialMode()
+                },
+                selectionAction = { intentSenderMode, typeMode, searchInfo ->
+                    MainCredentialActivity.launchForSelection(
+                        activity = this,
+                        activityResultLauncher = if (intentSenderMode)
+                            mCredentialActivityResultLauncher else null,
+                        databaseFile = databaseUri,
+                        keyFile = keyFile,
+                        hardwareKey = hardwareKey,
+                        typeMode = typeMode,
+                        searchInfo = searchInfo
+                    )
+                    onLaunchActivitySpecialMode()
+                },
+                registrationAction = { intentSenderMode, typeMode, registerInfo ->
+                    MainCredentialActivity.launchForRegistration(
+                        activity = this,
+                        activityResultLauncher = if (intentSenderMode)
+                            mCredentialActivityResultLauncher else null,
+                        databaseFile = databaseUri,
+                        keyFile = keyFile,
+                        hardwareKey = hardwareKey,
+                        typeMode = typeMode,
+                        registerInfo = registerInfo
+                    )
+                    onLaunchActivitySpecialMode()
+                }
+            )
+        } catch (e: FileNotFoundException) {
+            fileNoFoundAction(e)
+        }
     }
 
     private fun launchGroupActivityIfLoaded(database: ContextualDatabase) {
@@ -308,12 +325,13 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
                 { onValidateSpecialMode() },
                 { onCancelSpecialMode() },
                 { onLaunchActivitySpecialMode() },
-                mAutofillActivityResultLauncher)
+                mCredentialActivityResultLauncher
+            )
         }
     }
 
-    private fun launchPasswordActivityWithPath(databaseUri: Uri) {
-        launchPasswordActivity(databaseUri, null, null)
+    private fun launchMainCredentialActivityWithPath(databaseUri: Uri) {
+        launchMainCredentialActivity(databaseUri, null, null)
         // Delete flickering for kitkat <=
         @Suppress("DEPRECATION")
         if (Build.VERSION.SDK_INT < Build.VERSION_CODES.LOLLIPOP)
@@ -337,10 +355,6 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
             }
         }
 
-        mDatabase?.let { database ->
-            launchGroupActivityIfLoaded(database)
-        }
-
         // Show recent files if allowed
         if (PreferencesUtil.showRecentFiles(this@FileDatabaseSelectActivity)) {
             databaseFilesViewModel.loadListOfDatabases()
@@ -359,7 +373,7 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
         try {
             mDatabaseFileUri?.let { databaseUri ->
                 // Create the new database
-                createDatabase(databaseUri, mainCredential)
+                mDatabaseViewModel.createDatabase(databaseUri, mainCredential)
             }
         } catch (e: Exception) {
             val error = getString(R.string.error_create_database_file)
@@ -443,55 +457,36 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
          * -------------------------
          */
 
-        fun launchForSearchResult(context: Context,
-                                  searchInfo: SearchInfo) {
-            EntrySelectionHelper.startActivityForSearchModeResult(context,
-                    Intent(context, FileDatabaseSelectActivity::class.java),
-                    searchInfo)
+        fun launchForSearch(
+            context: Context,
+            searchInfo: SearchInfo
+        ) {
+            EntrySelectionHelper.startActivityForSearchModeResult(
+                context = context,
+                intent = Intent(context, FileDatabaseSelectActivity::class.java),
+                searchInfo = searchInfo
+            )
         }
 
         /*
          * -------------------------
-         * 		Save Launch
+         * 		Selection Launch
          * -------------------------
          */
 
-        fun launchForSaveResult(context: Context,
-                                searchInfo: SearchInfo) {
-            EntrySelectionHelper.startActivityForSaveModeResult(context,
-                    Intent(context, FileDatabaseSelectActivity::class.java),
-                    searchInfo)
-        }
-
-        /*
-         * -------------------------
-         * 		Keyboard Launch
-         * -------------------------
-         */
-
-        fun launchForKeyboardSelectionResult(activity: Activity,
-                                             searchInfo: SearchInfo? = null) {
-            EntrySelectionHelper.startActivityForKeyboardSelectionModeResult(activity,
-                    Intent(activity, FileDatabaseSelectActivity::class.java),
-                    searchInfo)
-        }
-
-        /*
-         * -------------------------
-         * 		Autofill Launch
-         * -------------------------
-         */
-
-        @RequiresApi(api = Build.VERSION_CODES.O)
-        fun launchForAutofillResult(activity: AppCompatActivity,
-                                    activityResultLauncher: ActivityResultLauncher<Intent>?,
-                                    autofillComponent: AutofillComponent,
-                                    searchInfo: SearchInfo? = null) {
-            AutofillHelper.startActivityForAutofillResult(activity,
-                    Intent(activity, FileDatabaseSelectActivity::class.java),
-                    activityResultLauncher,
-                    autofillComponent,
-                    searchInfo)
+        fun launchForSelection(
+            context: Context,
+            typeMode: TypeMode,
+            searchInfo: SearchInfo? = null,
+            activityResultLauncher: ActivityResultLauncher<Intent>?,
+        ) {
+            EntrySelectionHelper.startActivityForSelectionModeResult(
+                context = context,
+                intent = Intent(context, FileDatabaseSelectActivity::class.java),
+                searchInfo = searchInfo,
+                typeMode = typeMode,
+                activityResultLauncher = activityResultLauncher
+            )
         }
 
         /*
@@ -499,11 +494,19 @@ class FileDatabaseSelectActivity : DatabaseModeActivity(),
          * 		Registration Launch
          * -------------------------
          */
-        fun launchForRegistration(context: Context,
-                                  registerInfo: RegisterInfo? = null) {
-            EntrySelectionHelper.startActivityForRegistrationModeResult(context,
-                    Intent(context, FileDatabaseSelectActivity::class.java),
-                    registerInfo)
+        fun launchForRegistration(
+            context: Context,
+            typeMode: TypeMode,
+            registerInfo: RegisterInfo? = null,
+            activityResultLauncher: ActivityResultLauncher<Intent>?,
+        ) {
+            EntrySelectionHelper.startActivityForRegistrationModeResult(
+                context = context,
+                intent = Intent(context, FileDatabaseSelectActivity::class.java),
+                registerInfo = registerInfo,
+                typeMode = typeMode,
+                activityResultLauncher = activityResultLauncher
+            )
         }
     }
 }

app/src/main/java/com/kunzisoft/keepass/activities/IconPickerActivity.kt

@@ -78,6 +78,8 @@ class IconPickerActivity : DatabaseLockActivity() {
 
     private var mExternalFileHelper: ExternalFileHelper? = null
 
+    override fun manageDatabaseInfo(): Boolean = true
+
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
 
@@ -174,10 +176,10 @@ class IconPickerActivity : DatabaseLockActivity() {
         return true
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
 
-        if (database?.allowCustomIcons == true) {
+        if (database.allowCustomIcons) {
             uploadButton.setOpenDocumentClickListener(mExternalFileHelper)
         } else {
             uploadButton.visibility = View.GONE

app/src/main/java/com/kunzisoft/keepass/activities/ImageViewerActivity.kt

@@ -45,6 +45,8 @@ class ImageViewerActivity : DatabaseLockActivity() {
     private lateinit var imageView: ImageView
     private lateinit var progressView: View
 
+    override fun manageDatabaseInfo(): Boolean = false
+
     @SuppressLint("ClickableViewAccessibility")
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
@@ -101,7 +103,7 @@ class ImageViewerActivity : DatabaseLockActivity() {
         return true
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
 
         try {
@@ -119,18 +121,16 @@ class ImageViewerActivity : DatabaseLockActivity() {
                     resources.displayMetrics.heightPixels * 2
                 )
 
-                database?.let { database ->
-                    BinaryDatabaseManager.loadBitmap(
-                        database,
-                        attachment.binaryData,
-                        mImagePreviewMaxWidth
-                    ) { bitmapLoaded ->
-                        if (bitmapLoaded == null) {
-                            finish()
-                        } else {
-                            progressView.visibility = View.GONE
-                            imageView.setImageBitmap(bitmapLoaded)
-                        }
+                BinaryDatabaseManager.loadBitmap(
+                    database,
+                    attachment.binaryData,
+                    mImagePreviewMaxWidth
+                ) { bitmapLoaded ->
+                    if (bitmapLoaded == null) {
+                        finish()
+                    } else {
+                        progressView.visibility = View.GONE
+                        imageView.setImageBitmap(bitmapLoaded)
                     }
                 }
             } ?: finish()

app/src/main/java/com/kunzisoft/keepass/activities/KeyGeneratorActivity.kt

@@ -28,6 +28,8 @@ class KeyGeneratorActivity : DatabaseLockActivity() {
     private lateinit var validationButton: View
     private var lockView: View? = null
 
+    override fun manageDatabaseInfo(): Boolean = true
+
     private val keyGeneratorViewModel: KeyGeneratorViewModel by viewModels()
 
     override fun onCreate(savedInstanceState: Bundle?) {

app/src/main/java/com/kunzisoft/keepass/activities/MainCredentialActivity.kt

@@ -36,8 +36,6 @@ import android.widget.TextView
 import android.widget.Toast
 import androidx.activity.result.ActivityResultLauncher
 import androidx.activity.viewModels
-import androidx.annotation.RequiresApi
-import androidx.appcompat.app.AppCompatActivity
 import androidx.appcompat.widget.Toolbar
 import androidx.biometric.BiometricManager
 import androidx.coordinatorlayout.widget.CoordinatorLayout
@@ -49,16 +47,15 @@ import androidx.lifecycle.repeatOnLifecycle
 import com.google.android.material.snackbar.Snackbar
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.dialogs.DuplicateUuidDialog
-import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
 import com.kunzisoft.keepass.activities.helpers.ExternalFileHelper
-import com.kunzisoft.keepass.activities.helpers.SpecialMode
 import com.kunzisoft.keepass.activities.legacy.DatabaseModeActivity
 import com.kunzisoft.keepass.app.database.FileDatabaseHistoryAction
-import com.kunzisoft.keepass.autofill.AutofillComponent
-import com.kunzisoft.keepass.autofill.AutofillHelper
 import com.kunzisoft.keepass.biometric.DeviceUnlockFragment
 import com.kunzisoft.keepass.biometric.DeviceUnlockManager
 import com.kunzisoft.keepass.biometric.deviceUnlockError
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.TypeMode
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.MainCredential
 import com.kunzisoft.keepass.database.exception.DuplicateUuidDatabaseException
@@ -127,10 +124,7 @@ class MainCredentialActivity : DatabaseModeActivity() {
     private var mReadOnly: Boolean = false
     private var mForceReadOnly: Boolean = false
 
-    private var mAutofillActivityResultLauncher: ActivityResultLauncher<Intent>? =
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O)
-            AutofillHelper.buildActivityResultLauncher(this)
-        else null
+    override fun manageDatabaseInfo(): Boolean  = false
 
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
@@ -313,20 +307,18 @@ class MainCredentialActivity : DatabaseModeActivity() {
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
-        if (database != null) {
-            // Trying to load another database
-            if (mDatabaseFileUri != null
-                && database.fileUri != null
-                && mDatabaseFileUri != database.fileUri) {
-                Toast.makeText(this,
-                    R.string.warning_database_already_opened,
-                    Toast.LENGTH_LONG
-                ).show()
-            }
-            launchGroupActivityIfLoaded(database)
+        // Trying to load another database
+        if (mDatabaseFileUri != null
+            && database.fileUri != null
+            && mDatabaseFileUri != database.fileUri) {
+            Toast.makeText(this,
+                R.string.warning_database_already_opened,
+                Toast.LENGTH_LONG
+            ).show()
         }
+        launchGroupActivityIfLoaded(database)
     }
 
     override fun onDatabaseActionFinished(
@@ -433,7 +425,7 @@ class MainCredentialActivity : DatabaseModeActivity() {
                 { onValidateSpecialMode() },
                 { onCancelSpecialMode() },
                 { onLaunchActivitySpecialMode() },
-                mAutofillActivityResultLauncher
+                mCredentialActivityResultLauncher
             )
         }
     }
@@ -511,10 +503,11 @@ class MainCredentialActivity : DatabaseModeActivity() {
         val password = intent.getStringExtra(KEY_PASSWORD)
         // Consume the intent extra password
         intent.removeExtra(KEY_PASSWORD)
-        val launchImmediately = intent.getBooleanExtra(KEY_LAUNCH_IMMEDIATELY, false)
         if (password != null) {
             mainCredentialView?.populatePasswordTextView(password)
         }
+        val launchImmediately = intent.getBooleanExtra(KEY_LAUNCH_IMMEDIATELY, false)
+        intent.removeExtra(KEY_LAUNCH_IMMEDIATELY)
         if (launchImmediately) {
             loadDatabase()
         } else {
@@ -569,13 +562,10 @@ class MainCredentialActivity : DatabaseModeActivity() {
             clearCredentialsViews()
         }
 
-        if (mReadOnly && (
-                mSpecialMode == SpecialMode.SAVE
-                || mSpecialMode == SpecialMode.REGISTRATION)
-        ) {
-            Log.e(TAG, getString(R.string.autofill_read_only_save))
+        if (mReadOnly && mSpecialMode == SpecialMode.REGISTRATION) {
+            Log.e(TAG, getString(R.string.error_save_read_only))
             Snackbar.make(coordinatorLayout,
-                    R.string.autofill_read_only_save,
+                    R.string.error_save_read_only,
                     Snackbar.LENGTH_LONG).asError().show()
         } else {
             databaseFileUri?.let { databaseUri ->
@@ -596,7 +586,7 @@ class MainCredentialActivity : DatabaseModeActivity() {
                                                   readOnly: Boolean,
                                                   cipherEncryptDatabase: CipherEncryptDatabase?,
                                                   fixDuplicateUUID: Boolean) {
-        loadDatabase(
+        mDatabaseViewModel.loadDatabase(
             databaseUri,
             mainCredential,
             readOnly,
@@ -749,11 +739,13 @@ class MainCredentialActivity : DatabaseModeActivity() {
         private const val KEY_PASSWORD = "password"
         private const val KEY_LAUNCH_IMMEDIATELY = "launchImmediately"
 
-        private fun buildAndLaunchIntent(activity: Activity,
-                                         databaseFile: Uri,
-                                         keyFile: Uri?,
-                                         hardwareKey: HardwareKey?,
-                                         intentBuildLauncher: (Intent) -> Unit) {
+        private fun buildAndLaunchIntent(
+            activity: Activity,
+            databaseFile: Uri,
+            keyFile: Uri?,
+            hardwareKey: HardwareKey?,
+            intentBuildLauncher: (Intent) -> Unit
+        ) {
             val intent = Intent(activity, MainCredentialActivity::class.java)
             intent.putExtra(KEY_FILENAME, databaseFile)
             if (keyFile != null)
@@ -770,10 +762,12 @@ class MainCredentialActivity : DatabaseModeActivity() {
          */
 
         @Throws(FileNotFoundException::class)
-        fun launch(activity: Activity,
-                   databaseFile: Uri,
-                   keyFile: Uri?,
-                   hardwareKey: HardwareKey?) {
+        fun launch(
+            activity: Activity,
+            databaseFile: Uri,
+            keyFile: Uri?,
+            hardwareKey: HardwareKey?
+        ) {
             buildAndLaunchIntent(activity, databaseFile, keyFile, hardwareKey) { intent ->
                 activity.startActivity(intent)
             }
@@ -786,185 +780,73 @@ class MainCredentialActivity : DatabaseModeActivity() {
          */
 
         @Throws(FileNotFoundException::class)
-        fun launchForSearchResult(activity: Activity,
-                                  databaseFile: Uri,
-                                  keyFile: Uri?,
-                                  hardwareKey: HardwareKey?,
-                                  searchInfo: SearchInfo) {
+        fun launchForSearchResult(
+            activity: Activity,
+            databaseFile: Uri,
+            keyFile: Uri?,
+            hardwareKey: HardwareKey?,
+            searchInfo: SearchInfo
+        ) {
             buildAndLaunchIntent(activity, databaseFile, keyFile, hardwareKey) { intent ->
                 EntrySelectionHelper.startActivityForSearchModeResult(
-                        activity,
-                        intent,
-                        searchInfo)
+                    context = activity,
+                    intent = intent,
+                    searchInfo = searchInfo
+                )
             }
         }
 
         /*
          * -------------------------
-         * 		Save Launch
+         * 		Selection Launch
          * -------------------------
          */
 
         @Throws(FileNotFoundException::class)
-        fun launchForSaveResult(activity: Activity,
-                                databaseFile: Uri,
-                                keyFile: Uri?,
-                                hardwareKey: HardwareKey?,
-                                searchInfo: SearchInfo) {
+        fun launchForSelection(
+            activity: Activity,
+            databaseFile: Uri,
+            keyFile: Uri?,
+            hardwareKey: HardwareKey?,
+            typeMode: TypeMode,
+            searchInfo: SearchInfo?,
+            activityResultLauncher: ActivityResultLauncher<Intent>?
+        ) {
             buildAndLaunchIntent(activity, databaseFile, keyFile, hardwareKey) { intent ->
-                EntrySelectionHelper.startActivityForSaveModeResult(
-                        activity,
-                        intent,
-                        searchInfo)
+                EntrySelectionHelper.startActivityForSelectionModeResult(
+                    context = activity,
+                    intent = intent,
+                    typeMode = typeMode,
+                    searchInfo = searchInfo,
+                    activityResultLauncher = activityResultLauncher
+                )
             }
         }
 
         /*
          * -------------------------
-         * 		Keyboard Launch
+         *      Registration Launch
          * -------------------------
          */
 
         @Throws(FileNotFoundException::class)
-        fun launchForKeyboardResult(activity: Activity,
-                                    databaseFile: Uri,
-                                    keyFile: Uri?,
-                                    hardwareKey: HardwareKey?,
-                                    searchInfo: SearchInfo?) {
-            buildAndLaunchIntent(activity, databaseFile, keyFile, hardwareKey) { intent ->
-                EntrySelectionHelper.startActivityForKeyboardSelectionModeResult(
-                        activity,
-                        intent,
-                        searchInfo)
-            }
-        }
-
-        /*
-         * -------------------------
-         * 		Autofill Launch
-         * -------------------------
-         */
-
-        @RequiresApi(api = Build.VERSION_CODES.O)
-        @Throws(FileNotFoundException::class)
-        fun launchForAutofillResult(activity: AppCompatActivity,
-                                    databaseFile: Uri,
-                                    keyFile: Uri?,
-                                    hardwareKey: HardwareKey?,
-                                    activityResultLauncher: ActivityResultLauncher<Intent>?,
-                                    autofillComponent: AutofillComponent,
-                                    searchInfo: SearchInfo?) {
-            buildAndLaunchIntent(activity, databaseFile, keyFile, hardwareKey) { intent ->
-                AutofillHelper.startActivityForAutofillResult(
-                        activity,
-                        intent,
-                        activityResultLauncher,
-                        autofillComponent,
-                        searchInfo)
-            }
-        }
-
-        /*
-         * -------------------------
-         * 		Registration Launch
-         * -------------------------
-         */
-        fun launchForRegistration(activity: Activity,
-                                  databaseFile: Uri,
-                                  keyFile: Uri?,
-                                  hardwareKey: HardwareKey?,
-                                  registerInfo: RegisterInfo?) {
+        fun launchForRegistration(
+            activity: Activity,
+            databaseFile: Uri,
+            keyFile: Uri?,
+            hardwareKey: HardwareKey?,
+            typeMode: TypeMode,
+            registerInfo: RegisterInfo?,
+            activityResultLauncher: ActivityResultLauncher<Intent>?
+        ) {
             buildAndLaunchIntent(activity, databaseFile, keyFile, hardwareKey) { intent ->
                 EntrySelectionHelper.startActivityForRegistrationModeResult(
-                        activity,
-                        intent,
-                        registerInfo)
-            }
-        }
-
-        /*
-         * -------------------------
-         * 		Global Launch
-         * -------------------------
-         */
-        fun launch(activity: AppCompatActivity,
-                   databaseUri: Uri,
-                   keyFile: Uri?,
-                   hardwareKey: HardwareKey?,
-                   fileNoFoundAction: (exception: FileNotFoundException) -> Unit,
-                   onCancelSpecialMode: () -> Unit,
-                   onLaunchActivitySpecialMode: () -> Unit,
-                   autofillActivityResultLauncher: ActivityResultLauncher<Intent>?) {
-
-            try {
-                EntrySelectionHelper.doSpecialAction(activity.intent,
-                        {
-                            launch(
-                                activity,
-                                databaseUri,
-                                keyFile,
-                                hardwareKey
-                            )
-                        },
-                        { searchInfo -> // Search Action
-                            launchForSearchResult(
-                                activity,
-                                databaseUri,
-                                keyFile,
-                                hardwareKey,
-                                searchInfo
-                            )
-                            onLaunchActivitySpecialMode()
-                        },
-                        { searchInfo -> // Save Action
-                            launchForSaveResult(
-                                activity,
-                                databaseUri,
-                                keyFile,
-                                hardwareKey,
-                                searchInfo
-                            )
-                            onLaunchActivitySpecialMode()
-                        },
-                        { searchInfo -> // Keyboard Selection Action
-                            launchForKeyboardResult(
-                                activity,
-                                databaseUri,
-                                keyFile,
-                                hardwareKey,
-                                searchInfo
-                            )
-                            onLaunchActivitySpecialMode()
-                        },
-                        { searchInfo, autofillComponent -> // Autofill Selection Action
-                            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
-                                launchForAutofillResult(
-                                    activity,
-                                    databaseUri,
-                                    keyFile,
-                                    hardwareKey,
-                                    autofillActivityResultLauncher,
-                                    autofillComponent,
-                                    searchInfo
-                                )
-                                onLaunchActivitySpecialMode()
-                            } else {
-                                onCancelSpecialMode()
-                            }
-                        },
-                        { registerInfo -> // Registration Action
-                            launchForRegistration(
-                                activity,
-                                databaseUri,
-                                keyFile,
-                                hardwareKey,
-                                registerInfo
-                            )
-                            onLaunchActivitySpecialMode()
-                        }
+                    context = activity,
+                    intent = intent,
+                    typeMode = typeMode,
+                    registerInfo = registerInfo,
+                    activityResultLauncher = activityResultLauncher,
                 )
-            } catch (e: FileNotFoundException) {
-                fileNoFoundAction(e)
             }
         }
     }

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/DatabaseChangedDialogFragment.kt

@@ -67,7 +67,7 @@ class DatabaseChangedDialogFragment : DatabaseDialogFragment() {
                 }
                 builder.setMessage(stringBuilder)
                 builder.setPositiveButton(android.R.string.ok) { _, _ ->
-                    actionDatabaseListener?.validateDatabaseChanged()
+                    actionDatabaseListener?.onDatabaseChangeValidated()
                 }
                 return builder.create()
             }
@@ -76,7 +76,7 @@ class DatabaseChangedDialogFragment : DatabaseDialogFragment() {
     }
 
     interface ActionDatabaseChangedListener {
-        fun validateDatabaseChanged()
+        fun onDatabaseChangeValidated()
     }
 
     companion object {
@@ -86,9 +86,10 @@ class DatabaseChangedDialogFragment : DatabaseDialogFragment() {
         private const val NEW_FILE_DATABASE_INFO = "NEW_FILE_DATABASE_INFO"
         private const val READ_ONLY_DATABASE = "READ_ONLY_DATABASE"
 
-        fun getInstance(oldSnapFileDatabaseInfo: SnapFileDatabaseInfo,
-                        newSnapFileDatabaseInfo: SnapFileDatabaseInfo,
-                        readOnly: Boolean
+        fun getInstance(
+            oldSnapFileDatabaseInfo: SnapFileDatabaseInfo,
+            newSnapFileDatabaseInfo: SnapFileDatabaseInfo,
+            readOnly: Boolean
         )
         : DatabaseChangedDialogFragment {
             val fragment = DatabaseChangedDialogFragment()

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/DatabaseDialogFragment.kt

@@ -5,6 +5,9 @@ import android.view.View
 import android.view.WindowManager.LayoutParams.FLAG_SECURE
 import androidx.fragment.app.DialogFragment
 import androidx.fragment.app.activityViewModels
+import androidx.lifecycle.Lifecycle
+import androidx.lifecycle.lifecycleScope
+import androidx.lifecycle.repeatOnLifecycle
 import com.kunzisoft.keepass.activities.legacy.DatabaseRetrieval
 import com.kunzisoft.keepass.activities.legacy.resetAppTimeoutWhenViewTouchedOrFocused
 import com.kunzisoft.keepass.database.ContextualDatabase
@@ -12,23 +15,40 @@ import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.tasks.ActionRunnable
 import com.kunzisoft.keepass.timeout.TimeoutHelper
 import com.kunzisoft.keepass.viewmodels.DatabaseViewModel
+import kotlinx.coroutines.launch
 
 abstract class DatabaseDialogFragment : DialogFragment(), DatabaseRetrieval {
 
     private val mDatabaseViewModel: DatabaseViewModel by activityViewModels()
-    private var mDatabase: ContextualDatabase? = null
+    private val mDatabase: ContextualDatabase?
+        get() = mDatabaseViewModel.database
 
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
-
-        mDatabaseViewModel.database.observe(this) { database ->
-            this.mDatabase = database
-            resetAppTimeoutOnTouchOrFocus()
-            onDatabaseRetrieved(database)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.STARTED) {
+                mDatabaseViewModel.actionState.collect { uiState ->
+                    when (uiState) {
+                        is DatabaseViewModel.ActionState.OnDatabaseActionFinished -> {
+                            onDatabaseActionFinished(
+                                uiState.database,
+                                uiState.actionTask,
+                                uiState.result
+                            )
+                        }
+                        else -> {}
+                    }
+                }
+            }
         }
-
-        mDatabaseViewModel.actionFinished.observe(this) { result ->
-            onDatabaseActionFinished(result.database, result.actionTask, result.result)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.RESUMED) {
+                mDatabaseViewModel.databaseState.collect { database ->
+                    database?.let {
+                        onDatabaseRetrieved(database)
+                    }
+                }
+            }
         }
     }
 
@@ -45,13 +65,14 @@ abstract class DatabaseDialogFragment : DialogFragment(), DatabaseRetrieval {
     }
 
     @Suppress("DEPRECATION")
+    @Deprecated(message = "")
     override fun onActivityCreated(savedInstanceState: Bundle?) {
         super.onActivityCreated(savedInstanceState)
 
         resetAppTimeoutOnTouchOrFocus()
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         // Can be overridden by a subclass
     }
 

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/GroupDialogFragment.kt

@@ -36,7 +36,7 @@ import com.kunzisoft.keepass.database.element.icon.IconImage
 import com.kunzisoft.keepass.model.GroupInfo
 import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.utils.TimeUtil.getDateTimeString
-import com.kunzisoft.keepass.utils.UuidUtil
+import com.kunzisoft.keepass.utils.UUIDUtils.asHexString
 import com.kunzisoft.keepass.utils.getParcelableCompat
 import com.kunzisoft.keepass.view.DateTimeFieldView
 
@@ -62,14 +62,14 @@ class GroupDialogFragment : DatabaseDialogFragment() {
     private lateinit var uuidContainerView: ViewGroup
     private lateinit var uuidReferenceView: TextView
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
         mPopulateIconMethod = { imageView, icon ->
-            database?.iconDrawableFactory?.assignDatabaseIcon(imageView, icon, mIconColor)
+            database.iconDrawableFactory.assignDatabaseIcon(imageView, icon, mIconColor)
         }
         mPopulateIconMethod?.invoke(iconView, mGroupInfo.icon)
 
-        if (database?.allowCustomSearchableGroup() == true) {
+        if (database.allowCustomSearchableGroup()) {
             searchableLabelView.visibility = View.VISIBLE
             searchableView.visibility = View.VISIBLE
         } else {
@@ -155,7 +155,7 @@ class GroupDialogFragment : DatabaseDialogFragment() {
             searchableView.text = stringFromInheritableBoolean(mGroupInfo.searchable)
             autoTypeView.text = stringFromInheritableBoolean(mGroupInfo.enableAutoType,
                 mGroupInfo.defaultAutoTypeSequence)
-            val uuid = UuidUtil.toHexString(mGroupInfo.id)
+            val uuid = mGroupInfo.id?.asHexString()
             if (uuid == null || uuid.isEmpty()) {
                 uuidContainerView.visibility = View.GONE
             } else {

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/GroupEditDialogFragment.kt

@@ -112,32 +112,32 @@ class GroupEditDialogFragment : DatabaseDialogFragment() {
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
 
         mPopulateIconMethod = { imageView, icon ->
-            database?.iconDrawableFactory?.assignDatabaseIcon(imageView, icon, mIconColor)
+            database.iconDrawableFactory.assignDatabaseIcon(imageView, icon, mIconColor)
         }
         mPopulateIconMethod?.invoke(iconButtonView, mGroupInfo.icon)
 
-        searchableContainerView.visibility = if (database?.allowCustomSearchableGroup() == true) {
+        searchableContainerView.visibility = if (database.allowCustomSearchableGroup()) {
             View.VISIBLE
         } else {
             View.GONE
         }
 
-        if (database?.allowAutoType() == true) {
+        if (database.allowAutoType()) {
             autoTypeContainerView.visibility = View.VISIBLE
         } else {
             autoTypeContainerView.visibility = View.GONE
         }
 
-        tagsAdapter = TagsProposalAdapter(requireContext(), database?.tagPool)
+        tagsAdapter = TagsProposalAdapter(requireContext(), database.tagPool)
         tagsCompletionView.apply {
             threshold = 1
             setAdapter(tagsAdapter)
         }
-        tagsContainerView.visibility = if (database?.allowTags() == true) View.VISIBLE else View.GONE
+        tagsContainerView.visibility = if (database.allowTags()) View.VISIBLE else View.GONE
     }
 
     override fun onCreateDialog(savedInstanceState: Bundle?): Dialog {

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/IconEditDialogFragment.kt

@@ -45,10 +45,10 @@ class IconEditDialogFragment : DatabaseDialogFragment() {
 
     private var mCustomIcon: IconImageCustom? = null
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         super.onDatabaseRetrieved(database)
         mPopulateIconMethod = { imageView, icon ->
-            database?.iconDrawableFactory?.assignDatabaseIcon(imageView, icon)
+            database.iconDrawableFactory.assignDatabaseIcon(imageView, icon)
         }
         mCustomIcon?.let { customIcon ->
             populateViewsWithCustomIcon(customIcon)

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/SetMainCredentialDialogFragment.kt

@@ -35,9 +35,9 @@ import com.google.android.material.textfield.TextInputLayout
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.helpers.ExternalFileHelper
 import com.kunzisoft.keepass.activities.helpers.setOpenDocumentClickListener
+import com.kunzisoft.keepass.credentialprovider.activity.HardwareKeyActivity
 import com.kunzisoft.keepass.database.MainCredential
 import com.kunzisoft.keepass.hardware.HardwareKey
-import com.kunzisoft.keepass.hardware.HardwareKeyActivity
 import com.kunzisoft.keepass.password.PasswordEntropy
 import com.kunzisoft.keepass.utils.UriUtil.getDocumentFile
 import com.kunzisoft.keepass.utils.UriUtil.openUrl
@@ -258,8 +258,7 @@ class SetMainCredentialDialogFragment : DatabaseDialogFragment() {
             showEmptyPasswordConfirmationDialog()
         } else if (!error
             && hardwareKey != null
-            && !HardwareKeyActivity.isHardwareKeyAvailable(
-                requireActivity(), hardwareKey, false)
+            && !HardwareKeyActivity.isHardwareKeyAvailable(requireActivity(), hardwareKey)
         ) {
             // show hardware driver dialog if required
             error = true

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/SetOTPDialogFragment.kt

@@ -29,7 +29,11 @@ import android.view.MotionEvent
 import android.view.View
 import android.view.ViewGroup
 import android.view.inputmethod.EditorInfo
-import android.widget.*
+import android.widget.AdapterView
+import android.widget.ArrayAdapter
+import android.widget.EditText
+import android.widget.Spinner
+import android.widget.TextView
 import androidx.appcompat.app.AlertDialog
 import com.google.android.material.textfield.TextInputLayout
 import com.kunzisoft.keepass.R
@@ -40,15 +44,15 @@ import com.kunzisoft.keepass.otp.OtpElement.Companion.MAX_OTP_DIGITS
 import com.kunzisoft.keepass.otp.OtpElement.Companion.MAX_TOTP_PERIOD
 import com.kunzisoft.keepass.otp.OtpElement.Companion.MIN_HOTP_COUNTER
 import com.kunzisoft.keepass.otp.OtpElement.Companion.MIN_OTP_DIGITS
-import com.kunzisoft.keepass.otp.OtpElement.Companion.MIN_TOTP_PERIOD
 import com.kunzisoft.keepass.otp.OtpElement.Companion.MIN_OTP_SECRET
+import com.kunzisoft.keepass.otp.OtpElement.Companion.MIN_TOTP_PERIOD
 import com.kunzisoft.keepass.otp.OtpTokenType
 import com.kunzisoft.keepass.otp.OtpType
 import com.kunzisoft.keepass.otp.TokenCalculator
-import com.kunzisoft.keepass.utils.UriUtil.isContributingUser
+import com.kunzisoft.keepass.utils.AppUtil.isContributingUser
 import com.kunzisoft.keepass.utils.UriUtil.openUrl
 import com.kunzisoft.keepass.utils.getParcelableCompat
-import java.util.*
+import java.util.Locale
 
 class SetOTPDialogFragment : DatabaseDialogFragment() {
 

app/src/main/java/com/kunzisoft/keepass/activities/fragments/DatabaseFragment.kt

@@ -4,36 +4,59 @@ import android.os.Bundle
 import android.view.View
 import androidx.fragment.app.Fragment
 import androidx.fragment.app.activityViewModels
+import androidx.lifecycle.Lifecycle
+import androidx.lifecycle.lifecycleScope
+import androidx.lifecycle.repeatOnLifecycle
 import com.kunzisoft.keepass.activities.legacy.DatabaseRetrieval
 import com.kunzisoft.keepass.activities.legacy.resetAppTimeoutWhenViewTouchedOrFocused
 import com.kunzisoft.keepass.database.ContextualDatabase
-import com.kunzisoft.keepass.database.element.binary.BinaryData
 import com.kunzisoft.keepass.tasks.ActionRunnable
 import com.kunzisoft.keepass.viewmodels.DatabaseViewModel
+import kotlinx.coroutines.launch
 
 abstract class DatabaseFragment : Fragment(), DatabaseRetrieval {
 
-    private val mDatabaseViewModel: DatabaseViewModel by activityViewModels()
-    protected var mDatabase: ContextualDatabase? = null
+    protected val mDatabaseViewModel: DatabaseViewModel by activityViewModels()
+    protected val mDatabase: ContextualDatabase?
+        get() = mDatabaseViewModel.database
 
-    override fun onViewCreated(view: View, savedInstanceState: Bundle?) {
-        super.onViewCreated(view, savedInstanceState)
 
-        mDatabaseViewModel.database.observe(viewLifecycleOwner) { database ->
-            if (mDatabase == null || mDatabase != database) {
-                this.mDatabase = database
-                onDatabaseRetrieved(database)
+    override fun onCreate(savedInstanceState: Bundle?) {
+        super.onCreate(savedInstanceState)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.STARTED) {
+                mDatabaseViewModel.actionState.collect { uiState ->
+                    when (uiState) {
+                        is DatabaseViewModel.ActionState.OnDatabaseActionFinished -> {
+                            onDatabaseActionFinished(
+                                uiState.database,
+                                uiState.actionTask,
+                                uiState.result
+                            )
+                        }
+
+                        else -> {}
+                    }
+                }
             }
         }
-
-        mDatabaseViewModel.actionFinished.observe(viewLifecycleOwner) { result ->
-            onDatabaseActionFinished(result.database, result.actionTask, result.result)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.RESUMED) {
+                mDatabaseViewModel.databaseState.collect { database ->
+                    database?.let {
+                        onDatabaseRetrieved(database)
+                    }
+                }
+            }
         }
     }
 
     protected fun resetAppTimeoutWhenViewFocusedOrChanged(view: View?) {
         context?.let {
-            view?.resetAppTimeoutWhenViewTouchedOrFocused(it, mDatabase?.loaded)
+            view?.resetAppTimeoutWhenViewTouchedOrFocused(
+                context = it,
+                databaseLoaded = mDatabase?.loaded
+            )
         }
     }
 
@@ -44,8 +67,4 @@ abstract class DatabaseFragment : Fragment(), DatabaseRetrieval {
     ) {
         // Can be overridden by a subclass
     }
-
-    protected fun buildNewBinaryAttachment(): BinaryData? {
-        return mDatabase?.buildNewBinaryAttachment()
-    }
 }

app/src/main/java/com/kunzisoft/keepass/activities/fragments/EntryEditFragment.kt

@@ -230,7 +230,7 @@ class EntryEditFragment: DatabaseFragment() {
             val attachmentToUploadUri = it.attachmentToUploadUri
             val fileName = it.fileName
 
-            buildNewBinaryAttachment()?.let { binaryAttachment ->
+            mDatabaseViewModel.buildNewAttachment()?.let { binaryAttachment ->
                 val entryAttachment = Attachment(fileName, binaryAttachment)
                 // Ask to replace the current attachment
                 if ((!mAllowMultipleAttachments
@@ -273,13 +273,13 @@ class EntryEditFragment: DatabaseFragment() {
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
 
         templateView.populateIconMethod = { imageView, icon ->
-            database?.iconDrawableFactory?.assignDatabaseIcon(imageView, icon, mIconColor)
+            database.iconDrawableFactory.assignDatabaseIcon(imageView, icon, mIconColor)
         }
 
-        mAllowMultipleAttachments = database?.allowMultipleAttachments == true
+        mAllowMultipleAttachments = database.allowMultipleAttachments == true
 
         attachmentsAdapter?.database = database
         attachmentsAdapter?.onListSizeChangedListener = { previousSize, newSize ->
@@ -290,12 +290,12 @@ class EntryEditFragment: DatabaseFragment() {
             }
         }
 
-        tagsAdapter = TagsProposalAdapter(requireContext(), database?.tagPool)
+        tagsAdapter = TagsProposalAdapter(requireContext(), database.tagPool)
         tagsCompletionView.apply {
             threshold = 1
             setAdapter(tagsAdapter)
         }
-        tagsContainerView.visibility = if (database?.allowTags() == true) View.VISIBLE else View.GONE
+        tagsContainerView.visibility = if (database.allowTags()) View.VISIBLE else View.GONE
     }
 
     private fun assignEntryInfo(entryInfo: EntryInfo?) {

app/src/main/java/com/kunzisoft/keepass/activities/fragments/EntryFragment.kt

@@ -24,7 +24,7 @@ import com.kunzisoft.keepass.model.StreamDirection
 import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.timeout.ClipboardHelper
 import com.kunzisoft.keepass.utils.TimeUtil.getDateTimeString
-import com.kunzisoft.keepass.utils.UuidUtil
+import com.kunzisoft.keepass.utils.UUIDUtils.asHexString
 import com.kunzisoft.keepass.view.TemplateView
 import com.kunzisoft.keepass.view.hideByFading
 import com.kunzisoft.keepass.view.showByFading
@@ -133,7 +133,7 @@ class EntryFragment: DatabaseFragment() {
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         context?.let { context ->
             attachmentsAdapter = EntryAttachmentsItemsAdapter(context)
             attachmentsAdapter?.database = database
@@ -184,7 +184,7 @@ class EntryFragment: DatabaseFragment() {
         // customDataView.text = entryInfo?.customData?.toString()
 
         // Assign special data
-        uuidReferenceView.text = UuidUtil.toHexString(entryInfo?.id)
+        uuidReferenceView.text = entryInfo?.id?.asHexString()
     }
 
     private fun showClipboardDialog() {

app/src/main/java/com/kunzisoft/keepass/activities/fragments/GroupFragment.kt

@@ -36,9 +36,9 @@ import androidx.recyclerview.widget.RecyclerView
 import androidx.recyclerview.widget.RecyclerView.SCROLL_STATE_IDLE
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.dialogs.SortDialogFragment
-import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
-import com.kunzisoft.keepass.activities.helpers.SpecialMode
 import com.kunzisoft.keepass.adapters.NodesAdapter
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSpecialMode
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.element.Group
 import com.kunzisoft.keepass.database.element.SortNodeEnum
@@ -154,46 +154,44 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
         super.onDetach()
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         context?.let { context ->
-            database?.let { database ->
-                mAdapter = NodesAdapter(context, database).apply {
-                    setOnNodeClickListener(object : NodesAdapter.NodeClickCallback {
-                        override fun onNodeClick(database: ContextualDatabase, node: Node) {
-                            if (nodeActionSelectionMode) {
-                                if (listActionNodes.contains(node)) {
-                                    // Remove selected item if already selected
-                                    listActionNodes.remove(node)
-                                } else {
-                                    // Add selected item if not already selected
-                                    listActionNodes.add(node)
-                                }
-                                nodeClickListener?.onNodeSelected(database, listActionNodes)
-                                setActionNodes(listActionNodes)
-                                notifyNodeChanged(node)
+            mAdapter = NodesAdapter(context, database).apply {
+                setOnNodeClickListener(object : NodesAdapter.NodeClickCallback {
+                    override fun onNodeClick(database: ContextualDatabase, node: Node) {
+                        if (nodeActionSelectionMode) {
+                            if (listActionNodes.contains(node)) {
+                                // Remove selected item if already selected
+                                listActionNodes.remove(node)
                             } else {
-                                nodeClickListener?.onNodeClick(database, node)
+                                // Add selected item if not already selected
+                                listActionNodes.add(node)
                             }
+                            nodeClickListener?.onNodeSelected(database, listActionNodes)
+                            setActionNodes(listActionNodes)
+                            notifyNodeChanged(node)
+                        } else {
+                            nodeClickListener?.onNodeClick(database, node)
                         }
+                    }
 
-                        override fun onNodeLongClick(database: ContextualDatabase, node: Node): Boolean {
-                            if (nodeActionPasteMode == PasteMode.UNDEFINED) {
-                                // Select the first item after a long click
-                                if (!listActionNodes.contains(node))
-                                    listActionNodes.add(node)
+                    override fun onNodeLongClick(database: ContextualDatabase, node: Node): Boolean {
+                        if (nodeActionPasteMode == PasteMode.UNDEFINED) {
+                            // Select the first item after a long click
+                            if (!listActionNodes.contains(node))
+                                listActionNodes.add(node)
 
-                                nodeClickListener?.onNodeSelected(database, listActionNodes)
+                            nodeClickListener?.onNodeSelected(database, listActionNodes)
 
-                                setActionNodes(listActionNodes)
-                                notifyNodeChanged(node)
-                                activity?.hideKeyboard()
-                            }
-                            return true
+                            setActionNodes(listActionNodes)
+                            notifyNodeChanged(node)
+                            activity?.hideKeyboard()
                         }
-                    })
-                }
-                mNodesRecyclerView?.adapter = mAdapter
+                        return true
+                    }
+                })
             }
+            mNodesRecyclerView?.adapter = mAdapter
         }
     }
 
@@ -248,7 +246,7 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
 
         mNodesRecyclerView?.addOnScrollListener(mRecycleViewScrollListener)
         activity?.intent?.let {
-            specialMode = EntrySelectionHelper.retrieveSpecialModeFromIntent(it)
+            specialMode = it.retrieveSpecialMode()
         }
     }
 
@@ -299,9 +297,9 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
         }
     }
 
-    private fun containsRecycleBin(nodes: List<Node>): Boolean {
-        return mDatabase?.isRecycleBinEnabled == true
-                && nodes.any { it == mDatabase?.recycleBin }
+    private fun containsRecycleBin(database: ContextualDatabase?, nodes: List<Node>): Boolean {
+        return database?.isRecycleBinEnabled == true
+                && nodes.any { it == database.recycleBin }
     }
 
     fun actionNodesCallback(database: ContextualDatabase,
@@ -328,7 +326,7 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
                     // Open and Edit for a single item
                     if (nodes.size == 1) {
                         // Edition
-                        if (database.isReadOnly || containsRecycleBin(nodes)) {
+                        if (database.isReadOnly || containsRecycleBin(database, nodes)) {
                             menu?.removeItem(R.id.menu_edit)
                         }
                     } else {
@@ -348,7 +346,7 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
                     }
 
                     // Deletion
-                    if (database.isReadOnly || containsRecycleBin(nodes)) {
+                    if (database.isReadOnly || containsRecycleBin(database, nodes)) {
                         menu?.removeItem(R.id.menu_delete)
                     }
                 }

app/src/main/java/com/kunzisoft/keepass/activities/fragments/IconFragment.kt

@@ -71,8 +71,8 @@ abstract class IconFragment<T: IconImageDraw> : DatabaseFragment(),
         resetAppTimeoutWhenViewFocusedOrChanged(view)
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        iconPickerAdapter.iconDrawableFactory = database?.iconDrawableFactory
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        iconPickerAdapter.iconDrawableFactory = database.iconDrawableFactory
 
         CoroutineScope(Dispatchers.IO).launch {
             val populateList = launch {

app/src/main/java/com/kunzisoft/keepass/activities/fragments/IconPickerFragment.kt

@@ -48,9 +48,9 @@ class IconPickerFragment : DatabaseFragment() {
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         iconPickerPagerAdapter = IconPickerPagerAdapter(this,
-            if (database?.allowCustomIcons == true) 2 else 1)
+            if (database.allowCustomIcons) 2 else 1)
         viewPager.adapter = iconPickerPagerAdapter
         TabLayoutMediator(tabLayout, viewPager) { tab, position ->
             tab.text = when (position) {

app/src/main/java/com/kunzisoft/keepass/activities/fragments/KeyGeneratorFragment.kt

@@ -107,7 +107,7 @@ class KeyGeneratorFragment : DatabaseFragment() {
         super.onDestroyView()
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         // Nothing here
     }
 

app/src/main/java/com/kunzisoft/keepass/activities/fragments/PassphraseGeneratorFragment.kt

@@ -244,7 +244,7 @@ class PassphraseGeneratorFragment : DatabaseFragment() {
         }
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         // Nothing here
     }
 

app/src/main/java/com/kunzisoft/keepass/activities/fragments/PasswordGeneratorFragment.kt

@@ -293,20 +293,22 @@ class PasswordGeneratorFragment : DatabaseFragment() {
     private fun generatePassword() {
         var password = ""
         try {
-            password = PasswordGenerator(resources).generatePassword(getPasswordLength(),
-                uppercaseCompound.isChecked,
-                lowercaseCompound.isChecked,
-                digitsCompound.isChecked,
-                minusCompound.isChecked,
-                underlineCompound.isChecked,
-                spaceCompound.isChecked,
-                specialsCompound.isChecked,
-                bracketsCompound.isChecked,
-                extendedCompound.isChecked,
-                getConsiderChars(),
-                getIgnoreChars(),
-                atLeastOneCompound.isChecked,
-                excludeAmbiguousCompound.isChecked)
+            password = PasswordGenerator(resources).generatePassword(
+                length = getPasswordLength(),
+                upperCase = uppercaseCompound.isChecked,
+                lowerCase = lowercaseCompound.isChecked,
+                digits = digitsCompound.isChecked,
+                minus = minusCompound.isChecked,
+                underline = underlineCompound.isChecked,
+                space = spaceCompound.isChecked,
+                specials = specialsCompound.isChecked,
+                brackets = bracketsCompound.isChecked,
+                extended = extendedCompound.isChecked,
+                considerChars = getConsiderChars(),
+                ignoreChars = getIgnoreChars(),
+                atLeastOneFromEach = atLeastOneCompound.isChecked,
+                excludeAmbiguousChar = excludeAmbiguousCompound.isChecked
+            )
         } catch (e: Exception) {
             Log.e(TAG, "Unable to generate a password", e)
         }
@@ -318,7 +320,7 @@ class PasswordGeneratorFragment : DatabaseFragment() {
         super.onDestroy()
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         // Nothing here
     }
 

app/src/main/java/com/kunzisoft/keepass/activities/helpers/EntrySelectionHelper.kt

@@ -1,211 +0,0 @@
-/*
- * Copyright 2019 Jeremy Jamet / Kunzisoft.
- *
- * This file is part of KeePassDX.
- *
- *  KeePassDX is free software: you can redistribute it and/or modify
- *  it under the terms of the GNU General Public License as published by
- *  the Free Software Foundation, either version 3 of the License, or
- *  (at your option) any later version.
- *
- *  KeePassDX is distributed in the hope that it will be useful,
- *  but WITHOUT ANY WARRANTY; without even the implied warranty of
- *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
- *  GNU General Public License for more details.
- *
- *  You should have received a copy of the GNU General Public License
- *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
- *
- */
-package com.kunzisoft.keepass.activities.helpers
-
-import android.content.Context
-import android.content.Intent
-import android.os.Build
-import com.kunzisoft.keepass.autofill.AutofillComponent
-import com.kunzisoft.keepass.autofill.AutofillHelper
-import com.kunzisoft.keepass.model.RegisterInfo
-import com.kunzisoft.keepass.model.SearchInfo
-import com.kunzisoft.keepass.utils.getParcelableExtraCompat
-import com.kunzisoft.keepass.utils.getEnumExtra
-import com.kunzisoft.keepass.utils.putEnumExtra
-
-object EntrySelectionHelper {
-
-    private const val KEY_SPECIAL_MODE = "com.kunzisoft.keepass.extra.SPECIAL_MODE"
-    private const val KEY_TYPE_MODE = "com.kunzisoft.keepass.extra.TYPE_MODE"
-    private const val KEY_SEARCH_INFO = "com.kunzisoft.keepass.extra.SEARCH_INFO"
-    private const val KEY_REGISTER_INFO = "com.kunzisoft.keepass.extra.REGISTER_INFO"
-
-    fun startActivityForSearchModeResult(context: Context,
-                                         intent: Intent,
-                                         searchInfo: SearchInfo) {
-        addSpecialModeInIntent(intent, SpecialMode.SEARCH)
-        addSearchInfoInIntent(intent, searchInfo)
-        intent.flags = intent.flags or Intent.FLAG_ACTIVITY_CLEAR_TASK
-        context.startActivity(intent)
-    }
-
-    fun startActivityForSaveModeResult(context: Context,
-                                             intent: Intent,
-                                             searchInfo: SearchInfo) {
-        addSpecialModeInIntent(intent, SpecialMode.SAVE)
-        addTypeModeInIntent(intent, TypeMode.DEFAULT)
-        addSearchInfoInIntent(intent, searchInfo)
-        intent.flags = intent.flags or Intent.FLAG_ACTIVITY_CLEAR_TASK
-        context.startActivity(intent)
-    }
-
-    fun startActivityForKeyboardSelectionModeResult(context: Context,
-                                                    intent: Intent,
-                                                    searchInfo: SearchInfo?) {
-        addSpecialModeInIntent(intent, SpecialMode.SELECTION)
-        addTypeModeInIntent(intent, TypeMode.MAGIKEYBOARD)
-        addSearchInfoInIntent(intent, searchInfo)
-        intent.flags = intent.flags or Intent.FLAG_ACTIVITY_CLEAR_TASK
-        context.startActivity(intent)
-    }
-
-    fun startActivityForRegistrationModeResult(context: Context,
-                                               intent: Intent,
-                                               registerInfo: RegisterInfo?) {
-        addSpecialModeInIntent(intent, SpecialMode.REGISTRATION)
-        // At the moment, only autofill for registration
-        addTypeModeInIntent(intent, TypeMode.AUTOFILL)
-        addRegisterInfoInIntent(intent, registerInfo)
-        intent.flags = intent.flags or Intent.FLAG_ACTIVITY_CLEAR_TASK
-        context.startActivity(intent)
-    }
-
-    fun addSearchInfoInIntent(intent: Intent, searchInfo: SearchInfo?) {
-        searchInfo?.let {
-            intent.putExtra(KEY_SEARCH_INFO, it)
-        }
-    }
-
-    fun retrieveSearchInfoFromIntent(intent: Intent): SearchInfo? {
-        return intent.getParcelableExtraCompat(KEY_SEARCH_INFO)
-    }
-
-    private fun addRegisterInfoInIntent(intent: Intent, registerInfo: RegisterInfo?) {
-        registerInfo?.let {
-            intent.putExtra(KEY_REGISTER_INFO, it)
-        }
-    }
-
-    fun retrieveRegisterInfoFromIntent(intent: Intent): RegisterInfo? {
-        return intent.getParcelableExtraCompat(KEY_REGISTER_INFO)
-    }
-
-    fun removeInfoFromIntent(intent: Intent) {
-        intent.removeExtra(KEY_SEARCH_INFO)
-        intent.removeExtra(KEY_REGISTER_INFO)
-    }
-
-    fun addSpecialModeInIntent(intent: Intent, specialMode: SpecialMode) {
-        intent.putEnumExtra(KEY_SPECIAL_MODE, specialMode)
-    }
-
-    fun retrieveSpecialModeFromIntent(intent: Intent): SpecialMode {
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
-            if (AutofillHelper.retrieveAutofillComponent(intent) != null)
-                return SpecialMode.SELECTION
-        }
-        return intent.getEnumExtra<SpecialMode>(KEY_SPECIAL_MODE) ?: SpecialMode.DEFAULT
-    }
-
-    private fun addTypeModeInIntent(intent: Intent, typeMode: TypeMode) {
-        intent.putEnumExtra(KEY_TYPE_MODE, typeMode)
-    }
-
-    fun retrieveTypeModeFromIntent(intent: Intent): TypeMode {
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
-            if (AutofillHelper.retrieveAutofillComponent(intent) != null)
-                return TypeMode.AUTOFILL
-        }
-        return intent.getEnumExtra<TypeMode>(KEY_TYPE_MODE) ?: TypeMode.DEFAULT
-    }
-
-    fun removeModesFromIntent(intent: Intent) {
-        intent.removeExtra(KEY_SPECIAL_MODE)
-        intent.removeExtra(KEY_TYPE_MODE)
-    }
-
-    fun doSpecialAction(intent: Intent,
-                        defaultAction: () -> Unit,
-                        searchAction: (searchInfo: SearchInfo) -> Unit,
-                        saveAction: (searchInfo: SearchInfo) -> Unit,
-                        keyboardSelectionAction: (searchInfo: SearchInfo?) -> Unit,
-                        autofillSelectionAction: (searchInfo: SearchInfo?,
-                                                  autofillComponent: AutofillComponent) -> Unit,
-                        autofillRegistrationAction: (registerInfo: RegisterInfo?) -> Unit) {
-
-        when (retrieveSpecialModeFromIntent(intent)) {
-            SpecialMode.DEFAULT -> {
-                removeModesFromIntent(intent)
-                removeInfoFromIntent(intent)
-                defaultAction.invoke()
-            }
-            SpecialMode.SEARCH -> {
-                val searchInfo = retrieveSearchInfoFromIntent(intent)
-                removeModesFromIntent(intent)
-                removeInfoFromIntent(intent)
-                if (searchInfo != null)
-                    searchAction.invoke(searchInfo)
-                else {
-                    defaultAction.invoke()
-                }
-            }
-            SpecialMode.SAVE -> {
-                val searchInfo = retrieveSearchInfoFromIntent(intent)
-                removeModesFromIntent(intent)
-                removeInfoFromIntent(intent)
-                if (searchInfo != null)
-                    saveAction.invoke(searchInfo)
-                else {
-                    defaultAction.invoke()
-                }
-            }
-            SpecialMode.SELECTION -> {
-                val searchInfo: SearchInfo? = retrieveSearchInfoFromIntent(intent)
-                var autofillComponentInit = false
-                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
-                    AutofillHelper.retrieveAutofillComponent(intent)?.let { autofillComponent ->
-                        autofillSelectionAction.invoke(searchInfo, autofillComponent)
-                        autofillComponentInit = true
-                    }
-                }
-                if (!autofillComponentInit) {
-                    if (intent.getEnumExtra<SpecialMode>(KEY_SPECIAL_MODE) != null) {
-                        when (retrieveTypeModeFromIntent(intent)) {
-                            TypeMode.DEFAULT -> {
-                                removeModesFromIntent(intent)
-                                if (searchInfo != null)
-                                    searchAction.invoke(searchInfo)
-                                else
-                                    defaultAction.invoke()
-                            }
-                            TypeMode.MAGIKEYBOARD -> keyboardSelectionAction.invoke(searchInfo)
-                            else -> {
-                                // In this case, error
-                                removeModesFromIntent(intent)
-                                removeInfoFromIntent(intent)
-                            }
-                        }
-                    } else {
-                        if (searchInfo != null)
-                            searchAction.invoke(searchInfo)
-                        else
-                            defaultAction.invoke()
-                    }
-                }
-            }
-            SpecialMode.REGISTRATION -> {
-                val registerInfo: RegisterInfo? = retrieveRegisterInfoFromIntent(intent)
-                removeModesFromIntent(intent)
-                removeInfoFromIntent(intent)
-                autofillRegistrationAction.invoke(registerInfo)
-            }
-        }
-    }
-}

app/src/main/java/com/kunzisoft/keepass/activities/helpers/TypeMode.kt

@@ -1,5 +0,0 @@
-package com.kunzisoft.keepass.activities.helpers
-
-enum class TypeMode {
-    DEFAULT, MAGIKEYBOARD, AUTOFILL
-}

app/src/main/java/com/kunzisoft/keepass/activities/legacy/DatabaseActivity.kt

@@ -1,96 +1,307 @@
 package com.kunzisoft.keepass.activities.legacy
 
-import android.net.Uri
+import android.Manifest
+import android.content.Intent
+import android.content.pm.PackageManager
+import android.os.Build
 import android.os.Bundle
+import androidx.activity.result.ActivityResultLauncher
+import androidx.activity.result.contract.ActivityResultContract
+import androidx.activity.result.contract.ActivityResultContracts
 import androidx.activity.viewModels
+import androidx.appcompat.app.AlertDialog
+import androidx.core.app.ActivityCompat
+import androidx.core.app.ActivityOptionsCompat
+import androidx.core.content.ContextCompat
+import androidx.lifecycle.Lifecycle
+import androidx.lifecycle.lifecycleScope
+import androidx.lifecycle.repeatOnLifecycle
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.activities.dialogs.DatabaseChangedDialogFragment
+import com.kunzisoft.keepass.activities.dialogs.DatabaseChangedDialogFragment.Companion.DATABASE_CHANGED_DIALOG_TAG
 import com.kunzisoft.keepass.activities.stylish.StylishActivity
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.setActivityResult
 import com.kunzisoft.keepass.database.ContextualDatabase
-import com.kunzisoft.keepass.database.MainCredential
-import com.kunzisoft.keepass.database.DatabaseTaskProvider
-import com.kunzisoft.keepass.model.CipherEncryptDatabase
+import com.kunzisoft.keepass.database.DatabaseTaskProvider.Companion.startDatabaseService
+import com.kunzisoft.keepass.model.SnapFileDatabaseInfo
 import com.kunzisoft.keepass.tasks.ActionRunnable
-import com.kunzisoft.keepass.utils.getBinaryDir
+import com.kunzisoft.keepass.tasks.ProgressTaskDialogFragment
+import com.kunzisoft.keepass.tasks.ProgressTaskDialogFragment.Companion.PROGRESS_TASK_DIALOG_TAG
+import com.kunzisoft.keepass.tasks.ProgressTaskViewModel
 import com.kunzisoft.keepass.viewmodels.DatabaseViewModel
+import kotlinx.coroutines.launch
 
-abstract class DatabaseActivity: StylishActivity(), DatabaseRetrieval {
+abstract class DatabaseActivity : StylishActivity(), DatabaseRetrieval {
 
     protected val mDatabaseViewModel: DatabaseViewModel by viewModels()
-    protected var mDatabaseTaskProvider: DatabaseTaskProvider? = null
-    protected var mDatabase: ContextualDatabase? = null
+    protected val mDatabase: ContextualDatabase?
+        get() = mDatabaseViewModel.database
+
+    private val progressTaskViewModel: ProgressTaskViewModel by viewModels()
+    private var progressTaskDialogFragment: ProgressTaskDialogFragment? = null
+    private var databaseChangedDialogFragment: DatabaseChangedDialogFragment? = null
+
+    private val mActionDatabaseListener =
+        object : DatabaseChangedDialogFragment.ActionDatabaseChangedListener {
+            override fun onDatabaseChangeValidated() {
+                mDatabaseViewModel.onDatabaseChangeValidated()
+            }
+        }
+
+    private val tempServiceParameters = mutableListOf<Pair<Bundle?, String>>()
+    private val requestPermissionLauncher = registerForActivityResult(
+        ActivityResultContracts.RequestPermission()
+    ) { _ ->
+        // Whether or not the user has accepted, the service can be started,
+        // There just won't be any notification if it's not allowed.
+        tempServiceParameters.removeFirstOrNull()?.let {
+            startDatabaseService(it.first, it.second)
+        }
+    }
+
+    /**
+     * Useful to only waiting for the activity result and prevent any parallel action
+     */
+    var credentialResultLaunched = false
+
+    /**
+     * Utility activity result launcher,
+     * Used recursively, close each activity with return data
+     */
+    protected var mCredentialActivityResultLauncher: CredentialActivityResultLauncher =
+        CredentialActivityResultLauncher(
+        registerForActivityResult(
+                ActivityResultContracts.StartActivityForResult()
+            ) {
+                setActivityResult(
+                    lockDatabase = false,
+                    resultCode = it.resultCode,
+                    data = it.data
+                )
+            }
+        )
+
+    /**
+     * Custom ActivityResultLauncher to manage the database action
+     */
+    protected inner class CredentialActivityResultLauncher(
+        val builder: ActivityResultLauncher<Intent>
+    ) : ActivityResultLauncher<Intent>() {
+
+        override fun launch(
+            input: Intent?,
+            options: ActivityOptionsCompat?
+        ) {
+            credentialResultLaunched = true
+            builder.launch(input, options)
+        }
+
+        override fun unregister() {
+            builder.unregister()
+        }
+
+        override fun getContract(): ActivityResultContract<Intent?, *> {
+            return builder.getContract()
+        }
+    }
 
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
 
-        mDatabaseTaskProvider = DatabaseTaskProvider(this, showDatabaseDialog())
+        if (savedInstanceState != null
+            && savedInstanceState.containsKey(CREDENTIAL_RESULT_LAUNCHER_KEY)
+        ) {
+            credentialResultLaunched = savedInstanceState.getBoolean(CREDENTIAL_RESULT_LAUNCHER_KEY)
+        }
 
-        mDatabaseTaskProvider?.onDatabaseRetrieved = { database ->
-            val databaseWasReloaded = database?.wasReloaded == true
-            if (databaseWasReloaded && finishActivityIfReloadRequested()) {
-                finish()
-            } else if (mDatabase == null || mDatabase != database || databaseWasReloaded) {
-                database?.wasReloaded = false
-                onDatabaseRetrieved(database)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.STARTED) {
+                mDatabaseViewModel.actionState.collect { uiState ->
+                    if (credentialResultLaunched.not()) {
+                        when (uiState) {
+                            is DatabaseViewModel.ActionState.Wait -> {}
+                            is DatabaseViewModel.ActionState.OnDatabaseReloaded -> {
+                                if (finishActivityIfReloadRequested()) {
+                                    finish()
+                                }
+                            }
+                            is DatabaseViewModel.ActionState.OnDatabaseInfoChanged -> {
+                                if (manageDatabaseInfo()) {
+                                    showDatabaseChangedDialog(
+                                        uiState.previousDatabaseInfo,
+                                        uiState.newDatabaseInfo,
+                                        uiState.readOnlyDatabase
+                                    )
+                                }
+                            }
+                            is DatabaseViewModel.ActionState.OnDatabaseActionRequested -> {
+                                startDatabasePermissionService(
+                                    uiState.bundle,
+                                    uiState.actionTask
+                                )
+                            }
+                            is DatabaseViewModel.ActionState.OnDatabaseActionStarted -> {
+                                progressTaskViewModel.show(uiState.progressMessage)
+                            }
+                            is DatabaseViewModel.ActionState.OnDatabaseActionUpdated -> {
+                                progressTaskViewModel.show(uiState.progressMessage)
+                            }
+                            is DatabaseViewModel.ActionState.OnDatabaseActionStopped -> {
+                                progressTaskViewModel.hide()
+                            }
+                            is DatabaseViewModel.ActionState.OnDatabaseActionFinished -> {
+                                onDatabaseActionFinished(
+                                    uiState.database,
+                                    uiState.actionTask,
+                                    uiState.result
+                                )
+                                progressTaskViewModel.hide()
+                            }
+                        }
+                    }
+                }
             }
         }
-        mDatabaseTaskProvider?.onActionFinish = { database, actionTask, result ->
-            onDatabaseActionFinished(database, actionTask, result)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.RESUMED) {
+                progressTaskViewModel.progressTaskState.collect { state ->
+                    when (state) {
+                        is ProgressTaskViewModel.ProgressTaskState.Show ->
+                            startDialog()
+                        is ProgressTaskViewModel.ProgressTaskState.Hide ->
+                            stopDialog()
+                    }
+                }
+            }
+        }
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.RESUMED) {
+                mDatabaseViewModel.databaseState.collect { database ->
+                    if (credentialResultLaunched.not()) {
+                        // Nullable function
+                        onUnknownDatabaseRetrieved(database)
+                        database?.let {
+                            onDatabaseRetrieved(database)
+                        }
+                    }
+                }
+            }
         }
     }
 
-    protected open fun showDatabaseDialog(): Boolean {
-        return true
+    override fun onSaveInstanceState(outState: Bundle) {
+        outState.putBoolean(CREDENTIAL_RESULT_LAUNCHER_KEY, credentialResultLaunched)
+        super.onSaveInstanceState(outState)
     }
 
-    override fun onDestroy() {
-        mDatabaseTaskProvider?.destroy()
-        mDatabaseTaskProvider = null
-        mDatabase = null
-        super.onDestroy()
-    }
-
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        mDatabase = database
-        mDatabaseViewModel.defineDatabase(database)
+    /**
+     * Nullable function to retrieve a database
+     */
+    open fun onUnknownDatabaseRetrieved(database: ContextualDatabase?) {
         // optional method implementation
     }
 
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        // optional method implementation
+    }
+
+    open fun manageDatabaseInfo(): Boolean  = true
+
     override fun onDatabaseActionFinished(
         database: ContextualDatabase,
         actionTask: String,
         result: ActionRunnable.Result
     ) {
-        mDatabaseViewModel.onActionFinished(database, actionTask, result)
         // optional method implementation
     }
 
-    fun createDatabase(
-        databaseUri: Uri,
-        mainCredential: MainCredential
+    private fun startDatabasePermissionService(bundle: Bundle?, actionTask: String) {
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
+            if (ContextCompat.checkSelfPermission(this, Manifest.permission.POST_NOTIFICATIONS)
+                == PackageManager.PERMISSION_GRANTED
+            ) {
+                startDatabaseService(bundle, actionTask)
+            } else if (ActivityCompat.shouldShowRequestPermissionRationale(
+                    this,
+                    Manifest.permission.POST_NOTIFICATIONS
+                )
+            ) {
+                // it's not the first time, so the user deliberately chooses not to display the notification
+                startDatabaseService(bundle, actionTask)
+            } else {
+                AlertDialog.Builder(this)
+                    .setMessage(R.string.warning_database_notification_permission)
+                    .setNegativeButton(R.string.later) { _, _ ->
+                        // Refuses the notification, so start the service
+                        startDatabaseService(bundle, actionTask)
+                    }
+                    .setPositiveButton(R.string.ask) { _, _ ->
+                        // Save the temp parameters to ask the permission
+                        tempServiceParameters.add(Pair(bundle, actionTask))
+                        requestPermissionLauncher.launch(Manifest.permission.POST_NOTIFICATIONS)
+                    }.create().show()
+            }
+        } else {
+            startDatabaseService(bundle, actionTask)
+        }
+    }
+
+    private fun showDatabaseChangedDialog(
+        previousDatabaseInfo: SnapFileDatabaseInfo,
+        newDatabaseInfo: SnapFileDatabaseInfo,
+        readOnlyDatabase: Boolean
     ) {
-        mDatabaseTaskProvider?.startDatabaseCreate(databaseUri, mainCredential)
+        lifecycleScope.launch {
+            if (databaseChangedDialogFragment == null) {
+                databaseChangedDialogFragment = supportFragmentManager
+                    .findFragmentByTag(DATABASE_CHANGED_DIALOG_TAG) as DatabaseChangedDialogFragment?
+                databaseChangedDialogFragment?.actionDatabaseListener =
+                    mActionDatabaseListener
+            }
+            if (progressTaskDialogFragment == null) {
+                databaseChangedDialogFragment = DatabaseChangedDialogFragment.getInstance(
+                    previousDatabaseInfo,
+                    newDatabaseInfo,
+                    readOnlyDatabase
+                )
+                databaseChangedDialogFragment?.actionDatabaseListener =
+                    mActionDatabaseListener
+                databaseChangedDialogFragment?.show(
+                    supportFragmentManager,
+                    DATABASE_CHANGED_DIALOG_TAG
+                )
+            }
+        }
     }
 
-    fun loadDatabase(
-        databaseUri: Uri,
-        mainCredential: MainCredential,
-        readOnly: Boolean,
-        cipherEncryptDatabase: CipherEncryptDatabase?,
-        fixDuplicateUuid: Boolean
-    ) {
-        mDatabaseTaskProvider?.startDatabaseLoad(databaseUri, mainCredential, readOnly, cipherEncryptDatabase, fixDuplicateUuid)
+    private fun startDialog() {
+        lifecycleScope.launch {
+            if (showDatabaseDialog()) {
+                if (progressTaskDialogFragment == null) {
+                    progressTaskDialogFragment = supportFragmentManager
+                        .findFragmentByTag(PROGRESS_TASK_DIALOG_TAG) as ProgressTaskDialogFragment?
+                }
+                if (progressTaskDialogFragment == null) {
+                    progressTaskDialogFragment = ProgressTaskDialogFragment()
+                    progressTaskDialogFragment?.show(
+                        supportFragmentManager,
+                        PROGRESS_TASK_DIALOG_TAG
+                    )
+                }
+            }
+        }
     }
 
-    protected fun closeDatabase() {
-        mDatabase?.clearAndClose(this.getBinaryDir())
+    private fun stopDialog() {
+        progressTaskDialogFragment?.dismissAllowingStateLoss()
+        progressTaskDialogFragment = null
     }
 
-    override fun onResume() {
-        super.onResume()
-        mDatabaseTaskProvider?.registerProgressTask()
+    protected open fun showDatabaseDialog(): Boolean {
+        return true
     }
 
-    override fun onPause() {
-        mDatabaseTaskProvider?.unregisterProgressTask()
-        super.onPause()
+    companion object {
+        const val CREDENTIAL_RESULT_LAUNCHER_KEY = "com.kunzisoft.keepass.CREDENTIAL_RESULT_LAUNCHER_KEY"
     }
 }

app/src/main/java/com/kunzisoft/keepass/activities/legacy/DatabaseLockActivity.kt

@@ -34,8 +34,8 @@ import androidx.appcompat.app.AlertDialog
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.dialogs.DeleteNodesDialogFragment
 import com.kunzisoft.keepass.activities.dialogs.PasswordEncodingDialogFragment
-import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
-import com.kunzisoft.keepass.activities.helpers.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.removeModes
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.MainCredential
 import com.kunzisoft.keepass.database.element.Entry
@@ -87,128 +87,44 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
             deleteDatabaseNodes(nodes)
         }
 
-        mDatabaseViewModel.saveDatabase.observe(this) { save ->
-            mDatabaseTaskProvider?.startDatabaseSave(save)
-        }
-
-        mDatabaseViewModel.mergeDatabase.observe(this) { save ->
-            mDatabaseTaskProvider?.startDatabaseMerge(save)
-        }
-
-        mDatabaseViewModel.reloadDatabase.observe(this) { fixDuplicateUuid ->
-            mDatabaseTaskProvider?.askToStartDatabaseReload(mDatabase?.dataModifiedSinceLastLoading != false) {
-                mDatabaseTaskProvider?.startDatabaseReload(fixDuplicateUuid)
-            }
-        }
-
-        mDatabaseViewModel.saveName.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveName(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveDescription.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveDescription(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveDefaultUsername.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveDefaultUsername(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveColor.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveColor(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveCompression.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveCompression(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.removeUnlinkData.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseRemoveUnlinkedData(it)
-        }
-
-        mDatabaseViewModel.saveRecycleBin.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveRecycleBin(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveTemplatesGroup.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveTemplatesGroup(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveMaxHistoryItems.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveMaxHistoryItems(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveMaxHistorySize.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveMaxHistorySize(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveEncryption.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveEncryption(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveKeyDerivation.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveKeyDerivation(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveIterations.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveIterations(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveMemoryUsage.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveMemoryUsage(it.oldValue, it.newValue, it.save)
-        }
-
-        mDatabaseViewModel.saveParallelism.observe(this) {
-            mDatabaseTaskProvider?.startDatabaseSaveParallelism(it.oldValue, it.newValue, it.save)
-        }
-
         mExitLock = false
     }
 
-    open fun finishActivityIfDatabaseNotLoaded(): Boolean {
-        return true
-    }
-
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
         // End activity if database not loaded
-        if (finishActivityIfDatabaseNotLoaded() && (database == null || !database.loaded)) {
+        if (database.loaded.not())
             finish()
-        }
 
         // Focus view to reinitialize timeout,
         // view is not necessary loaded so retry later in resume
         viewToInvalidateTimeout()
-            ?.resetAppTimeoutWhenViewTouchedOrFocused(this, database?.loaded)
+            ?.resetAppTimeoutWhenViewTouchedOrFocused(this, database.loaded)
 
-        database?.let {
-            // check timeout
-            if (mTimeoutEnable) {
-                if (mLockReceiver == null) {
-                    mLockReceiver = LockReceiver {
-                        mDatabase = null
-                        closeDatabase(database)
-                        mExitLock = true
-                        closeOptionsMenu()
-                        finish()
-                    }
-                    registerLockReceiver(mLockReceiver)
+        // check timeout
+        if (mTimeoutEnable) {
+            if (mLockReceiver == null) {
+                mLockReceiver = LockReceiver {
+                    closeDatabase(database)
+                    mExitLock = true
+                    closeOptionsMenu()
+                    finish()
                 }
-
-                // After the first creation
-                // or If simply swipe with another application
-                // If the time is out -> close the Activity
-                TimeoutHelper.checkTimeAndLockIfTimeout(this)
-                // If onCreate already record time
-                if (!mExitLock)
-                    TimeoutHelper.recordTime(this, database.loaded)
+                registerLockReceiver(mLockReceiver)
             }
 
-            mDatabaseReadOnly = database.isReadOnly
-            mMergeDataAllowed = database.isMergeDataAllowed()
-
-            checkRegister()
+            // After the first creation
+            // or If simply swipe with another application
+            // If the time is out -> close the Activity
+            TimeoutHelper.checkTimeAndLockIfTimeout(this)
+            // If onCreate already record time
+            if (!mExitLock)
+                TimeoutHelper.recordTime(this, database.loaded)
         }
+
+        mDatabaseReadOnly = database.isReadOnly
+        mMergeDataAllowed = database.isMergeDataAllowed()
+
+        checkRegister()
     }
 
     override fun finish() {
@@ -227,7 +143,6 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
         actionTask: String,
         result: ActionRunnable.Result
     ) {
-        super.onDatabaseActionFinished(database, actionTask, result)
         when (actionTask) {
             DatabaseTaskNotificationService.ACTION_DATABASE_MERGE_TASK,
             DatabaseTaskNotificationService.ACTION_DATABASE_RELOAD_TASK -> {
@@ -249,24 +164,15 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
         databaseUri: Uri?,
         mainCredential: MainCredential
     ) {
-        assignDatabasePassword(databaseUri, mainCredential)
+        mDatabaseViewModel.assignMainCredential(databaseUri, mainCredential)
     }
 
-    private fun assignDatabasePassword(
-        databaseUri: Uri?,
-        mainCredential: MainCredential
-    ) {
-        if (databaseUri != null) {
-            mDatabaseTaskProvider?.startDatabaseAssignCredential(databaseUri, mainCredential)
-        }
-    }
-
-    fun assignPassword(mainCredential: MainCredential) {
+    fun assignMainCredential(mainCredential: MainCredential) {
         mDatabase?.let { database ->
             database.fileUri?.let { databaseUri ->
                 // Show the progress dialog now or after dialog confirmation
                 if (database.isValidCredential(mainCredential.toMasterCredential(contentResolver))) {
-                    assignDatabasePassword(databaseUri, mainCredential)
+                    mDatabaseViewModel.assignMainCredential(databaseUri, mainCredential)
                 } else {
                     PasswordEncodingDialogFragment.getInstance(databaseUri, mainCredential)
                         .show(supportFragmentManager, "passwordEncodingTag")
@@ -276,45 +182,51 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
     }
 
     fun saveDatabase() {
-        mDatabaseTaskProvider?.startDatabaseSave(true)
+        mDatabaseViewModel.saveDatabase(save = true)
     }
 
     fun saveDatabaseTo(uri: Uri) {
-        mDatabaseTaskProvider?.startDatabaseSave(true, uri)
+        mDatabaseViewModel.saveDatabase(save = true, saveToUri = uri)
     }
 
     fun mergeDatabase() {
-        mDatabaseTaskProvider?.startDatabaseMerge(mAutoSaveEnable)
+        mDatabaseViewModel.mergeDatabase(save = mAutoSaveEnable)
     }
 
     fun mergeDatabaseFrom(uri: Uri, mainCredential: MainCredential) {
-        mDatabaseTaskProvider?.startDatabaseMerge(mAutoSaveEnable, uri, mainCredential)
+        mDatabaseViewModel.mergeDatabase(mAutoSaveEnable, uri, mainCredential)
     }
 
     fun reloadDatabase() {
-        mDatabaseTaskProvider?.askToStartDatabaseReload(mDatabase?.dataModifiedSinceLastLoading != false) {
-            mDatabaseTaskProvider?.startDatabaseReload(false)
-        }
+        mDatabaseViewModel.reloadDatabase(fixDuplicateUuid = false)
     }
 
-    fun createEntry(newEntry: Entry,
-                    parent: Group) {
-        mDatabaseTaskProvider?.startDatabaseCreateEntry(newEntry, parent, mAutoSaveEnable)
+    fun createEntry(
+        newEntry: Entry,
+        parent: Group
+    ) {
+        mDatabaseViewModel.createEntry(newEntry, parent, mAutoSaveEnable)
     }
 
-    fun updateEntry(oldEntry: Entry,
-                    entryToUpdate: Entry) {
-        mDatabaseTaskProvider?.startDatabaseUpdateEntry(oldEntry, entryToUpdate, mAutoSaveEnable)
+    fun updateEntry(
+        oldEntry: Entry,
+        entryToUpdate: Entry
+    ) {
+        mDatabaseViewModel.updateEntry(oldEntry, entryToUpdate, mAutoSaveEnable)
     }
 
-    fun copyNodes(nodesToCopy: List<Node>,
-                  newParent: Group) {
-        mDatabaseTaskProvider?.startDatabaseCopyNodes(nodesToCopy, newParent, mAutoSaveEnable)
+    fun copyNodes(
+        nodesToCopy: List<Node>,
+        newParent: Group
+    ) {
+        mDatabaseViewModel.copyNodes(nodesToCopy, newParent, mAutoSaveEnable)
     }
 
-    fun moveNodes(nodesToMove: List<Node>,
-                  newParent: Group) {
-        mDatabaseTaskProvider?.startDatabaseMoveNodes(nodesToMove, newParent, mAutoSaveEnable)
+    fun moveNodes(
+        nodesToMove: List<Node>,
+        newParent: Group
+    ) {
+        mDatabaseViewModel.moveNodes(nodesToMove, newParent, mAutoSaveEnable)
     }
 
     private fun eachNodeRecyclable(database: ContextualDatabase, nodes: List<Node>): Boolean {
@@ -330,6 +242,7 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
     }
 
     fun deleteNodes(nodes: List<Node>, recycleBin: Boolean = false) {
+        // TODO Move in ViewModel
         mDatabase?.let { database ->
             // If recycle bin enabled, ensure it exists
             if (database.isRecycleBinEnabled) {
@@ -350,11 +263,14 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
     }
 
     private fun deleteDatabaseNodes(nodes: List<Node>) {
-        mDatabaseTaskProvider?.startDatabaseDeleteNodes(nodes, mAutoSaveEnable)
+        mDatabaseViewModel.deleteNodes(nodes, mAutoSaveEnable)
     }
 
-    fun createGroup(parent: Group,
-                    groupInfo: GroupInfo?) {
+    fun createGroup(
+        parent: Group,
+        groupInfo: GroupInfo?
+    ) {
+        // TODO Move in ViewModel
         // Build the group
         mDatabase?.createGroup()?.let { newGroup ->
             groupInfo?.let { info ->
@@ -362,12 +278,15 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
             }
             // Not really needed here because added in runnable but safe
             newGroup.parent = parent
-            mDatabaseTaskProvider?.startDatabaseCreateGroup(newGroup, parent, mAutoSaveEnable)
+            mDatabaseViewModel.createGroup(newGroup, parent, mAutoSaveEnable)
         }
     }
 
-    fun updateGroup(oldGroup: Group,
-                    groupInfo: GroupInfo) {
+    fun updateGroup(
+        oldGroup: Group,
+        groupInfo: GroupInfo
+    ) {
+        // TODO Move in ViewModel
         // If group updated save it in the database
         val updateGroup = Group(oldGroup).let { updateGroup ->
             updateGroup.apply {
@@ -377,27 +296,28 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
                 this.setGroupInfo(groupInfo)
             }
         }
-        mDatabaseTaskProvider?.startDatabaseUpdateGroup(oldGroup, updateGroup, mAutoSaveEnable)
+        mDatabaseViewModel.updateGroup(oldGroup, updateGroup, mAutoSaveEnable)
     }
 
-    fun restoreEntryHistory(mainEntryId: NodeId<UUID>,
-                            entryHistoryPosition: Int) {
-        mDatabaseTaskProvider
-            ?.startDatabaseRestoreEntryHistory(mainEntryId, entryHistoryPosition, mAutoSaveEnable)
+    fun restoreEntryHistory(
+        mainEntryId: NodeId<UUID>,
+        entryHistoryPosition: Int
+    ) {
+        mDatabaseViewModel.restoreEntryHistory(mainEntryId, entryHistoryPosition, mAutoSaveEnable)
     }
 
-    fun deleteEntryHistory(mainEntryId: NodeId<UUID>,
-                           entryHistoryPosition: Int) {
-        mDatabaseTaskProvider?.startDatabaseDeleteEntryHistory(mainEntryId, entryHistoryPosition, mAutoSaveEnable)
+    fun deleteEntryHistory(
+        mainEntryId: NodeId<UUID>,
+        entryHistoryPosition: Int
+    ) {
+        mDatabaseViewModel.deleteEntryHistory(mainEntryId, entryHistoryPosition, mAutoSaveEnable)
     }
 
     private fun checkRegister() {
-        // If in ave or registration mode, don't allow read only
-        if ((mSpecialMode == SpecialMode.SAVE
-                    || mSpecialMode == SpecialMode.REGISTRATION)
-            && mDatabaseReadOnly) {
+        // If in registration mode, don't allow read only
+        if (mSpecialMode == SpecialMode.REGISTRATION && mDatabaseReadOnly) {
             Toast.makeText(this, R.string.error_registration_read_only , Toast.LENGTH_LONG).show()
-            EntrySelectionHelper.removeModesFromIntent(intent)
+            intent.removeModes()
             finish()
         }
     }
@@ -450,9 +370,11 @@ abstract class DatabaseLockActivity : DatabaseModeActivity(),
                 .setNegativeButton(android.R.string.cancel, null)
                 .setPositiveButton(R.string.lock) { _, _ ->
                     sendBroadcast(Intent(LOCK_ACTION))
+                    finish()
                 }.create().show()
         } else {
             sendBroadcast(Intent(LOCK_ACTION))
+            finish()
         }
     }
 

app/src/main/java/com/kunzisoft/keepass/activities/legacy/DatabaseModeActivity.kt

@@ -5,9 +5,16 @@ import android.view.View
 import android.widget.Toast
 import androidx.activity.OnBackPressedCallback
 import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
-import com.kunzisoft.keepass.activities.helpers.SpecialMode
-import com.kunzisoft.keepass.activities.helpers.TypeMode
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.isIntentSenderMode
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.removeInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.removeModes
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveRegisterInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSearchInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSpecialMode
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveTypeMode
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.TypeMode
+import com.kunzisoft.keepass.model.RegisterInfo
 import com.kunzisoft.keepass.model.SearchInfo
 import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.view.ToolbarSpecial
@@ -19,7 +26,7 @@ import com.kunzisoft.keepass.view.ToolbarSpecial
 abstract class DatabaseModeActivity : DatabaseActivity() {
 
     protected var mSpecialMode: SpecialMode = SpecialMode.DEFAULT
-    private var mTypeMode: TypeMode = TypeMode.DEFAULT
+    protected var mTypeMode: TypeMode = TypeMode.DEFAULT
 
     private var mToolbarSpecial: ToolbarSpecial? = null
 
@@ -42,20 +49,14 @@ abstract class DatabaseModeActivity : DatabaseActivity() {
     /**
      * Intent sender uses special retains data in callback
      */
-    private fun isIntentSender(): Boolean {
-        return (mSpecialMode == SpecialMode.SELECTION
-                && mTypeMode == TypeMode.AUTOFILL)
-                /* TODO Registration callback #765
-                || (mSpecialMode == SpecialMode.REGISTRATION
-                && mTypeMode == TypeMode.AUTOFILL
-                && Build.VERSION.SDK_INT >= Build.VERSION_CODES.P)
-                */
+    protected fun isIntentSender(): Boolean {
+        return isIntentSenderMode(mSpecialMode, mTypeMode)
     }
 
     fun onLaunchActivitySpecialMode() {
         if (!isIntentSender()) {
-            EntrySelectionHelper.removeModesFromIntent(intent)
-            EntrySelectionHelper.removeInfoFromIntent(intent)
+            intent.removeModes()
+            intent.removeInfo()
             finish()
         }
     }
@@ -64,8 +65,8 @@ abstract class DatabaseModeActivity : DatabaseActivity() {
         if (isIntentSender()) {
             super.finish()
         } else {
-            EntrySelectionHelper.removeModesFromIntent(intent)
-            EntrySelectionHelper.removeInfoFromIntent(intent)
+            intent.removeModes()
+            intent.removeInfo()
             if (mSpecialMode != SpecialMode.DEFAULT) {
                 backToTheMainAppAndFinish()
             }
@@ -77,8 +78,8 @@ abstract class DatabaseModeActivity : DatabaseActivity() {
             // To get the app caller, only for IntentSender
             onRegularBackPressed()
         } else {
-            EntrySelectionHelper.removeModesFromIntent(intent)
-            EntrySelectionHelper.removeInfoFromIntent(intent)
+            intent.removeModes()
+            intent.removeInfo()
             if (mSpecialMode != SpecialMode.DEFAULT) {
                 backToTheMainAppAndFinish()
             }
@@ -109,17 +110,18 @@ abstract class DatabaseModeActivity : DatabaseActivity() {
             }
         })
 
-        mSpecialMode = EntrySelectionHelper.retrieveSpecialModeFromIntent(intent)
-        mTypeMode = EntrySelectionHelper.retrieveTypeModeFromIntent(intent)
+        mSpecialMode = intent.retrieveSpecialMode()
+        mTypeMode = intent.retrieveTypeMode()
     }
 
     override fun onResume() {
         super.onResume()
 
-        mSpecialMode = EntrySelectionHelper.retrieveSpecialModeFromIntent(intent)
-        mTypeMode = EntrySelectionHelper.retrieveTypeModeFromIntent(intent)
-        val searchInfo: SearchInfo? = EntrySelectionHelper.retrieveRegisterInfoFromIntent(intent)?.searchInfo
-                ?: EntrySelectionHelper.retrieveSearchInfoFromIntent(intent)
+        mSpecialMode = intent.retrieveSpecialMode()
+        mTypeMode = intent.retrieveTypeMode()
+        val registerInfo: RegisterInfo? = intent.retrieveRegisterInfo()
+        val searchInfo: SearchInfo? = registerInfo?.searchInfo
+                ?: intent.retrieveSearchInfo()
 
         // To show the selection mode
         mToolbarSpecial = findViewById(R.id.special_mode_view)
@@ -128,26 +130,25 @@ abstract class DatabaseModeActivity : DatabaseActivity() {
             val selectionModeStringId = when (mSpecialMode) {
                 SpecialMode.DEFAULT, // Not important because hidden
                 SpecialMode.SEARCH -> R.string.search_mode
-                SpecialMode.SAVE -> R.string.save_mode
                 SpecialMode.SELECTION -> R.string.selection_mode
-                SpecialMode.REGISTRATION -> R.string.registration_mode
+                SpecialMode.REGISTRATION -> R.string.save_mode // Save is registration mode
             }
             val typeModeStringId = when (mTypeMode) {
                 TypeMode.DEFAULT, // Not important because hidden
                 TypeMode.MAGIKEYBOARD -> R.string.magic_keyboard_title
                 TypeMode.AUTOFILL -> R.string.autofill
+                TypeMode.PASSKEY -> R.string.passkey
             }
             title = getString(selectionModeStringId)
             if (mTypeMode != TypeMode.DEFAULT)
                 title = "$title (${getString(typeModeStringId)})"
             // Populate subtitle
-            subtitle = searchInfo?.getName(resources)
+            subtitle = registerInfo?.getName(resources) ?: searchInfo?.getName(resources)
 
             // Show the toolbar or not
             visible = when (mSpecialMode) {
                 SpecialMode.DEFAULT -> false
                 SpecialMode.SEARCH -> true
-                SpecialMode.SAVE -> true
                 SpecialMode.SELECTION -> true
                 SpecialMode.REGISTRATION -> true
             }

app/src/main/java/com/kunzisoft/keepass/activities/legacy/DatabaseRetrieval.kt

@@ -4,8 +4,11 @@ import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.tasks.ActionRunnable
 
 interface DatabaseRetrieval {
-    fun onDatabaseRetrieved(database: ContextualDatabase?)
-    fun onDatabaseActionFinished(database: ContextualDatabase,
-                                 actionTask: String,
-                                 result: ActionRunnable.Result)
+    fun onDatabaseRetrieved(database: ContextualDatabase)
+
+    fun onDatabaseActionFinished(
+        database: ContextualDatabase,
+        actionTask: String,
+        result: ActionRunnable.Result
+    )
 }

app/src/main/java/com/kunzisoft/keepass/adapters/NodesAdapter.kt

@@ -22,7 +22,6 @@ package com.kunzisoft.keepass.adapters
 import android.content.Context
 import android.content.res.ColorStateList
 import android.graphics.Color
-import android.os.Build
 import android.util.Log
 import android.util.TypedValue
 import android.view.LayoutInflater
@@ -418,6 +417,7 @@ class NodesAdapter (
                 }
             }
 
+            // OTP
             val otpElement = entry.getOtpElement()
             holder.otpContainer?.removeCallbacks(holder.otpRunnable)
             if (otpElement != null
@@ -438,7 +438,11 @@ class NodesAdapter (
                 holder.otpContainer?.visibility = View.GONE
             }
             holder.attachmentIcon?.visibility =
-                    if (entry.containsAttachment()) View.VISIBLE else View.GONE
+                if (entry.containsAttachment()) View.VISIBLE else View.GONE
+
+            // Passkey
+            holder.passkeyIcon?.visibility =
+                if (entry.getPasskey() != null) View.VISIBLE else View.GONE
 
             // Assign colors
             assignBackgroundColor(holder.container, entry)
@@ -451,6 +455,7 @@ class NodesAdapter (
                     holder.otpToken?.setTextColor(foregroundColor)
                     holder.otpProgress?.setIndicatorColor(foregroundColor)
                     holder.attachmentIcon?.setColorFilter(foregroundColor)
+                    holder.passkeyIcon?.setColorFilter(foregroundColor)
                     holder.meta.setTextColor(foregroundColor)
                     iconColor = foregroundColor
                 } else {
@@ -459,6 +464,7 @@ class NodesAdapter (
                     holder.otpToken?.setTextColor(mTextColorSecondary)
                     holder.otpProgress?.setIndicatorColor(mTextColorSecondary)
                     holder.attachmentIcon?.setColorFilter(mTextColorSecondary)
+                    holder.passkeyIcon?.setColorFilter(mTextColorSecondary)
                     holder.meta.setTextColor(mTextColor)
                 }
             } else {
@@ -467,6 +473,7 @@ class NodesAdapter (
                 holder.otpToken?.setTextColor(mColorOnSecondary)
                 holder.otpProgress?.setIndicatorColor(mColorOnSecondary)
                 holder.attachmentIcon?.setColorFilter(mColorOnSecondary)
+                holder.passkeyIcon?.setColorFilter(mColorOnSecondary)
                 holder.meta.setTextColor(mColorOnSecondary)
             }
 
@@ -611,6 +618,7 @@ class NodesAdapter (
         var otpRunnable: OtpRunnable = OtpRunnable(otpContainer)
         var numberChildren: TextView? = itemView.findViewById(R.id.node_child_numbers)
         var attachmentIcon: ImageView? = itemView.findViewById(R.id.node_attachment_icon)
+        var passkeyIcon: ImageView? = itemView.findViewById(R.id.node_passkey_icon)
     }
 
     companion object {

app/src/main/java/com/kunzisoft/keepass/autofill/AutofillComponent.kt

@@ -1,6 +0,0 @@
-package com.kunzisoft.keepass.autofill
-
-import android.app.assist.AssistStructure
-
-data class AutofillComponent(val assistStructure: AssistStructure,
-                             val compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest?)

app/src/main/java/com/kunzisoft/keepass/credentialprovider/EntrySelectionHelper.kt

@@ -0,0 +1,424 @@
+/*
+ * Copyright 2019 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider
+
+import android.app.Activity
+import android.content.Context
+import android.content.Intent
+import android.graphics.drawable.Icon
+import android.os.Build
+import android.os.Bundle
+import android.os.ParcelUuid
+import android.util.Log
+import android.widget.RemoteViews
+import androidx.activity.result.ActivityResultLauncher
+import androidx.annotation.RequiresApi
+import androidx.core.content.ContextCompat
+import androidx.core.graphics.drawable.IconCompat
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.database.element.node.NodeIdUUID
+import com.kunzisoft.keepass.model.EntryInfo
+import com.kunzisoft.keepass.model.RegisterInfo
+import com.kunzisoft.keepass.model.SearchInfo
+import com.kunzisoft.keepass.utils.LOCK_ACTION
+import com.kunzisoft.keepass.utils.getEnum
+import com.kunzisoft.keepass.utils.getEnumExtra
+import com.kunzisoft.keepass.utils.getParcelableCompat
+import com.kunzisoft.keepass.utils.getParcelableExtraCompat
+import com.kunzisoft.keepass.utils.getParcelableList
+import com.kunzisoft.keepass.utils.putEnum
+import com.kunzisoft.keepass.utils.putEnumExtra
+import com.kunzisoft.keepass.utils.putParcelableList
+import java.io.IOException
+import java.util.UUID
+
+object EntrySelectionHelper {
+
+    private const val KEY_SPECIAL_MODE = "com.kunzisoft.keepass.extra.SPECIAL_MODE"
+    private const val KEY_TYPE_MODE = "com.kunzisoft.keepass.extra.TYPE_MODE"
+    private const val KEY_SEARCH_INFO = "com.kunzisoft.keepass.extra.SEARCH_INFO"
+    private const val KEY_REGISTER_INFO = "com.kunzisoft.keepass.extra.REGISTER_INFO"
+    private const val EXTRA_NODES_IDS = "com.kunzisoft.keepass.extra.NODES_IDS"
+    private const val EXTRA_NODE_ID = "com.kunzisoft.keepass.extra.NODE_ID"
+
+    /**
+     * Finish the activity by passing the result code and by locking the database if necessary
+     */
+    fun Activity.setActivityResult(
+        lockDatabase: Boolean = false,
+        resultCode: Int,
+        data: Intent? = null
+    ) {
+        when (resultCode) {
+            Activity.RESULT_OK ->
+                this.setResult(resultCode, data)
+            Activity.RESULT_CANCELED ->
+                this.setResult(resultCode)
+        }
+        this.finish()
+
+        if (lockDatabase) {
+            // Close the database
+            this.sendBroadcast(Intent(LOCK_ACTION))
+        }
+    }
+
+    fun startActivityForSearchModeResult(
+        context: Context,
+        intent: Intent,
+        searchInfo: SearchInfo
+    ) {
+        intent.addSpecialMode(SpecialMode.SEARCH)
+        intent.addSearchInfo(searchInfo)
+        intent.flags = intent.flags or Intent.FLAG_ACTIVITY_CLEAR_TASK
+        context.startActivity(intent)
+    }
+
+    fun startActivityForSelectionModeResult(
+        context: Context,
+        intent: Intent,
+        typeMode: TypeMode,
+        searchInfo: SearchInfo?,
+        activityResultLauncher: ActivityResultLauncher<Intent>? = null,
+    ) {
+        intent.addSpecialMode(SpecialMode.SELECTION)
+        intent.addTypeMode(typeMode)
+        intent.addSearchInfo(searchInfo)
+        if (activityResultLauncher == null) {
+            intent.flags = intent.flags or Intent.FLAG_ACTIVITY_CLEAR_TASK
+        }
+        activityResultLauncher?.launch(intent) ?: context.startActivity(intent)
+    }
+
+    fun startActivityForRegistrationModeResult(
+        context: Context,
+        activityResultLauncher: ActivityResultLauncher<Intent>?,
+        intent: Intent,
+        registerInfo: RegisterInfo?,
+        typeMode: TypeMode
+    ) {
+        intent.addSpecialMode(SpecialMode.REGISTRATION)
+        intent.addTypeMode(typeMode)
+        intent.addRegisterInfo(registerInfo)
+        if (activityResultLauncher == null) {
+            intent.flags = intent.flags or Intent.FLAG_ACTIVITY_CLEAR_TASK
+        }
+        activityResultLauncher?.launch(intent) ?: context.startActivity(intent)
+    }
+
+    /**
+     * Build the special mode response for internal entry selection for one entry
+     */
+    fun Activity.buildSpecialModeResponseAndSetResult(
+        entryInfo: EntryInfo,
+        extras: Bundle? = null
+    ) {
+        this.buildSpecialModeResponseAndSetResult(listOf(entryInfo), extras)
+    }
+
+    /**
+     * Build the special mode response for internal entry selection for multiple entries
+     */
+    fun Activity.buildSpecialModeResponseAndSetResult(
+        entriesInfo: List<EntryInfo>,
+        extras: Bundle? = null
+    ) {
+        try {
+            val mReplyIntent = Intent()
+            Log.d(javaClass.name, "Success special mode manual selection")
+            mReplyIntent.addNodesIds(entriesInfo.map { it.id })
+            extras?.let {
+                mReplyIntent.putExtras(it)
+            }
+            setResult(Activity.RESULT_OK, mReplyIntent)
+        } catch (e: Exception) {
+            Log.e(javaClass.name, "Unable to add the result", e)
+            setResult(Activity.RESULT_CANCELED)
+        }
+    }
+
+    fun Intent.addSearchInfo(searchInfo: SearchInfo?): Intent {
+        searchInfo?.let {
+            putExtra(KEY_SEARCH_INFO, it)
+        }
+        return this
+    }
+
+    fun Bundle.addSearchInfo(searchInfo: SearchInfo?): Bundle {
+        searchInfo?.let {
+            putParcelable(KEY_SEARCH_INFO, it)
+        }
+        return this
+    }
+
+    fun Intent.retrieveSearchInfo(): SearchInfo? {
+        return getParcelableExtraCompat(KEY_SEARCH_INFO)
+    }
+
+    fun Bundle.getSearchInfo(): SearchInfo? {
+        return getParcelableCompat(KEY_SEARCH_INFO)
+    }
+
+    fun Intent.addRegisterInfo(registerInfo: RegisterInfo?): Intent {
+        registerInfo?.let {
+            putExtra(KEY_REGISTER_INFO, it)
+        }
+        return this
+    }
+
+    fun Bundle.addRegisterInfo(registerInfo: RegisterInfo?): Bundle {
+        registerInfo?.let {
+            putParcelable(KEY_REGISTER_INFO, it)
+        }
+        return this
+    }
+
+    fun Intent.retrieveRegisterInfo(): RegisterInfo? {
+        return getParcelableExtraCompat(KEY_REGISTER_INFO)
+    }
+
+    fun Bundle.getRegisterInfo(): RegisterInfo? {
+        return getParcelableCompat(KEY_REGISTER_INFO)
+    }
+
+    fun Intent.removeInfo() {
+        removeExtra(KEY_SEARCH_INFO)
+        removeExtra(KEY_REGISTER_INFO)
+    }
+
+    fun Intent.addSpecialMode(specialMode: SpecialMode): Intent {
+        this.putEnumExtra(KEY_SPECIAL_MODE, specialMode)
+        return this
+    }
+
+    fun Bundle.addSpecialMode(specialMode: SpecialMode): Bundle {
+        this.putEnum(KEY_SPECIAL_MODE, specialMode)
+        return this
+    }
+
+    fun Intent.retrieveSpecialMode(): SpecialMode {
+        return this.getEnumExtra<SpecialMode>(KEY_SPECIAL_MODE) ?: SpecialMode.DEFAULT
+    }
+
+    fun Bundle.getSpecialMode(): SpecialMode {
+        return this.getEnum<SpecialMode>(KEY_SPECIAL_MODE) ?: SpecialMode.DEFAULT
+    }
+
+    fun Intent.addTypeMode(typeMode: TypeMode): Intent {
+        this.putEnumExtra(KEY_TYPE_MODE, typeMode)
+        return this
+    }
+
+    fun Intent.retrieveTypeMode(): TypeMode {
+        return getEnumExtra<TypeMode>(KEY_TYPE_MODE) ?: TypeMode.DEFAULT
+    }
+
+    fun Intent.removeModes() {
+        removeExtra(KEY_SPECIAL_MODE)
+        removeExtra(KEY_TYPE_MODE)
+    }
+
+    fun Intent.addNodesIds(nodesIds: List<UUID>): Intent {
+        this.putParcelableList(EXTRA_NODES_IDS, nodesIds.map { ParcelUuid(it) })
+        return this
+    }
+
+    fun Intent.retrieveNodesIds(): List<UUID>? {
+        return getParcelableList<ParcelUuid>(EXTRA_NODES_IDS)?.map { it.uuid }
+    }
+
+    fun Intent.removeNodesIds() {
+        removeExtra(EXTRA_NODES_IDS)
+    }
+
+    /**
+     * Add the node id to the intent
+     */
+    fun Intent.addNodeId(nodeId: UUID?) {
+        nodeId?.let {
+            putExtra(EXTRA_NODE_ID, ParcelUuid(nodeId))
+        }
+    }
+
+    /**
+     * Retrieve the node id from the intent
+     */
+    fun Intent.retrieveNodeId(): UUID? {
+        return getParcelableExtraCompat<ParcelUuid>(EXTRA_NODE_ID)?.uuid
+    }
+
+    fun Intent.removeNodeId() {
+        removeExtra(EXTRA_NODE_ID)
+    }
+
+    /**
+     * Retrieve nodes ids from intent and get the corresponding entry info list in [database]
+     */
+    fun Intent.retrieveAndRemoveEntries(database: ContextualDatabase): List<EntryInfo> {
+        val nodesIds = retrieveNodesIds()
+            ?: throw IOException("NodesIds is null")
+        removeNodesIds()
+        return nodesIds.mapNotNull { nodeId ->
+            database
+                .getEntryById(NodeIdUUID(nodeId))
+                ?.getEntryInfo(database)
+        }
+    }
+
+    /**
+     * Intent sender uses special retains data in callback
+     */
+    fun isIntentSenderMode(specialMode: SpecialMode, typeMode: TypeMode): Boolean {
+        return (specialMode == SpecialMode.SELECTION
+                && (typeMode == TypeMode.MAGIKEYBOARD || typeMode == TypeMode.AUTOFILL || typeMode == TypeMode.PASSKEY))
+                || (specialMode == SpecialMode.REGISTRATION
+                && (typeMode == TypeMode.AUTOFILL || typeMode == TypeMode.PASSKEY))
+    }
+
+    fun doSpecialAction(
+        intent: Intent,
+        defaultAction: () -> Unit,
+        searchAction: (searchInfo: SearchInfo) -> Unit,
+        selectionAction: (
+            intentSenderMode: Boolean,
+            typeMode: TypeMode,
+            searchInfo: SearchInfo?
+        ) -> Unit,
+        registrationAction: (
+            intentSenderMode: Boolean,
+            typeMode: TypeMode,
+            registerInfo: RegisterInfo?
+        ) -> Unit
+    ) {
+        when (val specialMode = intent.retrieveSpecialMode()) {
+            SpecialMode.DEFAULT -> {
+                intent.removeModes()
+                intent.removeInfo()
+                defaultAction.invoke()
+            }
+            SpecialMode.SEARCH -> {
+                val searchInfo = intent.retrieveSearchInfo()
+                intent.removeModes()
+                intent.removeInfo()
+                if (searchInfo != null)
+                    searchAction.invoke(searchInfo)
+                else {
+                    defaultAction.invoke()
+                }
+            }
+            SpecialMode.SELECTION -> {
+                val searchInfo: SearchInfo? = intent.retrieveSearchInfo()
+                if (intent.getEnumExtra<SpecialMode>(KEY_SPECIAL_MODE) != null) {
+                    when (val typeMode = intent.retrieveTypeMode()) {
+                        TypeMode.DEFAULT -> {
+                            intent.removeModes()
+                            if (searchInfo != null)
+                                searchAction.invoke(searchInfo)
+                            else
+                                defaultAction.invoke()
+                        }
+                        TypeMode.MAGIKEYBOARD -> selectionAction.invoke(
+                            isIntentSenderMode(specialMode, typeMode),
+                            typeMode,
+                            searchInfo
+                        )
+                        TypeMode.PASSKEY ->
+                            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.UPSIDE_DOWN_CAKE) {
+                                selectionAction.invoke(
+                                    isIntentSenderMode(specialMode, typeMode),
+                                    typeMode,
+                                    searchInfo
+                                )
+                            } else
+                                defaultAction.invoke()
+                        TypeMode.AUTOFILL -> {
+                            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
+                                selectionAction.invoke(
+                                    isIntentSenderMode(specialMode, typeMode),
+                                    typeMode,
+                                    searchInfo
+                                )
+                            } else
+                                defaultAction.invoke()
+                        }
+                    }
+                } else {
+                    if (searchInfo != null)
+                        searchAction.invoke(searchInfo)
+                    else
+                        defaultAction.invoke()
+                }
+            }
+            SpecialMode.REGISTRATION -> {
+                val registerInfo: RegisterInfo? = intent.retrieveRegisterInfo()
+                val typeMode = intent.retrieveTypeMode()
+                val intentSenderMode = isIntentSenderMode(specialMode, typeMode)
+                if (!intentSenderMode) {
+                    intent.removeModes()
+                    intent.removeInfo()
+                }
+                if (registerInfo != null)
+                    registrationAction.invoke(
+                        intentSenderMode,
+                        typeMode,
+                        registerInfo
+                    )
+                else {
+                    defaultAction.invoke()
+                }
+            }
+        }
+    }
+
+    fun performSelection(items: List<EntryInfo>,
+                         actionPopulateCredentialProvider: (entryInfo: EntryInfo) -> Unit,
+                         actionEntrySelection: (autoSearch: Boolean) -> Unit) {
+        if (items.size == 1) {
+            val itemFound = items[0]
+            actionPopulateCredentialProvider.invoke(itemFound)
+        } else if (items.size > 1) {
+            // Select the one we want in the selection
+            actionEntrySelection.invoke(true)
+        } else {
+            // Select an arbitrary one
+            actionEntrySelection.invoke(false)
+        }
+    }
+
+    /**
+     * Method to assign a drawable to a new icon from a database icon
+     */
+    @RequiresApi(Build.VERSION_CODES.M)
+    fun EntryInfo.buildIcon(
+        context: Context,
+        database: ContextualDatabase
+    ): Icon? {
+        try {
+            database.iconDrawableFactory.getBitmapFromIcon(context,
+                this.icon, ContextCompat.getColor(context, R.color.green))?.let { bitmap ->
+                return IconCompat.createWithBitmap(bitmap).toIcon(context)
+            }
+        } catch (e: Exception) {
+            Log.e(RemoteViews::class.java.name, "Unable to assign icon in remote view", e)
+        }
+        return null
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/SpecialMode.kt

@@ -1,9 +1,8 @@
-package com.kunzisoft.keepass.activities.helpers
+package com.kunzisoft.keepass.credentialprovider
 
 enum class SpecialMode {
     DEFAULT,
     SEARCH,
-    SAVE,
     SELECTION,
     REGISTRATION;
 }

app/src/main/java/com/kunzisoft/keepass/credentialprovider/TypeMode.kt

@@ -0,0 +1,5 @@
+package com.kunzisoft.keepass.credentialprovider
+
+enum class TypeMode {
+    DEFAULT, MAGIKEYBOARD, PASSKEY, AUTOFILL
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/activity/AutofillLauncherActivity.kt

@@ -0,0 +1,251 @@
+/*
+ * Copyright 2019 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.activity
+
+import android.app.PendingIntent
+import android.content.Context
+import android.content.Intent
+import android.os.Build
+import android.os.Bundle
+import android.util.Log
+import android.widget.Toast
+import androidx.activity.result.ActivityResultLauncher
+import androidx.activity.result.contract.ActivityResultContracts
+import androidx.activity.viewModels
+import androidx.annotation.RequiresApi
+import androidx.lifecycle.lifecycleScope
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.activities.FileDatabaseSelectActivity
+import com.kunzisoft.keepass.activities.GroupActivity
+import com.kunzisoft.keepass.activities.legacy.DatabaseModeActivity
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addRegisterInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addSearchInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addSpecialMode
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.getRegisterInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.getSearchInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.getSpecialMode
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.setActivityResult
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.autofill.AutofillComponent
+import com.kunzisoft.keepass.credentialprovider.autofill.AutofillHelper.addAutofillComponent
+import com.kunzisoft.keepass.credentialprovider.autofill.AutofillHelper.retrieveAutofillComponent
+import com.kunzisoft.keepass.credentialprovider.viewmodel.AutofillLauncherViewModel
+import com.kunzisoft.keepass.credentialprovider.viewmodel.CredentialLauncherViewModel
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.model.RegisterInfo
+import com.kunzisoft.keepass.model.SearchInfo
+import com.kunzisoft.keepass.utils.AppUtil.randomRequestCode
+import com.kunzisoft.keepass.view.toastError
+import kotlinx.coroutines.launch
+
+@RequiresApi(api = Build.VERSION_CODES.O)
+class AutofillLauncherActivity : DatabaseModeActivity() {
+
+    private val autofillLauncherViewModel: AutofillLauncherViewModel by viewModels()
+
+    private var mAutofillSelectionActivityResultLauncher: ActivityResultLauncher<Intent>? =
+        this.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) {
+            autofillLauncherViewModel.manageSelectionResult(it)
+        }
+
+    private var mAutofillRegistrationActivityResultLauncher: ActivityResultLauncher<Intent>? =
+        this.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) {
+            autofillLauncherViewModel.manageRegistrationResult(it)
+        }
+
+    override fun applyCustomStyle(): Boolean = false
+
+    override fun finishActivityIfReloadRequested(): Boolean = true
+
+    override fun manageDatabaseInfo(): Boolean  = false
+
+    override fun onCreate(savedInstanceState: Bundle?) {
+        // To apply the bypass https://github.com/Kunzisoft/KeePassDX/issues/2238
+        // before managing intent in super class
+        intent.retrieveSelectionBundle()?.apply {
+            intent.addSpecialMode(getSpecialMode())
+            intent.addSearchInfo(getSearchInfo())
+            intent.addRegisterInfo(getRegisterInfo())
+            intent.addAutofillComponent(retrieveAutofillComponent())
+        }
+        super.onCreate(savedInstanceState)
+        autofillLauncherViewModel.initialize()
+        lifecycleScope.launch {
+            // Initialize the parameters
+            autofillLauncherViewModel.uiState.collect { uiState ->
+                when (uiState) {
+                    AutofillLauncherViewModel.UIState.Loading -> {}
+                    is AutofillLauncherViewModel.UIState.ShowBlockRestartMessage -> {
+                        showBlockRestartMessage()
+                        autofillLauncherViewModel.cancelResult()
+                    }
+                    is AutofillLauncherViewModel.UIState.ShowAutofillSuggestionMessage -> {
+                        showAutofillSuggestionMessage()
+                    }
+                }
+            }
+        }
+        lifecycleScope.launch {
+            // Retrieve the UI
+            autofillLauncherViewModel.credentialUiState.collect { uiState ->
+                when (uiState) {
+                    is CredentialLauncherViewModel.CredentialState.Loading -> {}
+                    is CredentialLauncherViewModel.CredentialState.LaunchGroupActivityForSelection -> {
+                        GroupActivity.launchForSelection(
+                            context = this@AutofillLauncherActivity,
+                            database = uiState.database,
+                            searchInfo = uiState.searchInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = mAutofillSelectionActivityResultLauncher,
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchGroupActivityForRegistration -> {
+                        GroupActivity.launchForRegistration(
+                            context = this@AutofillLauncherActivity,
+                            database = uiState.database,
+                            registerInfo = uiState.registerInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = mAutofillRegistrationActivityResultLauncher
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchFileDatabaseSelectActivityForSelection -> {
+                        FileDatabaseSelectActivity.launchForSelection(
+                            context = this@AutofillLauncherActivity,
+                            searchInfo = uiState.searchInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = mAutofillSelectionActivityResultLauncher
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchFileDatabaseSelectActivityForRegistration -> {
+                        FileDatabaseSelectActivity.launchForRegistration(
+                            context = this@AutofillLauncherActivity,
+                            registerInfo = uiState.registerInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = mAutofillRegistrationActivityResultLauncher,
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.SetActivityResult -> {
+                        setActivityResult(
+                            lockDatabase = uiState.lockDatabase,
+                            resultCode = uiState.resultCode,
+                            data = uiState.data
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.ShowError -> {
+                        toastError(uiState.error)
+                        autofillLauncherViewModel.cancelResult()
+                    }
+                }
+            }
+        }
+    }
+
+    override fun onUnknownDatabaseRetrieved(database: ContextualDatabase?) {
+        super.onUnknownDatabaseRetrieved(database)
+        autofillLauncherViewModel.launchActionIfNeeded(intent, mSpecialMode, database)
+    }
+
+    private fun showBlockRestartMessage() {
+        // If item not allowed, show a toast
+        Toast.makeText(
+            applicationContext,
+            R.string.autofill_block_restart,
+            Toast.LENGTH_LONG
+        ).show()
+    }
+
+    private fun showAutofillSuggestionMessage() {
+        Toast.makeText(
+            applicationContext,
+            R.string.autofill_inline_suggestions_keyboard,
+            Toast.LENGTH_SHORT
+        ).show()
+    }
+
+    companion object {
+
+        private const val KEY_PENDING_INTENT_BUNDLE = "com.kunzisoft.keepass.extra.BUNDLE"
+        private val TAG = AutofillLauncherActivity::class.java.name
+
+        fun Intent.retrieveSelectionBundle(): Bundle? {
+            return this.getBundleExtra(KEY_PENDING_INTENT_BUNDLE)
+        }
+
+        fun getPendingIntentForSelection(
+            context: Context,
+            searchInfo: SearchInfo? = null,
+            autofillComponent: AutofillComponent
+        ): PendingIntent? {
+            try {
+                // Doesn't work with direct extra Parcelable in Android 11 (don't know why?)
+                // https://github.com/Kunzisoft/KeePassDX/issues/2238
+                // Wrap into a bundle to bypass the problem
+                val tempBundle = Bundle().apply {
+                    addSpecialMode(SpecialMode.SELECTION)
+                    addSearchInfo(searchInfo)
+                    addAutofillComponent(autofillComponent)
+                }
+                return PendingIntent.getActivity(
+                    context,
+                    randomRequestCode(),
+                    Intent(context, AutofillLauncherActivity::class.java).apply {
+                        putExtra(KEY_PENDING_INTENT_BUNDLE, tempBundle)
+                    },
+                    if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S) {
+                        PendingIntent.FLAG_MUTABLE or PendingIntent.FLAG_CANCEL_CURRENT
+                    } else {
+                        PendingIntent.FLAG_CANCEL_CURRENT
+                    }
+                )
+            } catch (e: RuntimeException) {
+                Log.e(TAG, "Unable to create pending intent for selection", e)
+                return null
+            }
+        }
+
+        fun getPendingIntentForRegistration(
+            context: Context,
+            registerInfo: RegisterInfo
+        ): PendingIntent? {
+            try {
+                // Bypass intent issue
+                val tempBundle = Bundle().apply {
+                    addSpecialMode(SpecialMode.REGISTRATION)
+                    addRegisterInfo(registerInfo)
+                }
+                return PendingIntent.getActivity(
+                    context,
+                    randomRequestCode(),
+                    Intent(context, AutofillLauncherActivity::class.java).apply {
+                        putExtra(KEY_PENDING_INTENT_BUNDLE, tempBundle)
+                    },
+                    if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S) {
+                        PendingIntent.FLAG_MUTABLE or PendingIntent.FLAG_CANCEL_CURRENT
+                    } else {
+                        PendingIntent.FLAG_CANCEL_CURRENT
+                    }
+                )
+            } catch (e: RuntimeException) {
+                Log.e(TAG, "Unable to create pending intent for registration", e)
+                return null
+            }
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/activity/EntrySelectionLauncherActivity.kt

@@ -0,0 +1,177 @@
+/*
+ * Copyright 2019 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.activity
+
+import android.content.Context
+import android.content.Intent
+import android.os.Bundle
+import androidx.activity.result.ActivityResultLauncher
+import androidx.activity.result.contract.ActivityResultContracts
+import androidx.activity.viewModels
+import androidx.lifecycle.lifecycleScope
+import com.kunzisoft.keepass.activities.FileDatabaseSelectActivity
+import com.kunzisoft.keepass.activities.GroupActivity
+import com.kunzisoft.keepass.activities.legacy.DatabaseModeActivity
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addSearchInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.setActivityResult
+import com.kunzisoft.keepass.credentialprovider.magikeyboard.MagikeyboardService
+import com.kunzisoft.keepass.credentialprovider.viewmodel.CredentialLauncherViewModel
+import com.kunzisoft.keepass.credentialprovider.viewmodel.EntrySelectionViewModel
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.model.SearchInfo
+import com.kunzisoft.keepass.view.toastError
+import kotlinx.coroutines.launch
+
+/**
+ * Activity to search or select entry in database,
+ * Commonly used with Magikeyboard
+ */
+class EntrySelectionLauncherActivity : DatabaseModeActivity() {
+
+    private val entrySelectionViewModel: EntrySelectionViewModel by viewModels()
+
+    private var mEntrySelectionActivityResultLauncher: ActivityResultLauncher<Intent>? =
+        this.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) {
+            entrySelectionViewModel.manageSelectionResult(it)
+        }
+
+    override fun applyCustomStyle() = false
+
+    override fun finishActivityIfReloadRequested() = false
+
+    override fun manageDatabaseInfo(): Boolean = false
+
+    override fun onCreate(savedInstanceState: Bundle?) {
+        super.onCreate(savedInstanceState)
+        entrySelectionViewModel.initialize()
+        lifecycleScope.launch {
+            // Initialize the parameters
+            entrySelectionViewModel.uiState.collect { uiState ->
+                when (uiState) {
+                    is EntrySelectionViewModel.UIState.Loading -> {}
+                    is EntrySelectionViewModel.UIState.PopulateKeyboard -> {
+                        MagikeyboardService.addEntryAndLaunchNotificationIfAllowed(
+                            context = this@EntrySelectionLauncherActivity,
+                            entry = uiState.entryInfo,
+                            toast = true
+                        )
+                    }
+                    is EntrySelectionViewModel.UIState.LaunchFileDatabaseSelectForSearch -> {
+                        FileDatabaseSelectActivity.launchForSearch(
+                            context = this@EntrySelectionLauncherActivity,
+                            searchInfo = uiState.searchInfo
+                        )
+                        finish()
+                    }
+                    is EntrySelectionViewModel.UIState.LaunchGroupActivityForSearch -> {
+                        GroupActivity.launchForSearch(
+                            context = this@EntrySelectionLauncherActivity,
+                            database = uiState.database,
+                            searchInfo = uiState.searchInfo
+                        )
+                        finish()
+                    }
+                }
+            }
+        }
+        lifecycleScope.launch {
+            // Retrieve the UI
+            entrySelectionViewModel.credentialUiState.collect { uiState ->
+                when (uiState) {
+                    is CredentialLauncherViewModel.CredentialState.Loading -> {}
+                    is CredentialLauncherViewModel.CredentialState.LaunchGroupActivityForSelection -> {
+                        GroupActivity.launchForSelection(
+                            context = this@EntrySelectionLauncherActivity,
+                            database = uiState.database,
+                            searchInfo = uiState.searchInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = mEntrySelectionActivityResultLauncher
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchGroupActivityForRegistration -> {
+                        GroupActivity.launchForRegistration(
+                            context = this@EntrySelectionLauncherActivity,
+                            database = uiState.database,
+                            registerInfo = uiState.registerInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = null // Null to not get any callback
+                        )
+                        finish()
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchFileDatabaseSelectActivityForSelection -> {
+                        FileDatabaseSelectActivity.launchForSelection(
+                            context = this@EntrySelectionLauncherActivity,
+                            searchInfo = uiState.searchInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = mEntrySelectionActivityResultLauncher
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchFileDatabaseSelectActivityForRegistration -> {
+                        FileDatabaseSelectActivity.launchForRegistration(
+                            context = this@EntrySelectionLauncherActivity,
+                            registerInfo = uiState.registerInfo,
+                            typeMode = uiState.typeMode,
+                            activityResultLauncher = null // Null to not get any callback
+                        )
+                        finish()
+                    }
+                    is CredentialLauncherViewModel.CredentialState.SetActivityResult -> {
+                        setActivityResult(
+                            lockDatabase = uiState.lockDatabase,
+                            resultCode = uiState.resultCode,
+                            data = uiState.data
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.ShowError -> {
+                        toastError(uiState.error)
+                        entrySelectionViewModel.cancelResult()
+                    }
+                }
+            }
+        }
+    }
+
+    override fun onUnknownDatabaseRetrieved(database: ContextualDatabase?) {
+        super.onUnknownDatabaseRetrieved(database)
+        entrySelectionViewModel.launchActionIfNeeded(intent, mSpecialMode, database)
+    }
+
+    override fun onDestroy() {
+        super.onDestroy()
+    }
+
+    companion object {
+
+        fun launch(
+            context: Context,
+            searchInfo: SearchInfo? = null
+        ) {
+            context.startActivity(Intent(
+                context,
+                EntrySelectionLauncherActivity::class.java
+            ).apply {
+                addSearchInfo(searchInfo)
+                // New task needed because don't launch from an Activity context
+                flags = Intent.FLAG_ACTIVITY_NEW_TASK or
+                        Intent.FLAG_ACTIVITY_CLEAR_TASK
+            })
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/activity/HardwareKeyActivity.kt

@@ -0,0 +1,170 @@
+package com.kunzisoft.keepass.credentialprovider.activity
+
+import android.content.Context
+import android.content.DialogInterface
+import android.content.Intent
+import android.os.Bundle
+import androidx.activity.result.ActivityResultLauncher
+import androidx.activity.result.contract.ActivityResultContracts
+import androidx.activity.viewModels
+import androidx.appcompat.app.AlertDialog
+import androidx.lifecycle.lifecycleScope
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.activities.legacy.DatabaseModeActivity
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.setActivityResult
+import com.kunzisoft.keepass.credentialprovider.viewmodel.CredentialLauncherViewModel
+import com.kunzisoft.keepass.credentialprovider.viewmodel.HardwareKeyLauncherViewModel
+import com.kunzisoft.keepass.credentialprovider.viewmodel.HardwareKeyLauncherViewModel.Companion.addHardwareKey
+import com.kunzisoft.keepass.credentialprovider.viewmodel.HardwareKeyLauncherViewModel.Companion.addSeed
+import com.kunzisoft.keepass.credentialprovider.viewmodel.HardwareKeyLauncherViewModel.Companion.buildHardwareKeyChallenge
+import com.kunzisoft.keepass.credentialprovider.viewmodel.HardwareKeyLauncherViewModel.Companion.isYubikeyDriverAvailable
+import com.kunzisoft.keepass.credentialprovider.viewmodel.HardwareKeyLauncherViewModel.UIState
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.hardware.HardwareKey
+import com.kunzisoft.keepass.tasks.ActionRunnable
+import com.kunzisoft.keepass.utils.AppUtil.openExternalApp
+import com.kunzisoft.keepass.view.toastError
+import kotlinx.coroutines.launch
+
+/**
+ * Special activity to deal with hardware key drivers,
+ * return the response to the database service once finished
+ */
+class HardwareKeyActivity: DatabaseModeActivity(){
+
+    private val mHardwareKeyLauncherViewModel: HardwareKeyLauncherViewModel by viewModels()
+
+    private var activityResultLauncher: ActivityResultLauncher<Intent> =
+        this.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) {
+            mHardwareKeyLauncherViewModel.manageSelectionResult(it)
+        }
+
+    override fun applyCustomStyle(): Boolean  = false
+
+    override fun showDatabaseDialog(): Boolean = false
+
+    override fun manageDatabaseInfo(): Boolean = false
+
+    override fun onCreate(savedInstanceState: Bundle?) {
+        super.onCreate(savedInstanceState)
+
+        lifecycleScope.launch {
+            mHardwareKeyLauncherViewModel.uiState.collect { uiState ->
+                when (uiState) {
+                    is UIState.Loading -> {}
+                    is UIState.ShowHardwareKeyDriverNeeded -> {
+                        showHardwareKeyDriverNeeded(
+                            this@HardwareKeyActivity,
+                            uiState.hardwareKey
+                        ) {
+                            mDatabaseViewModel.onChallengeResponded(null)
+                            finish()
+                        }
+                    }
+                    is UIState.LaunchChallengeActivityForResponse -> {
+                        // Send to the driver
+                        activityResultLauncher.launch(
+                            buildHardwareKeyChallenge(uiState.challenge)
+                        )
+                    }
+                    is UIState.OnChallengeResponded -> {
+                        mDatabaseViewModel.onChallengeResponded(uiState.response)
+                    }
+                }
+            }
+        }
+        lifecycleScope.launch {
+            mHardwareKeyLauncherViewModel.credentialUiState.collect { uiState ->
+                when (uiState) {
+                    is CredentialLauncherViewModel.CredentialState.SetActivityResult -> {
+                        setActivityResult(
+                            lockDatabase = uiState.lockDatabase,
+                            resultCode = uiState.resultCode,
+                            data = uiState.data
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.ShowError -> {
+                        toastError(uiState.error)
+                        mHardwareKeyLauncherViewModel.cancelResult()
+                    }
+                    else -> {}
+                }
+            }
+        }
+    }
+
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        super.onDatabaseRetrieved(database)
+        mHardwareKeyLauncherViewModel.launchActionIfNeeded(intent, mSpecialMode, database)
+    }
+
+    override fun onDatabaseActionFinished(
+        database: ContextualDatabase,
+        actionTask: String,
+        result: ActionRunnable.Result
+    ) {
+        super.onDatabaseActionFinished(database, actionTask, result)
+        finish()
+    }
+
+    private fun showHardwareKeyDriverNeeded(
+        context: Context,
+        hardwareKey: HardwareKey?,
+        onDialogDismissed: DialogInterface.OnDismissListener
+    ) {
+        val builder = AlertDialog.Builder(context)
+        builder
+            .setMessage(
+                context.getString(R.string.error_driver_required, hardwareKey.toString())
+            )
+            .setPositiveButton(R.string.download) { _, _ ->
+                context.openExternalApp(
+                    context.getString(R.string.key_driver_app_id),
+                    context.getString(R.string.key_driver_url)
+                )
+            }
+            .setNegativeButton(android.R.string.cancel) { _, _ -> }
+            .setOnDismissListener(onDialogDismissed)
+        builder.create().show()
+    }
+
+    companion object {
+        private val TAG = HardwareKeyActivity::class.java.simpleName
+
+        fun launchHardwareKeyActivity(
+            context: Context,
+            hardwareKey: HardwareKey,
+            seed: ByteArray?
+        ) {
+            context.startActivity(
+                Intent(
+                    context,
+                    HardwareKeyActivity::class.java).apply {
+                flags = Intent.FLAG_ACTIVITY_NEW_TASK or
+                        Intent.FLAG_ACTIVITY_MULTIPLE_TASK
+                addHardwareKey(hardwareKey)
+                addSeed(seed)
+            })
+        }
+
+        fun isHardwareKeyAvailable(
+            context: Context,
+            hardwareKey: HardwareKey?
+        ): Boolean {
+            if (hardwareKey == null)
+                return false
+            return when (hardwareKey) {
+                /*
+                HardwareKey.FIDO2_SECRET -> {
+                    // TODO FIDO2 under development
+                    false
+                }
+                */
+                HardwareKey.CHALLENGE_RESPONSE_YUBIKEY -> {
+                    // Check available intent
+                    isYubikeyDriverAvailable(context)
+                }
+            }
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/activity/PasskeyLauncherActivity.kt

@@ -0,0 +1,298 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.activity
+
+import android.app.PendingIntent
+import android.content.Context
+import android.content.Intent
+import android.os.Build
+import android.os.Bundle
+import android.util.Log
+import android.view.View
+import androidx.activity.result.ActivityResultLauncher
+import androidx.activity.result.contract.ActivityResultContracts
+import androidx.activity.viewModels
+import androidx.annotation.RequiresApi
+import androidx.appcompat.app.AlertDialog
+import androidx.lifecycle.lifecycleScope
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.activities.FileDatabaseSelectActivity
+import com.kunzisoft.keepass.activities.GroupActivity
+import com.kunzisoft.keepass.activities.legacy.DatabaseLockActivity
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addNodeId
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addSearchInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addSpecialMode
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addTypeMode
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.setActivityResult
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.TypeMode
+import com.kunzisoft.keepass.credentialprovider.passkey.data.AndroidPrivilegedApp
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.addAppOrigin
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.addAuthCode
+import com.kunzisoft.keepass.credentialprovider.viewmodel.CredentialLauncherViewModel
+import com.kunzisoft.keepass.credentialprovider.viewmodel.PasskeyLauncherViewModel
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.model.AppOrigin
+import com.kunzisoft.keepass.model.SearchInfo
+import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_UPDATE_ENTRY_TASK
+import com.kunzisoft.keepass.tasks.ActionRunnable
+import com.kunzisoft.keepass.utils.AppUtil.randomRequestCode
+import com.kunzisoft.keepass.view.toastError
+import kotlinx.coroutines.launch
+import java.util.UUID
+
+@RequiresApi(Build.VERSION_CODES.UPSIDE_DOWN_CAKE)
+class PasskeyLauncherActivity : DatabaseLockActivity() {
+
+    private val passkeyLauncherViewModel: PasskeyLauncherViewModel by viewModels()
+
+    private var mPasskeySelectionActivityResultLauncher: ActivityResultLauncher<Intent>? =
+        this.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) {
+            passkeyLauncherViewModel.manageSelectionResult(it)
+        }
+
+    private var mPasskeyRegistrationActivityResultLauncher: ActivityResultLauncher<Intent>? =
+        this.registerForActivityResult(ActivityResultContracts.StartActivityForResult()) {
+            passkeyLauncherViewModel.manageRegistrationResult(it)
+        }
+
+    override fun applyCustomStyle(): Boolean {
+        return false
+    }
+
+    override fun finishActivityIfReloadRequested(): Boolean {
+        return false
+    }
+
+    override fun onCreate(savedInstanceState: Bundle?) {
+        super.onCreate(savedInstanceState)
+        lifecycleScope.launch {
+            // Initialize the parameters
+            passkeyLauncherViewModel.initialize()
+            // Retrieve the UI
+            passkeyLauncherViewModel.uiState.collect { uiState ->
+                when (uiState) {
+                    is PasskeyLauncherViewModel.UIState.Loading -> {
+                        // Nothing to do
+                    }
+                    is PasskeyLauncherViewModel.UIState.ShowAppPrivilegedDialog -> {
+                        showAppPrivilegedDialog(
+                            temptingApp = uiState.temptingApp
+                        )
+                    }
+                    is PasskeyLauncherViewModel.UIState.ShowAppSignatureDialog -> {
+                        showAppSignatureDialog(
+                            temptingApp = uiState.temptingApp,
+                            nodeId = uiState.nodeId
+                        )
+                    }
+                    is PasskeyLauncherViewModel.UIState.UpdateEntry -> {
+                        updateEntry(uiState.oldEntry, uiState.newEntry)
+                    }
+                }
+            }
+        }
+        lifecycleScope.launch {
+            passkeyLauncherViewModel.credentialUiState.collect { uiState ->
+                when (uiState) {
+                    is CredentialLauncherViewModel.CredentialState.Loading -> {}
+                    is CredentialLauncherViewModel.CredentialState.SetActivityResult -> {
+                        setActivityResult(
+                            lockDatabase = uiState.lockDatabase,
+                            resultCode = uiState.resultCode,
+                            data = uiState.data
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.ShowError -> {
+                        toastError(uiState.error)
+                        passkeyLauncherViewModel.cancelResult()
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchGroupActivityForSelection -> {
+                        GroupActivity.launchForSelection(
+                            context = this@PasskeyLauncherActivity,
+                            database = uiState.database,
+                            typeMode = uiState.typeMode,
+                            searchInfo = uiState.searchInfo,
+                            activityResultLauncher = mPasskeySelectionActivityResultLauncher
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchGroupActivityForRegistration -> {
+                        GroupActivity.launchForRegistration(
+                            context = this@PasskeyLauncherActivity,
+                            database = uiState.database,
+                            typeMode = uiState.typeMode,
+                            registerInfo = uiState.registerInfo,
+                            activityResultLauncher = mPasskeyRegistrationActivityResultLauncher
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchFileDatabaseSelectActivityForSelection -> {
+                        FileDatabaseSelectActivity.launchForSelection(
+                            context = this@PasskeyLauncherActivity,
+                            typeMode = uiState.typeMode,
+                            searchInfo = uiState.searchInfo,
+                            activityResultLauncher = mPasskeySelectionActivityResultLauncher
+                        )
+                    }
+                    is CredentialLauncherViewModel.CredentialState.LaunchFileDatabaseSelectActivityForRegistration -> {
+                        FileDatabaseSelectActivity.launchForRegistration(
+                            context = this@PasskeyLauncherActivity,
+                            typeMode = uiState.typeMode,
+                            registerInfo = uiState.registerInfo,
+                            activityResultLauncher = mPasskeyRegistrationActivityResultLauncher,
+                        )
+                    }
+                }
+            }
+        }
+    }
+
+    override fun onUnknownDatabaseRetrieved(database: ContextualDatabase?) {
+        super.onUnknownDatabaseRetrieved(database)
+        passkeyLauncherViewModel.launchActionIfNeeded(intent, mSpecialMode, database)
+    }
+
+    override fun onDatabaseActionFinished(
+        database: ContextualDatabase,
+        actionTask: String,
+        result: ActionRunnable.Result
+    ) {
+        super.onDatabaseActionFinished(database, actionTask, result)
+        when (actionTask) {
+            ACTION_DATABASE_UPDATE_ENTRY_TASK -> {
+                // TODO When auto save is enabled, WARNING filter by the calling activity
+                // passkeyLauncherViewModel.autoSelectPasskey(result, database)
+            }
+        }
+    }
+
+    override fun viewToInvalidateTimeout(): View? {
+        return null
+    }
+
+    /**
+     * Display a dialog that asks the user to add an app to the list of privileged apps.
+     */
+    private fun showAppPrivilegedDialog(
+        temptingApp: AndroidPrivilegedApp
+    ) {
+        Log.w(javaClass.simpleName, "No privileged apps file found")
+        AlertDialog.Builder(this@PasskeyLauncherActivity).apply {
+            setTitle(getString(R.string.passkeys_privileged_apps_ask_title))
+            setMessage(StringBuilder()
+                .append(
+                    getString(
+                        R.string.passkeys_privileged_apps_ask_message,
+                        temptingApp.toString()
+                    )
+                )
+                .append("\n\n")
+                .append(getString(R.string.passkeys_privileged_apps_explanation))
+                .toString()
+            )
+            setPositiveButton(android.R.string.ok) { _, _ ->
+                passkeyLauncherViewModel.saveCustomPrivilegedApp(
+                    intent = intent,
+                    specialMode = mSpecialMode,
+                    database = mDatabase,
+                    temptingApp = temptingApp
+                )
+            }
+            setNegativeButton(android.R.string.cancel) { _, _ ->
+                passkeyLauncherViewModel.cancelResult()
+            }
+            setOnCancelListener {
+                passkeyLauncherViewModel.cancelResult()
+            }
+        }.create().show()
+    }
+
+    /**
+     * Display a dialog that asks the user to add an app signature in an existing passkey
+     */
+    private fun showAppSignatureDialog(
+        temptingApp: AppOrigin,
+        nodeId: UUID
+    ) {
+        AlertDialog.Builder(this@PasskeyLauncherActivity).apply {
+            setTitle(getString(R.string.passkeys_missing_signature_app_ask_title))
+            setMessage(StringBuilder()
+                .append(
+                    getString(
+                        R.string.passkeys_missing_signature_app_ask_message,
+                        temptingApp.toString()
+                    )
+                )
+                .append("\n\n")
+                .append(getString(R.string.passkeys_missing_signature_app_ask_explanation))
+                .append("\n\n")
+                .append(getString(R.string.passkeys_missing_signature_app_ask_question))
+                .toString()
+            )
+            setPositiveButton(android.R.string.ok) { _, _ ->
+                passkeyLauncherViewModel.saveAppSignature(
+                    database = mDatabase,
+                    temptingApp = temptingApp,
+                    nodeId = nodeId
+                )
+            }
+            setNegativeButton(android.R.string.cancel) { _, _ ->
+                passkeyLauncherViewModel.cancelResult()
+            }
+            setOnCancelListener {
+                passkeyLauncherViewModel.cancelResult()
+            }
+        }.create().show()
+    }
+
+    companion object {
+        private val TAG = PasskeyLauncherActivity::class.java.name
+
+        /**
+         * Get a pending intent to launch the passkey launcher activity
+         * [nodeId] can be :
+         *  - null if manual selection is requested
+         *  - null if manual registration is requested
+         *  - an entry node id if direct selection is requested
+         *  - a group node id if direct registration is requested in a default group
+         *  - an entry node id if overwriting is requested in an existing entry
+         */
+        fun getPendingIntent(
+            context: Context,
+            specialMode: SpecialMode,
+            searchInfo: SearchInfo? = null,
+            appOrigin: AppOrigin? = null,
+            nodeId: UUID? = null
+        ): PendingIntent? {
+            return PendingIntent.getActivity(
+                context,
+                randomRequestCode(),
+                Intent(context, PasskeyLauncherActivity::class.java).apply {
+                    addSpecialMode(specialMode)
+                    addTypeMode(TypeMode.PASSKEY)
+                    addSearchInfo(searchInfo)
+                    addAppOrigin(appOrigin)
+                    addNodeId(nodeId)
+                    addAuthCode(nodeId)
+                },
+                PendingIntent.FLAG_MUTABLE or PendingIntent.FLAG_UPDATE_CURRENT
+            )
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/autofill/AutofillComponent.kt

@@ -0,0 +1,8 @@
+package com.kunzisoft.keepass.credentialprovider.autofill
+
+import android.app.assist.AssistStructure
+
+data class AutofillComponent(
+    val assistStructure: AssistStructure,
+    val compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest?
+)

app/src/main/java/com/kunzisoft/keepass/credentialprovider/autofill/AutofillHelper.kt

@@ -17,10 +17,9 @@
  *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
  *
  */
-package com.kunzisoft.keepass.autofill
+package com.kunzisoft.keepass.credentialprovider.autofill
 
 import android.annotation.SuppressLint
-import android.app.Activity
 import android.app.PendingIntent
 import android.app.assist.AssistStructure
 import android.content.Context
@@ -28,6 +27,7 @@ import android.content.Intent
 import android.graphics.BlendMode
 import android.graphics.drawable.Icon
 import android.os.Build
+import android.os.Bundle
 import android.service.autofill.Dataset
 import android.service.autofill.Field
 import android.service.autofill.FillResponse
@@ -38,19 +38,14 @@ import android.view.autofill.AutofillId
 import android.view.autofill.AutofillManager
 import android.view.autofill.AutofillValue
 import android.widget.RemoteViews
-import android.widget.Toast
 import android.widget.inline.InlinePresentationSpec
-import androidx.activity.result.ActivityResultLauncher
-import androidx.activity.result.contract.ActivityResultContracts
 import androidx.annotation.RequiresApi
-import androidx.appcompat.app.AppCompatActivity
 import androidx.autofill.inline.UiVersions
 import androidx.autofill.inline.v1.InlineSuggestionUi
 import androidx.core.content.ContextCompat
 import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.activities.AutofillLauncherActivity
-import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
-import com.kunzisoft.keepass.activities.helpers.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.buildIcon
+import com.kunzisoft.keepass.credentialprovider.activity.AutofillLauncherActivity
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.element.icon.IconImage
 import com.kunzisoft.keepass.database.element.template.TemplateField
@@ -58,22 +53,63 @@ import com.kunzisoft.keepass.model.EntryInfo
 import com.kunzisoft.keepass.model.SearchInfo
 import com.kunzisoft.keepass.settings.AutofillSettingsActivity
 import com.kunzisoft.keepass.settings.PreferencesUtil
-import com.kunzisoft.keepass.utils.LOCK_ACTION
+import com.kunzisoft.keepass.utils.AppUtil.randomRequestCode
+import com.kunzisoft.keepass.utils.getParcelableCompat
 import com.kunzisoft.keepass.utils.getParcelableExtraCompat
+import java.io.IOException
 import kotlin.math.min
 
 
 @RequiresApi(api = Build.VERSION_CODES.O)
 object AutofillHelper {
 
-    private const val EXTRA_ASSIST_STRUCTURE = AutofillManager.EXTRA_ASSIST_STRUCTURE
+    private const val EXTRA_BASE_STRUCTURE = "com.kunzisoft.keepass.autofill.BASE_STRUCTURE"
     private const val EXTRA_INLINE_SUGGESTIONS_REQUEST = "com.kunzisoft.keepass.autofill.INLINE_SUGGESTIONS_REQUEST"
 
-    fun retrieveAutofillComponent(intent: Intent?): AutofillComponent? {
-        intent?.getParcelableExtraCompat<AssistStructure>(EXTRA_ASSIST_STRUCTURE)?.let { assistStructure ->
+    fun Intent.addAutofillComponent(autofillComponent: AutofillComponent?): Intent {
+        autofillComponent?.let {
+            this.putExtra(EXTRA_BASE_STRUCTURE, autofillComponent.assistStructure)
+            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
+                autofillComponent.compatInlineSuggestionsRequest?.let {
+                    this.putExtra(EXTRA_INLINE_SUGGESTIONS_REQUEST, it)
+                }
+            }
+        }
+        return this
+    }
+
+    fun Intent.retrieveAutofillComponent(): AutofillComponent? {
+        this.getParcelableExtraCompat<AssistStructure>(EXTRA_BASE_STRUCTURE)?.let { assistStructure ->
             return if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-                AutofillComponent(assistStructure,
-                        intent.getParcelableExtraCompat(EXTRA_INLINE_SUGGESTIONS_REQUEST))
+                AutofillComponent(
+                    assistStructure,
+                    this.getParcelableExtraCompat(EXTRA_INLINE_SUGGESTIONS_REQUEST))
+            } else {
+                AutofillComponent(assistStructure, null)
+            }
+        }
+        return null
+    }
+
+    fun Bundle.addAutofillComponent(autofillComponent: AutofillComponent?): Bundle {
+        autofillComponent?.let {
+            this.putParcelable(EXTRA_BASE_STRUCTURE, autofillComponent.assistStructure)
+            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
+                autofillComponent.compatInlineSuggestionsRequest?.let {
+                    this.putParcelable(EXTRA_INLINE_SUGGESTIONS_REQUEST, it)
+                }
+            }
+        }
+        return this
+    }
+
+    fun Bundle.retrieveAutofillComponent(): AutofillComponent? {
+        this.getParcelableCompat<AssistStructure>(EXTRA_BASE_STRUCTURE)?.let { assistStructure ->
+            return if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
+                AutofillComponent(
+                    assistStructure,
+                    this.getParcelableCompat(EXTRA_INLINE_SUGGESTIONS_REQUEST)
+                )
             } else {
                 AutofillComponent(assistStructure, null)
             }
@@ -132,11 +168,13 @@ object AutofillHelper {
         return this
     }
 
-    private fun buildDatasetForEntry(context: Context,
-                                     database: ContextualDatabase,
-                                     entryInfo: EntryInfo,
-                                     struct: StructureParser.Result,
-                                     inlinePresentation: InlinePresentation?): Dataset {
+    private fun buildDatasetForEntry(
+        context: Context,
+        database: ContextualDatabase,
+        entryInfo: EntryInfo,
+        struct: StructureParser.Result,
+        inlinePresentation: InlinePresentation?
+    ): Dataset {
         val remoteViews: RemoteViews = newRemoteViews(context, database, makeEntryTitle(entryInfo), entryInfo.icon)
 
         val datasetBuilder = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
@@ -263,7 +301,7 @@ object AutofillHelper {
                 }
             }
         }
-        for (field in entryInfo.customFields) {
+        for (field in entryInfo.getCustomFieldsForFilling()) {
             if (field.name == TemplateField.LABEL_HOLDER) {
                 struct.creditCardHolderId?.let { ccNameId ->
                     datasetBuilder.addValueToDatasetBuilder(
@@ -294,30 +332,15 @@ object AutofillHelper {
         return dataset
     }
 
-    /**
-     * Method to assign a drawable to a new icon from a database icon
-     */
-    private fun buildIconFromEntry(context: Context,
-                                   database: ContextualDatabase,
-                                   entryInfo: EntryInfo): Icon? {
-        try {
-            database.iconDrawableFactory.getBitmapFromIcon(context,
-                    entryInfo.icon, ContextCompat.getColor(context, R.color.green))?.let { bitmap ->
-                return Icon.createWithBitmap(bitmap)
-            }
-        } catch (e: Exception) {
-            Log.e(RemoteViews::class.java.name, "Unable to assign icon in remote view", e)
-        }
-        return null
-    }
-
     @SuppressLint("RestrictedApi")
     @RequiresApi(Build.VERSION_CODES.R)
-    private fun buildInlinePresentationForEntry(context: Context,
-                                                database: ContextualDatabase,
-                                                compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest,
-                                                positionItem: Int,
-                                                entryInfo: EntryInfo): InlinePresentation? {
+    private fun buildInlinePresentationForEntry(
+        context: Context,
+        database: ContextualDatabase,
+        compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest,
+        positionItem: Int,
+        entryInfo: EntryInfo
+    ): InlinePresentation? {
         compatInlineSuggestionsRequest.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
             val inlinePresentationSpecs = inlineSuggestionsRequest.inlinePresentationSpecs
             val maxSuggestion = inlineSuggestionsRequest.maxSuggestionCount
@@ -336,13 +359,9 @@ object AutofillHelper {
                 // Build the content for IME UI
                 val pendingIntent = PendingIntent.getActivity(
                     context,
-                    0,
+                    randomRequestCode(),
                     Intent(context, AutofillSettingsActivity::class.java),
-                    if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
-                        PendingIntent.FLAG_IMMUTABLE
-                    } else {
-                        0
-                    }
+                    PendingIntent.FLAG_IMMUTABLE
                 )
                 return InlinePresentation(
                     InlineSuggestionUi.newContentBuilder(pendingIntent).apply {
@@ -353,7 +372,7 @@ object AutofillHelper {
                             Icon.createWithResource(context, R.mipmap.ic_launcher_round).apply {
                                 setTintBlendMode(BlendMode.DST)
                             })
-                        buildIconFromEntry(context, database, entryInfo)?.let { icon ->
+                        entryInfo.buildIcon(context, database)?.let { icon ->
                             setEndIcon(icon.apply {
                                 setTintBlendMode(BlendMode.DST)
                             })
@@ -367,9 +386,11 @@ object AutofillHelper {
 
     @RequiresApi(Build.VERSION_CODES.R)
     @SuppressLint("RestrictedApi")
-    private fun buildInlinePresentationForManualSelection(context: Context,
-                                                          inlinePresentationSpec: InlinePresentationSpec,
-                                                          pendingIntent: PendingIntent): InlinePresentation? {
+    private fun buildInlinePresentationForManualSelection(
+        context: Context,
+        inlinePresentationSpec: InlinePresentationSpec,
+        pendingIntent: PendingIntent
+    ): InlinePresentation? {
         // Make sure that the IME spec claims support for v1 UI template.
         val imeStyle = inlinePresentationSpec.style
         if (!UiVersions.getVersions(imeStyle).contains(UiVersions.INLINE_UI_VERSION_1))
@@ -386,11 +407,13 @@ object AutofillHelper {
                 }.build().slice, inlinePresentationSpec, false)
     }
 
-    fun buildResponse(context: Context,
-                      database: ContextualDatabase,
-                      entriesInfo: List<EntryInfo>,
-                      parseResult: StructureParser.Result,
-                      compatInlineSuggestionsRequest: CompatInlineSuggestionsRequest?): FillResponse? {
+    fun buildResponse(
+        context: Context,
+        database: ContextualDatabase,
+        entriesInfo: List<EntryInfo>,
+        parseResult: StructureParser.Result,
+        autofillComponent: AutofillComponent
+    ): FillResponse? {
         val responseBuilder = FillResponse.Builder()
         // Add Header
         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.P) {
@@ -411,7 +434,8 @@ object AutofillHelper {
         // Add inline suggestion for new IME and dataset
         var numberInlineSuggestions = 0
         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-            compatInlineSuggestionsRequest?.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
+            autofillComponent.compatInlineSuggestionsRequest
+                ?.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
                 numberInlineSuggestions = minOf(inlineSuggestionsRequest.maxSuggestionCount, entriesInfo.size)
                 if (PreferencesUtil.isAutofillManualSelectionEnable(context)) {
                     if (entriesInfo.size >= inlineSuggestionsRequest.maxSuggestionCount) {
@@ -427,21 +451,27 @@ object AutofillHelper {
                 var inlinePresentation: InlinePresentation? = null
                 if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R
                     && numberInlineSuggestions > 0
-                    && compatInlineSuggestionsRequest != null) {
+                    && autofillComponent.compatInlineSuggestionsRequest != null) {
                     inlinePresentation = buildInlinePresentationForEntry(
                         context,
                         database,
-                        compatInlineSuggestionsRequest,
+                        autofillComponent.compatInlineSuggestionsRequest,
                         numberInlineSuggestions--,
                         entry
                     )
                 }
                 // Create dataset for each entry
                 responseBuilder.addDataset(
-                    buildDatasetForEntry(context, database, entry, parseResult, inlinePresentation)
+                    buildDatasetForEntry(
+                        context = context,
+                        database = database,
+                        entryInfo = entry,
+                        struct = parseResult,
+                        inlinePresentation = inlinePresentation
+                    )
                 )
             } catch (e: Exception) {
-                Log.e(TAG, "Unable to add dataset")
+                Log.e(TAG, "Unable to add dataset", e)
             }
         }
 
@@ -453,21 +483,28 @@ object AutofillHelper {
                 webScheme = parseResult.webScheme
                 manualSelection = true
             }
-            val manualSelectionView = RemoteViews(context.packageName, R.layout.item_autofill_select_entry)
-            AutofillLauncherActivity.getPendingIntentForSelection(context,
-                    searchInfo, compatInlineSuggestionsRequest)?.let { pendingIntent ->
+            val manualSelectionView = RemoteViews(
+                context.packageName,
+                R.layout.item_autofill_select_entry
+            )
+            AutofillLauncherActivity.getPendingIntentForSelection(
+                context,
+                searchInfo,
+                autofillComponent
+            )?.let { pendingIntent ->
 
                 var inlinePresentation: InlinePresentation? = null
                 if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-                    compatInlineSuggestionsRequest?.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
-                        val inlinePresentationSpec =
-                            inlineSuggestionsRequest.inlinePresentationSpecs[0]
-                        inlinePresentation = buildInlinePresentationForManualSelection(
-                            context,
-                            inlinePresentationSpec,
-                            pendingIntent
-                        )
-                    }
+                    autofillComponent.compatInlineSuggestionsRequest
+                        ?.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
+                            val inlinePresentationSpec =
+                                inlineSuggestionsRequest.inlinePresentationSpecs[0]
+                            inlinePresentation = buildInlinePresentationForManualSelection(
+                                context,
+                                inlinePresentationSpec,
+                                pendingIntent
+                            )
+                        }
                 }
 
                 val datasetBuilder = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
@@ -512,92 +549,33 @@ object AutofillHelper {
     }
 
     /**
-     * Build the Autofill response for one entry
+     * Build the Autofill response
      */
-    fun buildResponseAndSetResult(activity: Activity,
-                                  database: ContextualDatabase,
-                                  entryInfo: EntryInfo) {
-        buildResponseAndSetResult(activity, database, ArrayList<EntryInfo>().apply { add(entryInfo) })
-    }
-
-    /**
-     * Build the Autofill response for many entry
-     */
-    fun buildResponseAndSetResult(activity: Activity,
-                                  database: ContextualDatabase,
-                                  entriesInfo: List<EntryInfo>) {
+    fun buildResponse(
+        context: Context,
+        autofillComponent: AutofillComponent,
+        database: ContextualDatabase,
+        entriesInfo: List<EntryInfo>,
+        onIntentCreated: (Intent) -> Unit
+    ) {
         if (entriesInfo.isEmpty()) {
-            activity.setResult(Activity.RESULT_CANCELED)
+            throw IOException("No entries found")
         } else {
-            var setResultOk = false
-            activity.intent?.getParcelableExtraCompat<AssistStructure>(EXTRA_ASSIST_STRUCTURE)?.let { structure ->
-                StructureParser(structure).parse()?.let { result ->
-                    // New Response
-                    val response = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R) {
-                        val compatInlineSuggestionsRequest = activity.intent?.getParcelableExtraCompat<CompatInlineSuggestionsRequest>(EXTRA_INLINE_SUGGESTIONS_REQUEST)
-                        if (compatInlineSuggestionsRequest != null) {
-                            Toast.makeText(activity.applicationContext, R.string.autofill_inline_suggestions_keyboard, Toast.LENGTH_SHORT).show()
-                        }
-                        buildResponse(activity, database, entriesInfo, result, compatInlineSuggestionsRequest)
-                    } else {
-                        buildResponse(activity, database, entriesInfo, result, null)
-                    }
-                    val mReplyIntent = Intent()
-                    Log.d(activity.javaClass.name, "Success Autofill auth.")
-                    mReplyIntent.putExtra(
-                            AutofillManager.EXTRA_AUTHENTICATION_RESULT,
-                            response)
-                    setResultOk = true
-                    activity.setResult(Activity.RESULT_OK, mReplyIntent)
-                }
-            }
-            if (!setResultOk) {
-                Log.w(activity.javaClass.name, "Failed Autofill auth.")
-                activity.setResult(Activity.RESULT_CANCELED)
-            }
+            StructureParser(autofillComponent.assistStructure).parse()?.let { result ->
+                // New Response
+                onIntentCreated(Intent().putExtra(
+                    AutofillManager.EXTRA_AUTHENTICATION_RESULT,
+                    buildResponse(
+                        context = context,
+                        database = database,
+                        entriesInfo = entriesInfo,
+                        parseResult = result,
+                        autofillComponent = autofillComponent
+                    )
+                ))
+            } ?: throw IOException("Unable to parse the structure")
         }
     }
 
-    fun buildActivityResultLauncher(activity: AppCompatActivity,
-                                    lockDatabase: Boolean = false): ActivityResultLauncher<Intent> {
-        return activity.registerForActivityResult(
-            ActivityResultContracts.StartActivityForResult()
-        ) {
-            // Utility method to loop and close each activity with return data
-            if (it.resultCode == Activity.RESULT_OK) {
-                activity.setResult(it.resultCode, it.data)
-            }
-            if (it.resultCode == Activity.RESULT_CANCELED) {
-                activity.setResult(Activity.RESULT_CANCELED)
-            }
-            activity.finish()
-
-            if (lockDatabase && PreferencesUtil.isAutofillCloseDatabaseEnable(activity)) {
-                // Close the database
-                activity.sendBroadcast(Intent(LOCK_ACTION))
-            }
-        }
-    }
-
-    /**
-     * Utility method to start an activity with an Autofill for result
-     */
-    fun startActivityForAutofillResult(activity: AppCompatActivity,
-                                       intent: Intent,
-                                       activityResultLauncher: ActivityResultLauncher<Intent>?,
-                                       autofillComponent: AutofillComponent,
-                                       searchInfo: SearchInfo?) {
-        EntrySelectionHelper.addSpecialModeInIntent(intent, SpecialMode.SELECTION)
-        intent.putExtra(EXTRA_ASSIST_STRUCTURE, autofillComponent.assistStructure)
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R
-                && PreferencesUtil.isAutofillInlineSuggestionsEnable(activity)) {
-            autofillComponent.compatInlineSuggestionsRequest?.let {
-                intent.putExtra(EXTRA_INLINE_SUGGESTIONS_REQUEST, it)
-            }
-        }
-        EntrySelectionHelper.addSearchInfoInIntent(intent, searchInfo)
-        activityResultLauncher?.launch(intent)
-    }
-
     private val TAG = AutofillHelper::class.java.name
 }

app/src/main/java/com/kunzisoft/keepass/credentialprovider/autofill/CompatInlineSuggestionsRequest.kt

@@ -17,7 +17,7 @@
  *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
  *
  */
-package com.kunzisoft.keepass.autofill
+package com.kunzisoft.keepass.credentialprovider.autofill
 
 import android.annotation.TargetApi
 import android.os.Build

app/src/main/java/com/kunzisoft/keepass/credentialprovider/autofill/KeeAutofillService.kt

@@ -17,7 +17,7 @@
  *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
  *
  */
-package com.kunzisoft.keepass.autofill
+package com.kunzisoft.keepass.credentialprovider.autofill
 
 import android.annotation.SuppressLint
 import android.app.PendingIntent
@@ -43,8 +43,8 @@ import androidx.annotation.RequiresApi
 import androidx.autofill.inline.UiVersions
 import androidx.autofill.inline.v1.InlineSuggestionUi
 import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.activities.AutofillLauncherActivity
-import com.kunzisoft.keepass.autofill.StructureParser.Companion.APPLICATION_ID_POPUP_WINDOW
+import com.kunzisoft.keepass.credentialprovider.activity.AutofillLauncherActivity
+import com.kunzisoft.keepass.credentialprovider.autofill.StructureParser.Companion.APPLICATION_ID_POPUP_WINDOW
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.DatabaseTaskProvider
 import com.kunzisoft.keepass.database.helper.SearchHelper
@@ -53,7 +53,7 @@ import com.kunzisoft.keepass.model.RegisterInfo
 import com.kunzisoft.keepass.model.SearchInfo
 import com.kunzisoft.keepass.settings.AutofillSettingsActivity
 import com.kunzisoft.keepass.settings.PreferencesUtil
-import com.kunzisoft.keepass.utils.WebDomain
+import com.kunzisoft.keepass.utils.AppUtil.randomRequestCode
 import org.joda.time.DateTime
 
 
@@ -92,10 +92,11 @@ class KeeAutofillService : AutofillService() {
         autofillInlineSuggestionsEnabled = PreferencesUtil.isAutofillInlineSuggestionsEnable(this)
     }
 
-    override fun onFillRequest(request: FillRequest,
-                               cancellationSignal: CancellationSignal,
-                               callback: FillCallback) {
-
+    override fun onFillRequest(
+        request: FillRequest,
+        cancellationSignal: CancellationSignal,
+        callback: FillCallback
+    ) {
         cancellationSignal.setOnCancelListener { Log.w(TAG, "Cancel autofill.") }
 
         if (request.flags and FillRequest.FLAG_COMPATIBILITY_MODE_REQUEST != 0) {
@@ -120,64 +121,64 @@ class KeeAutofillService : AutofillService() {
                     webDomain = parseResult.webDomain
                     webScheme = parseResult.webScheme
                 }
-                WebDomain.getConcreteWebDomain(this, searchInfo.webDomain) { webDomainWithoutSubDomain ->
-                    searchInfo.webDomain = webDomainWithoutSubDomain
-                    val inlineSuggestionsRequest = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R
-                            && autofillInlineSuggestionsEnabled) {
-                        CompatInlineSuggestionsRequest(request)
-                    } else {
-                        null
-                    }
-                    launchSelection(mDatabase,
-                            searchInfo,
-                            parseResult,
-                            inlineSuggestionsRequest,
-                            callback)
+                val inlineSuggestionsRequest = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.R
+                        && autofillInlineSuggestionsEnabled) {
+                    CompatInlineSuggestionsRequest(request)
+                } else {
+                    null
                 }
+                val autofillComponent = AutofillComponent(
+                    latestStructure,
+                    inlineSuggestionsRequest
+                )
+                SearchHelper.checkAutoSearchInfo(
+                    context = this,
+                    database = mDatabase,
+                    searchInfo = searchInfo,
+                    onItemsFound = { openedDatabase, items ->
+                        callback.onSuccess(
+                            AutofillHelper.buildResponse(
+                                context = this,
+                                database = openedDatabase,
+                                entriesInfo = items,
+                                parseResult = parseResult,
+                                autofillComponent = autofillComponent
+                            )
+                        )
+                    },
+                    onItemNotFound = { openedDatabase ->
+                        // Show UI if no search result
+                        showUIForEntrySelection(parseResult, openedDatabase,
+                            searchInfo, autofillComponent, callback)
+                    },
+                    onDatabaseClosed = {
+                        // Show UI if database not open
+                        showUIForEntrySelection(parseResult, null,
+                            searchInfo, autofillComponent, callback)
+                    }
+                )
             }
         }
     }
 
-    private fun launchSelection(database: ContextualDatabase?,
-                                searchInfo: SearchInfo,
-                                parseResult: StructureParser.Result,
-                                inlineSuggestionsRequest: CompatInlineSuggestionsRequest?,
-                                callback: FillCallback) {
-        SearchHelper.checkAutoSearchInfo(this,
-                database,
-                searchInfo,
-                { openedDatabase, items ->
-                    callback.onSuccess(
-                            AutofillHelper.buildResponse(this, openedDatabase,
-                                    items, parseResult, inlineSuggestionsRequest)
-                    )
-                },
-                { openedDatabase ->
-                    // Show UI if no search result
-                    showUIForEntrySelection(parseResult, openedDatabase,
-                            searchInfo, inlineSuggestionsRequest, callback)
-                },
-                {
-                    // Show UI if database not open
-                    showUIForEntrySelection(parseResult, null,
-                            searchInfo, inlineSuggestionsRequest, callback)
-                }
-        )
-    }
-
     @SuppressLint("RestrictedApi")
-    private fun showUIForEntrySelection(parseResult: StructureParser.Result,
-                                        database: ContextualDatabase?,
-                                        searchInfo: SearchInfo,
-                                        inlineSuggestionsRequest: CompatInlineSuggestionsRequest?,
-                                        callback: FillCallback) {
+    private fun showUIForEntrySelection(
+        parseResult: StructureParser.Result,
+        database: ContextualDatabase?,
+        searchInfo: SearchInfo,
+        autofillComponent: AutofillComponent,
+        callback: FillCallback
+    ) {
         var success = false
         parseResult.allAutofillIds().let { autofillIds ->
             if (autofillIds.isNotEmpty()) {
                 // If the entire Autofill Response is authenticated, AuthActivity is used
                 // to generate Response.
-                AutofillLauncherActivity.getPendingIntentForSelection(this,
-                        searchInfo, inlineSuggestionsRequest)?.intentSender?.let { intentSender ->
+                AutofillLauncherActivity.getPendingIntentForSelection(
+                    this,
+                    searchInfo,
+                    autofillComponent
+                )?.intentSender?.let { intentSender ->
                     val responseBuilder = FillResponse.Builder()
                     val remoteViewsUnlock: RemoteViews = if (database == null) {
                         if (!parseResult.webDomain.isNullOrEmpty()) {
@@ -268,7 +269,8 @@ class KeeAutofillService : AutofillService() {
                         && autofillInlineSuggestionsEnabled
                     ) {
                         var inlinePresentation: InlinePresentation? = null
-                        inlineSuggestionsRequest?.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
+                        autofillComponent.compatInlineSuggestionsRequest
+                            ?.inlineSuggestionsRequest?.let { inlineSuggestionsRequest ->
                             val inlinePresentationSpecs =
                                 inlineSuggestionsRequest.inlinePresentationSpecs
                             if (inlineSuggestionsRequest.maxSuggestionCount > 0
@@ -286,7 +288,7 @@ class KeeAutofillService : AutofillService() {
                                         InlineSuggestionUi.newContentBuilder(
                                             PendingIntent.getActivity(
                                                 this,
-                                                0,
+                                                randomRequestCode(),
                                                 Intent(this, AutofillSettingsActivity::class.java),
                                                 PendingIntent.FLAG_IMMUTABLE
                                             )
@@ -358,7 +360,7 @@ class KeeAutofillService : AutofillService() {
 
     override fun onSaveRequest(request: SaveRequest, callback: SaveCallback) {
         var success = false
-        if (askToSaveData) {
+        if (askToSaveData && Build.VERSION.SDK_INT >= Build.VERSION_CODES.P) {
             val latestStructure = request.fillContexts.last().structure
             StructureParser(latestStructure).parse(true)?.let { parseResult ->
 
@@ -384,30 +386,32 @@ class KeeAutofillService : AutofillService() {
                     }
 
                     // Show UI to save data
+                    val searchInfo = SearchInfo().apply {
+                        applicationId = parseResult.applicationId
+                        webDomain = parseResult.webDomain
+                        webScheme = parseResult.webScheme
+                    }
                     val registerInfo = RegisterInfo(
-                            SearchInfo().apply {
-                                applicationId = parseResult.applicationId
-                                webDomain = parseResult.webDomain
-                                webScheme = parseResult.webScheme
-                            },
-                            parseResult.usernameValue?.textValue?.toString(),
-                            parseResult.passwordValue?.textValue?.toString(),
+                        searchInfo = searchInfo,
+                        username = parseResult.usernameValue?.textValue?.toString(),
+                        password = parseResult.passwordValue?.textValue?.toString(),
+                        creditCard = parseResult.creditCardNumber?.let { cardNumber ->
                             CreditCard(
                                 parseResult.creditCardHolder,
-                                parseResult.creditCardNumber,
+                                cardNumber,
                                 expiration,
                                 parseResult.cardVerificationValue
-                            ))
+                            )
+                        }
+                    )
 
-                    // TODO Callback in each activity #765
-                    //if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.P) {
-                    //    callback.onSuccess(AutofillLauncherActivity.getAuthIntentSenderForRegistration(this,
-                    //            registerInfo))
-                    //} else {
-                    AutofillLauncherActivity.launchForRegistration(this, registerInfo)
-                    success = true
-                    callback.onSuccess()
-                    //}
+                    AutofillLauncherActivity.getPendingIntentForRegistration(
+                        this,
+                        registerInfo
+                    )?.intentSender?.let { intentSender ->
+                        success = true
+                        callback.onSuccess(intentSender)
+                    }
                 }
             }
         }

app/src/main/java/com/kunzisoft/keepass/credentialprovider/autofill/StructureParser.kt

@@ -16,7 +16,7 @@
  *  You should have received a copy of the GNU General Public License
  *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
  */
-package com.kunzisoft.keepass.autofill
+package com.kunzisoft.keepass.credentialprovider.autofill
 
 import android.app.assist.AssistStructure
 import android.os.Build
@@ -362,8 +362,8 @@ class StructureParser(private val structure: AssistStructure) {
                 if (result?.passwordId == null) {
                     usernameIdCandidate = autofillId
                     usernameValueCandidate = node.autofillValue
+                    Log.d(TAG, "Autofill username candidate android text type: ${showHexInputType(inputType)}")
                 }
-                Log.d(TAG, "Autofill username candidate android text type: ${showHexInputType(inputType)}")
             }
             inputIsVariationType(inputType,
                 InputType.TYPE_TEXT_VARIATION_VISIBLE_PASSWORD) -> {

app/src/main/java/com/kunzisoft/keepass/credentialprovider/magikeyboard/Keyboard.java

@@ -14,7 +14,7 @@
  * the License.
  */
 
-package com.kunzisoft.keepass.magikeyboard;
+package com.kunzisoft.keepass.credentialprovider.magikeyboard;
 
 import android.content.Context;
 import android.content.res.Resources;

app/src/main/java/com/kunzisoft/keepass/credentialprovider/magikeyboard/KeyboardView.java

@@ -14,14 +14,14 @@
  * the License.
  */
 
-package com.kunzisoft.keepass.magikeyboard;
+package com.kunzisoft.keepass.credentialprovider.magikeyboard;
 
-import static com.kunzisoft.keepass.magikeyboard.MagikeyboardService.KEY_BACK_KEYBOARD;
-import static com.kunzisoft.keepass.magikeyboard.MagikeyboardService.KEY_CHANGE_KEYBOARD;
-import static com.kunzisoft.keepass.magikeyboard.MagikeyboardService.KEY_ENTRY;
-import static com.kunzisoft.keepass.magikeyboard.MagikeyboardService.KEY_ENTRY_ALT;
-import static com.kunzisoft.keepass.magikeyboard.MagikeyboardService.KEY_OTP;
-import static com.kunzisoft.keepass.magikeyboard.MagikeyboardService.KEY_OTP_ALT;
+import static com.kunzisoft.keepass.credentialprovider.magikeyboard.MagikeyboardService.KEY_BACK_KEYBOARD;
+import static com.kunzisoft.keepass.credentialprovider.magikeyboard.MagikeyboardService.KEY_CHANGE_KEYBOARD;
+import static com.kunzisoft.keepass.credentialprovider.magikeyboard.MagikeyboardService.KEY_ENTRY;
+import static com.kunzisoft.keepass.credentialprovider.magikeyboard.MagikeyboardService.KEY_ENTRY_ALT;
+import static com.kunzisoft.keepass.credentialprovider.magikeyboard.MagikeyboardService.KEY_OTP;
+import static com.kunzisoft.keepass.credentialprovider.magikeyboard.MagikeyboardService.KEY_OTP_ALT;
 
 import android.content.Context;
 import android.content.res.TypedArray;
@@ -52,7 +52,7 @@ import android.widget.TextView;
 import androidx.annotation.RequiresApi;
 
 import com.kunzisoft.keepass.R;
-import com.kunzisoft.keepass.magikeyboard.Keyboard.Key;
+import com.kunzisoft.keepass.credentialprovider.magikeyboard.Keyboard.Key;
 
 import java.util.Arrays;
 import java.util.HashMap;

app/src/main/java/com/kunzisoft/keepass/credentialprovider/magikeyboard/MagikeyboardService.kt

@@ -18,7 +18,7 @@
  *
  */
 
-package com.kunzisoft.keepass.magikeyboard
+package com.kunzisoft.keepass.credentialprovider.magikeyboard
 
 import android.app.Activity
 import android.content.Context
@@ -41,9 +41,10 @@ import androidx.core.graphics.BlendModeCompat
 import androidx.recyclerview.widget.LinearLayoutManager
 import androidx.recyclerview.widget.RecyclerView
 import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.activities.EntrySelectionLauncherActivity
-import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
 import com.kunzisoft.keepass.adapters.FieldsAdapter
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.removeModes
+import com.kunzisoft.keepass.credentialprovider.activity.EntrySelectionLauncherActivity
 import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.database.DatabaseTaskProvider
 import com.kunzisoft.keepass.database.element.Field
@@ -324,9 +325,9 @@ class MagikeyboardService : InputMethodService(), KeyboardView.OnKeyboardActionL
                 actionGoAutomatically()
             }
             KEY_FIELDS -> {
-                getEntryInfo()?.customFields?.let { customFields ->
+                getEntryInfo()?.getCustomFieldsForFilling()?.let { customFields ->
                     fieldsAdapter?.apply {
-                        setFields(customFields.filter { it.name != OTP_TOKEN_FIELD})
+                        setFields(customFields)
                         notifyDataSetChanged()
                     }
                 }
@@ -341,10 +342,11 @@ class MagikeyboardService : InputMethodService(), KeyboardView.OnKeyboardActionL
     }
 
     private fun actionKeyEntry(searchInfo: SearchInfo? = null) {
-        SearchHelper.checkAutoSearchInfo(this,
-            mDatabase,
-            searchInfo,
-            { _, items ->
+        SearchHelper.checkAutoSearchInfo(
+            context = this,
+            database = mDatabase,
+            searchInfo = searchInfo,
+            onItemsFound = { _, items ->
                 performSelection(
                     items,
                     {
@@ -361,11 +363,11 @@ class MagikeyboardService : InputMethodService(), KeyboardView.OnKeyboardActionL
                     }
                 )
             },
-            {
+            onItemNotFound = {
                 // Select if not found
                 launchEntrySelection(searchInfo)
             },
-            {
+            onDatabaseClosed = {
                 // Select if database not opened
                 removeEntryInfo()
                 launchEntrySelection(searchInfo)
@@ -460,34 +462,23 @@ class MagikeyboardService : InputMethodService(), KeyboardView.OnKeyboardActionL
             KeyboardEntryNotificationService.launchNotificationIfAllowed(context, entry, toast)
         }
 
-        fun performSelection(items: List<EntryInfo>,
-                             actionPopulateKeyboard: (entryInfo: EntryInfo) -> Unit,
-                             actionEntrySelection: (autoSearch: Boolean) -> Unit) {
-             if (items.size == 1) {
-                 val itemFound = items[0]
-                if (entryUUID != itemFound.id) {
-                    actionPopulateKeyboard.invoke(itemFound)
-                } else {
-                    // Force selection if magikeyboard already populated
-                    actionEntrySelection.invoke(false)
-                }
-            } else if (items.size > 1) {
-                // Select the one we want in the selection
-                actionEntrySelection.invoke(true)
-            } else {
-                // Select an arbitrary one
-                actionEntrySelection.invoke(false)
-            }
-        }
-
-        fun populateKeyboardAndMoveAppToBackground(activity: Activity,
-                                                   entry: EntryInfo,
-                                                   toast: Boolean = true) {
-            // Populate Magikeyboard with entry
-            addEntryAndLaunchNotificationIfAllowed(activity, entry, toast)
-            // Consume the selection mode
-            EntrySelectionHelper.removeModesFromIntent(activity.intent)
-            activity.moveTaskToBack(true)
+        fun performSelection(
+            items: List<EntryInfo>,
+            actionPopulateKeyboard: (entryInfo: EntryInfo) -> Unit,
+            actionEntrySelection: (autoSearch: Boolean) -> Unit
+        ) {
+            EntrySelectionHelper.performSelection(
+                items = items,
+                actionPopulateCredentialProvider = { itemFound ->
+                    if (entryUUID != itemFound.id) {
+                        actionPopulateKeyboard.invoke(itemFound)
+                    } else {
+                        // Force selection if magikeyboard already populated
+                        actionEntrySelection.invoke(false)
+                    }
+                },
+                actionEntrySelection = actionEntrySelection
+            )
         }
     }
 }

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/PasskeyProviderService.kt

@@ -0,0 +1,372 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey
+
+import android.graphics.BlendMode
+import android.graphics.drawable.Icon
+import android.os.Build
+import android.os.CancellationSignal
+import android.os.OutcomeReceiver
+import android.util.Log
+import androidx.annotation.RequiresApi
+import androidx.credentials.exceptions.ClearCredentialException
+import androidx.credentials.exceptions.CreateCredentialException
+import androidx.credentials.exceptions.CreateCredentialUnknownException
+import androidx.credentials.exceptions.GetCredentialException
+import androidx.credentials.exceptions.GetCredentialUnknownException
+import androidx.credentials.provider.BeginCreateCredentialRequest
+import androidx.credentials.provider.BeginCreateCredentialResponse
+import androidx.credentials.provider.BeginCreatePublicKeyCredentialRequest
+import androidx.credentials.provider.BeginGetCredentialRequest
+import androidx.credentials.provider.BeginGetCredentialResponse
+import androidx.credentials.provider.BeginGetPublicKeyCredentialOption
+import androidx.credentials.provider.CreateEntry
+import androidx.credentials.provider.CredentialEntry
+import androidx.credentials.provider.CredentialProviderService
+import androidx.credentials.provider.ProviderClearCredentialStateRequest
+import androidx.credentials.provider.PublicKeyCredentialEntry
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.buildIcon
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.activity.PasskeyLauncherActivity
+import com.kunzisoft.keepass.credentialprovider.passkey.data.PublicKeyCredentialCreationOptions
+import com.kunzisoft.keepass.credentialprovider.passkey.data.PublicKeyCredentialRequestOptions
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.database.DatabaseTaskProvider
+import com.kunzisoft.keepass.database.exception.RegisterInReadOnlyDatabaseException
+import com.kunzisoft.keepass.database.helper.SearchHelper
+import com.kunzisoft.keepass.model.SearchInfo
+import com.kunzisoft.keepass.settings.PreferencesUtil.isPasskeyAutoSelectEnable
+import com.kunzisoft.keepass.view.toastError
+import java.io.IOException
+import java.time.Instant
+
+@RequiresApi(Build.VERSION_CODES.UPSIDE_DOWN_CAKE)
+class PasskeyProviderService : CredentialProviderService() {
+
+    private var mDatabaseTaskProvider: DatabaseTaskProvider? = null
+    private var mDatabase: ContextualDatabase? = null
+    private lateinit var defaultIcon: Icon
+    private var isAutoSelectAllowed: Boolean = false
+
+    override fun onCreate() {
+        super.onCreate()
+
+        mDatabaseTaskProvider = DatabaseTaskProvider(this)
+        mDatabaseTaskProvider?.registerProgressTask()
+        mDatabaseTaskProvider?.onDatabaseRetrieved = { database ->
+            this.mDatabase = database
+        }
+
+        defaultIcon = Icon.createWithResource(
+            this@PasskeyProviderService,
+            R.mipmap.ic_launcher_round
+        ).apply {
+            setTintBlendMode(BlendMode.DST)
+        }
+
+        isAutoSelectAllowed = isPasskeyAutoSelectEnable(this)
+    }
+
+    override fun onDestroy() {
+        mDatabaseTaskProvider?.unregisterProgressTask()
+        super.onDestroy()
+    }
+
+    private fun buildPasskeySearchInfo(relyingParty: String): SearchInfo {
+        return SearchInfo().apply {
+            this.relyingParty = relyingParty
+        }
+    }
+
+    override fun onBeginGetCredentialRequest(
+        request: BeginGetCredentialRequest,
+        cancellationSignal: CancellationSignal,
+        callback: OutcomeReceiver<BeginGetCredentialResponse, GetCredentialException>
+    ) {
+        Log.d(javaClass.simpleName, "onBeginGetCredentialRequest called")
+        try {
+            processGetCredentialsRequest(request) { response ->
+                callback.onResult(response)
+            }
+        } catch (e: Exception) {
+            Log.e(javaClass.simpleName, "onBeginGetCredentialRequest error", e)
+            callback.onError(GetCredentialUnknownException())
+        }
+    }
+
+    private fun processGetCredentialsRequest(
+        request: BeginGetCredentialRequest,
+        callback: (BeginGetCredentialResponse?) -> Unit
+    ) {
+        var knownOption = false
+        for (option in request.beginGetCredentialOptions) {
+            when (option) {
+                is BeginGetPublicKeyCredentialOption -> {
+                    knownOption = true
+                    populatePasskeyData(option) { listCredentials ->
+                        callback(BeginGetCredentialResponse(listCredentials))
+                    }
+                }
+            }
+        }
+        if (knownOption.not()) {
+            throw IOException("unknown type of beginGetCredentialOption")
+        }
+    }
+
+    private fun populatePasskeyData(
+        option: BeginGetPublicKeyCredentialOption,
+        callback: (List<CredentialEntry>) -> Unit
+    ) {
+
+        val passkeyEntries: MutableList<CredentialEntry> = mutableListOf()
+
+        val relyingPartyId = PublicKeyCredentialRequestOptions(option.requestJson).rpId
+        val searchInfo = buildPasskeySearchInfo(relyingPartyId)
+        Log.d(TAG, "Build passkey search for relying party $relyingPartyId")
+        SearchHelper.checkAutoSearchInfo(
+            context = this,
+            database = mDatabase,
+            searchInfo = searchInfo,
+            onItemsFound = { database, items ->
+                Log.d(TAG, "Add pending intent for passkey selection with found items")
+                for (passkeyEntry in items) {
+                    PasskeyLauncherActivity.getPendingIntent(
+                        context = applicationContext,
+                        specialMode = SpecialMode.SELECTION,
+                        nodeId = passkeyEntry.id,
+                        appOrigin = passkeyEntry.appOrigin
+                    )?.let { usagePendingIntent ->
+                        val passkey = passkeyEntry.passkey
+                        passkeyEntries.add(
+                            PublicKeyCredentialEntry(
+                                context = applicationContext,
+                                username = passkey?.username ?: "Unknown",
+                                icon = passkeyEntry.buildIcon(this@PasskeyProviderService, database)?.apply {
+                                    setTintBlendMode(BlendMode.DST)
+                                } ?: defaultIcon,
+                                pendingIntent = usagePendingIntent,
+                                beginGetPublicKeyCredentialOption = option,
+                                displayName = passkeyEntry.getVisualTitle(),
+                                isAutoSelectAllowed = isAutoSelectAllowed
+                            )
+                        )
+                    }
+                }
+                callback(passkeyEntries)
+            },
+            onItemNotFound = { _ ->
+                Log.w(TAG, "No passkey found in the database with this relying party : $relyingPartyId")
+                Log.d(TAG, "Add pending intent for passkey selection in opened database")
+                PasskeyLauncherActivity.getPendingIntent(
+                    context = applicationContext,
+                    specialMode = SpecialMode.SELECTION,
+                    searchInfo = searchInfo
+                )?.let { pendingIntent ->
+                    passkeyEntries.add(
+                        PublicKeyCredentialEntry(
+                            context = applicationContext,
+                            username = getString(R.string.passkey_database_username),
+                            displayName = getString(R.string.passkey_selection_description),
+                            icon = defaultIcon,
+                            pendingIntent = pendingIntent,
+                            beginGetPublicKeyCredentialOption = option,
+                            lastUsedTime = Instant.now(),
+                            isAutoSelectAllowed = isAutoSelectAllowed
+                        )
+                    )
+                }
+                callback(passkeyEntries)
+            },
+            onDatabaseClosed = {
+                Log.d(TAG, "Add pending intent for passkey selection in closed database")
+                // Database is locked, a public key credential entry is shown to unlock it
+                PasskeyLauncherActivity.getPendingIntent(
+                    context = applicationContext,
+                    specialMode = SpecialMode.SELECTION,
+                    searchInfo = searchInfo
+                )?.let { pendingIntent ->
+                    passkeyEntries.add(
+                        PublicKeyCredentialEntry(
+                            context = applicationContext,
+                            username = getString(R.string.passkey_database_username),
+                            displayName = getString(R.string.passkey_locked_database_description),
+                            icon = defaultIcon,
+                            pendingIntent = pendingIntent,
+                            beginGetPublicKeyCredentialOption = option,
+                            lastUsedTime = Instant.now(),
+                            isAutoSelectAllowed = isAutoSelectAllowed
+                        )
+                    )
+                }
+                callback(passkeyEntries)
+            }
+        )
+    }
+
+    override fun onBeginCreateCredentialRequest(
+        request: BeginCreateCredentialRequest,
+        cancellationSignal: CancellationSignal,
+        callback: OutcomeReceiver<BeginCreateCredentialResponse, CreateCredentialException>,
+    ) {
+        Log.d(javaClass.simpleName, "onBeginCreateCredentialRequest called")
+        try {
+            processCreateCredentialRequest(request) {
+                callback.onResult(BeginCreateCredentialResponse(it))
+            }
+        } catch (e: Exception) {
+            Log.e(javaClass.simpleName, "onBeginCreateCredentialRequest error", e)
+            toastError(e)
+            callback.onError(CreateCredentialUnknownException(e.localizedMessage))
+        }
+    }
+
+    private fun processCreateCredentialRequest(
+        request: BeginCreateCredentialRequest,
+        callback: (List<CreateEntry>) -> Unit
+    ) {
+        when (request) {
+            is BeginCreatePublicKeyCredentialRequest -> {
+                // Request is passkey type
+                handleCreatePasskeyQuery(request, callback)
+            }
+            else -> {
+                // request type not supported
+                throw IOException("unknown type of BeginCreateCredentialRequest")
+            }
+        }
+    }
+
+    private fun MutableList<CreateEntry>.addPendingIntentCreationNewEntry(
+        accountName: String,
+        searchInfo: SearchInfo?
+    ) {
+        Log.d(TAG, "Add pending intent for registration in opened database to create new item")
+        // TODO add a setting to directly store in a specific group
+        PasskeyLauncherActivity.getPendingIntent(
+            context = applicationContext,
+            specialMode = SpecialMode.REGISTRATION,
+            searchInfo = searchInfo
+        )?.let { pendingIntent ->
+            this.add(
+                CreateEntry(
+                    accountName = accountName,
+                    icon = defaultIcon,
+                    pendingIntent = pendingIntent,
+                    description = getString(R.string.passkey_creation_description)
+                )
+            )
+        }
+    }
+
+    private fun handleCreatePasskeyQuery(
+        request: BeginCreatePublicKeyCredentialRequest,
+        callback: (List<CreateEntry>) -> Unit
+    ) {
+        val databaseName = mDatabase?.name
+        val accountName =
+            if (databaseName?.isBlank() != false)
+                getString(R.string.passkey_database_username)
+            else databaseName
+        val createEntries: MutableList<CreateEntry> = mutableListOf()
+        val relyingPartyId = PublicKeyCredentialCreationOptions(
+            requestJson = request.requestJson,
+            clientDataHash = request.clientDataHash
+        ).relyingPartyEntity.id
+        val searchInfo = buildPasskeySearchInfo(relyingPartyId)
+        Log.d(TAG, "Build passkey search for relying party $relyingPartyId")
+        SearchHelper.checkAutoSearchInfo(
+            context = this,
+            database = mDatabase,
+            searchInfo = searchInfo,
+            onItemsFound = { database, items ->
+                if (database.isReadOnly) {
+                    throw RegisterInReadOnlyDatabaseException()
+                } else {
+                    // To create a new entry
+                    createEntries.addPendingIntentCreationNewEntry(accountName, searchInfo)
+                    /* TODO Overwrite
+                    // To select an existing entry and permit an overwrite
+                    Log.w(TAG, "Passkey already registered")
+                    for (entryInfo in items) {
+                        PasskeyHelper.getPendingIntent(
+                            context = applicationContext,
+                            specialMode = SpecialMode.REGISTRATION,
+                            searchInfo = searchInfo,
+                            passkeyEntryNodeId = entryInfo.id
+                        )?.let { createPendingIntent ->
+                            createEntries.add(
+                                CreateEntry(
+                                    accountName = accountName,
+                                    pendingIntent = createPendingIntent,
+                                    description = getString(
+                                        R.string.passkey_update_description,
+                                        entryInfo.passkey?.displayName
+                                    )
+                                )
+                            )
+                        }
+                    }*/
+                }
+                callback(createEntries)
+            },
+            onItemNotFound = { database ->
+                // To create a new entry
+                if (database.isReadOnly) {
+                    throw RegisterInReadOnlyDatabaseException()
+                } else {
+                    createEntries.addPendingIntentCreationNewEntry(accountName, searchInfo)
+                }
+                callback(createEntries)
+            },
+            onDatabaseClosed = {
+                // Launch the passkey launcher activity to open the database
+                Log.d(TAG, "Add pending intent for passkey registration in closed database")
+                PasskeyLauncherActivity.getPendingIntent(
+                    context = applicationContext,
+                    specialMode = SpecialMode.REGISTRATION
+                )?.let { pendingIntent ->
+                    createEntries.add(
+                        CreateEntry(
+                            accountName = accountName,
+                            icon = defaultIcon,
+                            pendingIntent = pendingIntent,
+                            description = getString(R.string.passkey_locked_database_description)
+                        )
+                    )
+                }
+                callback(createEntries)
+            }
+        )
+    }
+
+    override fun onClearCredentialStateRequest(
+        request: ProviderClearCredentialStateRequest,
+        cancellationSignal: CancellationSignal,
+        callback: OutcomeReceiver<Void?, ClearCredentialException>
+    ) {
+        // nothing to do
+    }
+
+    companion object {
+        private val TAG = PasskeyProviderService::class.java.simpleName
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/data/AndroidPrivilegedApp.kt

@@ -0,0 +1,148 @@
+/*
+ * Copyright 2025 AOSP modified by Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.data
+
+import android.os.Build
+import android.os.Parcelable
+import android.util.Log
+import kotlinx.parcelize.Parcelize
+import org.json.JSONArray
+import org.json.JSONException
+import org.json.JSONObject
+
+/**
+ * Represents an Android privileged app, based on AOSP code
+ */
+@Parcelize
+data class AndroidPrivilegedApp(
+    val packageName: String,
+    val fingerprints: Set<String>
+): Parcelable {
+
+    override fun toString(): String {
+        return "$packageName ($fingerprints)"
+    }
+
+    companion object {
+        private const val PACKAGE_NAME_KEY = "package_name"
+        private const val SIGNATURES_KEY = "signatures"
+        private const val FINGERPRINT_KEY = "cert_fingerprint_sha256"
+        private const val BUILD_KEY = "build"
+        private const val USER_DEBUG_KEY = "userdebug"
+        private const val TYPE_KEY = "type"
+        private const val APP_INFO_KEY = "info"
+        private const val ANDROID_TYPE_KEY = "android"
+        private const val USER_BUILD_TYPE = "userdebug"
+        private const val APPS_KEY = "apps"
+
+        /**
+         * Extracts a list of AndroidPrivilegedApp objects from a JSONObject.
+         */
+        @JvmStatic
+        fun extractPrivilegedApps(jsonObject: JSONObject): List<AndroidPrivilegedApp> {
+            val apps = mutableListOf<AndroidPrivilegedApp>()
+            if (!jsonObject.has(APPS_KEY)) {
+                return apps
+            }
+            val appsJsonArray = jsonObject.getJSONArray(APPS_KEY)
+            for (i in 0 until appsJsonArray.length()) {
+                try {
+                    val appJsonObject = appsJsonArray.getJSONObject(i)
+                    if (appJsonObject.getString(TYPE_KEY) != ANDROID_TYPE_KEY) {
+                        continue
+                    }
+                    if (!appJsonObject.has(APP_INFO_KEY)) {
+                        continue
+                    }
+                    apps.add(
+                        createFromJSONObject(
+                            appJsonObject.getJSONObject(APP_INFO_KEY)
+                        )
+                    )
+                } catch (e: JSONException) {
+                    Log.e(AndroidPrivilegedApp::class.simpleName, "Error parsing privileged app", e)
+                }
+            }
+            return apps
+        }
+
+        /**
+         * Creates an AndroidPrivilegedApp object from a JSONObject.
+         */
+        @JvmStatic
+        private fun createFromJSONObject(
+            appInfoJsonObject: JSONObject,
+            filterUserDebug: Boolean = true
+        ): AndroidPrivilegedApp {
+            val signaturesJson = appInfoJsonObject.getJSONArray(SIGNATURES_KEY)
+            val fingerprints = mutableSetOf<String>()
+            for (j in 0 until signaturesJson.length()) {
+                if (filterUserDebug) {
+                    if (USER_DEBUG_KEY == signaturesJson.getJSONObject(j)
+                            .optString(BUILD_KEY) && USER_BUILD_TYPE != Build.TYPE
+                    ) {
+                        continue
+                    }
+                }
+                fingerprints.add(signaturesJson.getJSONObject(j).getString(FINGERPRINT_KEY))
+            }
+            return AndroidPrivilegedApp(
+                packageName = appInfoJsonObject.getString(PACKAGE_NAME_KEY),
+                fingerprints = fingerprints
+            )
+        }
+
+        /**
+         * Creates a JSONObject from a list of AndroidPrivilegedApp objects.
+         * The structure will be similar to what `extractPrivilegedApps` expects.
+         *
+         * @param privilegedApps The list of AndroidPrivilegedApp objects.
+         * @return A JSONObject representing the list.
+         */
+        @JvmStatic
+        fun toJsonObject(privilegedApps: List<AndroidPrivilegedApp>): JSONObject {
+            val rootJsonObject = JSONObject()
+            val appsJsonArray = JSONArray()
+
+            for (app in privilegedApps) {
+                val appInfoObject = JSONObject()
+                appInfoObject.put(PACKAGE_NAME_KEY, app.packageName)
+
+                val signaturesArray = JSONArray()
+                for (fingerprint in app.fingerprints) {
+                    val signatureObject = JSONObject()
+                    signatureObject.put(FINGERPRINT_KEY, fingerprint)
+                    // If needed: signatureObject.put(BUILD_KEY, "user")
+                    signaturesArray.put(signatureObject)
+                }
+                appInfoObject.put(SIGNATURES_KEY, signaturesArray)
+
+                val appContainerObject = JSONObject()
+                appContainerObject.put(TYPE_KEY, ANDROID_TYPE_KEY)
+                appContainerObject.put(APP_INFO_KEY, appInfoObject)
+
+                appsJsonArray.put(appContainerObject)
+            }
+
+            rootJsonObject.put(APPS_KEY, appsJsonArray)
+            return rootJsonObject
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/data/AuthenticatorAssertionResponse.kt

@@ -0,0 +1,71 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.data
+
+import android.util.Log
+import androidx.credentials.exceptions.GetCredentialUnknownException
+import com.kunzisoft.encrypt.Signature
+import com.kunzisoft.encrypt.Base64Helper.Companion.b64Encode
+import org.json.JSONObject
+
+class AuthenticatorAssertionResponse(
+    private val requestOptions: PublicKeyCredentialRequestOptions,
+    private val userPresent: Boolean,
+    private val userVerified: Boolean,
+    private val backupEligibility: Boolean,
+    private val backupState: Boolean,
+    private var userHandle: String,
+    privateKey: String,
+    private val clientDataResponse: ClientDataResponse,
+) : AuthenticatorResponse {
+
+    override var clientJson = JSONObject()
+    private var authenticatorData: ByteArray = AuthenticatorData.buildAuthenticatorData(
+        relyingPartyId = requestOptions.rpId.toByteArray(),
+        userPresent = userPresent,
+        userVerified = userVerified,
+        backupEligibility = backupEligibility,
+        backupState = backupState
+    )
+    private var signature: ByteArray = byteArrayOf()
+
+    init {
+        try {
+            signature = Signature.sign(privateKey, dataToSign())
+        } catch (e: Exception) {
+            Log.e(this::class.java.simpleName, "Unable to sign: ${e.message}")
+            throw GetCredentialUnknownException("Signing failed")
+        }
+    }
+
+    private fun dataToSign(): ByteArray {
+        return authenticatorData + clientDataResponse.hashData()
+    }
+
+    override fun json(): JSONObject {
+        // https://www.w3.org/TR/webauthn-3/#authdata-flags
+        return clientJson.apply {
+            put("clientDataJSON", clientDataResponse.buildResponse())
+            put("authenticatorData", b64Encode(authenticatorData))
+            put("signature", b64Encode(signature))
+            put("userHandle", userHandle)
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/data/AuthenticatorAttestationResponse.kt

@@ -0,0 +1,89 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.data
+
+import com.kunzisoft.encrypt.Base64Helper.Companion.b64Encode
+import com.kunzisoft.keepass.utils.UUIDUtils.asBytes
+import org.json.JSONArray
+import org.json.JSONObject
+import java.util.UUID
+
+class AuthenticatorAttestationResponse(
+    private val requestOptions: PublicKeyCredentialCreationOptions,
+    private val credentialId: ByteArray,
+    private val credentialPublicKey: ByteArray,
+    private val userPresent: Boolean,
+    private val userVerified: Boolean,
+    private val backupEligibility: Boolean,
+    private val backupState: Boolean,
+    private val publicKeyTypeId: Long,
+    private val publicKeyCbor: ByteArray,
+    private val clientDataResponse: ClientDataResponse,
+) : AuthenticatorResponse {
+
+    override var clientJson = JSONObject()
+    var attestationObject: ByteArray
+
+    init {
+        attestationObject = defaultAttestationObject()
+    }
+
+    private fun buildAuthData(): ByteArray {
+        return AuthenticatorData.buildAuthenticatorData(
+            relyingPartyId = requestOptions.relyingPartyEntity.id.toByteArray(),
+            userPresent = userPresent,
+            userVerified = userVerified,
+            backupEligibility = backupEligibility,
+            backupState = backupState,
+            attestedCredentialData = true
+        ) + AAGUID +
+            //credIdLen
+            byteArrayOf((credentialId.size shr 8).toByte(), credentialId.size.toByte()) +
+            credentialId +
+            credentialPublicKey
+    }
+
+    internal fun defaultAttestationObject(): ByteArray {
+        // https://www.w3.org/TR/webauthn-3/#attestation-object
+        val ao = mutableMapOf<String, Any>()
+        ao.put("fmt", "none")
+        ao.put("attStmt", emptyMap<Any, Any>())
+        ao.put("authData", buildAuthData())
+        return Cbor().encode(ao)
+    }
+
+    override fun json(): JSONObject {
+        // See AuthenticatorAttestationResponseJSON at
+        // https://w3c.github.io/webauthn/#ref-for-dom-publickeycredential-tojson
+        return clientJson.apply {
+            put("clientDataJSON", clientDataResponse.buildResponse())
+            put("authenticatorData", b64Encode(buildAuthData()))
+            put("transports", JSONArray(listOf("internal", "hybrid")))
+            put("publicKey", b64Encode(publicKeyCbor))
+            put("publicKeyAlgorithm", publicKeyTypeId)
+            put("attestationObject", b64Encode(attestationObject))
+        }
+    }
+
+    companion object {
+        // Authenticator Attestation Global Unique Identifier
+        private val AAGUID: ByteArray = UUID.fromString("eaecdef2-1c31-5634-8639-f1cbd9c00a08").asBytes()
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/data/AuthenticatorData.kt

@@ -0,0 +1,57 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.data
+
+import com.kunzisoft.encrypt.HashManager
+
+class AuthenticatorData {
+
+    companion object {
+        fun buildAuthenticatorData(
+            relyingPartyId: ByteArray,
+            userPresent: Boolean,
+            userVerified: Boolean,
+            backupEligibility: Boolean,
+            backupState: Boolean,
+            attestedCredentialData: Boolean = false
+        ): ByteArray {
+            // https://www.w3.org/TR/webauthn-3/#table-authData
+            var flags = 0
+            if (userPresent)
+                flags = flags or 0x01
+            // bit at index 1 is reserved
+            if (userVerified)
+                flags = flags or 0x04
+            if (backupEligibility)
+                flags = flags or 0x08
+            if (backupState)
+                flags = flags or 0x10
+            // bit at index 5 is reserved
+            if (attestedCredentialData) {
+                flags = flags or 0x40
+            }
+            // bit at index 7: Extension data included == false
+
+            return HashManager.hashSha256(relyingPartyId) +
+                    byteArrayOf(flags.toByte()) +
+                    byteArrayOf(0, 0, 0, 0)
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/data/AuthenticatorResponse.kt

@@ -0,0 +1,28 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.data
+
+import org.json.JSONObject
+
+interface AuthenticatorResponse {
+    var clientJson: JSONObject
+
+    fun json(): JSONObject
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/data/Cbor.kt

@@ -0,0 +1,208 @@
+/*
+ * Copyright 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.data
+
+import androidx.annotation.RestrictTo
+
+@RestrictTo(RestrictTo.Scope.LIBRARY)
+class Cbor {
+    data class Item(val item: Any, val len: Int)
+
+    data class Arg(val arg: Long, val len: Int)
+
+    val TYPE_UNSIGNED_INT = 0x00
+    val TYPE_NEGATIVE_INT = 0x01
+    val TYPE_BYTE_STRING = 0x02
+    val TYPE_TEXT_STRING = 0x03
+    val TYPE_ARRAY = 0x04
+    val TYPE_MAP = 0x05
+    val TYPE_TAG = 0x06
+    val TYPE_FLOAT = 0x07
+
+    fun decode(data: ByteArray): Any {
+        val ret = parseItem(data, 0)
+        return ret.item
+    }
+
+    fun encode(data: Any): ByteArray {
+        if (data is Number) {
+            if (data is Double) {
+                throw IllegalArgumentException("Don't support doubles yet")
+            } else {
+                val value = data.toLong()
+                if (value >= 0) {
+                    return createArg(TYPE_UNSIGNED_INT, value)
+                } else {
+                    return createArg(TYPE_NEGATIVE_INT, -1 - value)
+                }
+            }
+        }
+        if (data is ByteArray) {
+            return createArg(TYPE_BYTE_STRING, data.size.toLong()) + data
+        }
+        if (data is String) {
+            return createArg(TYPE_TEXT_STRING, data.length.toLong()) + data.encodeToByteArray()
+        }
+        if (data is List<*>) {
+            var ret = createArg(TYPE_ARRAY, data.size.toLong())
+            for (i in data) {
+                ret += encode(i!!)
+            }
+            return ret
+        }
+        if (data is Map<*, *>) {
+            // See:
+            // https://fidoalliance.org/specs/fido-v2.1-ps-20210615/fido-client-to-authenticator-protocol-v2.1-ps-20210615.html#ctap2-canonical-cbor-encoding-form
+            var ret = createArg(TYPE_MAP, data.size.toLong())
+            var byteMap: MutableMap<ByteArray, ByteArray> = mutableMapOf()
+            for (i in data) {
+                // Convert to byte arrays so we can sort them.
+                byteMap.put(encode(i.key!!), encode(i.value!!))
+            }
+
+            var keysList = ArrayList<ByteArray>(byteMap.keys)
+            keysList.sortedWith(
+                Comparator<ByteArray> { a, b ->
+                    // If two keys have different lengths, the shorter one sorts earlier;
+                    // If two keys have the same length, the one with the lower value in (byte-wise)
+                    // lexical order sorts earlier.
+                    var aBytes = byteMap.get(a)!!
+                    var bBytes = byteMap.get(b)!!
+                    when {
+                        a.size > b.size -> 1
+                        a.size < b.size -> -1
+                        aBytes.size > bBytes.size -> 1
+                        aBytes.size < bBytes.size -> -1
+                        else -> 0
+                    }
+                }
+            )
+
+            for (key in keysList) {
+                ret += key
+                ret += byteMap.get(key)!!
+            }
+            return ret
+        }
+        throw IllegalArgumentException("Bad type")
+    }
+
+    private fun getType(data: ByteArray, offset: Int): Int {
+        val d = data[offset].toInt()
+        return (d and 0xFF) shr 5
+    }
+
+    private fun getArg(data: ByteArray, offset: Int): Arg {
+        val arg = data[offset].toLong() and 0x1F
+        if (arg < 24) {
+            return Arg(arg, 1)
+        }
+        if (arg == 24L) {
+            return Arg(data[offset + 1].toLong() and 0xFF, 2)
+        }
+        if (arg == 25L) {
+            var ret = (data[offset + 1].toLong() and 0xFF) shl 8
+            ret = ret or (data[offset + 2].toLong() and 0xFF)
+            return Arg(ret, 3)
+        }
+        if (arg == 26L) {
+            var ret = (data[offset + 1].toLong() and 0xFF) shl 24
+            ret = ret or ((data[offset + 2].toLong() and 0xFF) shl 16)
+            ret = ret or ((data[offset + 3].toLong() and 0xFF) shl 8)
+            ret = ret or (data[offset + 4].toLong() and 0xFF)
+            return Arg(ret, 5)
+        }
+        throw IllegalArgumentException("Bad arg")
+    }
+
+    private fun parseItem(data: ByteArray, offset: Int): Item {
+        val itemType = getType(data, offset)
+        val arg = getArg(data, offset)
+        println("Type $itemType ${arg.arg} ${arg.len}")
+
+        when (itemType) {
+            TYPE_UNSIGNED_INT -> {
+                return Item(arg.arg, arg.len)
+            }
+            TYPE_NEGATIVE_INT -> {
+                return Item(-1 - arg.arg, arg.len)
+            }
+            TYPE_BYTE_STRING -> {
+                val ret =
+                    data.sliceArray(offset + arg.len.toInt() until offset + arg.len.toInt() + arg.arg.toInt())
+                return Item(ret, arg.len + arg.arg.toInt())
+            }
+            TYPE_TEXT_STRING -> {
+                val ret =
+                    data.sliceArray(offset + arg.len.toInt() until offset + arg.len.toInt() + arg.arg.toInt())
+                return Item(ret.toString(Charsets.UTF_8), arg.len + arg.arg.toInt())
+            }
+            TYPE_ARRAY -> {
+                val ret = mutableListOf<Any>()
+                var consumed = arg.len
+                for (i in 0 until arg.arg.toInt()) {
+                    val item = parseItem(data, offset + consumed)
+                    ret.add(item.item)
+                    consumed += item.len
+                }
+                return Item(ret.toList(), consumed)
+            }
+            TYPE_MAP -> {
+                val ret = mutableMapOf<Any, Any>()
+                var consumed = arg.len
+                for (i in 0 until arg.arg.toInt()) {
+                    val key = parseItem(data, offset + consumed)
+                    consumed += key.len
+                    val value = parseItem(data, offset + consumed)
+                    consumed += value.len
+                    ret[key.item] = value.item
+                }
+                return Item(ret.toMap(), consumed)
+            }
+            else -> {
+                throw IllegalArgumentException("Bad type")
+            }
+        }
+    }
+
+    private fun createArg(type: Int, arg: Long): ByteArray {
+        val t = type shl 5
+        val a = arg.toInt()
+        if (arg < 24) {
+            return byteArrayOf(((t or a) and 0xFF).toByte())
+        }
+        if (arg <= 0xFF) {
+            return byteArrayOf(((t or 24) and 0xFF).toByte(), (a and 0xFF).toByte())
+        }
+        if (arg <= 0xFFFF) {
+            return byteArrayOf(
+                ((t or 25) and 0xFF).toByte(),
+                ((a shr 8) and 0xFF).toByte(),
+                (a and 0xFF).toByte()
+            )
+        }
+        if (arg <= 0xFFFFFFFF) {
+            return byteArrayOf(
+                ((t or 26) and 0xFF).toByte(),
+                ((a shr 24) and 0xFF).toByte(),
+                ((a shr 16) and 0xFF).toByte(),
+                ((a shr 8) and 0xFF).toByte(),
+                (a and 0xFF).toByte()
+            )
+        }
+        throw IllegalArgumentException("bad Arg")
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/data/ClientDataBuildResponse.kt

@@ -0,0 +1,63 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.data
+
+import com.kunzisoft.encrypt.HashManager
+import com.kunzisoft.encrypt.Base64Helper.Companion.b64Encode
+import org.json.JSONObject
+
+open class ClientDataBuildResponse(
+    type: Type,
+    challenge: ByteArray,
+    origin: String,
+    crossOrigin: Boolean? = false,
+    topOrigin: String? = null,
+): AuthenticatorResponse, ClientDataResponse {
+    override var clientJson = JSONObject()
+
+    init {
+        // https://w3c.github.io/webauthn/#client-data
+        clientJson.put("type", type.value)
+        clientJson.put("challenge", b64Encode(challenge))
+        clientJson.put("origin", origin)
+        crossOrigin?.let {
+            clientJson.put("crossOrigin", it)
+        }
+        topOrigin?.let {
+            clientJson.put("topOrigin", it)
+        }
+    }
+
+    override fun json(): JSONObject {
+        return clientJson
+    }
+
+    enum class Type(val value: String) {
+        GET("webauthn.get"), CREATE("webauthn.create")
+    }
+
+    override fun buildResponse(): String {
+        return b64Encode(json().toString().toByteArray())
+    }
+
+    override fun hashData(): ByteArray {
+        return HashManager.hashSha256(json().toString().toByteArray())
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/data/ClientDataDefinedResponse.kt

@@ -0,0 +1,37 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.data
+
+open class ClientDataDefinedResponse(
+    private val clientDataHash: ByteArray
+): ClientDataResponse {
+
+    override fun hashData(): ByteArray {
+        return clientDataHash
+    }
+
+    override fun buildResponse(): String {
+        return CLIENT_DATA_JSON_PRIVILEGED
+    }
+
+    companion object {
+        private const val CLIENT_DATA_JSON_PRIVILEGED = "<placeholder>"
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/data/ClientDataResponse.kt

@@ -0,0 +1,25 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.data
+
+interface ClientDataResponse {
+    fun hashData(): ByteArray
+    fun buildResponse(): String
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/data/FidoDataTypes.kt

@@ -0,0 +1,80 @@
+/*
+ * Copyright 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.kunzisoft.keepass.credentialprovider.passkey.data
+
+data class PublicKeyCredentialRpEntity(val name: String, val id: String)
+
+data class PublicKeyCredentialUserEntity(
+    val name: String,
+    val id: ByteArray,
+    val displayName: String
+) {
+    override fun equals(other: Any?): Boolean {
+        if (this === other) return true
+        if (javaClass != other?.javaClass) return false
+
+        other as PublicKeyCredentialUserEntity
+
+        if (name != other.name) return false
+        if (!id.contentEquals(other.id)) return false
+        if (displayName != other.displayName) return false
+
+        return true
+    }
+
+    override fun hashCode(): Int {
+        var result = name.hashCode()
+        result = 31 * result + id.contentHashCode()
+        result = 31 * result + displayName.hashCode()
+        return result
+    }
+}
+
+data class PublicKeyCredentialParameters(val type: String, val alg: Long)
+
+data class PublicKeyCredentialDescriptor(
+    val type: String,
+    val id: ByteArray,
+    val transports: List<String>
+) {
+    override fun equals(other: Any?): Boolean {
+        if (this === other) return true
+        if (javaClass != other?.javaClass) return false
+
+        other as PublicKeyCredentialDescriptor
+
+        if (type != other.type) return false
+        if (!id.contentEquals(other.id)) return false
+        if (transports != other.transports) return false
+
+        return true
+    }
+
+    override fun hashCode(): Int {
+        var result = type.hashCode()
+        result = 31 * result + id.contentHashCode()
+        result = 31 * result + transports.hashCode()
+        return result
+    }
+}
+
+data class AuthenticatorSelectionCriteria(
+    val authenticatorAttachment: String,
+    val residentKey: String,
+    val requireResidentKey: Boolean = false,
+    val userVerification: String = "preferred"
+)

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/data/FidoPublicKeyCredential.kt

@@ -0,0 +1,50 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.data
+
+import org.json.JSONObject
+
+class FidoPublicKeyCredential(
+    val id: String,
+    val response: AuthenticatorResponse,
+    val authenticatorAttachment: String
+) {
+
+    fun json(): String {
+        // see at https://www.w3.org/TR/webauthn-3/#sctn-authenticator-credential-properties-extension
+        val discoverableCredential = true
+        val rk = JSONObject()
+        rk.put("rk", discoverableCredential)
+        val credProps = JSONObject()
+        credProps.put("credProps", rk)
+
+        // See RegistrationResponseJSON at
+        // https://w3c.github.io/webauthn/#ref-for-dom-publickeycredential-tojson
+        val ret = JSONObject()
+        ret.put("id", id)
+        ret.put("rawId", id)
+        ret.put("type", "public-key")
+        ret.put("authenticatorAttachment", authenticatorAttachment)
+        ret.put("response", response.json())
+        ret.put("clientExtensionResults", JSONObject()) // TODO credProps
+
+        return ret.toString()
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/data/PublicKeyCredentialCreationOptions.kt

@@ -0,0 +1,73 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.data
+
+import com.kunzisoft.encrypt.Base64Helper
+import org.json.JSONObject
+
+class PublicKeyCredentialCreationOptions(
+    requestJson: String,
+    var clientDataHash: ByteArray?
+) {
+    val json: JSONObject = JSONObject(requestJson)
+
+    val relyingPartyEntity: PublicKeyCredentialRpEntity
+    val userEntity: PublicKeyCredentialUserEntity
+    val challenge: ByteArray
+    val pubKeyCredParams: List<PublicKeyCredentialParameters>
+
+    var timeout: Long
+    var excludeCredentials: List<PublicKeyCredentialDescriptor>
+    var authenticatorSelection: AuthenticatorSelectionCriteria
+    var attestation: String
+
+    init {
+        val rpJson = json.getJSONObject("rp")
+        relyingPartyEntity = PublicKeyCredentialRpEntity(rpJson.getString("name"), rpJson.getString("id"))
+        val rpUser = json.getJSONObject("user")
+        val userId = Base64Helper.b64Decode(rpUser.getString("id"))
+        userEntity =
+            PublicKeyCredentialUserEntity(
+                rpUser.getString("name"),
+                userId,
+                rpUser.getString("displayName")
+            )
+        challenge = Base64Helper.b64Decode(json.getString("challenge"))
+        val pubKeyCredParamsJson = json.getJSONArray("pubKeyCredParams")
+        val pubKeyCredParamsTmp: MutableList<PublicKeyCredentialParameters> = mutableListOf()
+        for (i in 0 until pubKeyCredParamsJson.length()) {
+            val e = pubKeyCredParamsJson.getJSONObject(i)
+            pubKeyCredParamsTmp.add(
+                PublicKeyCredentialParameters(e.getString("type"), e.getLong("alg"))
+            )
+        }
+        pubKeyCredParams = pubKeyCredParamsTmp.toList()
+
+        timeout = json.optLong("timeout", 0)
+        // TODO: Fix excludeCredentials and authenticatorSelection
+        excludeCredentials = emptyList()
+        authenticatorSelection = AuthenticatorSelectionCriteria("platform", "required")
+        attestation = json.optString("attestation", "none")
+    }
+
+    companion object {
+        private val TAG = PublicKeyCredentialCreationOptions::class.simpleName
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/data/PublicKeyCredentialCreationParameters.kt

@@ -0,0 +1,51 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.data
+
+import java.security.KeyPair
+
+data class PublicKeyCredentialCreationParameters(
+        val publicKeyCredentialCreationOptions: PublicKeyCredentialCreationOptions,
+        val credentialId: ByteArray,
+        val signatureKey: Pair<KeyPair, Long>,
+        val clientDataResponse: ClientDataResponse
+) {
+    override fun equals(other: Any?): Boolean {
+        if (this === other) return true
+        if (javaClass != other?.javaClass) return false
+
+        other as PublicKeyCredentialCreationParameters
+
+        if (publicKeyCredentialCreationOptions != other.publicKeyCredentialCreationOptions) return false
+        if (!credentialId.contentEquals(other.credentialId)) return false
+        if (signatureKey != other.signatureKey) return false
+        if (clientDataResponse != other.clientDataResponse) return false
+
+        return true
+    }
+
+    override fun hashCode(): Int {
+        var result = publicKeyCredentialCreationOptions.hashCode()
+        result = 31 * result + credentialId.contentHashCode()
+        result = 31 * result + signatureKey.hashCode()
+        result = 31 * result + clientDataResponse.hashCode()
+        return result
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/data/PublicKeyCredentialRequestOptions.kt

@@ -0,0 +1,31 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.data
+
+import com.kunzisoft.encrypt.Base64Helper
+import org.json.JSONObject
+
+class PublicKeyCredentialRequestOptions(requestJson: String) {
+    val json: JSONObject = JSONObject(requestJson)
+    val challenge: ByteArray = Base64Helper.b64Decode(json.getString("challenge"))
+    val timeout: Long = json.optLong("timeout", 0)
+    val rpId: String = json.optString("rpId", "")
+    val userVerification: String = json.optString("userVerification", "preferred")
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/data/PublicKeyCredentialUsageParameters.kt

@@ -0,0 +1,28 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.data
+
+import com.kunzisoft.keepass.model.AppOrigin
+
+data class PublicKeyCredentialUsageParameters(
+        val publicKeyCredentialRequestOptions: PublicKeyCredentialRequestOptions,
+        val clientDataResponse: ClientDataResponse,
+        var appOrigin: AppOrigin
+)

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/util/PasskeyHelper.kt

@@ -0,0 +1,604 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.util
+
+import android.app.Activity
+import android.content.Context
+import android.content.Intent
+import android.os.Build
+import android.os.Bundle
+import android.security.keystore.KeyGenParameterSpec
+import android.security.keystore.KeyProperties
+import android.util.Log
+import android.widget.Toast
+import androidx.annotation.RequiresApi
+import androidx.credentials.CreatePublicKeyCredentialRequest
+import androidx.credentials.CreatePublicKeyCredentialResponse
+import androidx.credentials.GetPublicKeyCredentialOption
+import androidx.credentials.PublicKeyCredential
+import androidx.credentials.exceptions.CreateCredentialUnknownException
+import androidx.credentials.exceptions.GetCredentialUnknownException
+import androidx.credentials.provider.CallingAppInfo
+import androidx.credentials.provider.PendingIntentHandler
+import androidx.credentials.provider.ProviderCreateCredentialRequest
+import androidx.credentials.provider.ProviderGetCredentialRequest
+import com.kunzisoft.encrypt.Base64Helper.Companion.b64Encode
+import com.kunzisoft.encrypt.Signature
+import com.kunzisoft.encrypt.Signature.getApplicationFingerprints
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.addNodeId
+import com.kunzisoft.keepass.credentialprovider.passkey.data.AuthenticatorAssertionResponse
+import com.kunzisoft.keepass.credentialprovider.passkey.data.AuthenticatorAttestationResponse
+import com.kunzisoft.keepass.credentialprovider.passkey.data.Cbor
+import com.kunzisoft.keepass.credentialprovider.passkey.data.ClientDataBuildResponse
+import com.kunzisoft.keepass.credentialprovider.passkey.data.ClientDataDefinedResponse
+import com.kunzisoft.keepass.credentialprovider.passkey.data.ClientDataResponse
+import com.kunzisoft.keepass.credentialprovider.passkey.data.FidoPublicKeyCredential
+import com.kunzisoft.keepass.credentialprovider.passkey.data.PublicKeyCredentialCreationOptions
+import com.kunzisoft.keepass.credentialprovider.passkey.data.PublicKeyCredentialCreationParameters
+import com.kunzisoft.keepass.credentialprovider.passkey.data.PublicKeyCredentialRequestOptions
+import com.kunzisoft.keepass.credentialprovider.passkey.data.PublicKeyCredentialUsageParameters
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PrivilegedAllowLists.getOriginFromPrivilegedAllowLists
+import com.kunzisoft.keepass.model.AndroidOrigin
+import com.kunzisoft.keepass.model.AppOrigin
+import com.kunzisoft.keepass.model.EntryInfo
+import com.kunzisoft.keepass.model.Passkey
+import com.kunzisoft.keepass.utils.AppUtil
+import com.kunzisoft.keepass.utils.StringUtil.toHexString
+import com.kunzisoft.keepass.utils.getParcelableExtraCompat
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.withContext
+import java.io.IOException
+import java.security.KeyStore
+import java.security.MessageDigest
+import java.security.SecureRandom
+import java.time.Instant
+import java.util.UUID
+import javax.crypto.KeyGenerator
+import javax.crypto.Mac
+import javax.crypto.SecretKey
+
+/**
+ * Utility class to manage the passkey elements,
+ * allows to add and retrieve intent values with preconfigured keys,
+ * and makes it easy to create creation and usage requests
+ */
+@RequiresApi(Build.VERSION_CODES.UPSIDE_DOWN_CAKE)
+object PasskeyHelper {
+
+    private const val EXTRA_PASSKEY = "com.kunzisoft.keepass.passkey.extra.passkey"
+
+    private const val HMAC_TYPE = "HmacSHA256"
+
+    private const val EXTRA_APP_ORIGIN = "com.kunzisoft.keepass.extra.appOrigin"
+    private const val EXTRA_TIMESTAMP = "com.kunzisoft.keepass.extra.timestamp"
+    private const val EXTRA_AUTHENTICATION_CODE = "com.kunzisoft.keepass.extra.authenticationCode"
+
+    private const val SEPARATOR = "_"
+
+    private const val NAME_OF_HMAC_KEY = "KeePassDXCredentialProviderHMACKey"
+
+    private const val KEYSTORE_TYPE = "AndroidKeyStore"
+
+    private val PLACEHOLDER_FOR_NEW_NODE_ID = "0".repeat(32)
+
+    private val REGEX_TIMESTAMP = "[0-9]{10}".toRegex()
+    private val REGEX_AUTHENTICATION_CODE = "[A-F0-9]{64}".toRegex() // 256 bits = 64 hex chars
+
+    private const val MAX_DIFF_IN_SECONDS = 60
+
+    private val internalSecureRandom: SecureRandom = SecureRandom()
+
+    /**
+     * Add an authentication code generated by an entry to the intent
+     */
+    fun Intent.addAuthCode(passkeyEntryNodeId: UUID? = null) {
+        putExtras(Bundle().apply {
+            val timestamp = Instant.now().epochSecond
+            putString(EXTRA_TIMESTAMP, timestamp.toString())
+            putString(
+                EXTRA_AUTHENTICATION_CODE,
+                generatedAuthenticationCode(
+                    passkeyEntryNodeId, timestamp
+                ).toHexString()
+            )
+        })
+    }
+
+    /**
+     * Add the passkey to the intent
+     */
+    fun Intent.addPasskey(passkey: Passkey?) {
+        passkey?.let {
+            putExtra(EXTRA_PASSKEY, passkey)
+        }
+    }
+
+    /**
+     * Retrieve the passkey from the intent
+     */
+    fun Intent.retrievePasskey(): Passkey? {
+        return this.getParcelableExtraCompat(EXTRA_PASSKEY)
+    }
+
+    /**
+     * Remove the passkey from the intent
+     */
+    fun Intent.removePasskey() {
+        return this.removeExtra(EXTRA_PASSKEY)
+    }
+
+    /**
+     * Add the app origin to the intent
+     */
+    fun Intent.addAppOrigin(appOrigin: AppOrigin?) {
+        appOrigin?.let {
+            putExtra(EXTRA_APP_ORIGIN, appOrigin)
+        }
+    }
+
+    /**
+     * Retrieve the app origin from the intent
+     */
+    fun Intent.retrieveAppOrigin(): AppOrigin? {
+        return this.getParcelableExtraCompat(EXTRA_APP_ORIGIN)
+    }
+
+    /**
+     * Remove the app origin from the intent
+     */
+    fun Intent.removeAppOrigin() {
+        return this.removeExtra(EXTRA_APP_ORIGIN)
+    }
+
+    /**
+     * Build the Passkey response for one entry
+     */
+    fun Activity.buildPasskeyResponseAndSetResult(
+        entryInfo: EntryInfo,
+        extras: Bundle? = null
+    ) {
+        try {
+            entryInfo.passkey?.let { passkey ->
+                val mReplyIntent = Intent()
+                Log.d(javaClass.name, "Success Passkey manual selection")
+                mReplyIntent.addPasskey(passkey)
+                mReplyIntent.addAppOrigin(entryInfo.appOrigin)
+                mReplyIntent.addNodeId(entryInfo.id)
+                extras?.let {
+                    mReplyIntent.putExtras(it)
+                }
+                setResult(Activity.RESULT_OK, mReplyIntent)
+            } ?: run {
+                throw IOException("No passkey found")
+            }
+        } catch (e: Exception) {
+            Log.e(javaClass.name, "Unable to add the passkey as result", e)
+            Toast.makeText(
+                this,
+                getString(R.string.error_passkey_result),
+                Toast.LENGTH_SHORT
+            ).show()
+            setResult(Activity.RESULT_CANCELED)
+        }
+    }
+
+    /**
+     * Check the timestamp and authentication code transmitted via PendingIntent
+     */
+    fun checkSecurity(intent: Intent, nodeId: UUID?) {
+        val timestampString = intent.getStringExtra(EXTRA_TIMESTAMP)
+        if (timestampString.isNullOrEmpty())
+            throw CreateCredentialUnknownException("Timestamp null")
+        if (timestampString.matches(REGEX_TIMESTAMP).not()) {
+            throw CreateCredentialUnknownException("Timestamp not valid")
+        }
+        val timestamp = timestampString.toLong()
+        val diff = Instant.now().epochSecond - timestamp
+        if (diff < 0 || diff > MAX_DIFF_IN_SECONDS) {
+            throw CreateCredentialUnknownException("Out of time")
+        }
+        verifyAuthenticationCode(
+            intent.getStringExtra(EXTRA_AUTHENTICATION_CODE),
+            generatedAuthenticationCode(nodeId, timestamp)
+        )
+    }
+
+    /**
+     * Verify the authentication code from the encrypted message received from the intent
+     */
+    private fun verifyAuthenticationCode(
+        valueToCheck: String?,
+        authenticationCode: ByteArray
+    ) {
+        if (valueToCheck.isNullOrEmpty())
+            throw CreateCredentialUnknownException("Authentication code empty")
+        if (valueToCheck.matches(REGEX_AUTHENTICATION_CODE).not())
+            throw CreateCredentialUnknownException("Authentication not valid")
+        if (MessageDigest.isEqual(authenticationCode, generateAuthenticationCode(valueToCheck)))
+            throw CreateCredentialUnknownException("Authentication code incorrect")
+    }
+
+    /**
+     * Generate the authentication code base on the entry [nodeId] and [timestamp]
+     */
+    private fun generatedAuthenticationCode(nodeId: UUID?, timestamp: Long): ByteArray {
+        return generateAuthenticationCode(
+            (nodeId?.toString() ?: PLACEHOLDER_FOR_NEW_NODE_ID) + SEPARATOR + timestamp.toString()
+        )
+    }
+
+    /**
+     * Generate the authentication code base on the entry [message]
+     */
+    private fun generateAuthenticationCode(message: String): ByteArray {
+        val keyStore = KeyStore.getInstance(KEYSTORE_TYPE)
+        keyStore.load(null)
+        val hmacKey = try {
+            keyStore.getKey(NAME_OF_HMAC_KEY, null) as SecretKey
+        } catch (_: Exception) {
+            // key not found
+            generateKey()
+        }
+
+        val mac = Mac.getInstance(HMAC_TYPE)
+        mac.init(hmacKey)
+        val authenticationCode = mac.doFinal(message.toByteArray())
+        return authenticationCode
+    }
+
+    /**
+     * Generate the HMAC key if cannot be found in the KeyStore
+     */
+    private fun generateKey(): SecretKey? {
+        val keyGenerator = KeyGenerator.getInstance(
+            KeyProperties.KEY_ALGORITHM_HMAC_SHA256, KEYSTORE_TYPE
+        )
+        val keySizeInBits = 128
+        keyGenerator.init(
+            KeyGenParameterSpec.Builder(NAME_OF_HMAC_KEY, KeyProperties.PURPOSE_SIGN)
+                .setKeySize(keySizeInBits)
+                .build()
+        )
+        val key = keyGenerator.generateKey()
+        return key
+    }
+
+    /**
+     * Retrieve the [PublicKeyCredentialCreationOptions] from the intent
+     */
+    fun ProviderCreateCredentialRequest.retrievePasskeyCreationComponent(): PublicKeyCredentialCreationOptions {
+        val request = this
+        if (request.callingRequest !is CreatePublicKeyCredentialRequest) {
+            throw CreateCredentialUnknownException("callingRequest is of wrong type: ${request.callingRequest.type}")
+        }
+        val createPublicKeyCredentialRequest = request.callingRequest as CreatePublicKeyCredentialRequest
+        return PublicKeyCredentialCreationOptions(
+            requestJson = createPublicKeyCredentialRequest.requestJson,
+            clientDataHash = createPublicKeyCredentialRequest.clientDataHash
+        )
+    }
+
+    /**
+     * Retrieve the [GetPublicKeyCredentialOption] from the intent
+     */
+    fun ProviderGetCredentialRequest.retrievePasskeyUsageComponent(): GetPublicKeyCredentialOption {
+        val request = this
+        if (request.credentialOptions.size != 1) {
+            throw GetCredentialUnknownException("not exact one credentialOption")
+        }
+        if (request.credentialOptions[0] !is GetPublicKeyCredentialOption) {
+            throw CreateCredentialUnknownException("credentialOptions is of wrong type: ${request.credentialOptions[0]}")
+        }
+        return request.credentialOptions[0] as GetPublicKeyCredentialOption
+    }
+
+    /**
+     * Utility method to retrieve the origin asynchronously,
+     * checks for the presence of the application in the privilege lists
+     *
+     * @param providedClientDataHash Client data hash precalculated by the system
+     * @param callingAppInfo CallingAppInfo to verify and retrieve the specific Origin
+     * @param context Context for file operations.
+     * call [onOriginRetrieved] if the origin is already calculated by the system and in the privileged list, return the clientDataHash
+     * call [onOriginNotRetrieved] if the origin is not retrieved from the system, return a new Android Origin
+     */
+    suspend fun getOrigin(
+        providedClientDataHash: ByteArray?,
+        callingAppInfo: CallingAppInfo?,
+        context: Context,
+        onOriginRetrieved: suspend (appOrigin: AppOrigin, clientDataHash: ByteArray) -> Unit,
+        onOriginNotRetrieved: suspend (appOrigin: AppOrigin, androidOriginString: String) -> Unit
+    ) {
+        if (callingAppInfo == null) {
+            throw SecurityException("Calling app info cannot be retrieved")
+        }
+        withContext(Dispatchers.IO) {
+
+            // For trusted browsers like Chrome and Firefox
+            val callOrigin = try {
+                getOriginFromPrivilegedAllowLists(callingAppInfo, context)
+            } catch (e: Exception) {
+                // Throw the Privileged Exception only if it's a browser
+                if (e is PrivilegedAllowLists.PrivilegedException
+                    && AppUtil.getInstalledBrowsersWithSignatures(context).any {
+                        it.packageName == e.temptingApp.packageName
+                    }
+                ) throw e
+                null
+            }
+
+            // Build the default Android origin
+            val androidOrigin = AndroidOrigin(
+                packageName = callingAppInfo.packageName,
+                fingerprint = callingAppInfo.signingInfo.getApplicationFingerprints()
+            )
+
+            // Check if the webDomain is validated by the system
+            withContext(Dispatchers.Main) {
+                if (callOrigin != null && providedClientDataHash != null) {
+                    // Origin already defined by the system
+                    Log.d(javaClass.simpleName, "Origin $callOrigin retrieved from callingAppInfo")
+                    onOriginRetrieved(
+                        AppOrigin.fromOrigin(callOrigin, androidOrigin, verified = true),
+                        providedClientDataHash
+                    )
+                } else {
+                    // Add Android origin by default
+                    onOriginNotRetrieved(
+                        AppOrigin(verified = false).apply {
+                            addAndroidOrigin(androidOrigin)
+                        },
+                        androidOrigin.toOriginValue()
+                    )
+                }
+            }
+        }
+    }
+
+    /**
+     * Generate a credential id randomly
+     */
+    private fun generateCredentialId(): ByteArray {
+        // see https://w3c.github.io/webauthn/#credential-id
+        val size = 16
+        val credentialId = ByteArray(size)
+        internalSecureRandom.nextBytes(credentialId)
+        return credentialId
+    }
+
+    /**
+     * Utility method to create a passkey and the associated creation request parameters
+     * [intent] allows to retrieve the request
+     * [context] context to manage package verification files
+     * [defaultBackupEligibility] the default backup eligibility to add the the passkey entry
+     * [defaultBackupState] the default backup state to add the the passkey entry
+     * [passkeyCreated] is called asynchronously when the passkey has been created
+     */
+    suspend fun retrievePasskeyCreationRequestParameters(
+        intent: Intent,
+        context: Context,
+        defaultBackupEligibility: Boolean?,
+        defaultBackupState: Boolean?,
+        passkeyCreated: suspend (Passkey, AppOrigin?, PublicKeyCredentialCreationParameters) -> Unit
+    ) {
+        val createCredentialRequest = PendingIntentHandler.retrieveProviderCreateCredentialRequest(intent)
+        if (createCredentialRequest == null)
+            throw CreateCredentialUnknownException("could not retrieve request from intent")
+        val callingAppInfo = createCredentialRequest.callingAppInfo
+        val creationOptions = createCredentialRequest.retrievePasskeyCreationComponent()
+
+        val relyingParty = creationOptions.relyingPartyEntity.id
+        val username = creationOptions.userEntity.name
+        val userHandle = creationOptions.userEntity.id
+        val pubKeyCredParams = creationOptions.pubKeyCredParams
+        val clientDataHash = creationOptions.clientDataHash
+
+        val credentialId = generateCredentialId()
+
+        val (keyPair, keyTypeId) = Signature.generateKeyPair(
+            pubKeyCredParams.map { params -> params.alg }
+        ) ?: throw CreateCredentialUnknownException("no known public key type found")
+        val privateKeyPem = Signature.convertPrivateKeyToPem(keyPair.private)
+
+        // Create the passkey element
+        val passkey = Passkey(
+            username = username,
+            privateKeyPem = privateKeyPem,
+            credentialId = b64Encode(credentialId),
+            userHandle = b64Encode(userHandle),
+            relyingParty = relyingParty,
+            backupEligibility = defaultBackupEligibility,
+            backupState = defaultBackupState
+        )
+
+        // create new entry in database
+        getOrigin(
+            providedClientDataHash = clientDataHash,
+            callingAppInfo = callingAppInfo,
+            context = context,
+            onOriginRetrieved = { appInfoToStore, clientDataHash ->
+                passkeyCreated.invoke(
+                    passkey,
+                    appInfoToStore,
+                    PublicKeyCredentialCreationParameters(
+                        publicKeyCredentialCreationOptions = creationOptions,
+                        credentialId = credentialId,
+                        signatureKey = Pair(keyPair, keyTypeId),
+                        clientDataResponse = ClientDataDefinedResponse(clientDataHash)
+                    )
+                )
+            },
+            onOriginNotRetrieved = { appInfoToStore, origin ->
+                passkeyCreated.invoke(
+                    passkey,
+                    appInfoToStore,
+                    PublicKeyCredentialCreationParameters(
+                        publicKeyCredentialCreationOptions = creationOptions,
+                        credentialId = credentialId,
+                        signatureKey = Pair(keyPair, keyTypeId),
+                        clientDataResponse = ClientDataBuildResponse(
+                            type = ClientDataBuildResponse.Type.CREATE,
+                            challenge = creationOptions.challenge,
+                            origin = origin
+                        )
+                    )
+                )
+            }
+        )
+    }
+
+    /**
+     * Build the passkey public key credential response,
+     * by calling this method the user is always recognized as present and verified
+     */
+    fun buildCreatePublicKeyCredentialResponse(
+        publicKeyCredentialCreationParameters: PublicKeyCredentialCreationParameters,
+        backupEligibility: Boolean,
+        backupState: Boolean
+    ): CreatePublicKeyCredentialResponse {
+
+        val keyPair = publicKeyCredentialCreationParameters.signatureKey.first
+        val keyTypeId = publicKeyCredentialCreationParameters.signatureKey.second
+        val responseJson = FidoPublicKeyCredential(
+            id = b64Encode(publicKeyCredentialCreationParameters.credentialId),
+            response = AuthenticatorAttestationResponse(
+                requestOptions = publicKeyCredentialCreationParameters.publicKeyCredentialCreationOptions,
+                credentialId = publicKeyCredentialCreationParameters.credentialId,
+                credentialPublicKey = Cbor().encode(
+                    Signature.convertPublicKeyToMap(
+                    publicKeyIn = keyPair.public,
+                    keyTypeId = keyTypeId
+                ) ?: mapOf<Int, Any>()),
+                userPresent = true,
+                userVerified = true,
+                backupEligibility = backupEligibility,
+                backupState = backupState,
+                publicKeyTypeId = keyTypeId,
+                publicKeyCbor = Signature.convertPublicKey(keyPair.public, keyTypeId)!!,
+                clientDataResponse = publicKeyCredentialCreationParameters.clientDataResponse
+            ),
+            authenticatorAttachment = "platform"
+        ).json()
+        // log only the length to prevent logging sensitive information
+        Log.d(javaClass.simpleName, "Json response for key creation")
+        return CreatePublicKeyCredentialResponse(responseJson)
+    }
+
+    /**
+     * Utility method to use a passkey and create the associated usage request parameters
+     * [intent] allows to retrieve the request
+     * [context] context to manage package verification files
+     * [result] is called asynchronously after the creation of PublicKeyCredentialUsageParameters, the origin associated with it may or may not be verified
+     */
+    suspend fun retrievePasskeyUsageRequestParameters(
+        intent: Intent,
+        context: Context,
+        result: suspend (PublicKeyCredentialUsageParameters) -> Unit
+    ) {
+        val getCredentialRequest = PendingIntentHandler.retrieveProviderGetCredentialRequest(intent)
+        if (getCredentialRequest == null)
+            throw CreateCredentialUnknownException("could not retrieve request from intent")
+        val callingAppInfo = getCredentialRequest.callingAppInfo
+        val credentialOption = getCredentialRequest.retrievePasskeyUsageComponent()
+        val clientDataHash = credentialOption.clientDataHash
+
+        val requestOptions = PublicKeyCredentialRequestOptions(credentialOption.requestJson)
+
+        getOrigin(
+            providedClientDataHash = clientDataHash,
+            callingAppInfo = callingAppInfo,
+            context = context,
+            onOriginRetrieved = { appOrigin, clientDataHash ->
+                result.invoke(
+                    PublicKeyCredentialUsageParameters(
+                        publicKeyCredentialRequestOptions = requestOptions,
+                        clientDataResponse = ClientDataDefinedResponse(clientDataHash),
+                        appOrigin = appOrigin
+                    )
+                )
+            },
+            onOriginNotRetrieved = { appOrigin, androidOriginString ->
+                // By default we crate an usage parameter with Android origin
+                result.invoke(
+                    PublicKeyCredentialUsageParameters(
+                        publicKeyCredentialRequestOptions = requestOptions,
+                        clientDataResponse = ClientDataBuildResponse(
+                            type = ClientDataBuildResponse.Type.GET,
+                            challenge = requestOptions.challenge,
+                            origin = androidOriginString
+                        ),
+                        appOrigin = appOrigin
+                    )
+                )
+            }
+        )
+    }
+
+    /**
+     * Build the passkey public key credential response,
+     * by calling this method the user is always recognized as present and verified
+     */
+    fun buildPasskeyPublicKeyCredential(
+        requestOptions: PublicKeyCredentialRequestOptions,
+        clientDataResponse: ClientDataResponse,
+        passkey: Passkey,
+        defaultBackupEligibility: Boolean,
+        defaultBackupState: Boolean
+    ): PublicKeyCredential {
+        val getCredentialResponse = FidoPublicKeyCredential(
+            id = passkey.credentialId,
+            response = AuthenticatorAssertionResponse(
+                requestOptions = requestOptions,
+                userPresent = true,
+                userVerified = true,
+                backupEligibility = passkey.backupEligibility ?: defaultBackupEligibility,
+                backupState = passkey.backupState ?: defaultBackupState,
+                userHandle = passkey.userHandle,
+                privateKey = passkey.privateKeyPem,
+                clientDataResponse = clientDataResponse
+            ),
+            authenticatorAttachment = "platform"
+        ).json()
+        Log.d(javaClass.simpleName, "Json response for key usage")
+        return PublicKeyCredential(getCredentialResponse)
+    }
+
+
+    /**
+     * Verify that the application signature is contained in the [appOrigin]
+     */
+    fun getVerifiedGETClientDataResponse(
+        usageParameters: PublicKeyCredentialUsageParameters,
+        appOrigin: AppOrigin
+    ): ClientDataResponse {
+        val appToCheck = usageParameters.appOrigin
+        return if (appToCheck.verified) {
+            usageParameters.clientDataResponse
+        } else {
+            // Origin checked by Android app signature
+            ClientDataBuildResponse(
+                type = ClientDataBuildResponse.Type.GET,
+                challenge = usageParameters.publicKeyCredentialRequestOptions.challenge,
+                origin = appToCheck.checkAppOrigin(appOrigin)
+            )
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/passkey/util/PrivilegedAllowLists.kt

@@ -0,0 +1,227 @@
+/*
+ * Copyright 2025 Jeremy Jamet / Kunzisoft.
+ *
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.credentialprovider.passkey.util
+
+import android.content.Context
+import android.util.Log
+import androidx.credentials.provider.CallingAppInfo
+import com.kunzisoft.encrypt.Signature.getAllFingerprints
+import com.kunzisoft.keepass.BuildConfig
+import com.kunzisoft.keepass.credentialprovider.passkey.data.AndroidPrivilegedApp
+import org.json.JSONObject
+import java.io.File
+import java.io.FileNotFoundException
+import java.io.InputStream
+
+object PrivilegedAllowLists {
+
+    private const val FILE_NAME_PRIVILEGED_APPS_CUSTOM = "passkeys_privileged_apps_custom.json"
+    private const val FILE_NAME_PRIVILEGED_APPS_COMMUNITY = "passkeys_privileged_apps_community.json"
+    private const val FILE_NAME_PRIVILEGED_APPS_GOOGLE = "passkeys_privileged_apps_google.json"
+
+    private fun retrieveContentFromStream(
+        inputStream: InputStream,
+    ): String {
+        return inputStream.use { fileInputStream ->
+            fileInputStream.bufferedReader(Charsets.UTF_8).readText()
+        }
+    }
+
+    /**
+     * Get the origin from a predefined privileged allow list
+     *
+     * @param callingAppInfo CallingAppInfo to verify and retrieve the specific Origin
+     * @param inputStream File input stream containing the origin list as JSON
+     */
+    private fun getOriginFromPrivilegedAllowListStream(
+        callingAppInfo: CallingAppInfo,
+        inputStream: InputStream
+    ): String? {
+        val privilegedAllowList = retrieveContentFromStream(inputStream)
+        return callingAppInfo.getOrigin(privilegedAllowList)?.removeSuffix("/")
+    }
+
+    /**
+     * Get the origin from the predefined privileged allow lists
+     *
+     * @param callingAppInfo CallingAppInfo to verify and retrieve the specific Origin
+     * @param context Context for file operations.
+     */
+    fun getOriginFromPrivilegedAllowLists(
+        callingAppInfo: CallingAppInfo,
+        context: Context
+    ): String? {
+        return try {
+            // Check the custom apps first
+            getOriginFromPrivilegedAllowListStream(
+                callingAppInfo = callingAppInfo,
+                File(context.filesDir, FILE_NAME_PRIVILEGED_APPS_CUSTOM)
+                    .inputStream()
+            )
+        } catch (e: Exception) {
+            // Then the Google list if allowed
+            if (BuildConfig.CLOSED_STORE) {
+                try {
+                    // Check the Google list if allowed
+                    // http://www.gstatic.com/gpm-passkeys-privileged-apps/apps.json
+                    getOriginFromPrivilegedAllowListStream(
+                        callingAppInfo = callingAppInfo,
+                        inputStream = context.assets.open(FILE_NAME_PRIVILEGED_APPS_GOOGLE)
+                    )
+                } catch (_: Exception) {
+                    // Then the community apps list
+                    getOriginFromPrivilegedAllowListStream(
+                        callingAppInfo = callingAppInfo,
+                        inputStream = context.assets.open(FILE_NAME_PRIVILEGED_APPS_COMMUNITY)
+                    )
+                }
+            } else {
+                when (e) {
+                    is FileNotFoundException -> {
+                        val attemptApp = AndroidPrivilegedApp(
+                            packageName = callingAppInfo.packageName,
+                            fingerprints = callingAppInfo.signingInfo
+                                .getAllFingerprints() ?: emptySet()
+                        )
+                        throw PrivilegedException(
+                            temptingApp = attemptApp,
+                            message = "$attemptApp is not in the allow list"
+                        )
+                    }
+                    else -> throw e
+                }
+            }
+        }
+    }
+
+    /**
+     * Retrieves a list of predefined AndroidPrivilegedApp objects from an asset JSON file.
+     *
+     * @param inputStream File input stream containing the origin list as JSON
+     */
+    private fun retrievePrivilegedApps(
+        inputStream: InputStream
+    ): List<AndroidPrivilegedApp> {
+        val jsonObject = JSONObject(retrieveContentFromStream(inputStream))
+        return AndroidPrivilegedApp.extractPrivilegedApps(jsonObject)
+    }
+
+    /**
+     * Retrieves a list of predefined AndroidPrivilegedApp objects from a context
+     *
+     * @param context Context for file operations.
+     */
+    fun retrievePredefinedPrivilegedApps(
+        context: Context
+    ): List<AndroidPrivilegedApp> {
+        return try {
+            val predefinedApps = mutableListOf<AndroidPrivilegedApp>()
+            predefinedApps.addAll(retrievePrivilegedApps(context.assets.open(FILE_NAME_PRIVILEGED_APPS_COMMUNITY)))
+            if (BuildConfig.CLOSED_STORE) {
+                predefinedApps.addAll(retrievePrivilegedApps(context.assets.open(FILE_NAME_PRIVILEGED_APPS_GOOGLE)))
+            }
+            predefinedApps
+        } catch (e: Exception) {
+            Log.e(PrivilegedAllowLists::class.simpleName, "Error retrieving privileged apps", e)
+            emptyList()
+        }
+    }
+
+    /**
+     * Retrieves a list of AndroidPrivilegedApp objects from the custom JSON file.
+     *
+     * @param context Context for file operations.
+     */
+    fun retrieveCustomPrivilegedApps(
+        context: Context
+    ): List<AndroidPrivilegedApp> {
+        return try {
+            retrievePrivilegedApps(File(context.filesDir, FILE_NAME_PRIVILEGED_APPS_CUSTOM).inputStream())
+        } catch (e: Exception) {
+            Log.i(PrivilegedAllowLists::class.simpleName, "No custom privileged apps", e)
+            emptyList()
+        }
+    }
+
+    /**
+     * Retrieves a list of all predefined and custom AndroidPrivilegedApp objects.
+     */
+    fun retrieveAllPrivilegedApps(
+        context: Context
+    ): List<AndroidPrivilegedApp> {
+        return retrievePredefinedPrivilegedApps(context) + retrieveCustomPrivilegedApps(context)
+    }
+
+    /**
+     * Saves a list of custom AndroidPrivilegedApp objects to a JSON file.
+     *
+     * @param context Context for file operations.
+     * @param privilegedApps The list of apps to save.
+     * @return True if saving was successful, false otherwise.
+     */
+    fun saveCustomPrivilegedApps(context: Context, privilegedApps: List<AndroidPrivilegedApp>): Boolean {
+        return try {
+            val jsonToSave = AndroidPrivilegedApp.toJsonObject(privilegedApps)
+            val file = File(context.filesDir, FILE_NAME_PRIVILEGED_APPS_CUSTOM)
+
+            // Delete existing file before writing to ensure atomicity if needed
+            if (file.exists()) {
+                file.delete()
+            }
+
+            file.outputStream().use { fileOutputStream ->
+                fileOutputStream.write(
+                    jsonToSave
+                        .toString(4) // toString(4) for pretty print
+                        .toByteArray(Charsets.UTF_8)
+                )
+            }
+            true
+        } catch (e: Exception) {
+            Log.e(PrivilegedAllowLists::class.simpleName, "Error saving privileged apps", e)
+            false
+        }
+    }
+
+    /**
+     * Deletes the custom JSON file.
+     *
+     * @param context Context for file operations.
+     * @return True if deletion was successful or file didn't exist, false otherwise.
+     */
+    fun deletePrivilegedAppsFile(context: Context): Boolean {
+        return try {
+            val file = File(context.filesDir, FILE_NAME_PRIVILEGED_APPS_CUSTOM)
+            if (file.exists()) {
+                file.delete()
+            } else {
+                true // File didn't exist, so considered "successfully deleted"
+            }
+        } catch (e: SecurityException) {
+            Log.e(PrivilegedAllowLists::class.simpleName, "Error deleting privileged apps file", e)
+            false
+        }
+    }
+
+    class PrivilegedException(
+        val temptingApp: AndroidPrivilegedApp,
+        message: String
+    ) : Exception(message)
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/viewmodel/AutofillLauncherViewModel.kt

@@ -0,0 +1,279 @@
+package com.kunzisoft.keepass.credentialprovider.viewmodel
+
+import android.app.Activity.RESULT_CANCELED
+import android.app.Activity.RESULT_OK
+import android.app.Application
+import android.content.Intent
+import android.os.Build
+import android.util.Log
+import androidx.activity.result.ActivityResult
+import androidx.annotation.RequiresApi
+import androidx.lifecycle.viewModelScope
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveAndRemoveEntries
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveRegisterInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSearchInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSpecialMode
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.TypeMode
+import com.kunzisoft.keepass.credentialprovider.autofill.AutofillComponent
+import com.kunzisoft.keepass.credentialprovider.autofill.AutofillHelper
+import com.kunzisoft.keepass.credentialprovider.autofill.AutofillHelper.retrieveAutofillComponent
+import com.kunzisoft.keepass.credentialprovider.autofill.KeeAutofillService
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.database.exception.RegisterInReadOnlyDatabaseException
+import com.kunzisoft.keepass.database.helper.SearchHelper
+import com.kunzisoft.keepass.model.RegisterInfo
+import com.kunzisoft.keepass.model.SearchInfo
+import com.kunzisoft.keepass.settings.PreferencesUtil
+import kotlinx.coroutines.CoroutineExceptionHandler
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.flow.MutableStateFlow
+import kotlinx.coroutines.flow.StateFlow
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
+import java.io.IOException
+
+@RequiresApi(api = Build.VERSION_CODES.O)
+class AutofillLauncherViewModel(application: Application): CredentialLauncherViewModel(application) {
+
+    private var mAutofillComponent: AutofillComponent? = null
+
+    private var mLockDatabaseAfterSelection: Boolean = false
+
+    private val mUiState = MutableStateFlow<UIState>(UIState.Loading)
+    val uiState: StateFlow<UIState> = mUiState
+
+    fun initialize() {
+        mLockDatabaseAfterSelection = PreferencesUtil.isAutofillCloseDatabaseEnable(getApplication())
+    }
+
+    override fun onResult() {
+        super.onResult()
+        mAutofillComponent = null
+    }
+
+    override suspend fun launchAction(
+        intent: Intent,
+        specialMode: SpecialMode,
+        database: ContextualDatabase?
+    ) {
+        // Retrieve selection mode
+        when (intent.retrieveSpecialMode()) {
+            SpecialMode.SELECTION -> {
+                val searchInfo = intent.retrieveSearchInfo()
+                if (searchInfo == null)
+                    throw IOException("Search info is null")
+                mAutofillComponent = intent.retrieveAutofillComponent()
+                // Build search param
+                launchSelection(database, mAutofillComponent, searchInfo)
+            }
+            SpecialMode.REGISTRATION -> {
+                // To register info
+                val registerInfo = intent.retrieveRegisterInfo()
+                if (registerInfo == null)
+                    throw IOException("Register info is null")
+                launchRegistration(database, registerInfo)
+            }
+            else -> {
+                // Not an autofill call
+                cancelResult()
+            }
+        }
+    }
+
+    private suspend fun launchSelection(
+        database: ContextualDatabase?,
+        autofillComponent: AutofillComponent?,
+        searchInfo: SearchInfo
+    ) {
+        withContext(Dispatchers.IO) {
+            if (autofillComponent == null) {
+                throw IOException("Autofill component is null")
+            }
+            if (KeeAutofillService.autofillAllowedFor(
+                    applicationId = searchInfo.applicationId,
+                    webDomain = searchInfo.webDomain,
+                    context = getApplication()
+                )
+            ) {
+                // If database is open
+                SearchHelper.checkAutoSearchInfo(
+                    context = getApplication(),
+                    database = database,
+                    searchInfo = searchInfo,
+                    onItemsFound = { openedDatabase, items ->
+                        // Items found
+                        if (autofillComponent.compatInlineSuggestionsRequest != null) {
+                            mUiState.value = UIState.ShowAutofillSuggestionMessage
+                        }
+                        AutofillHelper.buildResponse(
+                            context = getApplication(),
+                            autofillComponent = autofillComponent,
+                            database = openedDatabase,
+                            entriesInfo = items
+                        ) { intent ->
+                            setResult(intent, lockDatabase = mLockDatabaseAfterSelection)
+                        }
+                    },
+                    onItemNotFound = { openedDatabase ->
+                        // Show the database UI to select the entry
+                        mCredentialUiState.value =
+                            CredentialState.LaunchGroupActivityForSelection(
+                                database = openedDatabase,
+                                searchInfo = searchInfo,
+                                typeMode = TypeMode.AUTOFILL
+                            )
+                    },
+                    onDatabaseClosed = {
+                        // If database not open
+                        mCredentialUiState.value =
+                            CredentialState.LaunchFileDatabaseSelectActivityForSelection(
+                                searchInfo = searchInfo,
+                                typeMode = TypeMode.AUTOFILL
+                            )
+                    }
+                )
+            } else {
+                mUiState.value = UIState.ShowBlockRestartMessage
+            }
+        }
+    }
+
+    override fun manageSelectionResult(
+        database: ContextualDatabase,
+        activityResult: ActivityResult
+    ) {
+        super.manageSelectionResult(database, activityResult)
+        val intent = activityResult.data
+        viewModelScope.launch(CoroutineExceptionHandler { _, e ->
+            Log.e(TAG, "Unable to create selection response for autofill", e)
+            showError(e)
+        }) {
+            when (activityResult.resultCode) {
+                RESULT_OK -> {
+                    withContext(Dispatchers.IO) {
+                        Log.d(TAG, "Autofill selection result")
+                        if (intent == null)
+                            throw IOException("Intent is null")
+                        val entries = intent.retrieveAndRemoveEntries(database)
+                        val autofillComponent = mAutofillComponent
+                        if (autofillComponent == null)
+                            throw IOException("Autofill component is null")
+                        withContext(Dispatchers.Main) {
+                            AutofillHelper.buildResponse(
+                                context = getApplication(),
+                                autofillComponent = autofillComponent,
+                                database = database,
+                                entriesInfo = entries
+                            ) { intent ->
+                                setResult(intent, lockDatabase = mLockDatabaseAfterSelection)
+                            }
+                        }
+                    }
+                }
+                RESULT_CANCELED -> {
+                    withContext(Dispatchers.Main) {
+                        cancelResult()
+                    }
+                }
+            }
+        }
+    }
+
+    // -------------
+    //  Registration
+    // -------------
+
+    private fun launchRegistration(
+        database: ContextualDatabase?,
+        registerInfo: RegisterInfo
+    ) {
+        val searchInfo = registerInfo.searchInfo
+        if (KeeAutofillService.autofillAllowedFor(
+                applicationId = searchInfo.applicationId,
+                webDomain = searchInfo.webDomain,
+                context = getApplication()
+            )) {
+            val readOnly = database?.isReadOnly != false
+            SearchHelper.checkAutoSearchInfo(
+                context = getApplication(),
+                database = database,
+                searchInfo = searchInfo,
+                onItemsFound = { openedDatabase, _ ->
+                    if (!readOnly) {
+                        // Show the database UI to select the entry
+                        mCredentialUiState.value =
+                            CredentialState.LaunchGroupActivityForRegistration(
+                                database = openedDatabase,
+                                registerInfo = registerInfo,
+                                typeMode = TypeMode.AUTOFILL
+                            )
+                    } else {
+                        mCredentialUiState.value = CredentialState.ShowError(
+                            RegisterInReadOnlyDatabaseException()
+                        )
+                    }
+                },
+                onItemNotFound = { openedDatabase ->
+                    if (!readOnly) {
+                        // Show the database UI to select the entry
+                        mCredentialUiState.value =
+                            CredentialState.LaunchGroupActivityForRegistration(
+                                database = openedDatabase,
+                                registerInfo = registerInfo,
+                                typeMode = TypeMode.AUTOFILL
+                            )
+                    } else {
+                        mCredentialUiState.value = CredentialState.ShowError(
+                            RegisterInReadOnlyDatabaseException()
+                        )
+                    }
+                },
+                onDatabaseClosed = {
+                    // If database not open
+                    mCredentialUiState.value =
+                        CredentialState.LaunchFileDatabaseSelectActivityForRegistration(
+                            registerInfo = registerInfo,
+                            typeMode = TypeMode.AUTOFILL
+                        )
+                }
+            )
+        } else {
+            mUiState.value = UIState.ShowBlockRestartMessage
+        }
+    }
+
+    override fun manageRegistrationResult(activityResult: ActivityResult) {
+        isResultLauncherRegistered = false
+        viewModelScope.launch(CoroutineExceptionHandler { _, e ->
+            Log.e(TAG, "Unable to create registration response for autofill", e)
+            showError(e)
+        }) {
+            val responseIntent = Intent()
+            when (activityResult.resultCode) {
+                RESULT_OK -> {
+                    Log.d(TAG, "Autofill registration result")
+                    withContext(Dispatchers.Main) {
+                        setResult(responseIntent)
+                    }
+                }
+                RESULT_CANCELED -> {
+                    withContext(Dispatchers.Main) {
+                        cancelResult()
+                    }
+                }
+            }
+        }
+
+    }
+
+    sealed class UIState {
+        object Loading: UIState()
+        object ShowBlockRestartMessage: UIState()
+        object ShowAutofillSuggestionMessage: UIState()
+    }
+
+    companion object {
+        private val TAG = AutofillLauncherViewModel::class.java.name
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/viewmodel/CredentialLauncherViewModel.kt

@@ -0,0 +1,151 @@
+package com.kunzisoft.keepass.credentialprovider.viewmodel
+
+import android.app.Activity.RESULT_CANCELED
+import android.app.Activity.RESULT_OK
+import android.app.Application
+import android.content.Intent
+import android.util.Log
+import androidx.activity.result.ActivityResult
+import androidx.lifecycle.AndroidViewModel
+import androidx.lifecycle.viewModelScope
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.TypeMode
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.model.RegisterInfo
+import com.kunzisoft.keepass.model.SearchInfo
+import kotlinx.coroutines.CoroutineExceptionHandler
+import kotlinx.coroutines.flow.MutableStateFlow
+import kotlinx.coroutines.flow.StateFlow
+import kotlinx.coroutines.launch
+
+abstract class CredentialLauncherViewModel(application: Application): AndroidViewModel(application) {
+
+    protected var mDatabase: ContextualDatabase? = null
+
+    protected var isResultLauncherRegistered: Boolean = false
+    private var mSelectionResult: ActivityResult? = null
+
+    protected val mCredentialUiState = MutableStateFlow<CredentialState>(CredentialState.Loading)
+    val credentialUiState: StateFlow<CredentialState> = mCredentialUiState
+
+    fun showError(error: Throwable) {
+        Log.e(TAG, "Error on credential provider launch", error)
+        mCredentialUiState.value = CredentialState.ShowError(error)
+    }
+
+    open fun onResult() {
+        isResultLauncherRegistered = false
+        mSelectionResult = null
+    }
+
+    fun setResult(intent: Intent, lockDatabase: Boolean = false) {
+        // Remove the launcher register
+        onResult()
+        mCredentialUiState.value = CredentialState.SetActivityResult(
+            lockDatabase = lockDatabase,
+            resultCode = RESULT_OK,
+            data = intent
+        )
+    }
+
+    fun cancelResult(lockDatabase: Boolean = false) {
+        onResult()
+        mCredentialUiState.value = CredentialState.SetActivityResult(
+            lockDatabase = lockDatabase,
+            resultCode = RESULT_CANCELED
+        )
+    }
+
+    private fun onDatabaseRetrieved(database: ContextualDatabase) {
+        mDatabase = database
+        mSelectionResult?.let { selectionResult ->
+            manageSelectionResult(database, selectionResult)
+        }
+    }
+
+    fun manageSelectionResult(activityResult: ActivityResult) {
+        // Waiting for the database if needed
+        when (activityResult.resultCode) {
+            RESULT_OK -> {
+                mSelectionResult = activityResult
+                mDatabase?.let { database ->
+                    manageSelectionResult(database, activityResult)
+                }
+            }
+            RESULT_CANCELED -> {
+                cancelResult()
+            }
+        }
+    }
+
+    open fun manageSelectionResult(database: ContextualDatabase, activityResult: ActivityResult) {
+        mSelectionResult = null
+    }
+
+    open fun manageRegistrationResult(activityResult: ActivityResult) {}
+
+    open fun onExceptionOccurred(e: Throwable) {
+        showError(e)
+    }
+
+    open fun launchActionIfNeeded(
+        intent: Intent,
+        specialMode: SpecialMode,
+        database: ContextualDatabase?
+    ) {
+        if (database != null) {
+            onDatabaseRetrieved(database)
+        }
+        if (isResultLauncherRegistered.not()) {
+            isResultLauncherRegistered = true
+            viewModelScope.launch(CoroutineExceptionHandler { _, e ->
+                onExceptionOccurred(e)
+            }) {
+                launchAction(intent, specialMode, database)
+            }
+        }
+    }
+
+    /**
+     * Launch the main action
+     */
+    protected abstract suspend fun launchAction(
+        intent: Intent,
+        specialMode: SpecialMode,
+        database: ContextualDatabase?
+    )
+
+    sealed class CredentialState {
+        object Loading : CredentialState()
+        data class LaunchGroupActivityForSelection(
+            val database: ContextualDatabase,
+            val searchInfo: SearchInfo?,
+            val typeMode: TypeMode
+        ): CredentialState()
+        data class LaunchGroupActivityForRegistration(
+            val database: ContextualDatabase,
+            val registerInfo: RegisterInfo?,
+            val typeMode: TypeMode
+        ): CredentialState()
+        data class LaunchFileDatabaseSelectActivityForSelection(
+            val searchInfo: SearchInfo?,
+            val typeMode: TypeMode
+        ): CredentialState()
+        data class LaunchFileDatabaseSelectActivityForRegistration(
+            val registerInfo: RegisterInfo?,
+            val typeMode: TypeMode
+        ): CredentialState()
+        data class SetActivityResult(
+            val lockDatabase: Boolean,
+            val resultCode: Int,
+            val data: Intent? = null
+        ): CredentialState()
+        data class ShowError(
+            val error: Throwable
+        ): CredentialState()
+    }
+
+    companion object {
+        private val TAG = CredentialLauncherViewModel::class.java.name
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/viewmodel/EntrySelectionViewModel.kt

@@ -0,0 +1,297 @@
+package com.kunzisoft.keepass.credentialprovider.viewmodel
+
+import android.app.Activity.RESULT_CANCELED
+import android.app.Activity.RESULT_OK
+import android.app.Application
+import android.content.Intent
+import android.util.Log
+import androidx.activity.result.ActivityResult
+import androidx.core.net.toUri
+import androidx.lifecycle.viewModelScope
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveAndRemoveEntries
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveNodeId
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSearchInfo
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.TypeMode
+import com.kunzisoft.keepass.credentialprovider.magikeyboard.MagikeyboardService
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.database.exception.RegisterInReadOnlyDatabaseException
+import com.kunzisoft.keepass.database.helper.SearchHelper
+import com.kunzisoft.keepass.model.EntryInfo
+import com.kunzisoft.keepass.model.SearchInfo
+import com.kunzisoft.keepass.otp.OtpEntryFields
+import com.kunzisoft.keepass.utils.KeyboardUtil.isKeyboardActivatedInSettings
+import kotlinx.coroutines.CoroutineExceptionHandler
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.flow.MutableStateFlow
+import kotlinx.coroutines.flow.StateFlow
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
+import java.io.IOException
+
+class EntrySelectionViewModel(application: Application): CredentialLauncherViewModel(application) {
+
+    private var searchShareForMagikeyboard: Boolean = false
+    private var mLockDatabaseAfterSelection: Boolean = false
+    private val mUiState = MutableStateFlow<UIState>(UIState.Loading)
+    val uiState: StateFlow<UIState> = mUiState
+
+    fun initialize() {
+        searchShareForMagikeyboard = getApplication<Application>().isKeyboardActivatedInSettings()
+        mLockDatabaseAfterSelection = false // TODO Close database after selection
+    }
+
+    override fun launchActionIfNeeded(
+        intent: Intent,
+        specialMode: SpecialMode,
+        database: ContextualDatabase?
+    ) {
+        // Launch with database when a nodeId is present
+        if ((database != null && database.loaded) || intent.retrieveNodeId() == null) {
+            super.launchActionIfNeeded(intent, specialMode, database)
+        }
+    }
+
+    override suspend fun launchAction(
+        intent: Intent,
+        specialMode: SpecialMode,
+        database: ContextualDatabase?
+    ) {
+        val searchInfo: SearchInfo? = intent.retrieveSearchInfo()
+        if (searchInfo != null) {
+            launch(database, searchInfo)
+        } else {
+            // To manage share
+            var sharedWebDomain: String? = null
+            var otpString: String? = null
+
+            when (intent.action) {
+                Intent.ACTION_SEND -> {
+                    if ("text/plain" == intent.type) {
+                        // Retrieve web domain or OTP
+                        intent.getStringExtra(Intent.EXTRA_TEXT)?.let { extra ->
+                            if (OtpEntryFields.isOTPUri(extra))
+                                otpString = extra
+                            else
+                                sharedWebDomain = extra.toUri().host
+                        }
+                    }
+                    launchSelection(database, sharedWebDomain, otpString)
+                }
+                Intent.ACTION_VIEW -> {
+                    // Retrieve OTP
+                    intent.dataString?.let { extra ->
+                        if (OtpEntryFields.isOTPUri(extra))
+                            otpString = extra
+                    }
+                    launchSelection(database, null, otpString)
+                }
+                else -> {
+                    if (database != null && database.loaded) {
+                        mUiState.value = UIState.LaunchGroupActivityForSearch(
+                            database = database,
+                            searchInfo = SearchInfo()
+                        )
+                    } else {
+                        mUiState.value = UIState.LaunchFileDatabaseSelectForSearch(
+                            searchInfo = SearchInfo()
+                        )
+                    }
+                }
+            }
+        }
+    }
+
+    // -------------
+    //  Selection
+    // -------------
+
+    private fun launchSelection(
+        database: ContextualDatabase?,
+        sharedWebDomain: String?,
+        otpString: String?
+    ) {
+        // Build domain search param
+        val searchInfo = SearchInfo().apply {
+            this.webDomain = sharedWebDomain
+            this.otpString = otpString
+        }
+        launch(database, searchInfo)
+    }
+
+    private fun launch(
+        database: ContextualDatabase?,
+        searchInfo: SearchInfo
+    ) {
+        // If database is open
+        val readOnly = database?.isReadOnly != false
+        SearchHelper.checkAutoSearchInfo(
+            context = getApplication(),
+            database = database,
+            searchInfo = searchInfo,
+            onItemsFound = { openedDatabase, items ->
+                // Items found
+                if (searchInfo.otpString != null) {
+                    if (!readOnly) {
+                        mCredentialUiState.value =
+                            CredentialState.LaunchGroupActivityForRegistration(
+                                database = openedDatabase,
+                                registerInfo = searchInfo.toRegisterInfo(),
+                                typeMode = TypeMode.DEFAULT
+                            )
+                    } else {
+                        mCredentialUiState.value = CredentialState.ShowError(
+                            RegisterInReadOnlyDatabaseException()
+                        )
+                    }
+                } else if (searchShareForMagikeyboard) {
+                    MagikeyboardService.performSelection(
+                        items,
+                        { entryInfo ->
+                            populateKeyboard(entryInfo)
+                        },
+                        { autoSearch ->
+                            mCredentialUiState.value = CredentialState.LaunchGroupActivityForSelection(
+                                database = openedDatabase,
+                                searchInfo = searchInfo,
+                                typeMode = TypeMode.MAGIKEYBOARD
+                            )
+                        }
+                    )
+                } else {
+                    mUiState.value = UIState.LaunchGroupActivityForSearch(
+                        database = openedDatabase,
+                        searchInfo = searchInfo
+                    )
+                }
+            },
+            onItemNotFound = { openedDatabase ->
+                // Show the database UI to select the entry
+                if (searchInfo.otpString != null) {
+                    if (!readOnly) {
+                        mCredentialUiState.value =
+                            CredentialState.LaunchGroupActivityForRegistration(
+                                database = openedDatabase,
+                                registerInfo = searchInfo.toRegisterInfo(),
+                                typeMode = TypeMode.DEFAULT
+                            )
+                    } else {
+                        mCredentialUiState.value = CredentialState.ShowError(
+                            RegisterInReadOnlyDatabaseException()
+                        )
+                    }
+                } else if (searchShareForMagikeyboard) {
+                    mCredentialUiState.value = CredentialState.LaunchGroupActivityForSelection(
+                        database = openedDatabase,
+                        searchInfo = searchInfo,
+                        typeMode = TypeMode.MAGIKEYBOARD
+                    )
+                } else {
+                    mUiState.value = UIState.LaunchGroupActivityForSearch(
+                        database = openedDatabase,
+                        searchInfo = searchInfo
+                    )
+                }
+            },
+            onDatabaseClosed = {
+                // If database not open
+                if (searchInfo.otpString != null) {
+                    mCredentialUiState.value = CredentialState.LaunchFileDatabaseSelectActivityForRegistration(
+                        registerInfo = searchInfo.toRegisterInfo(),
+                        typeMode = TypeMode.DEFAULT
+                    )
+                } else if (searchShareForMagikeyboard) {
+                    mCredentialUiState.value = CredentialState.LaunchFileDatabaseSelectActivityForSelection(
+                        searchInfo = searchInfo,
+                        typeMode = TypeMode.MAGIKEYBOARD
+                    )
+                } else {
+                    mUiState.value = UIState.LaunchFileDatabaseSelectForSearch(
+                        searchInfo = searchInfo
+                    )
+                }
+            }
+        )
+    }
+
+    private fun populateKeyboard(entryInfo: EntryInfo) {
+        // Automatically populate keyboard
+        mUiState.value = UIState.PopulateKeyboard(entryInfo)
+        setResult(Intent(), lockDatabase = mLockDatabaseAfterSelection)
+    }
+
+    override fun manageSelectionResult(
+        database: ContextualDatabase,
+        activityResult: ActivityResult
+    ) {
+        super.manageSelectionResult(database, activityResult)
+        val intent = activityResult.data
+        viewModelScope.launch(CoroutineExceptionHandler { _, e ->
+            Log.e(TAG, "Unable to create selection response for Magikeyboard", e)
+            showError(e)
+        }) {
+            when (activityResult.resultCode) {
+                RESULT_OK -> {
+                    withContext(Dispatchers.IO) {
+                        Log.d(TAG, "Magikeyboard selection result")
+                        if (intent == null)
+                            throw IOException("Intent is null")
+                        val entries = intent.retrieveAndRemoveEntries(database)
+                        withContext(Dispatchers.Main) {
+                            // Populate Magikeyboard with entry
+                            entries.firstOrNull()?.let { entryInfo ->
+                                populateKeyboard(entryInfo)
+                            } // TODO Manage multiple entries in Magikeyboard
+                        }
+                    }
+                }
+                RESULT_CANCELED -> {
+                    withContext(Dispatchers.Main) {
+                        cancelResult()
+                    }
+                }
+            }
+        }
+    }
+
+    override fun manageRegistrationResult(activityResult: ActivityResult) {
+        super.manageRegistrationResult(activityResult)
+        viewModelScope.launch(CoroutineExceptionHandler { _, e ->
+            Log.e(TAG, "Unable to create selection response for Magikeyboard", e)
+            showError(e)
+        }) {
+            when (activityResult.resultCode) {
+                RESULT_OK -> {
+                    // Empty data result
+                    // TODO Show Toast indicating value is saved
+                    withContext(Dispatchers.Main) {
+                        setResult(Intent(), lockDatabase = false)
+                    }
+                }
+                RESULT_CANCELED -> {
+                    withContext(Dispatchers.Main) {
+                        cancelResult()
+                    }
+                }
+            }
+        }
+    }
+
+    sealed class UIState {
+        object Loading: UIState()
+        data class PopulateKeyboard(
+            val entryInfo: EntryInfo
+        ): UIState()
+        data class LaunchFileDatabaseSelectForSearch(
+            val searchInfo: SearchInfo
+        ): UIState()
+        data class LaunchGroupActivityForSearch(
+            val database: ContextualDatabase,
+            val searchInfo: SearchInfo
+        ): UIState()
+    }
+
+    companion object {
+        private val TAG = EntrySelectionViewModel::class.java.name
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/viewmodel/HardwareKeyLauncherViewModel.kt

@@ -0,0 +1,147 @@
+package com.kunzisoft.keepass.credentialprovider.viewmodel
+
+import android.app.Activity.RESULT_OK
+import android.app.Application
+import android.content.Context
+import android.content.Intent
+import android.util.Log
+import androidx.activity.result.ActivityResult
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.activity.HardwareKeyActivity.Companion.isHardwareKeyAvailable
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.hardware.HardwareKey
+import kotlinx.coroutines.flow.MutableStateFlow
+import kotlinx.coroutines.flow.StateFlow
+
+class HardwareKeyLauncherViewModel(application: Application): CredentialLauncherViewModel(application) {
+
+    private val mUiState = MutableStateFlow<UIState>(UIState.Loading)
+    val uiState: StateFlow<UIState> = mUiState
+
+    override suspend fun launchAction(
+        intent: Intent,
+        specialMode: SpecialMode,
+        database: ContextualDatabase?
+    ) {
+        val hardwareKey = HardwareKey.Companion.getHardwareKeyFromString(
+            intent.getStringExtra(DATA_HARDWARE_KEY)
+        )
+        if (isHardwareKeyAvailable(getApplication(), hardwareKey)) {
+            when (hardwareKey) {
+                /*
+                HardwareKey.FIDO2_SECRET -> {
+                    // TODO FIDO2 under development
+                    throw Exception("FIDO2 not implemented")
+                }
+                */
+                HardwareKey.CHALLENGE_RESPONSE_YUBIKEY -> {
+                    launchYubikeyChallengeForResponse(intent.getByteArrayExtra(DATA_SEED))
+                }
+                else -> {
+                    UIState.OnChallengeResponded(null)
+                }
+            }
+        } else {
+            mUiState.value = UIState.ShowHardwareKeyDriverNeeded(hardwareKey)
+        }
+    }
+
+    private fun launchYubikeyChallengeForResponse(seed: ByteArray?) {
+        // Transform the seed before sending
+        var challenge: ByteArray? = null
+        if (seed != null) {
+            challenge = ByteArray(64)
+            seed.copyInto(challenge, 0, 0, 32)
+            challenge.fill(32, 32, 64)
+        }
+        mUiState.value = UIState.LaunchChallengeActivityForResponse(challenge)
+        Log.d(TAG, "Challenge sent")
+    }
+
+    override fun manageSelectionResult(
+        database: ContextualDatabase,
+        activityResult: ActivityResult
+    ) {
+        super.manageSelectionResult(database, activityResult)
+
+        if (activityResult.resultCode == RESULT_OK) {
+            val challengeResponse: ByteArray? =
+                activityResult.data?.getByteArrayExtra(HARDWARE_KEY_RESPONSE_KEY)
+            Log.d(TAG, "Response form challenge")
+            mUiState.value = UIState.OnChallengeResponded(challengeResponse)
+        } else {
+            Log.e(TAG, "Response from challenge error")
+            mUiState.value = UIState.OnChallengeResponded(null)
+        }
+    }
+
+    sealed class UIState {
+        object Loading : UIState()
+        data class ShowHardwareKeyDriverNeeded(
+            val hardwareKey: HardwareKey?
+        ): UIState()
+        data class LaunchChallengeActivityForResponse(
+            val challenge: ByteArray?,
+        ): UIState() {
+            override fun equals(other: Any?): Boolean {
+                if (this === other) return true
+                if (javaClass != other?.javaClass) return false
+
+                other as LaunchChallengeActivityForResponse
+
+                return challenge.contentEquals(other.challenge)
+            }
+
+            override fun hashCode(): Int {
+                return challenge?.contentHashCode() ?: 0
+            }
+        }
+        data class OnChallengeResponded(
+            val response: ByteArray?
+        ): UIState() {
+            override fun equals(other: Any?): Boolean {
+                if (this === other) return true
+                if (javaClass != other?.javaClass) return false
+
+                other as OnChallengeResponded
+
+                return response.contentEquals(other.response)
+            }
+
+            override fun hashCode(): Int {
+                return response?.contentHashCode() ?: 0
+            }
+        }
+    }
+
+    companion object {
+        private val TAG = HardwareKeyLauncherViewModel::class.java.name
+
+        private const val DATA_HARDWARE_KEY = "DATA_HARDWARE_KEY"
+        private const val DATA_SEED = "DATA_SEED"
+
+        // Driver call
+        private const val YUBIKEY_CHALLENGE_RESPONSE_INTENT = "android.yubikey.intent.action.CHALLENGE_RESPONSE"
+        private const val HARDWARE_KEY_CHALLENGE_KEY = "challenge"
+        private const val HARDWARE_KEY_RESPONSE_KEY = "response"
+
+        fun isYubikeyDriverAvailable(context: Context): Boolean {
+            return Intent(YUBIKEY_CHALLENGE_RESPONSE_INTENT)
+                .resolveActivity(context.packageManager) != null
+        }
+
+        fun buildHardwareKeyChallenge(challenge: ByteArray?): Intent {
+            return Intent(YUBIKEY_CHALLENGE_RESPONSE_INTENT).apply {
+                putExtra(HARDWARE_KEY_CHALLENGE_KEY, challenge)
+            }
+        }
+
+        fun Intent.addHardwareKey(hardwareKey: HardwareKey) {
+            putExtra(DATA_HARDWARE_KEY, hardwareKey.value)
+        }
+
+        fun Intent.addSeed(seed: ByteArray?) {
+            putExtra(DATA_SEED, seed)
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/credentialprovider/viewmodel/PasskeyLauncherViewModel.kt

@@ -0,0 +1,550 @@
+package com.kunzisoft.keepass.credentialprovider.viewmodel
+
+import android.app.Activity.RESULT_CANCELED
+import android.app.Activity.RESULT_OK
+import android.app.Application
+import android.content.Intent
+import android.os.Build
+import android.util.Log
+import androidx.activity.result.ActivityResult
+import androidx.annotation.RequiresApi
+import androidx.credentials.GetCredentialResponse
+import androidx.credentials.exceptions.GetCredentialUnknownException
+import androidx.credentials.provider.PendingIntentHandler
+import androidx.lifecycle.viewModelScope
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.removeInfo
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.removeNodeId
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveNodeId
+import com.kunzisoft.keepass.credentialprovider.EntrySelectionHelper.retrieveSearchInfo
+import com.kunzisoft.keepass.credentialprovider.SpecialMode
+import com.kunzisoft.keepass.credentialprovider.TypeMode
+import com.kunzisoft.keepass.credentialprovider.passkey.data.AndroidPrivilegedApp
+import com.kunzisoft.keepass.credentialprovider.passkey.data.PublicKeyCredentialCreationParameters
+import com.kunzisoft.keepass.credentialprovider.passkey.data.PublicKeyCredentialUsageParameters
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.buildCreatePublicKeyCredentialResponse
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.buildPasskeyPublicKeyCredential
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.checkSecurity
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.getVerifiedGETClientDataResponse
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.removeAppOrigin
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.removePasskey
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.retrieveAppOrigin
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.retrievePasskey
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.retrievePasskeyCreationRequestParameters
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PasskeyHelper.retrievePasskeyUsageRequestParameters
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PrivilegedAllowLists
+import com.kunzisoft.keepass.credentialprovider.passkey.util.PrivilegedAllowLists.saveCustomPrivilegedApps
+import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.database.element.Entry
+import com.kunzisoft.keepass.database.element.node.NodeIdUUID
+import com.kunzisoft.keepass.database.exception.RegisterInReadOnlyDatabaseException
+import com.kunzisoft.keepass.database.helper.SearchHelper
+import com.kunzisoft.keepass.model.AppOrigin
+import com.kunzisoft.keepass.model.Passkey
+import com.kunzisoft.keepass.model.RegisterInfo
+import com.kunzisoft.keepass.model.SearchInfo
+import com.kunzisoft.keepass.model.SignatureNotFoundException
+import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.getNewEntry
+import com.kunzisoft.keepass.settings.PreferencesUtil
+import com.kunzisoft.keepass.tasks.ActionRunnable
+import kotlinx.coroutines.CoroutineExceptionHandler
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.flow.MutableStateFlow
+import kotlinx.coroutines.flow.StateFlow
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
+import java.io.IOException
+import java.io.InvalidObjectException
+import java.util.UUID
+
+@RequiresApi(Build.VERSION_CODES.UPSIDE_DOWN_CAKE)
+class PasskeyLauncherViewModel(application: Application): CredentialLauncherViewModel(application) {
+
+    private var mUsageParameters: PublicKeyCredentialUsageParameters? = null
+    private var mCreationParameters: PublicKeyCredentialCreationParameters? = null
+    private var mPasskey: Passkey? = null
+
+    private var mLockDatabaseAfterSelection: Boolean = false
+    private var mBackupEligibility: Boolean = true
+    private var mBackupState: Boolean = false
+
+    private val mUiState = MutableStateFlow<UIState>(UIState.Loading)
+    val uiState: StateFlow<UIState> = mUiState
+
+    fun initialize() {
+        mLockDatabaseAfterSelection = PreferencesUtil.isPasskeyCloseDatabaseEnable(getApplication())
+        mBackupEligibility = PreferencesUtil.isPasskeyBackupEligibilityEnable(getApplication())
+        mBackupState = PreferencesUtil.isPasskeyBackupStateEnable(getApplication())
+    }
+
+    fun showAppPrivilegedDialog(
+        temptingApp: AndroidPrivilegedApp
+    ) {
+        mUiState.value = UIState.ShowAppPrivilegedDialog(temptingApp)
+    }
+
+    fun showAppSignatureDialog(
+        temptingApp: AppOrigin,
+        nodeId: UUID
+    ) {
+        mUiState.value = UIState.ShowAppSignatureDialog(temptingApp, nodeId)
+    }
+
+    fun saveCustomPrivilegedApp(
+        intent: Intent,
+        specialMode: SpecialMode,
+        database: ContextualDatabase?,
+        temptingApp: AndroidPrivilegedApp
+    ) {
+        viewModelScope.launch(CoroutineExceptionHandler { _, e ->
+            showError(e)
+        }) {
+            saveCustomPrivilegedApps(
+                context = getApplication(),
+                privilegedApps = listOf(temptingApp)
+            )
+            launchAction(
+                intent = intent,
+                specialMode = specialMode,
+                database = database
+            )
+        }
+    }
+
+    fun saveAppSignature(
+        database: ContextualDatabase?,
+        temptingApp: AppOrigin,
+        nodeId: UUID
+    ) {
+        viewModelScope.launch(CoroutineExceptionHandler { _, e ->
+            showError(e)
+        }) {
+            // Update the entry with app signature
+            val entry = database
+                ?.getEntryById(NodeIdUUID(nodeId))
+                ?: throw GetCredentialUnknownException(
+                    "No passkey with nodeId $nodeId found"
+                )
+            if (database.isReadOnly)
+                throw RegisterInReadOnlyDatabaseException()
+            val newEntry = Entry(entry)
+            val entryInfo = newEntry.getEntryInfo(
+                database,
+                raw = true,
+                removeTemplateConfiguration = false
+            )
+            entryInfo.saveAppOrigin(database, temptingApp)
+            newEntry.setEntryInfo(database, entryInfo)
+            mUiState.value = UIState.UpdateEntry(
+                oldEntry = entry,
+                newEntry = newEntry
+            )
+        }
+    }
+
+    override fun onExceptionOccurred(e: Throwable) {
+        if (e is PrivilegedAllowLists.PrivilegedException) {
+            showAppPrivilegedDialog(e.temptingApp)
+        } else {
+            super.onExceptionOccurred(e)
+        }
+    }
+
+    override fun launchActionIfNeeded(
+        intent: Intent,
+        specialMode: SpecialMode,
+        database: ContextualDatabase?
+    ) {
+        // Launch with database when a nodeId is present
+        if ((database != null && database.loaded) || intent.retrieveNodeId() == null) {
+            super.launchActionIfNeeded(intent, specialMode, database)
+        }
+    }
+
+    override suspend fun launchAction(
+        intent: Intent,
+        specialMode: SpecialMode,
+        database: ContextualDatabase?
+    ) {
+        val searchInfo = intent.retrieveSearchInfo() ?: SearchInfo()
+        val appOrigin = intent.retrieveAppOrigin() ?: AppOrigin(verified = false)
+        val nodeId = intent.retrieveNodeId()
+        intent.removeInfo()
+        intent.removeAppOrigin()
+        intent.removeNodeId()
+        checkSecurity(intent, nodeId)
+        when (specialMode) {
+            SpecialMode.SELECTION -> {
+                launchSelection(
+                    intent = intent,
+                    database = database,
+                    nodeId = nodeId,
+                    searchInfo = searchInfo,
+                    appOrigin = appOrigin
+                )
+            }
+            SpecialMode.REGISTRATION -> {
+                // TODO Registration in predefined group
+                // launchRegistration(database, nodeId, mSearchInfo)
+                launchRegistration(
+                    intent = intent,
+                    database = database,
+                    nodeId = null,
+                    searchInfo = searchInfo
+                )
+            }
+            else -> {
+                throw InvalidObjectException("Passkey launch mode not supported")
+            }
+        }
+    }
+
+    // -------------
+    //  Selection
+    // -------------
+
+    private suspend fun launchSelection(
+        intent: Intent,
+        database: ContextualDatabase?,
+        nodeId: UUID?,
+        searchInfo: SearchInfo,
+        appOrigin: AppOrigin
+    ) {
+        withContext(Dispatchers.IO) {
+            Log.d(TAG, "Launch passkey selection")
+            retrievePasskeyUsageRequestParameters(
+                intent = intent,
+                context = getApplication()
+            ) { usageParameters ->
+                // Save the requested parameters
+                mUsageParameters = usageParameters
+                // Manage the passkey to use
+                nodeId?.let { nodeId ->
+                    autoSelectPasskeyAndSetResult(database, nodeId, appOrigin)
+                } ?: run {
+                    SearchHelper.checkAutoSearchInfo(
+                        context = getApplication(),
+                        database = database,
+                        searchInfo = searchInfo,
+                        onItemsFound = { _, _ ->
+                            Log.w(
+                                TAG, "Passkey found for auto selection, should not append," +
+                                        "use PasskeyProviderService instead"
+                            )
+                            cancelResult()
+                        },
+                        onItemNotFound = { openedDatabase ->
+                            Log.d(
+                                TAG, "No Passkey found for selection," +
+                                        "launch manual selection in opened database"
+                            )
+                            mCredentialUiState.value =
+                                CredentialState.LaunchGroupActivityForSelection(
+                                    database = openedDatabase,
+                                    searchInfo = searchInfo,
+                                    typeMode = TypeMode.PASSKEY
+                                )
+                        },
+                        onDatabaseClosed = {
+                            Log.d(TAG, "Manual passkey selection in closed database")
+                            mCredentialUiState.value =
+                                CredentialState.LaunchFileDatabaseSelectActivityForSelection(
+                                    searchInfo = searchInfo,
+                                    typeMode = TypeMode.PASSKEY
+                                )
+                        }
+                    )
+                }
+            }
+        }
+    }
+
+    fun autoSelectPasskey(
+        result: ActionRunnable.Result,
+        database: ContextualDatabase
+    ) {
+        viewModelScope.launch(CoroutineExceptionHandler { _, e ->
+            showError(e)
+        }) {
+            if (result.isSuccess) {
+                val entry = result.data?.getNewEntry(database)
+                    ?: throw IOException("No passkey entry found")
+                autoSelectPasskeyAndSetResult(
+                    database = database,
+                    nodeId = entry.nodeId.id,
+                    appOrigin = entry.getAppOrigin()
+                        ?: throw IOException("No App origin found")
+                )
+            } else throw result.exception
+                ?: IOException("Unable to auto select passkey")
+        }
+    }
+
+    private suspend fun autoSelectPasskeyAndSetResult(
+        database: ContextualDatabase?,
+        nodeId: UUID,
+        appOrigin: AppOrigin
+    ) {
+        withContext(Dispatchers.IO) {
+            mUsageParameters?.let { usageParameters ->
+                // To get the passkey from the database
+                val passkey = database
+                    ?.getEntryById(NodeIdUUID(nodeId))
+                    ?.getEntryInfo(database)
+                    ?.passkey
+                    ?: throw IOException(
+                        "No passkey with nodeId $nodeId found"
+                    )
+                // Build the response
+                val result = Intent()
+                try {
+                    PendingIntentHandler.setGetCredentialResponse(
+                        result,
+                        GetCredentialResponse(
+                            buildPasskeyPublicKeyCredential(
+                                requestOptions = usageParameters.publicKeyCredentialRequestOptions,
+                                clientDataResponse = getVerifiedGETClientDataResponse(
+                                    usageParameters = usageParameters,
+                                    appOrigin = appOrigin
+                                ),
+                                passkey = passkey,
+                                defaultBackupEligibility = mBackupEligibility,
+                                defaultBackupState = mBackupState
+                            )
+                        )
+                    )
+                    setResult(result, lockDatabase = mLockDatabaseAfterSelection)
+                } catch (e: SignatureNotFoundException) {
+                    // Request the dialog if signature exception
+                    showAppSignatureDialog(e.temptingApp, nodeId)
+                }
+            } ?: throw IOException("Usage parameters is null")
+        }
+    }
+
+    override fun manageSelectionResult(
+        database: ContextualDatabase,
+        activityResult: ActivityResult
+    ) {
+        super.manageSelectionResult(database, activityResult)
+        val intent = activityResult.data
+        viewModelScope.launch(CoroutineExceptionHandler { _, e ->
+            Log.e(TAG, "Unable to create selection response for passkey", e)
+            if (e is SignatureNotFoundException) {
+                intent?.retrieveNodeId()?.let { nodeId ->
+                    showAppSignatureDialog(e.temptingApp, nodeId)
+                } ?: cancelResult()
+            } else {
+                showError(e)
+            }
+        }) {
+            // Build a new formatted response from the selection response
+            val responseIntent = Intent()
+            when (activityResult.resultCode) {
+                RESULT_OK -> {
+                    withContext(Dispatchers.IO) {
+                        Log.d(TAG, "Passkey selection result")
+                        if (intent == null)
+                            throw IOException("Intent is null")
+                        val passkey = intent.retrievePasskey()
+                            ?: throw IOException("Passkey is null")
+                        val appOrigin = intent.retrieveAppOrigin()
+                            ?: throw IOException("App origin is null")
+                        intent.removePasskey()
+                        intent.removeAppOrigin()
+                        mUsageParameters?.let { usageParameters ->
+                            // Check verified origin
+                            PendingIntentHandler.setGetCredentialResponse(
+                                responseIntent,
+                                GetCredentialResponse(
+                                    buildPasskeyPublicKeyCredential(
+                                        requestOptions = usageParameters.publicKeyCredentialRequestOptions,
+                                        clientDataResponse = getVerifiedGETClientDataResponse(
+                                            usageParameters = usageParameters,
+                                            appOrigin = appOrigin
+                                        ),
+                                        passkey = passkey,
+                                        defaultBackupEligibility = mBackupEligibility,
+                                        defaultBackupState = mBackupState
+                                    )
+                                )
+                            )
+                        } ?: run {
+                            throw IOException("Usage parameters is null")
+                        }
+                        withContext(Dispatchers.Main) {
+                            setResult(responseIntent, lockDatabase = mLockDatabaseAfterSelection)
+                        }
+                    }
+                }
+                RESULT_CANCELED -> {
+                    withContext(Dispatchers.Main) {
+                        cancelResult()
+                    }
+                }
+            }
+        }
+    }
+
+    // -------------
+    //  Registration
+    // -------------
+
+    private suspend fun launchRegistration(
+        intent: Intent,
+        database: ContextualDatabase?,
+        nodeId: UUID?,
+        searchInfo: SearchInfo
+    ) {
+        withContext(Dispatchers.IO) {
+            Log.d(TAG, "Launch passkey registration")
+            retrievePasskeyCreationRequestParameters(
+                intent = intent,
+                context = getApplication(),
+                defaultBackupEligibility = mBackupEligibility,
+                defaultBackupState = mBackupState,
+                passkeyCreated = { passkey, appInfoToStore, publicKeyCredentialParameters ->
+                    // Save the requested parameters
+                    mPasskey = passkey
+                    mCreationParameters = publicKeyCredentialParameters
+                    // Manage the passkey and create a register info
+                    val registerInfo = RegisterInfo(
+                        searchInfo = searchInfo,
+                        passkey = passkey,
+                        appOrigin = appInfoToStore
+                    )
+                    // If nodeId already provided
+                    nodeId?.let { nodeId ->
+                        autoRegisterPasskeyAndSetResult(database, nodeId, passkey)
+                    } ?: run {
+                        SearchHelper.checkAutoSearchInfo(
+                            context = getApplication(),
+                            database = database,
+                            searchInfo = searchInfo,
+                            onItemsFound = { openedDatabase, _ ->
+                                Log.w(
+                                    TAG, "Passkey found for registration, " +
+                                            "but launch manual registration for a new entry"
+                                )
+                                mCredentialUiState.value =
+                                    CredentialState.LaunchGroupActivityForRegistration(
+                                        database = openedDatabase,
+                                        registerInfo = registerInfo,
+                                        typeMode = TypeMode.PASSKEY
+                                    )
+                            },
+                            onItemNotFound = { openedDatabase ->
+                                Log.d(TAG, "Launch new manual registration in opened database")
+                                mCredentialUiState.value =
+                                    CredentialState.LaunchGroupActivityForRegistration(
+                                        database = openedDatabase,
+                                        registerInfo = registerInfo,
+                                        typeMode = TypeMode.PASSKEY
+                                    )
+                            },
+                            onDatabaseClosed = {
+                                Log.d(TAG, "Manual passkey registration in closed database")
+                                mCredentialUiState.value =
+                                    CredentialState.LaunchFileDatabaseSelectActivityForRegistration(
+                                        registerInfo = registerInfo,
+                                        typeMode = TypeMode.PASSKEY
+                                    )
+                            }
+                        )
+                    }
+                }
+            )
+        }
+    }
+
+    private suspend fun autoRegisterPasskeyAndSetResult(
+        database: ContextualDatabase?,
+        nodeId: UUID,
+        passkey: Passkey
+    ) {
+        withContext(Dispatchers.IO) {
+            mCreationParameters?.let { creationParameters ->
+                // To set the passkey to the database
+                // TODO Overwrite and Register in a predefined group
+                withContext(Dispatchers.Main) {
+                    setResult(Intent())
+                }
+            } ?: run {
+                withContext(Dispatchers.Main) {
+                    Log.e(TAG, "Unable to auto select passkey, usage parameters are empty")
+                    cancelResult()
+                }
+            }
+        }
+    }
+
+    override fun manageRegistrationResult(activityResult: ActivityResult) {
+        val intent = activityResult.data
+        viewModelScope.launch(CoroutineExceptionHandler { _, e ->
+            Log.e(TAG, "Unable to create registration response for passkey", e)
+            if (e is SignatureNotFoundException) {
+                intent?.retrieveNodeId()?.let { nodeId ->
+                    showAppSignatureDialog(e.temptingApp, nodeId)
+                } ?: cancelResult()
+            } else {
+                showError(e)
+            }
+        }) {
+            // Build a new formatted response from the creation response
+            val responseIntent = Intent()
+            when (activityResult.resultCode) {
+                RESULT_OK -> {
+                    withContext(Dispatchers.IO) {
+                        Log.d(TAG, "Passkey registration result")
+                        val passkey = intent?.retrievePasskey()
+                        intent?.removePasskey()
+                        intent?.removeAppOrigin()
+                        // If registered passkey is the same as the one we want to validate,
+                        if (mPasskey == passkey) {
+                            mCreationParameters?.let {
+                                PendingIntentHandler.setCreateCredentialResponse(
+                                    intent = responseIntent,
+                                    response = buildCreatePublicKeyCredentialResponse(
+                                        publicKeyCredentialCreationParameters = it,
+                                        backupEligibility = passkey?.backupEligibility
+                                            ?: mBackupEligibility,
+                                        backupState = passkey?.backupState
+                                            ?: mBackupState
+                                    )
+                                )
+                            }
+                        } else {
+                            throw SecurityException("Passkey was modified before registration")
+                        }
+                        withContext(Dispatchers.Main) {
+                            setResult(responseIntent)
+                        }
+                    }
+                }
+                RESULT_CANCELED -> {
+                    withContext(Dispatchers.Main) {
+                        cancelResult()
+                    }
+                }
+            }
+        }
+    }
+
+    sealed class UIState {
+        object Loading : UIState()
+        data class ShowAppPrivilegedDialog(
+            val temptingApp: AndroidPrivilegedApp
+        ): UIState()
+        data class ShowAppSignatureDialog(
+            val temptingApp: AppOrigin,
+            val nodeId: UUID
+        ): UIState()
+        data class UpdateEntry(
+            val oldEntry: Entry,
+            val newEntry: Entry
+        ): UIState()
+    }
+
+    companion object {
+        private val TAG = PasskeyLauncherViewModel::class.java.name
+    }
+}

app/src/main/java/com/kunzisoft/keepass/database/DatabaseTaskProvider.kt

@@ -19,7 +19,6 @@
  */
 package com.kunzisoft.keepass.database
 
-import android.Manifest
 import android.content.BroadcastReceiver
 import android.content.ComponentName
 import android.content.Context
@@ -29,23 +28,15 @@ import android.content.Context.BIND_IMPORTANT
 import android.content.Intent
 import android.content.IntentFilter
 import android.content.ServiceConnection
-import android.content.pm.PackageManager
 import android.net.Uri
-import android.os.Build
 import android.os.Bundle
 import android.os.IBinder
 import android.util.Log
 import android.widget.Toast
-import androidx.activity.result.contract.ActivityResultContracts
 import androidx.appcompat.app.AlertDialog
-import androidx.core.app.ActivityCompat.shouldShowRequestPermissionRationale
 import androidx.core.content.ContextCompat
 import androidx.core.content.ContextCompat.RECEIVER_NOT_EXPORTED
-import androidx.fragment.app.FragmentActivity
-import androidx.lifecycle.lifecycleScope
 import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.activities.dialogs.DatabaseChangedDialogFragment
-import com.kunzisoft.keepass.activities.dialogs.DatabaseChangedDialogFragment.Companion.DATABASE_CHANGED_DIALOG_TAG
 import com.kunzisoft.keepass.database.crypto.EncryptionAlgorithm
 import com.kunzisoft.keepass.database.crypto.kdf.KdfEngine
 import com.kunzisoft.keepass.database.element.Entry
@@ -55,7 +46,6 @@ import com.kunzisoft.keepass.database.element.node.Node
 import com.kunzisoft.keepass.database.element.node.NodeId
 import com.kunzisoft.keepass.database.element.node.Type
 import com.kunzisoft.keepass.model.CipherEncryptDatabase
-import com.kunzisoft.keepass.model.SnapFileDatabaseInfo
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_CHALLENGE_RESPONDED
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_ASSIGN_CREDENTIAL_TASK
@@ -89,13 +79,9 @@ import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_UPDATE_RECYCLE_BIN_TASK
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_UPDATE_TEMPLATES_GROUP_TASK
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.getBundleFromListNodes
-import com.kunzisoft.keepass.tasks.ActionRunnable
-import com.kunzisoft.keepass.tasks.ProgressTaskDialogFragment
-import com.kunzisoft.keepass.tasks.ProgressTaskDialogFragment.Companion.PROGRESS_TASK_DIALOG_TAG
 import com.kunzisoft.keepass.utils.DATABASE_START_TASK_ACTION
 import com.kunzisoft.keepass.utils.DATABASE_STOP_TASK_ACTION
 import com.kunzisoft.keepass.utils.putParcelableList
-import kotlinx.coroutines.launch
 import java.util.UUID
 
 /**
@@ -103,175 +89,58 @@ import java.util.UUID
  * Useful to retrieve a database instance and sending tasks commands
  */
 class DatabaseTaskProvider(
-    private var context: Context,
-    private var showDialog: Boolean = true
+    private var context: Context
 ) {
 
-    // To show dialog only if context is an activity
-    private var activity: FragmentActivity? = try { context as? FragmentActivity? }
-    catch (_: Exception) { null }
-
     var onDatabaseRetrieved: ((database: ContextualDatabase?) -> Unit)? = null
 
-    var onActionFinish: ((database: ContextualDatabase,
-                          actionTask: String,
-                          result: ActionRunnable.Result) -> Unit)? = null
-
-    private var intentDatabaseTask: Intent = Intent(
-        context.applicationContext,
-        DatabaseTaskNotificationService::class.java
-    )
+    var onStartActionRequested: ((bundle: Bundle?, actionTask: String) -> Unit)? = null
+    var actionTaskListener: DatabaseTaskNotificationService.ActionTaskListener? = null
+    var databaseInfoListener: DatabaseTaskNotificationService.DatabaseInfoListener? = null
 
     private var databaseTaskBroadcastReceiver: BroadcastReceiver? = null
     private var mBinder: DatabaseTaskNotificationService.ActionTaskBinder? = null
 
     private var serviceConnection: ServiceConnection? = null
 
-    private var progressTaskDialogFragment: ProgressTaskDialogFragment? = null
-    private var databaseChangedDialogFragment: DatabaseChangedDialogFragment? = null
-
     fun destroy() {
-        this.activity = null
         this.onDatabaseRetrieved = null
-        this.onActionFinish = null
         this.databaseTaskBroadcastReceiver = null
         this.mBinder = null
         this.serviceConnection = null
-        this.progressTaskDialogFragment = null
-        this.databaseChangedDialogFragment = null
     }
 
-    private val actionTaskListener = object: DatabaseTaskNotificationService.ActionTaskListener {
-        override fun onActionStarted(
-            database: ContextualDatabase,
-            progressMessage: ProgressMessage
-        ) {
-            if (showDialog)
-                startDialog(progressMessage)
-        }
-
-        override fun onActionUpdated(
-            database: ContextualDatabase,
-            progressMessage: ProgressMessage
-        ) {
-            if (showDialog)
-                updateDialog(progressMessage)
-        }
-
-        override fun onActionStopped(
-            database: ContextualDatabase
-        ) {
-            // Remove the progress task
-            stopDialog()
-        }
-
-        override fun onActionFinished(
-            database: ContextualDatabase,
-            actionTask: String,
-            result: ActionRunnable.Result
-        ) {
-            onActionFinish?.invoke(database, actionTask, result)
-            onActionStopped(database)
-        }
+    fun onDatabaseChangeValidated() {
+        mBinder?.getService()?.saveDatabaseInfo()
     }
 
-    private val mActionDatabaseListener = object: DatabaseChangedDialogFragment.ActionDatabaseChangedListener {
-        override fun validateDatabaseChanged() {
-            mBinder?.getService()?.saveDatabaseInfo()
-        }
-    }
-
-    private var databaseInfoListener = object:
-        DatabaseTaskNotificationService.DatabaseInfoListener {
-        override fun onDatabaseInfoChanged(
-            previousDatabaseInfo: SnapFileDatabaseInfo,
-            newDatabaseInfo: SnapFileDatabaseInfo,
-            readOnlyDatabase: Boolean
-        ) {
-            activity?.let { activity ->
-                activity.lifecycleScope.launch {
-                    if (databaseChangedDialogFragment == null) {
-                        databaseChangedDialogFragment = activity.supportFragmentManager
-                            .findFragmentByTag(DATABASE_CHANGED_DIALOG_TAG) as DatabaseChangedDialogFragment?
-                        databaseChangedDialogFragment?.actionDatabaseListener =
-                            mActionDatabaseListener
-                    }
-                    if (progressTaskDialogFragment == null) {
-                        databaseChangedDialogFragment = DatabaseChangedDialogFragment.getInstance(
-                            previousDatabaseInfo,
-                            newDatabaseInfo,
-                            readOnlyDatabase
-                        )
-                        databaseChangedDialogFragment?.actionDatabaseListener =
-                            mActionDatabaseListener
-                        databaseChangedDialogFragment?.show(
-                            activity.supportFragmentManager,
-                            DATABASE_CHANGED_DIALOG_TAG
-                        )
-                    }
-                }
-            }
-        }
-    }
-
-    private var databaseListener = object: DatabaseTaskNotificationService.DatabaseListener {
+    private var databaseListener = object : DatabaseTaskNotificationService.DatabaseListener {
         override fun onDatabaseRetrieved(database: ContextualDatabase?) {
             onDatabaseRetrieved?.invoke(database)
         }
     }
 
-    private fun startDialog(progressMessage: ProgressMessage) {
-        activity?.let { activity ->
-            activity.lifecycleScope.launch {
-                if (progressTaskDialogFragment == null) {
-                    progressTaskDialogFragment = activity.supportFragmentManager
-                        .findFragmentByTag(PROGRESS_TASK_DIALOG_TAG) as ProgressTaskDialogFragment?
-                }
-                if (progressTaskDialogFragment == null) {
-                    progressTaskDialogFragment = ProgressTaskDialogFragment()
-                    progressTaskDialogFragment?.show(
-                        activity.supportFragmentManager,
-                        PROGRESS_TASK_DIALOG_TAG
-                    )
-                }
-                updateDialog(progressMessage)
-            }
-        }
-    }
-
-    private fun updateDialog(progressMessage: ProgressMessage) {
-        progressTaskDialogFragment?.apply {
-            updateTitle(progressMessage.titleId)
-            updateMessage(progressMessage.messageId)
-            updateWarning(progressMessage.warningId)
-            setCancellable(progressMessage.cancelable)
-        }
-    }
-
-    private fun stopDialog() {
-        progressTaskDialogFragment?.dismissAllowingStateLoss()
-        progressTaskDialogFragment = null
-    }
-
     private fun initServiceConnection() {
-        stopDialog()
         if (serviceConnection == null) {
             serviceConnection = object : ServiceConnection {
                 override fun onBindingDied(name: ComponentName?) {
-                    stopDialog()
+                    actionTaskListener?.onActionStopped()
+                    onDatabaseRetrieved?.invoke(null)
                 }
 
                 override fun onNullBinding(name: ComponentName?) {
-                    stopDialog()
+                    actionTaskListener?.onActionStopped()
+                    onDatabaseRetrieved?.invoke(null)
                 }
 
                 override fun onServiceConnected(name: ComponentName?, serviceBinder: IBinder?) {
-                    mBinder = (serviceBinder as DatabaseTaskNotificationService.ActionTaskBinder?)?.apply {
-                        addServiceListeners(this)
-                        getService().checkDatabase()
-                        getService().checkDatabaseInfo()
-                        getService().checkAction()
-                    }
+                    mBinder =
+                        (serviceBinder as DatabaseTaskNotificationService.ActionTaskBinder?)?.apply {
+                            addServiceListeners(this)
+                            getService().checkDatabase()
+                            getService().checkDatabaseInfo()
+                            getService().checkAction()
+                        }
                 }
 
                 override fun onServiceDisconnected(name: ComponentName?) {
@@ -284,20 +153,36 @@ class DatabaseTaskProvider(
 
     private fun addServiceListeners(service: DatabaseTaskNotificationService.ActionTaskBinder?) {
         service?.addDatabaseListener(databaseListener)
-        service?.addDatabaseFileInfoListener(databaseInfoListener)
-        service?.addActionTaskListener(actionTaskListener)
+        databaseInfoListener?.let { infoListener ->
+            service?.addDatabaseFileInfoListener(infoListener)
+        }
+        actionTaskListener?.let { taskListener ->
+            service?.addActionTaskListener(taskListener)
+        }
     }
 
     private fun removeServiceListeners(service: DatabaseTaskNotificationService.ActionTaskBinder?) {
-        service?.removeActionTaskListener(actionTaskListener)
-        service?.removeDatabaseFileInfoListener(databaseInfoListener)
+        actionTaskListener?.let { taskListener ->
+            service?.removeActionTaskListener(taskListener)
+        }
+        databaseInfoListener?.let { infoListener ->
+            service?.removeDatabaseFileInfoListener(infoListener)
+        }
         service?.removeDatabaseListener(databaseListener)
+        onDatabaseRetrieved?.invoke(null)
     }
 
     private fun bindService() {
         initServiceConnection()
         serviceConnection?.let {
-            context.bindService(intentDatabaseTask, it, BIND_AUTO_CREATE or BIND_IMPORTANT or BIND_ABOVE_CLIENT)
+            context.bindService(
+                Intent(
+                    context.applicationContext,
+                    DatabaseTaskNotificationService::class.java
+                ),
+                it,
+                BIND_AUTO_CREATE or BIND_IMPORTANT or BIND_ABOVE_CLIENT
+            )
         }
     }
 
@@ -325,6 +210,7 @@ class DatabaseTaskProvider(
                         // Bind to the service when is starting
                         bindService()
                     }
+
                     DATABASE_STOP_TASK_ACTION -> {
                         // Remove the progress task
                         unBindService()
@@ -332,7 +218,8 @@ class DatabaseTaskProvider(
                 }
             }
         }
-        ContextCompat.registerReceiver(context, databaseTaskBroadcastReceiver,
+        ContextCompat.registerReceiver(
+            context, databaseTaskBroadcastReceiver,
             IntentFilter().apply {
                 addAction(DATABASE_START_TASK_ACTION)
                 addAction(DATABASE_STOP_TASK_ACTION)
@@ -356,58 +243,9 @@ class DatabaseTaskProvider(
         }
     }
 
-    private val tempServiceParameters = mutableListOf<Pair<Bundle?, String>>()
-    private val requestPermissionLauncher = activity?.registerForActivityResult(
-        ActivityResultContracts.RequestPermission()
-    ) { _ ->
-        // Whether or not the user has accepted, the service can be started,
-        // There just won't be any notification if it's not allowed.
-        tempServiceParameters.removeFirstOrNull()?.let {
-            startService(it.first, it.second)
-        }
-    }
-
     private fun start(bundle: Bundle? = null, actionTask: String) {
-        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
-            val contextActivity = activity
-            if (ContextCompat.checkSelfPermission(context, Manifest.permission.POST_NOTIFICATIONS)
-                == PackageManager.PERMISSION_GRANTED
-            ) {
-                startService(bundle, actionTask)
-            } else if (contextActivity != null && shouldShowRequestPermissionRationale(
-                    contextActivity,
-                    Manifest.permission.POST_NOTIFICATIONS
-                )
-            ) {
-                // it's not the first time, so the user deliberately chooses not to display the notification
-                startService(bundle, actionTask)
-            } else {
-                AlertDialog.Builder(context)
-                    .setMessage(R.string.warning_database_notification_permission)
-                    .setNegativeButton(R.string.later) { _, _ ->
-                        // Refuses the notification, so start the service
-                        startService(bundle, actionTask)
-                    }
-                    .setPositiveButton(R.string.ask) { _, _ ->
-                        // Save the temp parameters to ask the permission
-                        tempServiceParameters.add(Pair(bundle, actionTask))
-                        requestPermissionLauncher?.launch(Manifest.permission.POST_NOTIFICATIONS)
-                    }.create().show()
-            }
-        } else {
-            startService(bundle, actionTask)
-        }
-    }
-
-    private fun startService(bundle: Bundle? = null, actionTask: String) {
-        try {
-            if (bundle != null)
-                intentDatabaseTask.putExtras(bundle)
-            intentDatabaseTask.action = actionTask
-            context.startService(intentDatabaseTask)
-        } catch (e: Exception) {
-            Log.e(TAG, "Unable to perform database action", e)
-            Toast.makeText(context, R.string.error_start_database_action, Toast.LENGTH_LONG).show()
+        onStartActionRequested?.invoke(bundle, actionTask) ?: run {
+            context.startDatabaseService(bundle, actionTask)
         }
     }
 
@@ -417,47 +255,51 @@ class DatabaseTaskProvider(
       ----
     */
 
-    fun startDatabaseCreate(databaseUri: Uri,
-                            mainCredential: MainCredential
+    fun startDatabaseCreate(
+        databaseUri: Uri,
+        mainCredential: MainCredential
     ) {
         start(Bundle().apply {
             putParcelable(DatabaseTaskNotificationService.DATABASE_URI_KEY, databaseUri)
             putParcelable(DatabaseTaskNotificationService.MAIN_CREDENTIAL_KEY, mainCredential)
-        }
-            , ACTION_DATABASE_CREATE_TASK)
+        }, ACTION_DATABASE_CREATE_TASK)
     }
 
-    fun startDatabaseLoad(databaseUri: Uri,
-                          mainCredential: MainCredential,
-                          readOnly: Boolean,
-                          cipherEncryptDatabase: CipherEncryptDatabase?,
-                          fixDuplicateUuid: Boolean) {
+    fun startDatabaseLoad(
+        databaseUri: Uri,
+        mainCredential: MainCredential,
+        readOnly: Boolean,
+        cipherEncryptDatabase: CipherEncryptDatabase?,
+        fixDuplicateUuid: Boolean
+    ) {
         start(Bundle().apply {
             putParcelable(DatabaseTaskNotificationService.DATABASE_URI_KEY, databaseUri)
             putParcelable(DatabaseTaskNotificationService.MAIN_CREDENTIAL_KEY, mainCredential)
             putBoolean(DatabaseTaskNotificationService.READ_ONLY_KEY, readOnly)
-            putParcelable(DatabaseTaskNotificationService.CIPHER_DATABASE_KEY, cipherEncryptDatabase)
+            putParcelable(
+                DatabaseTaskNotificationService.CIPHER_DATABASE_KEY,
+                cipherEncryptDatabase
+            )
             putBoolean(DatabaseTaskNotificationService.FIX_DUPLICATE_UUID_KEY, fixDuplicateUuid)
-        }
-            , ACTION_DATABASE_LOAD_TASK)
+        }, ACTION_DATABASE_LOAD_TASK)
     }
 
-    fun startDatabaseMerge(save: Boolean,
-                           fromDatabaseUri: Uri? = null,
-                           mainCredential: MainCredential? = null) {
+    fun startDatabaseMerge(
+        save: Boolean,
+        fromDatabaseUri: Uri? = null,
+        mainCredential: MainCredential? = null
+    ) {
         start(Bundle().apply {
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
             putParcelable(DatabaseTaskNotificationService.DATABASE_URI_KEY, fromDatabaseUri)
             putParcelable(DatabaseTaskNotificationService.MAIN_CREDENTIAL_KEY, mainCredential)
-        }
-            , ACTION_DATABASE_MERGE_TASK)
+        }, ACTION_DATABASE_MERGE_TASK)
     }
 
     fun startDatabaseReload(fixDuplicateUuid: Boolean) {
         start(Bundle().apply {
             putBoolean(DatabaseTaskNotificationService.FIX_DUPLICATE_UUID_KEY, fixDuplicateUuid)
-        }
-            , ACTION_DATABASE_RELOAD_TASK)
+        }, ACTION_DATABASE_RELOAD_TASK)
     }
 
     fun askToStartDatabaseReload(conditionToAsk: Boolean, approved: () -> Unit) {
@@ -473,15 +315,15 @@ class DatabaseTaskProvider(
         }
     }
 
-    fun startDatabaseAssignCredential(databaseUri: Uri,
-                                      mainCredential: MainCredential
+    fun startDatabaseAssignCredential(
+        databaseUri: Uri,
+        mainCredential: MainCredential
     ) {
 
         start(Bundle().apply {
             putParcelable(DatabaseTaskNotificationService.DATABASE_URI_KEY, databaseUri)
             putParcelable(DatabaseTaskNotificationService.MAIN_CREDENTIAL_KEY, mainCredential)
-        }
-            , ACTION_DATABASE_ASSIGN_CREDENTIAL_TASK)
+        }, ACTION_DATABASE_ASSIGN_CREDENTIAL_TASK)
     }
 
     /*
@@ -490,54 +332,60 @@ class DatabaseTaskProvider(
       ----
     */
 
-    fun startDatabaseCreateGroup(newGroup: Group,
-                                 parent: Group,
-                                 save: Boolean) {
+    fun startDatabaseCreateGroup(
+        newGroup: Group,
+        parent: Group,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putParcelable(DatabaseTaskNotificationService.GROUP_KEY, newGroup)
             putParcelable(DatabaseTaskNotificationService.PARENT_ID_KEY, parent.nodeId)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_CREATE_GROUP_TASK)
+        }, ACTION_DATABASE_CREATE_GROUP_TASK)
     }
 
-    fun startDatabaseUpdateGroup(oldGroup: Group,
-                                 groupToUpdate: Group,
-                                 save: Boolean) {
+    fun startDatabaseUpdateGroup(
+        oldGroup: Group,
+        groupToUpdate: Group,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putParcelable(DatabaseTaskNotificationService.GROUP_ID_KEY, oldGroup.nodeId)
             putParcelable(DatabaseTaskNotificationService.GROUP_KEY, groupToUpdate)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_GROUP_TASK)
+        }, ACTION_DATABASE_UPDATE_GROUP_TASK)
     }
 
-    fun startDatabaseCreateEntry(newEntry: Entry,
-                                 parent: Group,
-                                 save: Boolean) {
+    fun startDatabaseCreateEntry(
+        newEntry: Entry,
+        parent: Group,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putParcelable(DatabaseTaskNotificationService.ENTRY_KEY, newEntry)
             putParcelable(DatabaseTaskNotificationService.PARENT_ID_KEY, parent.nodeId)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_CREATE_ENTRY_TASK)
+        }, ACTION_DATABASE_CREATE_ENTRY_TASK)
     }
 
-    fun startDatabaseUpdateEntry(oldEntry: Entry,
-                                 entryToUpdate: Entry,
-                                 save: Boolean) {
+    fun startDatabaseUpdateEntry(
+        oldEntry: Entry,
+        entryToUpdate: Entry,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putParcelable(DatabaseTaskNotificationService.ENTRY_ID_KEY, oldEntry.nodeId)
             putParcelable(DatabaseTaskNotificationService.ENTRY_KEY, entryToUpdate)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_ENTRY_TASK)
+        }, ACTION_DATABASE_UPDATE_ENTRY_TASK)
     }
 
-    private fun startDatabaseActionListNodes(actionTask: String,
-                                             nodesPaste: List<Node>,
-                                             newParent: Group?,
-                                             save: Boolean) {
+    private fun startDatabaseActionListNodes(
+        actionTask: String,
+        nodesPaste: List<Node>,
+        newParent: Group?,
+        save: Boolean
+    ) {
         val groupsIdToCopy = ArrayList<NodeId<*>>()
         val entriesIdToCopy = ArrayList<NodeId<UUID>>()
         nodesPaste.forEach { nodeVersioned ->
@@ -545,6 +393,7 @@ class DatabaseTaskProvider(
                 Type.GROUP -> {
                     groupsIdToCopy.add((nodeVersioned as Group).nodeId)
                 }
+
                 Type.ENTRY -> {
                     entriesIdToCopy.add((nodeVersioned as Entry).nodeId)
                 }
@@ -559,24 +408,29 @@ class DatabaseTaskProvider(
             if (newParentId != null)
                 putParcelable(DatabaseTaskNotificationService.PARENT_ID_KEY, newParentId)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , actionTask)
+        }, actionTask)
     }
 
-    fun startDatabaseCopyNodes(nodesToCopy: List<Node>,
-                               newParent: Group,
-                               save: Boolean) {
+    fun startDatabaseCopyNodes(
+        nodesToCopy: List<Node>,
+        newParent: Group,
+        save: Boolean
+    ) {
         startDatabaseActionListNodes(ACTION_DATABASE_COPY_NODES_TASK, nodesToCopy, newParent, save)
     }
 
-    fun startDatabaseMoveNodes(nodesToMove: List<Node>,
-                               newParent: Group,
-                               save: Boolean) {
+    fun startDatabaseMoveNodes(
+        nodesToMove: List<Node>,
+        newParent: Group,
+        save: Boolean
+    ) {
         startDatabaseActionListNodes(ACTION_DATABASE_MOVE_NODES_TASK, nodesToMove, newParent, save)
     }
 
-    fun startDatabaseDeleteNodes(nodesToDelete: List<Node>,
-                                 save: Boolean) {
+    fun startDatabaseDeleteNodes(
+        nodesToDelete: List<Node>,
+        save: Boolean
+    ) {
         startDatabaseActionListNodes(ACTION_DATABASE_DELETE_NODES_TASK, nodesToDelete, null, save)
     }
 
@@ -586,26 +440,28 @@ class DatabaseTaskProvider(
       -----------------
     */
 
-    fun startDatabaseRestoreEntryHistory(mainEntryId: NodeId<UUID>,
-                                         entryHistoryPosition: Int,
-                                         save: Boolean) {
+    fun startDatabaseRestoreEntryHistory(
+        mainEntryId: NodeId<UUID>,
+        entryHistoryPosition: Int,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putParcelable(DatabaseTaskNotificationService.ENTRY_ID_KEY, mainEntryId)
             putInt(DatabaseTaskNotificationService.ENTRY_HISTORY_POSITION_KEY, entryHistoryPosition)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_RESTORE_ENTRY_HISTORY)
+        }, ACTION_DATABASE_RESTORE_ENTRY_HISTORY)
     }
 
-    fun startDatabaseDeleteEntryHistory(mainEntryId: NodeId<UUID>,
-                                        entryHistoryPosition: Int,
-                                        save: Boolean) {
+    fun startDatabaseDeleteEntryHistory(
+        mainEntryId: NodeId<UUID>,
+        entryHistoryPosition: Int,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putParcelable(DatabaseTaskNotificationService.ENTRY_ID_KEY, mainEntryId)
             putInt(DatabaseTaskNotificationService.ENTRY_HISTORY_POSITION_KEY, entryHistoryPosition)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_DELETE_ENTRY_HISTORY)
+        }, ACTION_DATABASE_DELETE_ENTRY_HISTORY)
     }
 
     /*
@@ -614,110 +470,118 @@ class DatabaseTaskProvider(
       -----------------
     */
 
-    fun startDatabaseSaveName(oldName: String,
-                              newName: String,
-                              save: Boolean) {
+    fun startDatabaseSaveName(
+        oldName: String,
+        newName: String,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putString(DatabaseTaskNotificationService.OLD_ELEMENT_KEY, oldName)
             putString(DatabaseTaskNotificationService.NEW_ELEMENT_KEY, newName)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_NAME_TASK)
+        }, ACTION_DATABASE_UPDATE_NAME_TASK)
     }
 
-    fun startDatabaseSaveDescription(oldDescription: String,
-                                     newDescription: String,
-                                     save: Boolean) {
+    fun startDatabaseSaveDescription(
+        oldDescription: String,
+        newDescription: String,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putString(DatabaseTaskNotificationService.OLD_ELEMENT_KEY, oldDescription)
             putString(DatabaseTaskNotificationService.NEW_ELEMENT_KEY, newDescription)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_DESCRIPTION_TASK)
+        }, ACTION_DATABASE_UPDATE_DESCRIPTION_TASK)
     }
 
-    fun startDatabaseSaveDefaultUsername(oldDefaultUsername: String,
-                                         newDefaultUsername: String,
-                                         save: Boolean) {
+    fun startDatabaseSaveDefaultUsername(
+        oldDefaultUsername: String,
+        newDefaultUsername: String,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putString(DatabaseTaskNotificationService.OLD_ELEMENT_KEY, oldDefaultUsername)
             putString(DatabaseTaskNotificationService.NEW_ELEMENT_KEY, newDefaultUsername)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_DEFAULT_USERNAME_TASK)
+        }, ACTION_DATABASE_UPDATE_DEFAULT_USERNAME_TASK)
     }
 
-    fun startDatabaseSaveColor(oldColor: String,
-                               newColor: String,
-                               save: Boolean) {
+    fun startDatabaseSaveColor(
+        oldColor: String,
+        newColor: String,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putString(DatabaseTaskNotificationService.OLD_ELEMENT_KEY, oldColor)
             putString(DatabaseTaskNotificationService.NEW_ELEMENT_KEY, newColor)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_COLOR_TASK)
+        }, ACTION_DATABASE_UPDATE_COLOR_TASK)
     }
 
-    fun startDatabaseSaveCompression(oldCompression: CompressionAlgorithm,
-                                     newCompression: CompressionAlgorithm,
-                                     save: Boolean) {
+    fun startDatabaseSaveCompression(
+        oldCompression: CompressionAlgorithm,
+        newCompression: CompressionAlgorithm,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putSerializable(DatabaseTaskNotificationService.OLD_ELEMENT_KEY, oldCompression)
             putSerializable(DatabaseTaskNotificationService.NEW_ELEMENT_KEY, newCompression)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_COMPRESSION_TASK)
+        }, ACTION_DATABASE_UPDATE_COMPRESSION_TASK)
     }
 
     fun startDatabaseRemoveUnlinkedData(save: Boolean) {
         start(Bundle().apply {
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_REMOVE_UNLINKED_DATA_TASK)
+        }, ACTION_DATABASE_REMOVE_UNLINKED_DATA_TASK)
     }
 
-    fun startDatabaseSaveRecycleBin(oldRecycleBin: Group?,
-                                    newRecycleBin: Group?,
-                                    save: Boolean) {
+    fun startDatabaseSaveRecycleBin(
+        oldRecycleBin: Group?,
+        newRecycleBin: Group?,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putParcelable(DatabaseTaskNotificationService.OLD_ELEMENT_KEY, oldRecycleBin)
             putParcelable(DatabaseTaskNotificationService.NEW_ELEMENT_KEY, newRecycleBin)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_RECYCLE_BIN_TASK)
+        }, ACTION_DATABASE_UPDATE_RECYCLE_BIN_TASK)
     }
 
-    fun startDatabaseSaveTemplatesGroup(oldTemplatesGroup: Group?,
-                                        newTemplatesGroup: Group?,
-                                        save: Boolean) {
+    fun startDatabaseSaveTemplatesGroup(
+        oldTemplatesGroup: Group?,
+        newTemplatesGroup: Group?,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putParcelable(DatabaseTaskNotificationService.OLD_ELEMENT_KEY, oldTemplatesGroup)
             putParcelable(DatabaseTaskNotificationService.NEW_ELEMENT_KEY, newTemplatesGroup)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_TEMPLATES_GROUP_TASK)
+        }, ACTION_DATABASE_UPDATE_TEMPLATES_GROUP_TASK)
     }
 
-    fun startDatabaseSaveMaxHistoryItems(oldMaxHistoryItems: Int,
-                                         newMaxHistoryItems: Int,
-                                         save: Boolean) {
+    fun startDatabaseSaveMaxHistoryItems(
+        oldMaxHistoryItems: Int,
+        newMaxHistoryItems: Int,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putInt(DatabaseTaskNotificationService.OLD_ELEMENT_KEY, oldMaxHistoryItems)
             putInt(DatabaseTaskNotificationService.NEW_ELEMENT_KEY, newMaxHistoryItems)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_MAX_HISTORY_ITEMS_TASK)
+        }, ACTION_DATABASE_UPDATE_MAX_HISTORY_ITEMS_TASK)
     }
 
-    fun startDatabaseSaveMaxHistorySize(oldMaxHistorySize: Long,
-                                        newMaxHistorySize: Long,
-                                        save: Boolean) {
+    fun startDatabaseSaveMaxHistorySize(
+        oldMaxHistorySize: Long,
+        newMaxHistorySize: Long,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putLong(DatabaseTaskNotificationService.OLD_ELEMENT_KEY, oldMaxHistorySize)
             putLong(DatabaseTaskNotificationService.NEW_ELEMENT_KEY, newMaxHistorySize)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_MAX_HISTORY_SIZE_TASK)
+        }, ACTION_DATABASE_UPDATE_MAX_HISTORY_SIZE_TASK)
     }
 
     /*
@@ -726,59 +590,64 @@ class DatabaseTaskProvider(
       -------------------
      */
 
-    fun startDatabaseSaveEncryption(oldEncryption: EncryptionAlgorithm,
-                                    newEncryption: EncryptionAlgorithm,
-                                    save: Boolean) {
+    fun startDatabaseSaveEncryption(
+        oldEncryption: EncryptionAlgorithm,
+        newEncryption: EncryptionAlgorithm,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putSerializable(DatabaseTaskNotificationService.OLD_ELEMENT_KEY, oldEncryption)
             putSerializable(DatabaseTaskNotificationService.NEW_ELEMENT_KEY, newEncryption)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_ENCRYPTION_TASK)
+        }, ACTION_DATABASE_UPDATE_ENCRYPTION_TASK)
     }
 
-    fun startDatabaseSaveKeyDerivation(oldKeyDerivation: KdfEngine,
-                                       newKeyDerivation: KdfEngine,
-                                       save: Boolean) {
+    fun startDatabaseSaveKeyDerivation(
+        oldKeyDerivation: KdfEngine,
+        newKeyDerivation: KdfEngine,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putSerializable(DatabaseTaskNotificationService.OLD_ELEMENT_KEY, oldKeyDerivation)
             putSerializable(DatabaseTaskNotificationService.NEW_ELEMENT_KEY, newKeyDerivation)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_KEY_DERIVATION_TASK)
+        }, ACTION_DATABASE_UPDATE_KEY_DERIVATION_TASK)
     }
 
-    fun startDatabaseSaveIterations(oldIterations: Long,
-                                    newIterations: Long,
-                                    save: Boolean) {
+    fun startDatabaseSaveIterations(
+        oldIterations: Long,
+        newIterations: Long,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putLong(DatabaseTaskNotificationService.OLD_ELEMENT_KEY, oldIterations)
             putLong(DatabaseTaskNotificationService.NEW_ELEMENT_KEY, newIterations)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_ITERATIONS_TASK)
+        }, ACTION_DATABASE_UPDATE_ITERATIONS_TASK)
     }
 
-    fun startDatabaseSaveMemoryUsage(oldMemoryUsage: Long,
-                                     newMemoryUsage: Long,
-                                     save: Boolean) {
+    fun startDatabaseSaveMemoryUsage(
+        oldMemoryUsage: Long,
+        newMemoryUsage: Long,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putLong(DatabaseTaskNotificationService.OLD_ELEMENT_KEY, oldMemoryUsage)
             putLong(DatabaseTaskNotificationService.NEW_ELEMENT_KEY, newMemoryUsage)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_MEMORY_USAGE_TASK)
+        }, ACTION_DATABASE_UPDATE_MEMORY_USAGE_TASK)
     }
 
-    fun startDatabaseSaveParallelism(oldParallelism: Long,
-                                     newParallelism: Long,
-                                     save: Boolean) {
+    fun startDatabaseSaveParallelism(
+        oldParallelism: Long,
+        newParallelism: Long,
+        save: Boolean
+    ) {
         start(Bundle().apply {
             putLong(DatabaseTaskNotificationService.OLD_ELEMENT_KEY, oldParallelism)
             putLong(DatabaseTaskNotificationService.NEW_ELEMENT_KEY, newParallelism)
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
-        }
-            , ACTION_DATABASE_UPDATE_PARALLELISM_TASK)
+        }, ACTION_DATABASE_UPDATE_PARALLELISM_TASK)
     }
 
     /**
@@ -788,18 +657,32 @@ class DatabaseTaskProvider(
         start(Bundle().apply {
             putBoolean(DatabaseTaskNotificationService.SAVE_DATABASE_KEY, save)
             putParcelable(DatabaseTaskNotificationService.DATABASE_URI_KEY, saveToUri)
-        }
-            , ACTION_DATABASE_SAVE)
+        }, ACTION_DATABASE_SAVE)
     }
 
     fun startChallengeResponded(response: ByteArray?) {
         start(Bundle().apply {
             putByteArray(DatabaseTaskNotificationService.DATA_BYTES, response)
-        }
-            , ACTION_CHALLENGE_RESPONDED)
+        }, ACTION_CHALLENGE_RESPONDED)
     }
 
     companion object {
         private val TAG = DatabaseTaskProvider::class.java.name
+
+        fun Context.startDatabaseService(bundle: Bundle? = null, actionTask: String) {
+            try {
+                val intentDatabaseTask = Intent(
+                    applicationContext,
+                    DatabaseTaskNotificationService::class.java
+                )
+                if (bundle != null)
+                    intentDatabaseTask.putExtras(bundle)
+                intentDatabaseTask.action = actionTask
+                startService(intentDatabaseTask)
+            } catch (e: Exception) {
+                Log.e(TAG, "Unable to perform database action", e)
+                Toast.makeText(this, R.string.error_start_database_action, Toast.LENGTH_LONG).show()
+            }
+        }
     }
 }

app/src/main/java/com/kunzisoft/keepass/database/ProgressMessage.kt

@@ -4,7 +4,7 @@ import androidx.annotation.StringRes
 
 data class ProgressMessage(
     @StringRes
-    var titleId: Int,
+    var titleId: Int? = null,
     @StringRes
     var messageId: Int? = null,
     @StringRes

app/src/main/java/com/kunzisoft/keepass/database/helper/LocalizedHelper.kt

@@ -24,14 +24,44 @@ import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.database.element.database.CompressionAlgorithm
 import com.kunzisoft.keepass.database.element.template.TemplateEngine
 import com.kunzisoft.keepass.database.element.template.TemplateField
-import com.kunzisoft.keepass.database.exception.*
+import com.kunzisoft.keepass.database.exception.CopyEntryDatabaseException
+import com.kunzisoft.keepass.database.exception.CopyGroupDatabaseException
+import com.kunzisoft.keepass.database.exception.CorruptedDatabaseException
+import com.kunzisoft.keepass.database.exception.DatabaseInputException
+import com.kunzisoft.keepass.database.exception.DatabaseOutputException
+import com.kunzisoft.keepass.database.exception.DuplicateUuidDatabaseException
+import com.kunzisoft.keepass.database.exception.EmptyKeyDatabaseException
+import com.kunzisoft.keepass.database.exception.FileNotFoundDatabaseException
+import com.kunzisoft.keepass.database.exception.HardwareKeyDatabaseException
+import com.kunzisoft.keepass.database.exception.InvalidAlgorithmDatabaseException
+import com.kunzisoft.keepass.database.exception.InvalidCredentialsDatabaseException
+import com.kunzisoft.keepass.database.exception.KDFMemoryDatabaseException
+import com.kunzisoft.keepass.database.exception.LocalizedException
+import com.kunzisoft.keepass.database.exception.MergeDatabaseKDBException
+import com.kunzisoft.keepass.database.exception.MoveEntryDatabaseException
+import com.kunzisoft.keepass.database.exception.MoveGroupDatabaseException
+import com.kunzisoft.keepass.database.exception.NoMemoryDatabaseException
+import com.kunzisoft.keepass.database.exception.RegisterInReadOnlyDatabaseException
+import com.kunzisoft.keepass.database.exception.SignatureDatabaseException
+import com.kunzisoft.keepass.database.exception.UnknownDatabaseLocationException
+import com.kunzisoft.keepass.database.exception.VersionDatabaseException
+import com.kunzisoft.keepass.database.exception.XMLMalformedDatabaseException
+import com.kunzisoft.keepass.model.PasskeyEntryFields.FIELD_CREDENTIAL_ID
+import com.kunzisoft.keepass.model.PasskeyEntryFields.FIELD_FLAG_BE
+import com.kunzisoft.keepass.model.PasskeyEntryFields.FIELD_FLAG_BS
+import com.kunzisoft.keepass.model.PasskeyEntryFields.FIELD_PRIVATE_KEY
+import com.kunzisoft.keepass.model.PasskeyEntryFields.FIELD_RELYING_PARTY
+import com.kunzisoft.keepass.model.PasskeyEntryFields.FIELD_USERNAME
+import com.kunzisoft.keepass.model.PasskeyEntryFields.FIELD_USER_HANDLE
+import com.kunzisoft.keepass.model.PasskeyEntryFields.PASSKEY_FIELD
 
-fun DatabaseException.getLocalizedMessage(resources: Resources): String? =
+fun LocalizedException.getLocalizedMessage(resources: Resources): String? =
     when (this) {
         is FileNotFoundDatabaseException -> resources.getString(R.string.file_not_found_content)
         is CorruptedDatabaseException -> resources.getString(R.string.corrupted_file)
         is InvalidAlgorithmDatabaseException -> resources.getString(R.string.invalid_algorithm)
         is UnknownDatabaseLocationException -> resources.getString(R.string.error_location_unknown)
+        is RegisterInReadOnlyDatabaseException -> resources.getString(R.string.error_save_read_only)
         is HardwareKeyDatabaseException -> resources.getString(R.string.error_hardware_key_unsupported)
         is EmptyKeyDatabaseException -> resources.getString(R.string.error_empty_key)
         is SignatureDatabaseException -> resources.getString(R.string.invalid_db_sig)
@@ -63,6 +93,11 @@ fun TemplateField.isStandardPasswordName(context: Context, name: String): Boolea
             || name == getLocalizedName(context, LABEL_PASSWORD)
 }
 
+fun TemplateField.isPasskeyLabel(context: Context, name: String): Boolean {
+    return name.equals(PASSKEY_FIELD, true)
+            || name == getLocalizedName(context, PASSKEY_FIELD)
+}
+
 fun TemplateField.getLocalizedName(context: Context?, name: String): String {
     if (context == null
         || TemplateEngine.containsTemplateDecorator(name)
@@ -107,6 +142,15 @@ fun TemplateField.getLocalizedName(context: Context?, name: String): String {
         LABEL_SECURE_NOTE.equals(name, true) -> context.getString(R.string.secure_note)
         LABEL_MEMBERSHIP.equals(name, true) -> context.getString(R.string.membership)
 
+        PASSKEY_FIELD.equals(name, true) -> context.getString(R.string.passkey)
+        FIELD_USERNAME.equals(name, true) -> context.getString(R.string.passkey_username)
+        FIELD_PRIVATE_KEY.equals(name, true) -> context.getString(R.string.passkey_private_key)
+        FIELD_CREDENTIAL_ID.equals(name, true) -> context.getString(R.string.passkey_credential_id)
+        FIELD_USER_HANDLE.equals(name, true) -> context.getString(R.string.passkey_user_handle)
+        FIELD_RELYING_PARTY.equals(name, true) -> context.getString(R.string.passkey_relying_party)
+        FIELD_FLAG_BE.equals(name, true) -> context.getString(R.string.passkey_backup_eligibility)
+        FIELD_FLAG_BS.equals(name, true) -> context.getString(R.string.passkey_backup_state)
+
         else -> name
     }
 }

app/src/main/java/com/kunzisoft/keepass/database/helper/SearchHelper.kt

@@ -21,9 +21,16 @@ package com.kunzisoft.keepass.database.helper
 
 import android.content.Context
 import com.kunzisoft.keepass.database.ContextualDatabase
+import com.kunzisoft.keepass.database.search.SearchParameters
 import com.kunzisoft.keepass.model.EntryInfo
 import com.kunzisoft.keepass.model.SearchInfo
+import com.kunzisoft.keepass.settings.PreferencesUtil.searchSubDomains
 import com.kunzisoft.keepass.timeout.TimeoutHelper
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.Dispatchers
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
+import mozilla.components.lib.publicsuffixlist.PublicSuffixList
 
 object SearchHelper {
 
@@ -41,38 +48,112 @@ object SearchHelper {
     }
 
     /**
-     * Utility method to perform actions if item is found or not after an auto search in [database]
+     * Get the concrete web domain AKA without sub domain if needed
      */
-    fun checkAutoSearchInfo(context: Context,
-                            database: ContextualDatabase?,
-                            searchInfo: SearchInfo?,
-                            onItemsFound: (openedDatabase: ContextualDatabase,
-                                           items: List<EntryInfo>) -> Unit,
-                            onItemNotFound: (openedDatabase: ContextualDatabase) -> Unit,
-                            onDatabaseClosed: () -> Unit) {
-        if (database == null || !database.loaded) {
-            onDatabaseClosed.invoke()
-        } else if (TimeoutHelper.checkTime(context)) {
-            var searchWithoutUI = false
-            if (searchInfo != null
-                && !searchInfo.manualSelection
-                && !searchInfo.containsOnlyNullValues()) {
-                // If search provide results
-                database.createVirtualGroupFromSearchInfo(
-                        searchInfoString = searchInfo.toString(),
-                        searchInfoByDomain = searchInfo.isASearchByDomain(),
-                        max = MAX_SEARCH_ENTRY
-                )?.let { searchGroup ->
-                    if (searchGroup.numberOfChildEntries > 0) {
-                        searchWithoutUI = true
-                        onItemsFound.invoke(database,
-                                searchGroup.getChildEntriesInfo(database))
+    private fun getConcreteWebDomain(
+        context: Context,
+        webDomain: String?,
+        concreteWebDomain: (searchSubDomains: Boolean, concreteWebDomain: String?) -> Unit
+    ) {
+        val domain = webDomain
+        val searchSubDomains = searchSubDomains(context)
+        if (domain != null) {
+            // Warning, web domain can contains IP, don't crop in this case
+            if (searchSubDomains
+                || Regex(SearchInfo.WEB_IP_REGEX).matches(domain)) {
+                concreteWebDomain.invoke(searchSubDomains, webDomain)
+            } else {
+                CoroutineScope(Dispatchers.IO).launch {
+                    val publicSuffixList = PublicSuffixList(context)
+                    val publicSuffix = publicSuffixList
+                        .getPublicSuffixPlusOne(domain).await()
+                    withContext(Dispatchers.Main) {
+                        concreteWebDomain.invoke(false, publicSuffix)
                     }
                 }
             }
-            if (!searchWithoutUI) {
+        } else {
+            concreteWebDomain.invoke(searchSubDomains, null)
+        }
+    }
+
+    /**
+     * Create search parameters asynchronously from [SearchInfo]
+     */
+    fun SearchInfo.getSearchParametersFromSearchInfo(
+        context: Context,
+        callback: (SearchParameters) -> Unit
+    ) {
+        getConcreteWebDomain(
+            context,
+            webDomain
+        ) { searchSubDomains, concreteDomain ->
+            var query = this.toString()
+            if (isDomainSearch && concreteDomain != null)
+                query = concreteDomain
+            callback.invoke(
+                SearchParameters().apply {
+                    searchQuery = query
+                    allowEmptyQuery = false
+                    searchInTitles = false
+                    searchInUsernames = false
+                    searchInPasswords = false
+                    searchInAppIds = isAppIdSearch
+                    searchInUrls = isDomainSearch
+                    searchByDomain = true
+                    searchBySubDomain = searchSubDomains
+                    searchInRelyingParty = isPasskeySearch
+                    searchInNotes = false
+                    searchInOTP = isOTPSearch
+                    searchInOther = false
+                    searchInUUIDs = false
+                    searchInTags = isTagSearch
+                    searchInCurrentGroup = false
+                    searchInSearchableGroup = true
+                    searchInRecycleBin = false
+                    searchInTemplates = false
+                }
+            )
+        }
+    }
+
+    /**
+     * Utility method to perform actions if item is found or not after an auto search in [database]
+     */
+    fun checkAutoSearchInfo(
+        context: Context,
+        database: ContextualDatabase?,
+        searchInfo: SearchInfo?,
+        onItemsFound: (openedDatabase: ContextualDatabase,
+                       items: List<EntryInfo>) -> Unit,
+        onItemNotFound: (openedDatabase: ContextualDatabase) -> Unit,
+        onDatabaseClosed: () -> Unit
+    ) {
+        // Do not place coroutine at start, bug in Passkey implementation
+        if (database == null || !database.loaded) {
+            onDatabaseClosed.invoke()
+        } else if (TimeoutHelper.checkTime(context)) {
+            if (searchInfo != null
+                && !searchInfo.manualSelection
+                && !searchInfo.containsOnlyNullValues()
+            ) {
+                searchInfo.getSearchParametersFromSearchInfo(context) { searchParameters ->
+                    // If search provide results
+                    database.createVirtualGroupFromSearchInfo(
+                        searchParameters = searchParameters,
+                        max = MAX_SEARCH_ENTRY
+                    )?.let { searchGroup ->
+                        if (searchGroup.numberOfChildEntries > 0) {
+                            onItemsFound.invoke(
+                                database,
+                                searchGroup.getChildEntriesInfo(database)
+                            )
+                        } else
+                            onItemNotFound.invoke(database)
+                    } ?: onItemNotFound.invoke(database)
+                }
+            } else
                 onItemNotFound.invoke(database)
-            }
         }
     }
 }

app/src/main/java/com/kunzisoft/keepass/hardware/HardwareKeyActivity.kt

@@ -1,170 +0,0 @@
-package com.kunzisoft.keepass.hardware
-
-import android.app.Activity
-import android.content.Context
-import android.content.DialogInterface
-import android.content.Intent
-import android.content.Intent.FLAG_ACTIVITY_NEW_TASK
-import android.util.Log
-import androidx.activity.result.ActivityResult
-import androidx.activity.result.ActivityResultCallback
-import androidx.activity.result.ActivityResultLauncher
-import androidx.activity.result.contract.ActivityResultContracts
-import androidx.appcompat.app.AlertDialog
-import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.activities.legacy.DatabaseModeActivity
-import com.kunzisoft.keepass.database.ContextualDatabase
-import com.kunzisoft.keepass.utils.UriUtil.openExternalApp
-
-/**
- * Special activity to deal with hardware key drivers,
- * return the response to the database service once finished
- */
-class HardwareKeyActivity: DatabaseModeActivity(){
-
-    // To manage hardware key challenge response
-    private val resultCallback = ActivityResultCallback<ActivityResult> { result ->
-        if (result.resultCode == Activity.RESULT_OK) {
-            val challengeResponse: ByteArray? = result.data?.getByteArrayExtra(HARDWARE_KEY_RESPONSE_KEY)
-            Log.d(TAG, "Response form challenge")
-            mDatabaseTaskProvider?.startChallengeResponded(challengeResponse ?: ByteArray(0))
-        } else {
-            Log.e(TAG, "Response from challenge error")
-            mDatabaseTaskProvider?.startChallengeResponded(ByteArray(0))
-        }
-        finish()
-    }
-
-    private var activityResultLauncher: ActivityResultLauncher<Intent> = registerForActivityResult(
-        ActivityResultContracts.StartActivityForResult(),
-        resultCallback
-    )
-
-    override fun applyCustomStyle(): Boolean {
-        return false
-    }
-
-    override fun showDatabaseDialog(): Boolean {
-        return false
-    }
-
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        super.onDatabaseRetrieved(database)
-
-        val hardwareKey = HardwareKey.getHardwareKeyFromString(
-            intent.getStringExtra(DATA_HARDWARE_KEY)
-        )
-        if (isHardwareKeyAvailable(this, hardwareKey, true) {
-                mDatabaseTaskProvider?.startChallengeResponded(ByteArray(0))
-            }) {
-            when (hardwareKey) {
-                /*
-                HardwareKey.FIDO2_SECRET -> {
-                    // TODO FIDO2 under development
-                    throw Exception("FIDO2 not implemented")
-                }
-                */
-                HardwareKey.CHALLENGE_RESPONSE_YUBIKEY -> {
-                    launchYubikeyChallengeForResponse(intent.getByteArrayExtra(DATA_SEED))
-                }
-                else -> {
-                    finish()
-                }
-            }
-        }
-    }
-
-    private fun launchYubikeyChallengeForResponse(seed: ByteArray?) {
-        // Transform the seed before sending
-        var challenge: ByteArray? = null
-        if (seed != null) {
-            challenge = ByteArray(64)
-            seed.copyInto(challenge, 0, 0, 32)
-            challenge.fill(32, 32, 64)
-        }
-        // Send to the driver
-        activityResultLauncher.launch(
-            Intent(YUBIKEY_CHALLENGE_RESPONSE_INTENT).apply {
-                putExtra(HARDWARE_KEY_CHALLENGE_KEY, challenge)
-            }
-        )
-        Log.d(TAG, "Challenge sent")
-    }
-
-    companion object {
-        private val TAG = HardwareKeyActivity::class.java.simpleName
-
-        private const val DATA_HARDWARE_KEY = "DATA_HARDWARE_KEY"
-        private const val DATA_SEED = "DATA_SEED"
-        private const val YUBIKEY_CHALLENGE_RESPONSE_INTENT = "android.yubikey.intent.action.CHALLENGE_RESPONSE"
-        private const val HARDWARE_KEY_CHALLENGE_KEY = "challenge"
-        private const val HARDWARE_KEY_RESPONSE_KEY = "response"
-
-        fun launchHardwareKeyActivity(
-            context: Context,
-            hardwareKey: HardwareKey,
-            seed: ByteArray?
-        ) {
-            context.startActivity(Intent(context, HardwareKeyActivity::class.java).apply {
-                flags = FLAG_ACTIVITY_NEW_TASK
-                putExtra(DATA_HARDWARE_KEY, hardwareKey.value)
-                putExtra(DATA_SEED, seed)
-            })
-        }
-
-        fun isHardwareKeyAvailable(
-            context: Context,
-            hardwareKey: HardwareKey?,
-            showDialog: Boolean = true,
-            onDialogDismissed: DialogInterface.OnDismissListener? = null
-        ): Boolean {
-            if (hardwareKey == null)
-                return false
-            return when (hardwareKey) {
-                /*
-                HardwareKey.FIDO2_SECRET -> {
-                    // TODO FIDO2 under development
-                    if (showDialog)
-                        UnderDevelopmentFeatureDialogFragment()
-                            .show(activity.supportFragmentManager, "underDevFeatureDialog")
-                    false
-                }
-                */
-                HardwareKey.CHALLENGE_RESPONSE_YUBIKEY -> {
-                    // Check available intent
-                    val yubikeyDriverAvailable =
-                        Intent(YUBIKEY_CHALLENGE_RESPONSE_INTENT)
-                            .resolveActivity(context.packageManager) != null
-                    if (showDialog && !yubikeyDriverAvailable
-                        && context is Activity)
-                        showHardwareKeyDriverNeeded(context, hardwareKey) {
-                            onDialogDismissed?.onDismiss(it)
-                            context.finish()
-                        }
-                    yubikeyDriverAvailable
-                }
-            }
-        }
-
-        private fun showHardwareKeyDriverNeeded(
-            context: Context,
-            hardwareKey: HardwareKey,
-            onDialogDismissed: DialogInterface.OnDismissListener
-        ) {
-            val builder = AlertDialog.Builder(context)
-            builder
-                .setMessage(
-                    context.getString(R.string.error_driver_required, hardwareKey.toString())
-                )
-                .setPositiveButton(R.string.download) { _, _ ->
-                    context.openExternalApp(
-                        context.getString(R.string.key_driver_app_id),
-                        context.getString(R.string.key_driver_url)
-                    )
-                }
-                .setNegativeButton(android.R.string.cancel) { _, _ -> }
-                .setOnDismissListener(onDialogDismissed)
-            builder.create().show()
-        }
-    }
-}

app/src/main/java/com/kunzisoft/keepass/hardware/HardwareKeyResponseHelper.kt

@@ -1,144 +0,0 @@
-package com.kunzisoft.keepass.hardware
-
-import android.app.Activity
-import android.content.Intent
-import android.os.Bundle
-import android.util.Log
-import androidx.activity.result.ActivityResult
-import androidx.activity.result.ActivityResultCallback
-import androidx.activity.result.ActivityResultLauncher
-import androidx.activity.result.contract.ActivityResultContracts
-import androidx.appcompat.app.AlertDialog
-import androidx.fragment.app.Fragment
-import androidx.fragment.app.FragmentActivity
-import androidx.lifecycle.lifecycleScope
-import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.utils.UriUtil.openExternalApp
-import kotlinx.coroutines.launch
-
-class HardwareKeyResponseHelper {
-
-    private var activity: FragmentActivity? = null
-    private var fragment: Fragment? = null
-
-    private var getChallengeResponseResultLauncher: ActivityResultLauncher<Intent>? = null
-
-    constructor(context: FragmentActivity) {
-        this.activity = context
-        this.fragment = null
-    }
-
-    constructor(context: Fragment) {
-        this.activity = context.activity
-        this.fragment = context
-    }
-
-    fun buildHardwareKeyResponse(onChallengeResponded: (challengeResponse: ByteArray?,
-                                                        extra: Bundle?) -> Unit) {
-        val resultCallback = ActivityResultCallback<ActivityResult> { result ->
-            if (result.resultCode == Activity.RESULT_OK) {
-                val challengeResponse: ByteArray? = result.data?.getByteArrayExtra(HARDWARE_KEY_RESPONSE_KEY)
-                Log.d(TAG, "Response form challenge")
-                onChallengeResponded.invoke(challengeResponse,
-                    result.data?.getBundleExtra(EXTRA_BUNDLE_KEY))
-            } else {
-                Log.e(TAG, "Response from challenge error")
-                onChallengeResponded.invoke(null,
-                    result.data?.getBundleExtra(EXTRA_BUNDLE_KEY))
-            }
-        }
-
-        getChallengeResponseResultLauncher = if (fragment != null) {
-            fragment?.registerForActivityResult(
-                ActivityResultContracts.StartActivityForResult(),
-                resultCallback
-            )
-        } else {
-            activity?.registerForActivityResult(
-                ActivityResultContracts.StartActivityForResult(),
-                resultCallback
-            )
-        }
-    }
-
-    fun launchChallengeForResponse(hardwareKey: HardwareKey, seed: ByteArray?) {
-        when (hardwareKey) {
-            /*
-            HardwareKey.FIDO2_SECRET -> {
-                // TODO FIDO2 under development
-                throw Exception("FIDO2 not implemented")
-            }
-            */
-            HardwareKey.CHALLENGE_RESPONSE_YUBIKEY -> {
-                // Transform the seed before sending
-                var challenge: ByteArray? = null
-                if (seed != null) {
-                    challenge = ByteArray(64)
-                    seed.copyInto(challenge, 0, 0, 32)
-                    challenge.fill(32, 32, 64)
-                }
-                // Send to the driver
-                getChallengeResponseResultLauncher!!.launch(
-                    Intent(YUBIKEY_CHALLENGE_RESPONSE_INTENT).apply {
-                        putExtra(HARDWARE_KEY_CHALLENGE_KEY, challenge)
-                    }
-                )
-                Log.d(TAG, "Challenge sent")
-            }
-        }
-    }
-
-    companion object {
-        private val TAG = HardwareKeyResponseHelper::class.java.simpleName
-
-        private const val YUBIKEY_CHALLENGE_RESPONSE_INTENT = "android.yubikey.intent.action.CHALLENGE_RESPONSE"
-        private const val HARDWARE_KEY_CHALLENGE_KEY = "challenge"
-        private const val HARDWARE_KEY_RESPONSE_KEY = "response"
-        private const val EXTRA_BUNDLE_KEY = "EXTRA_BUNDLE_KEY"
-
-        fun isHardwareKeyAvailable(
-            activity: FragmentActivity,
-            hardwareKey: HardwareKey,
-            showDialog: Boolean = true
-        ): Boolean {
-            return when (hardwareKey) {
-                /*
-                HardwareKey.FIDO2_SECRET -> {
-                    // TODO FIDO2 under development
-                    if (showDialog)
-                        UnderDevelopmentFeatureDialogFragment()
-                            .show(activity.supportFragmentManager, "underDevFeatureDialog")
-                    false
-                }
-                */
-                HardwareKey.CHALLENGE_RESPONSE_YUBIKEY -> {
-                    // Check available intent
-                    val yubikeyDriverAvailable =
-                        Intent(YUBIKEY_CHALLENGE_RESPONSE_INTENT)
-                            .resolveActivity(activity.packageManager) != null
-                    if (showDialog && !yubikeyDriverAvailable)
-                        showHardwareKeyDriverNeeded(activity, hardwareKey)
-                    yubikeyDriverAvailable
-                }
-            }
-        }
-
-        private fun showHardwareKeyDriverNeeded(
-            activity: FragmentActivity,
-            hardwareKey: HardwareKey
-        ) {
-            activity.lifecycleScope.launch {
-                val builder = AlertDialog.Builder(activity)
-                builder
-                    .setMessage(
-                        activity.getString(R.string.error_driver_required, hardwareKey.toString())
-                    )
-                    .setPositiveButton(R.string.download) { _, _ ->
-                        activity.openExternalApp(activity.getString(R.string.key_driver_app_id))
-                    }
-                    .setNegativeButton(android.R.string.cancel) { _, _ -> }
-                builder.create().show()
-            }
-        }
-    }
-}

app/src/main/java/com/kunzisoft/keepass/password/PasswordGenerator.kt

@@ -33,20 +33,22 @@ import java.util.*
 class PasswordGenerator(private val resources: Resources) {
 
     @Throws(IllegalArgumentException::class)
-    fun generatePassword(length: Int,
-                         upperCase: Boolean,
-                         lowerCase: Boolean,
-                         digits: Boolean,
-                         minus: Boolean,
-                         underline: Boolean,
-                         space: Boolean,
-                         specials: Boolean,
-                         brackets: Boolean,
-                         extended: Boolean,
-                         considerChars: String,
-                         ignoreChars: String,
-                         atLeastOneFromEach: Boolean,
-                         excludeAmbiguousChar: Boolean): String {
+    fun generatePassword(
+        length: Int,
+        upperCase: Boolean,
+        lowerCase: Boolean,
+        digits: Boolean,
+        minus: Boolean,
+        underline: Boolean,
+        space: Boolean,
+        specials: Boolean,
+        brackets: Boolean,
+        extended: Boolean,
+        considerChars: String,
+        ignoreChars: String,
+        atLeastOneFromEach: Boolean,
+        excludeAmbiguousChar: Boolean
+    ): String {
         // Desired password length is 0 or less
         if (length <= 0) {
             throw IllegalArgumentException(resources.getString(R.string.error_wrong_length))
@@ -228,7 +230,7 @@ class PasswordGenerator(private val resources: Resources) {
         private const val MINUS_CHAR = "-"
         private const val UNDERLINE_CHAR = "_"
         private const val SPACE_CHAR = " "
-        private const val SPECIAL_CHARS = "!\"#$%&'*+,./:;=?@\\^`"
+        private const val SPECIAL_CHARS = "&/,^@.#:%\\='$!?*`;+\"|~"
         private const val BRACKET_CHARS = "[]{}()<>"
         private const val AMBIGUOUS_CHARS = "iI|lLoO01"
 

app/src/main/java/com/kunzisoft/keepass/receivers/DexModeReceiver.kt

@@ -1,13 +1,9 @@
 package com.kunzisoft.keepass.receivers
 
 import android.content.BroadcastReceiver
-import android.content.ComponentName
 import android.content.Context
 import android.content.Intent
-import android.content.pm.PackageManager
 import android.util.Log
-import com.kunzisoft.keepass.magikeyboard.MagikeyboardService
-import com.kunzisoft.keepass.utils.DexUtil
 import com.kunzisoft.keepass.utils.MagikeyboardUtil
 
 class DexModeReceiver : BroadcastReceiver() {

app/src/main/java/com/kunzisoft/keepass/services/AttachmentFileNotificationService.kt

@@ -36,6 +36,7 @@ import com.kunzisoft.keepass.model.AttachmentState
 import com.kunzisoft.keepass.model.EntryAttachmentState
 import com.kunzisoft.keepass.model.StreamDirection
 import com.kunzisoft.keepass.tasks.BinaryDatabaseManager
+import com.kunzisoft.keepass.utils.AppUtil.randomRequestCode
 import com.kunzisoft.keepass.utils.UriUtil.getDocumentFile
 import com.kunzisoft.keepass.utils.getParcelableExtraCompat
 import kotlinx.coroutines.CoroutineScope
@@ -164,7 +165,7 @@ class AttachmentFileNotificationService: LockNotificationService() {
                     }
                 }
                 if (attachmentNotificationList.isEmpty()) {
-                    stopSelf()
+                    stopService()
                 }
             }
         }
@@ -194,7 +195,7 @@ class AttachmentFileNotificationService: LockNotificationService() {
     private fun newNotification(attachmentNotification: AttachmentNotification) {
 
         val pendingContentIntent = PendingIntent.getActivity(this,
-            0,
+            randomRequestCode(),
             Intent().apply {
                 action = Intent.ACTION_VIEW
                 setDataAndType(attachmentNotification.uri,
@@ -208,7 +209,7 @@ class AttachmentFileNotificationService: LockNotificationService() {
         )
 
         val pendingDeleteIntent =  PendingIntent.getService(this,
-                0,
+            randomRequestCode(),
                 Intent(this, AttachmentFileNotificationService::class.java).apply {
                     // No action to delete the service
                     putExtra(FILE_URI_KEY, attachmentNotification.uri)

app/src/main/java/com/kunzisoft/keepass/services/ClipboardEntryNotificationService.kt

@@ -62,7 +62,7 @@ class ClipboardEntryNotificationService : LockNotificationService() {
             sendBroadcast(Intent(LOCK_ACTION))
         }
         // Stop the service
-        stopSelf()
+        stopService()
     }
 
     override fun onStartCommand(intent: Intent?, flags: Int, startId: Int): Int {
@@ -274,10 +274,12 @@ class ClipboardEntryNotificationService : LockNotificationService() {
             val containsPasswordToCopy = entry.password.isNotEmpty()
                     && PreferencesUtil.allowCopyProtectedFields(context)
             val containsOTPToCopy = entry.containsCustomField(OTP_TOKEN_FIELD)
-            val containsExtraFieldToCopy = entry.customFields.isNotEmpty()
-                    && (entry.containsCustomFieldsNotProtected()
+            val customFields = entry.getCustomFieldsForFilling()
+            val containsExtraFieldToCopy = customFields.isNotEmpty()
+                    && (customFields.any { !it.protectedValue.isProtected }
                         ||
-                        (entry.containsCustomFieldsProtected() && PreferencesUtil.allowCopyProtectedFields(context))
+                        (customFields.any { it.protectedValue.isProtected }
+                                && PreferencesUtil.allowCopyProtectedFields(context))
                     )
 
             var startService = false
@@ -320,7 +322,7 @@ class ClipboardEntryNotificationService : LockNotificationService() {
                     if (containsExtraFieldToCopy) {
                         try {
                             var anonymousFieldNumber = 0
-                            entry.customFields.forEach { field ->
+                            entry.getCustomFieldsForFilling().forEach { field ->
                                 //If value is not protected or allowed
                                 if ((!field.protectedValue.isProtected
                                         || PreferencesUtil.allowCopyProtectedFields(context))

app/src/main/java/com/kunzisoft/keepass/services/DatabaseTaskNotificationService.kt

@@ -61,13 +61,14 @@ import com.kunzisoft.keepass.database.element.node.Node
 import com.kunzisoft.keepass.database.element.node.NodeId
 import com.kunzisoft.keepass.database.element.node.Type
 import com.kunzisoft.keepass.hardware.HardwareKey
-import com.kunzisoft.keepass.hardware.HardwareKeyActivity
+import com.kunzisoft.keepass.credentialprovider.activity.HardwareKeyActivity
 import com.kunzisoft.keepass.model.CipherEncryptDatabase
 import com.kunzisoft.keepass.model.SnapFileDatabaseInfo
 import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.tasks.ActionRunnable
 import com.kunzisoft.keepass.tasks.ProgressTaskUpdater
 import com.kunzisoft.keepass.timeout.TimeoutHelper
+import com.kunzisoft.keepass.utils.AppUtil.randomRequestCode
 import com.kunzisoft.keepass.utils.DATABASE_START_TASK_ACTION
 import com.kunzisoft.keepass.utils.DATABASE_STOP_TASK_ACTION
 import com.kunzisoft.keepass.utils.LOCK_ACTION
@@ -175,7 +176,7 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
             progressMessage: ProgressMessage
         )
         fun onActionStopped(
-            database: ContextualDatabase
+            database: ContextualDatabase? = null
         )
         fun onActionFinished(
             database: ContextualDatabase,
@@ -218,7 +219,7 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
                     Log.i(TAG, "Database file modified " +
                             "$previousDatabaseInfo != $lastFileDatabaseInfo ")
                     // Call listener to indicate a change in database info
-                    if (!mSaveState && previousDatabaseInfo != null) {
+                    if (!mSaveState) {
                         mDatabaseInfoListeners.forEach { listener ->
                             listener.onDatabaseInfoChanged(
                                 previousDatabaseInfo,
@@ -261,11 +262,12 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
                     )
                 }
             } else {
+                /* Do not stopped here, service cannot be connected
                 mActionTaskListeners.forEach { actionTaskListener ->
                     actionTaskListener.onActionStopped(
                         database
                     )
-                }
+                }*/
             }
         }
     }
@@ -337,7 +339,7 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
         val intentAction = intent?.action
 
         if (intentAction == null && !database.loaded) {
-            stopSelf()
+            stopService()
         }
 
         val actionRunnable: ActionRunnable? = when (intentAction) {
@@ -446,10 +448,10 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
                                 TimeoutHelper.releaseTemporarilyDisableTimeout()
                                 // Stop service after save if user remove task
                                 if (save && mTaskRemovedRequested) {
-                                    actionOnLock()
+                                    stopService()
                                 } else if (TimeoutHelper.checkTimeAndLockIfTimeout(this@DatabaseTaskNotificationService)) {
                                     if (!database.loaded) {
-                                        stopSelf()
+                                        stopService()
                                     } else {
                                         // Restart the service to open lock notification
                                         try {
@@ -534,11 +536,10 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
 
         val notificationBuilder = buildNewNotification().apply {
             setSmallIcon(iconId)
-            intent?.let {
-                setContentTitle(getString(
-                    intent.getIntExtra(DATABASE_TASK_TITLE_KEY, mProgressMessage.titleId))
-                )
-            }
+            val titleId = mProgressMessage.titleId?.let {
+                intent?.getIntExtra(DATABASE_TASK_TITLE_KEY, it)
+            } ?: R.string.app_name
+            setContentTitle(getString(titleId))
             setAutoCancel(false)
             setContentIntent(null)
         }
@@ -550,7 +551,7 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
                     // Build Intents for notification action
                     val pendingDatabaseIntent = PendingIntent.getActivity(
                         this,
-                        0,
+                        randomRequestCode(),
                         Intent(this, GroupActivity::class.java),
                         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
                             PendingIntent.FLAG_IMMUTABLE or PendingIntent.FLAG_UPDATE_CURRENT
@@ -660,7 +661,9 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
     }
 
     private fun updateMessage(resId: Int) {
-        mProgressMessage.messageId = resId
+        mProgressMessage = mProgressMessage.copy(
+            messageId = resId
+        )
         notifyProgressMessage()
     }
 
@@ -672,13 +675,19 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
         updateMessage(R.string.decrypting_db)
     }
 
-    override fun actionOnLock() {
+    override fun stopService() {
         if (!TimeoutHelper.temporarilyDisableLock) {
             closeDatabase(mDatabase)
+            // Remove the database during the lock
+            // And notify each subscriber
+            mDatabase = null
+            mDatabaseListeners.forEach { listener ->
+                listener.onDatabaseRetrieved(null)
+            }
             // Remove the lock timer (no more needed if it exists)
             TimeoutHelper.cancelLockTimer(this)
             // Service is stopped after receive the broadcast
-            super.actionOnLock()
+            super.stopService()
         }
     }
 
@@ -709,9 +718,9 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
             notifyProgressMessage()
             HardwareKeyActivity
                 .launchHardwareKeyActivity(
-                    this@DatabaseTaskNotificationService,
-                    hardwareKey,
-                    seed
+                    context = this@DatabaseTaskNotificationService,
+                    hardwareKey = hardwareKey,
+                    seed = seed
                 )
             // Wait the response
             mProgressMessage.apply {
@@ -722,7 +731,9 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
             // Close channels
             closeChallengeResponse()
             // Restore previous message
-            mProgressMessage = previousMessage
+            mProgressMessage = previousMessage.apply {
+                cancelable = null
+            }
             notifyProgressMessage()
         }
         return response
@@ -1385,6 +1396,15 @@ open class DatabaseTaskNotificationService : LockNotificationService(), Progress
             return nodesAction
         }
 
+        fun Bundle.getNewEntry(database: ContextualDatabase): Entry? {
+            getBundle(NEW_NODES_KEY)
+                ?.getParcelableList<NodeId<UUID>>(ENTRIES_ID_KEY)
+                ?.get(0)?.let {
+                return database.getEntryById(it)
+            }
+            return null
+        }
+
         fun getBundleFromListNodes(nodes: List<Node>): Bundle {
             val groupsId = mutableListOf<NodeId<*>>()
             val entriesId = mutableListOf<NodeId<UUID>>()

app/src/main/java/com/kunzisoft/keepass/services/KeyboardEntryNotificationService.kt

@@ -27,7 +27,7 @@ import android.util.Log
 import android.widget.Toast
 import androidx.preference.PreferenceManager
 import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.magikeyboard.MagikeyboardService
+import com.kunzisoft.keepass.credentialprovider.magikeyboard.MagikeyboardService
 import com.kunzisoft.keepass.model.EntryInfo
 import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.timeout.TimeoutHelper
@@ -55,7 +55,7 @@ class KeyboardEntryNotificationService : LockNotificationService() {
             sendBroadcast(Intent(LOCK_ACTION))
         }
         // Stop the service
-        stopSelf()
+        stopService()
     }
 
     override fun onStartCommand(intent: Intent?, flags: Int, startId: Int): Int {

app/src/main/java/com/kunzisoft/keepass/services/LockNotificationService.kt

@@ -20,7 +20,6 @@
 package com.kunzisoft.keepass.services
 
 import android.content.Intent
-import androidx.core.app.ServiceCompat
 import com.kunzisoft.keepass.timeout.TimeoutHelper
 import com.kunzisoft.keepass.utils.LockReceiver
 import com.kunzisoft.keepass.utils.registerLockReceiver
@@ -29,13 +28,7 @@ import com.kunzisoft.keepass.utils.unregisterLockReceiver
 abstract class LockNotificationService : NotificationService() {
 
     private var mLockReceiver: LockReceiver = LockReceiver {
-        actionOnLock()
-    }
-
-    protected open fun actionOnLock() {
-        // Stop the service in all cases
-        ServiceCompat.stopForeground(this, ServiceCompat.STOP_FOREGROUND_REMOVE)
-        stopSelf()
+        stopService()
     }
 
     override fun onCreate() {
@@ -46,7 +39,7 @@ abstract class LockNotificationService : NotificationService() {
 
     override fun onTaskRemoved(rootIntent: Intent?) {
         if (!TimeoutHelper.temporarilyDisableLock) {
-            actionOnLock()
+            stopService()
         }
         super.onTaskRemoved(rootIntent)
     }

app/src/main/java/com/kunzisoft/keepass/services/NotificationService.kt

@@ -17,6 +17,7 @@ import android.util.TypedValue
 import android.widget.Toast
 import androidx.core.app.NotificationCompat
 import androidx.core.app.NotificationManagerCompat
+import androidx.core.app.ServiceCompat
 import androidx.core.content.ContextCompat
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.stylish.Stylish
@@ -114,6 +115,12 @@ abstract class NotificationService : Service() {
         }
     }
 
+    protected open fun stopService() {
+        // Stop the service in all cases
+        ServiceCompat.stopForeground(this, ServiceCompat.STOP_FOREGROUND_REMOVE)
+        stopSelf()
+    }
+
     protected fun defineTimerJob(builder: NotificationCompat.Builder,
                                  type: NotificationServiceType,
                                  timeoutMilliseconds: Long,

app/src/main/java/com/kunzisoft/keepass/settings/AutofillSettingsActivity.kt

@@ -19,9 +19,12 @@
  */
 package com.kunzisoft.keepass.settings
 
+import android.os.Build
+import androidx.annotation.RequiresApi
 import androidx.preference.PreferenceFragmentCompat
 import com.kunzisoft.keepass.R
 
+@RequiresApi(Build.VERSION_CODES.O)
 class AutofillSettingsActivity : ExternalSettingsActivity() {
 
     override fun retrieveTitle(): Int {

app/src/main/java/com/kunzisoft/keepass/settings/AutofillSettingsFragment.kt

@@ -21,6 +21,7 @@ package com.kunzisoft.keepass.settings
 
 import android.os.Build
 import android.os.Bundle
+import androidx.annotation.RequiresApi
 import androidx.fragment.app.DialogFragment
 import androidx.preference.Preference
 import androidx.preference.PreferenceFragmentCompat
@@ -29,6 +30,7 @@ import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.settings.preferencedialogfragment.AutofillBlocklistAppIdPreferenceDialogFragmentCompat
 import com.kunzisoft.keepass.settings.preferencedialogfragment.AutofillBlocklistWebDomainPreferenceDialogFragmentCompat
 
+@RequiresApi(Build.VERSION_CODES.O)
 class AutofillSettingsFragment : PreferenceFragmentCompat() {
 
     override fun onCreatePreferences(savedInstanceState: Bundle?, rootKey: String?) {
@@ -39,11 +41,14 @@ class AutofillSettingsFragment : PreferenceFragmentCompat() {
         if (Build.VERSION.SDK_INT < Build.VERSION_CODES.R) {
             autofillInlineSuggestionsPreference?.isVisible = false
         }
+
+        val autofillAskSaveDataPreference: TwoStatePreference? = findPreference(getString(R.string.autofill_ask_to_save_data_key))
+        if (Build.VERSION.SDK_INT < Build.VERSION_CODES.P) {
+            autofillAskSaveDataPreference?.isVisible = false
+        }
     }
 
     override fun onDisplayPreferenceDialog(preference: Preference) {
-        var otherDialogFragment = false
-
         var dialogFragment: DialogFragment? = null
 
         when (preference.key) {
@@ -53,7 +58,7 @@ class AutofillSettingsFragment : PreferenceFragmentCompat() {
             getString(R.string.autofill_web_domain_blocklist_key) -> {
                 dialogFragment = AutofillBlocklistWebDomainPreferenceDialogFragmentCompat.newInstance(preference.key)
             }
-            else -> otherDialogFragment = true
+            else -> {}
         }
 
         if (dialogFragment != null) {
@@ -62,7 +67,7 @@ class AutofillSettingsFragment : PreferenceFragmentCompat() {
             dialogFragment.show(parentFragmentManager, TAG_AUTOFILL_PREF_FRAGMENT)
         }
         // Could not be handled here. Try with the super method.
-        else if (otherDialogFragment) {
+        else {
             super.onDisplayPreferenceDialog(preference)
         }
     }

app/src/main/java/com/kunzisoft/keepass/settings/ExternalSettingsActivity.kt

@@ -13,6 +13,8 @@ abstract class ExternalSettingsActivity : DatabaseModeActivity() {
 
     private var lockView: FloatingActionButton? = null
 
+    override fun manageDatabaseInfo(): Boolean = true
+
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
 

app/src/main/java/com/kunzisoft/keepass/settings/MainPreferenceFragment.kt

@@ -21,20 +21,25 @@ package com.kunzisoft.keepass.settings
 
 import android.content.Context
 import android.os.Bundle
-import android.view.View
 import androidx.fragment.app.activityViewModels
+import androidx.lifecycle.Lifecycle
+import androidx.lifecycle.lifecycleScope
+import androidx.lifecycle.repeatOnLifecycle
 import androidx.preference.Preference
 import androidx.preference.PreferenceCategory
 import androidx.preference.PreferenceFragmentCompat
 import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.database.ContextualDatabase
 import com.kunzisoft.keepass.viewmodels.DatabaseViewModel
+import kotlinx.coroutines.launch
 
 class MainPreferenceFragment : PreferenceFragmentCompat() {
 
     private var mCallback: Callback? = null
 
     private val mDatabaseViewModel: DatabaseViewModel by activityViewModels()
-    private var mDatabaseLoaded: Boolean = false
+    private val mDatabase: ContextualDatabase?
+        get() = mDatabaseViewModel.database
 
     override fun onAttach(context: Context) {
         super.onAttach(context)
@@ -50,20 +55,24 @@ class MainPreferenceFragment : PreferenceFragmentCompat() {
         mCallback = null
         super.onDetach()
     }
-    override fun onViewCreated(view: View, savedInstanceState: Bundle?) {
-        mDatabaseViewModel.database.observe(viewLifecycleOwner) { database ->
-            mDatabaseLoaded = database?.loaded == true
-            checkDatabaseLoaded()
+
+    override fun onCreate(savedInstanceState: Bundle?) {
+        super.onCreate(savedInstanceState)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.RESUMED) {
+                mDatabaseViewModel.databaseState.collect { database ->
+                    checkDatabaseLoaded(database?.loaded == true)
+                }
+            }
         }
-        super.onViewCreated(view, savedInstanceState)
     }
 
-    private fun checkDatabaseLoaded() {
+    private fun checkDatabaseLoaded(isDatabaseLoaded: Boolean) {
         findPreference<Preference>(getString(R.string.settings_database_key))
-            ?.isEnabled = mDatabaseLoaded
+            ?.isEnabled = isDatabaseLoaded
 
         findPreference<PreferenceCategory>(getString(R.string.settings_database_category_key))
-            ?.isVisible = mDatabaseLoaded
+            ?.isVisible = isDatabaseLoaded
     }
 
     override fun onCreatePreferences(savedInstanceState: Bundle?, rootKey: String?) {
@@ -119,7 +128,7 @@ class MainPreferenceFragment : PreferenceFragmentCompat() {
             }
         }
 
-        checkDatabaseLoaded()
+        checkDatabaseLoaded(mDatabase?.loaded == true)
     }
 
     interface Callback {

app/src/main/java/com/kunzisoft/keepass/settings/NestedAppSettingsFragment.kt

@@ -21,7 +21,6 @@ package com.kunzisoft.keepass.settings
 
 import android.content.ActivityNotFoundException
 import android.content.Intent
-import android.net.Uri
 import android.os.Build
 import android.os.Bundle
 import android.provider.Settings
@@ -30,6 +29,7 @@ import android.view.autofill.AutofillManager
 import android.widget.Toast
 import androidx.annotation.RequiresApi
 import androidx.appcompat.app.AlertDialog
+import androidx.core.net.toUri
 import androidx.fragment.app.DialogFragment
 import androidx.fragment.app.FragmentActivity
 import androidx.preference.ListPreference
@@ -47,7 +47,7 @@ import com.kunzisoft.keepass.icons.IconPackChooser
 import com.kunzisoft.keepass.services.ClipboardEntryNotificationService
 import com.kunzisoft.keepass.settings.preference.IconPackListPreference
 import com.kunzisoft.keepass.settings.preferencedialogfragment.DurationDialogFragmentCompat
-import com.kunzisoft.keepass.utils.UriUtil.isContributingUser
+import com.kunzisoft.keepass.utils.AppUtil.isContributingUser
 import com.kunzisoft.keepass.utils.UriUtil.openUrl
 import com.kunzisoft.keepass.utils.UriUtil.releaseAllUnnecessaryPermissionUris
 
@@ -119,7 +119,16 @@ class NestedAppSettingsFragment : NestedSettingsFragment() {
 
         activity?.let { activity ->
             if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
-                val autoFillEnablePreference: TwoStatePreference? = findPreference(getString(R.string.settings_autofill_enable_key))
+
+                // Hide Passkeys settings if needed
+                if (Build.VERSION.SDK_INT < Build.VERSION_CODES.UPSIDE_DOWN_CAKE) {
+                    findPreference<Preference>(getString(R.string.passkeys_explanation_key))
+                        ?.isVisible = false
+                    findPreference<Preference>(getString(R.string.settings_passkeys_key))
+                        ?.isVisible = false
+                }
+
+                val autoFillEnablePreference: TwoStatePreference? = findPreference(getString(R.string.settings_credential_provider_enable_key))
                 activity.getSystemService(AutofillManager::class.java)?.let { autofillManager ->
                     if (autofillManager.hasEnabledAutofillServices())
                         autoFillEnablePreference?.isChecked = autofillManager.hasEnabledAutofillServices()
@@ -161,7 +170,7 @@ class NestedAppSettingsFragment : NestedSettingsFragment() {
                                     val intent =
                                         Intent(Settings.ACTION_REQUEST_SET_AUTOFILL_SERVICE)
                                     intent.data =
-                                        Uri.parse("package:com.kunzisoft.keepass.autofill.KeeAutofillService")
+                                        "package:com.kunzisoft.keepass.autofill.KeeAutofillService".toUri()
                                     Log.d(javaClass.name, "Autofill enable service: intent=$intent")
                                     startActivity(intent)
                                 } else {
@@ -171,7 +180,7 @@ class NestedAppSettingsFragment : NestedSettingsFragment() {
                         }
                 }
             } else {
-                findPreference<Preference>(getString(R.string.autofill_key))?.isVisible = false
+                findPreference<Preference>(getString(R.string.credential_provider_key))?.isVisible = false
             }
         }
 
@@ -192,14 +201,28 @@ class NestedAppSettingsFragment : NestedSettingsFragment() {
             false
         }
 
-        findPreference<Preference>(getString(R.string.autofill_explanation_key))?.setOnPreferenceClickListener {
-            context?.openUrl(R.string.autofill_explanation_url)
-            false
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.UPSIDE_DOWN_CAKE) {
+            findPreference<Preference>(getString(R.string.passkeys_explanation_key))?.setOnPreferenceClickListener {
+                context?.openUrl(R.string.passkeys_explanation_url)
+                false
+            }
+
+            findPreference<Preference>(getString(R.string.settings_passkeys_key))?.setOnPreferenceClickListener {
+                startActivity(Intent(context, PasskeysSettingsActivity::class.java))
+                false
+            }
         }
 
-        findPreference<Preference>(getString(R.string.settings_autofill_key))?.setOnPreferenceClickListener {
-            startActivity(Intent(context, AutofillSettingsActivity::class.java))
-            false
+        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
+            findPreference<Preference>(getString(R.string.autofill_explanation_key))?.setOnPreferenceClickListener {
+                context?.openUrl(R.string.autofill_explanation_url)
+                false
+            }
+
+            findPreference<Preference>(getString(R.string.settings_autofill_key))?.setOnPreferenceClickListener {
+                startActivity(Intent(context, AutofillSettingsActivity::class.java))
+                false
+            }
         }
 
         findPreference<Preference>(getString(R.string.clipboard_notifications_key))?.setOnPreferenceChangeListener { _, newValue ->
@@ -530,7 +553,7 @@ class NestedAppSettingsFragment : NestedSettingsFragment() {
         super.onResume()
         activity?.let { activity ->
             if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O) {
-                findPreference<TwoStatePreference?>(getString(R.string.settings_autofill_enable_key))?.let { autoFillEnablePreference ->
+                findPreference<TwoStatePreference?>(getString(R.string.settings_credential_provider_enable_key))?.let { autoFillEnablePreference ->
                     val autofillManager = activity.getSystemService(AutofillManager::class.java)
                     autoFillEnablePreference.isChecked = autofillManager != null
                             && autofillManager.hasEnabledAutofillServices()

app/src/main/java/com/kunzisoft/keepass/settings/NestedDatabaseSettingsFragment.kt

@@ -19,13 +19,21 @@
  */
 package com.kunzisoft.keepass.settings
 
-import android.graphics.Color
 import android.os.Bundle
 import android.util.Log
-import android.view.*
+import android.view.LayoutInflater
+import android.view.Menu
+import android.view.MenuInflater
+import android.view.MenuItem
+import android.view.View
+import android.view.ViewGroup
+import androidx.core.graphics.toColorInt
 import androidx.core.view.MenuProvider
 import androidx.fragment.app.DialogFragment
 import androidx.fragment.app.activityViewModels
+import androidx.lifecycle.Lifecycle
+import androidx.lifecycle.lifecycleScope
+import androidx.lifecycle.repeatOnLifecycle
 import androidx.preference.Preference
 import androidx.preference.PreferenceCategory
 import androidx.preference.TwoStatePreference
@@ -39,19 +47,40 @@ import com.kunzisoft.keepass.database.crypto.EncryptionAlgorithm
 import com.kunzisoft.keepass.database.crypto.kdf.KdfEngine
 import com.kunzisoft.keepass.database.element.Group
 import com.kunzisoft.keepass.database.element.database.CompressionAlgorithm
-import com.kunzisoft.keepass.database.helper.*
+import com.kunzisoft.keepass.database.helper.getLocalizedName
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService
-import com.kunzisoft.keepass.settings.preference.*
-import com.kunzisoft.keepass.settings.preferencedialogfragment.*
+import com.kunzisoft.keepass.settings.preference.DialogColorPreference
+import com.kunzisoft.keepass.settings.preference.DialogListExplanationPreference
+import com.kunzisoft.keepass.settings.preference.InputKdfNumberPreference
+import com.kunzisoft.keepass.settings.preference.InputKdfSizePreference
+import com.kunzisoft.keepass.settings.preference.InputNumberPreference
+import com.kunzisoft.keepass.settings.preference.InputTextPreference
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseColorPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseDataCompressionPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseDefaultUsernamePreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseDescriptionPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseEncryptionAlgorithmPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseKeyDerivationPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseMaxHistoryItemsPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseMaxHistorySizePreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseMemoryUsagePreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseNamePreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseParallelismPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseRecycleBinGroupPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseRemoveUnlinkedDataPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseRoundsPreferenceDialogFragmentCompat
+import com.kunzisoft.keepass.settings.preferencedialogfragment.DatabaseTemplatesGroupPreferenceDialogFragmentCompat
 import com.kunzisoft.keepass.tasks.ActionRunnable
 import com.kunzisoft.keepass.utils.getParcelableCompat
 import com.kunzisoft.keepass.utils.getSerializableCompat
 import com.kunzisoft.keepass.viewmodels.DatabaseViewModel
+import kotlinx.coroutines.launch
 
 class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetrieval {
 
     private val mDatabaseViewModel: DatabaseViewModel by activityViewModels()
-    private var mDatabase: ContextualDatabase? = null
+    private val mDatabase: ContextualDatabase?
+        get() = mDatabaseViewModel.database
     private var mDatabaseReadOnly: Boolean = false
     private var mMergeDataAllowed: Boolean = false
     private var mDatabaseAutoSaveEnabled: Boolean = true
@@ -114,19 +143,46 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
         }
     }
 
+    override fun onCreate(savedInstanceState: Bundle?) {
+        super.onCreate(savedInstanceState)
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.STARTED) {
+                mDatabaseViewModel.actionState.collect { uiState ->
+                    when (uiState) {
+                        is DatabaseViewModel.ActionState.OnDatabaseActionFinished -> {
+                            onDatabaseActionFinished(
+                                uiState.database,
+                                uiState.actionTask,
+                                uiState.result
+                            )
+                        }
+
+                        else -> {}
+                    }
+                }
+            }
+        }
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.RESUMED) {
+                mDatabaseViewModel.databaseState.collect { database ->
+                    database?.let {
+                        onDatabaseRetrieved(database)
+                    }
+                }
+            }
+        }
+    }
+
     override fun onViewCreated(view: View, savedInstanceState: Bundle?) {
         super.onViewCreated(view, savedInstanceState)
-
         activity?.addMenuProvider(menuProvider, viewLifecycleOwner)
-
-        mDatabaseViewModel.database.observe(viewLifecycleOwner) { database ->
-            mDatabase = database
-            view.resetAppTimeoutWhenViewTouchedOrFocused(requireContext(), database?.loaded)
-            onDatabaseRetrieved(database)
-        }
-
-        mDatabaseViewModel.actionFinished.observe(viewLifecycleOwner) {
-            onDatabaseActionFinished(it.database, it.actionTask, it.result)
+        viewLifecycleOwner.lifecycleScope.launch {
+            mDatabaseViewModel.databaseState.collect { database ->
+                view.resetAppTimeoutWhenViewTouchedOrFocused(
+                    context = requireContext(),
+                    databaseLoaded = database?.loaded
+                )
+            }
         }
     }
 
@@ -167,29 +223,26 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
         mDatabaseViewModel.reloadDatabase(false)
     }
 
-    override fun onDatabaseRetrieved(database: ContextualDatabase?) {
-        mDatabase = database
-        mDatabaseReadOnly = database?.isReadOnly == true
-        mMergeDataAllowed = database?.isMergeDataAllowed() == true
+    override fun onDatabaseRetrieved(database: ContextualDatabase) {
+        mDatabaseReadOnly = database.isReadOnly
+        mMergeDataAllowed = database.isMergeDataAllowed()
 
-        mDatabase?.let {
-            if (it.loaded) {
-                when (mScreen) {
-                    Screen.DATABASE -> {
-                        onCreateDatabasePreference(it)
-                    }
-                    Screen.DATABASE_SECURITY -> {
-                        onCreateDatabaseSecurityPreference(it)
-                    }
-                    Screen.DATABASE_MASTER_KEY -> {
-                        onCreateDatabaseMasterKeyPreference(it)
-                    }
-                    else -> {
-                    }
+        if (database.loaded) {
+            when (mScreen) {
+                Screen.DATABASE -> {
+                    onCreateDatabasePreference(database)
+                }
+                Screen.DATABASE_SECURITY -> {
+                    onCreateDatabaseSecurityPreference(database)
+                }
+                Screen.DATABASE_MASTER_KEY -> {
+                    onCreateDatabaseMasterKeyPreference(database)
+                }
+                else -> {
                 }
-            } else {
-                Log.e(javaClass.name, "Database isn't ready")
             }
+        } else {
+            Log.e(javaClass.name, "Database isn't ready")
         }
     }
 
@@ -458,7 +511,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newDefaultUsername
                                 } else {
-                                    mDatabase?.defaultUsername = oldDefaultUsername
+                                    database.defaultUsername = oldDefaultUsername
                                     oldDefaultUsername
                                 }
                         dbDefaultUsernamePref?.summary = defaultUsernameToShow
@@ -471,7 +524,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newColor
                                 } else {
-                                    mDatabase?.customColor = Color.parseColor(oldColor)
+                                    database.customColor = oldColor.toColorInt()
                                     oldColor
                                 }
                         dbCustomColorPref?.summary = defaultColorToShow
@@ -483,7 +536,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newCompression
                                 } else {
-                                    mDatabase?.compressionAlgorithm = oldCompression
+                                    database.compressionAlgorithm = oldCompression
                                     oldCompression
                                 }
                         dbDataCompressionPref?.summary = algorithmToShow?.getLocalizedName(resources)
@@ -497,7 +550,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 } else {
                                     oldRecycleBin
                                 }
-                        mDatabase?.setRecycleBin(recycleBinToShow)
+                        database.setRecycleBin(recycleBinToShow)
                         refreshRecycleBinGroup(database)
                     }
                     DatabaseTaskNotificationService.ACTION_DATABASE_UPDATE_TEMPLATES_GROUP_TASK -> {
@@ -509,7 +562,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                             } else {
                                 oldTemplatesGroup
                             }
-                        mDatabase?.setTemplatesGroup(templatesGroupToShow)
+                        database.setTemplatesGroup(templatesGroupToShow)
                         refreshTemplatesGroup(database)
                     }
                     DatabaseTaskNotificationService.ACTION_DATABASE_UPDATE_MAX_HISTORY_ITEMS_TASK -> {
@@ -519,7 +572,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newMaxHistoryItems
                                 } else {
-                                    mDatabase?.historyMaxItems = oldMaxHistoryItems
+                                    database.historyMaxItems = oldMaxHistoryItems
                                     oldMaxHistoryItems
                                 }
                         dbMaxHistoryItemsPref?.summary = maxHistoryItemsToShow.toString()
@@ -531,7 +584,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newMaxHistorySize
                                 } else {
-                                    mDatabase?.historyMaxSize = oldMaxHistorySize
+                                    database.historyMaxSize = oldMaxHistorySize
                                     oldMaxHistorySize
                                 }
                         dbMaxHistorySizePref?.summary = maxHistorySizeToShow.toString()
@@ -549,7 +602,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newEncryption
                                 } else {
-                                    mDatabase?.encryptionAlgorithm = oldEncryption
+                                    database.encryptionAlgorithm = oldEncryption
                                     oldEncryption
                                 }
                         mEncryptionAlgorithmPref?.summary = algorithmToShow.toString()
@@ -561,7 +614,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newKeyDerivationEngine
                                 } else {
-                                    mDatabase?.kdfEngine = oldKeyDerivationEngine
+                                    database.kdfEngine = oldKeyDerivationEngine
                                     oldKeyDerivationEngine
                                 }
                         mKeyDerivationPref?.summary = kdfEngineToShow.toString()
@@ -578,7 +631,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newIterations
                                 } else {
-                                    mDatabase?.numberKeyEncryptionRounds = oldIterations
+                                    database.numberKeyEncryptionRounds = oldIterations
                                     oldIterations
                                 }
                         mRoundPref?.summary = roundsToShow.toString()
@@ -590,7 +643,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newMemoryUsage
                                 } else {
-                                    mDatabase?.memoryUsage = oldMemoryUsage
+                                    database.memoryUsage = oldMemoryUsage
                                     oldMemoryUsage
                                 }
                         mMemoryPref?.summary = memoryToShow.toString()
@@ -602,7 +655,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newParallelism
                                 } else {
-                                    mDatabase?.parallelism = oldParallelism
+                                    database.parallelism = oldParallelism
                                     oldParallelism
                                 }
                         mParallelismPref?.summary = parallelismToShow.toString()