Merge branch 'release/3.1'

CHANGELOG

@@ -1,3 +1,13 @@
+KeePassDX(3.1.0)
+ * Add breadcrumb
+ * Add path in search results #1148
+ * Add group info dialog #1177
+ * Manage colors #64 #913
+ * Fix UI in Android 8 #509
+ * Upgrade libs and SDK to 31 #833
+ * Fix parser of database v1 #1201
+ * Stop asking WRITE_EXTERNAL_STORAGE permission
+
 KeePassDX(3.0.4)
  * Fix autofill inline bugs #1173 #1165
  * Small UI change

README.md

@@ -72,7 +72,7 @@ Other questions? You can read the [FAQ](https://github.com/Kunzisoft/KeePassDX/w
 
 ## License
 
-  Copyright © 2020 Jeremy Jamet / [Kunzisoft](https://www.kunzisoft.com).
+  Copyright © 2022 Jeremy Jamet / [Kunzisoft](https://www.kunzisoft.com).
 
   This file is part of KeePassDX.
 

app/build.gradle

@@ -3,16 +3,16 @@ apply plugin: 'kotlin-android'
 apply plugin: 'kotlin-kapt'
 
 android {
-    compileSdkVersion 30
+    compileSdkVersion 31
-    buildToolsVersion "30.0.3"
+    buildToolsVersion "31.0.0"
     ndkVersion "21.4.7075529"
 
     defaultConfig {
         applicationId "com.kunzisoft.keepass"
         minSdkVersion 15
-        targetSdkVersion 30
+        targetSdkVersion 31
-        versionCode = 91
+        versionCode = 92
-        versionName = "3.0.4"
+        versionName = "3.1.0"
         multiDexEnabled true
 
         testApplicationId = "com.kunzisoft.keepass.tests"
@@ -99,21 +99,21 @@ android {
     }
 }
 
-def room_version = "2.3.0"
+def room_version = "2.4.1"
 
 dependencies {
     implementation "org.jetbrains.kotlin:kotlin-stdlib-jdk8:$kotlin_version"
     implementation "androidx.appcompat:appcompat:$android_appcompat_version"
     implementation 'androidx.preference:preference-ktx:1.1.1'
     implementation 'androidx.cardview:cardview:1.0.0'
-    implementation 'androidx.constraintlayout:constraintlayout:2.1.2'
+    implementation 'androidx.constraintlayout:constraintlayout:2.1.3'
     implementation 'androidx.viewpager2:viewpager2:1.1.0-beta01'
     implementation 'androidx.documentfile:documentfile:1.0.1'
     implementation 'androidx.biometric:biometric:1.1.0'
     implementation 'androidx.media:media:1.4.3'
     // Lifecycle - LiveData - ViewModel - Coroutines
     implementation "androidx.core:core-ktx:$android_core_version"
-    implementation 'androidx.fragment:fragment-ktx:1.3.6'
+    implementation 'androidx.fragment:fragment-ktx:1.4.0'
     implementation "com.google.android.material:material:$android_material_version"
     // Database
     implementation "androidx.room:room-runtime:$room_version"
@@ -123,7 +123,7 @@ dependencies {
     // Time
     implementation 'joda-time:joda-time:2.10.13'
     // Color
-    implementation 'com.github.Kunzisoft:AndroidClearChroma:2.4'
+    implementation 'com.github.Kunzisoft:AndroidClearChroma:2.6'
     // Education
     implementation 'com.getkeepsafe.taptargetview:taptargetview:1.13.3'
     // Apache Commons

app/src/main/AndroidManifest.xml

@@ -10,15 +10,12 @@
       android:anyDensity="true" />
     <uses-permission
         android:name="android.permission.FOREGROUND_SERVICE" />
+    <uses-permission
+        android:name="android.permission.SCHEDULE_EXACT_ALARM" />
     <uses-permission
         android:name="android.permission.USE_BIOMETRIC" />
     <uses-permission
         android:name="android.permission.VIBRATE"/>
-    <!-- Write permission until Android 10 -->
-    <uses-permission
-        android:name="android.permission.WRITE_EXTERNAL_STORAGE"
-        android:maxSdkVersion="28"
-        tools:ignore="ScopedStorage" />
     <!-- Open apps from links -->
     <uses-permission
         android:name="android.permission.QUERY_ALL_PACKAGES"
@@ -30,12 +27,13 @@
         android:roundIcon="@mipmap/ic_launcher_round"
         android:name="com.kunzisoft.keepass.app.App"
         android:allowBackup="true"
-        android:fullBackupContent="@xml/backup_rules"
+        android:fullBackupContent="@xml/old_backup_rules"
+        android:dataExtractionRules="@xml/backup_rules"
         android:backupAgent="com.kunzisoft.keepass.backup.SettingsBackupAgent"
         android:largeHeap="true"
         android:resizeableActivity="true"
         android:theme="@style/KeepassDXStyle.Night"
-        tools:targetApi="n">
+        tools:targetApi="s">
         <meta-data
             android:name="com.google.android.backup.api_key"
             android:value="${googleAndroidBackupAPIKey}" />

app/src/main/java/com/kunzisoft/keepass/activities/AutofillLauncherActivity.kt

@@ -233,9 +233,8 @@ class AutofillLauncherActivity : DatabaseModeActivity() {
                         }
                     })
                 },
-                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S) {
-                    // TODO Mutable
+                    PendingIntent.FLAG_MUTABLE or PendingIntent.FLAG_CANCEL_CURRENT
-                    PendingIntent.FLAG_CANCEL_CURRENT
                 } else {
                     PendingIntent.FLAG_CANCEL_CURRENT
                 })
@@ -248,9 +247,8 @@ class AutofillLauncherActivity : DatabaseModeActivity() {
                     EntrySelectionHelper.addSpecialModeInIntent(this, SpecialMode.REGISTRATION)
                     putExtra(KEY_REGISTER_INFO, registerInfo)
                 },
-                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.M) {
+                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S) {
-                    // TODO Mutable
+                    PendingIntent.FLAG_MUTABLE or PendingIntent.FLAG_CANCEL_CURRENT
-                    PendingIntent.FLAG_CANCEL_CURRENT
                 } else {
                     PendingIntent.FLAG_CANCEL_CURRENT
                 })

app/src/main/java/com/kunzisoft/keepass/activities/EntryActivity.kt

@@ -36,7 +36,12 @@ import androidx.activity.result.ActivityResultLauncher
 import androidx.activity.viewModels
 import androidx.appcompat.widget.Toolbar
 import androidx.coordinatorlayout.widget.CoordinatorLayout
+import androidx.core.graphics.BlendModeColorFilterCompat
+import androidx.core.graphics.BlendModeCompat
+import androidx.core.graphics.ColorUtils
+import com.google.android.material.appbar.AppBarLayout
 import com.google.android.material.appbar.CollapsingToolbarLayout
+import com.google.android.material.progressindicator.LinearProgressIndicator
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.fragments.EntryFragment
 import com.kunzisoft.keepass.activities.helpers.ExternalFileHelper
@@ -58,7 +63,11 @@ import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.tasks.ActionRunnable
 import com.kunzisoft.keepass.tasks.AttachmentFileBinderManager
 import com.kunzisoft.keepass.timeout.TimeoutHelper
-import com.kunzisoft.keepass.utils.*
+import com.kunzisoft.keepass.utils.MenuUtil
+import com.kunzisoft.keepass.utils.UriUtil
+import com.kunzisoft.keepass.utils.UuidUtil
+import com.kunzisoft.keepass.view.changeControlColor
+import com.kunzisoft.keepass.view.changeTitleColor
 import com.kunzisoft.keepass.view.hideByFading
 import com.kunzisoft.keepass.view.showActionErrorIfNeeded
 import com.kunzisoft.keepass.viewmodels.EntryViewModel
@@ -68,9 +77,10 @@ class EntryActivity : DatabaseLockActivity() {
 
     private var coordinatorLayout: CoordinatorLayout? = null
     private var collapsingToolbarLayout: CollapsingToolbarLayout? = null
+    private var appBarLayout: AppBarLayout? = null
     private var titleIconView: ImageView? = null
     private var historyView: View? = null
-    private var entryProgress: ProgressBar? = null
+    private var entryProgress: LinearProgressIndicator? = null
     private var lockView: View? = null
     private var toolbar: Toolbar? = null
     private var loadingView: ProgressBar? = null
@@ -93,7 +103,12 @@ class EntryActivity : DatabaseLockActivity() {
     }
 
     private var mIcon: IconImage? = null
-    private var mIconColor: Int = 0
+    private var mColorAccent: Int = 0
+    private var mControlColor: Int = 0
+    private var mColorPrimary: Int = 0
+    private var mColorBackground: Int = 0
+    private var mBackgroundColor: Int? = null
+    private var mForegroundColor: Int? = null
 
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
@@ -108,6 +123,7 @@ class EntryActivity : DatabaseLockActivity() {
         // Get views
         coordinatorLayout = findViewById(R.id.toolbar_coordinator)
         collapsingToolbarLayout = findViewById(R.id.toolbar_layout)
+        appBarLayout = findViewById(R.id.app_bar)
         titleIconView = findViewById(R.id.entry_icon)
         historyView = findViewById(R.id.history_container)
         entryProgress = findViewById(R.id.entry_progress)
@@ -118,10 +134,19 @@ class EntryActivity : DatabaseLockActivity() {
         collapsingToolbarLayout?.title = " "
         toolbar?.title = " "
 
-        // Retrieve the textColor to tint the icon
+        // Retrieve the textColor to tint the toolbar
-        val taIconColor = theme.obtainStyledAttributes(intArrayOf(R.attr.colorAccent))
+        val taColorAccent = theme.obtainStyledAttributes(intArrayOf(R.attr.colorAccent))
-        mIconColor = taIconColor.getColor(0, Color.BLACK)
+        val taControlColor = theme.obtainStyledAttributes(intArrayOf(R.attr.toolbarColorControl))
-        taIconColor.recycle()
+        val taColorPrimary = theme.obtainStyledAttributes(intArrayOf(R.attr.colorPrimary))
+        val taColorBackground = theme.obtainStyledAttributes(intArrayOf(android.R.attr.windowBackground))
+        mColorAccent = taColorAccent.getColor(0, Color.BLACK)
+        mControlColor = taControlColor.getColor(0, Color.BLACK)
+        mColorPrimary = taColorPrimary.getColor(0, Color.BLACK)
+        mColorBackground = taColorBackground.getColor(0, Color.BLACK)
+        taColorAccent.recycle()
+        taControlColor.recycle()
+        taColorPrimary.recycle()
+        taColorBackground.recycle()
 
         // Get Entry from UUID
         try {
@@ -166,10 +191,8 @@ class EntryActivity : DatabaseLockActivity() {
                 // Assign history dedicated view
                 historyView?.visibility = if (entryIsHistory) View.VISIBLE else View.GONE
                 if (entryIsHistory) {
-                    val taColorAccent = theme.obtainStyledAttributes(intArrayOf(R.attr.colorAccent))
                     collapsingToolbarLayout?.contentScrim =
-                        ColorDrawable(taColorAccent.getColor(0, Color.BLACK))
+                        ColorDrawable(mColorAccent)
-                    taColorAccent.recycle()
                 }
 
                 val entryInfo = entryInfoHistory.entryInfo
@@ -184,15 +207,15 @@ class EntryActivity : DatabaseLockActivity() {
                 }
                 // Assign title icon
                 mIcon = entryInfo.icon
-                titleIconView?.let { iconView ->
-                    mIconDrawableFactory?.assignDatabaseIcon(iconView, entryInfo.icon, mIconColor)
-                }
                 // Assign title text
                 val entryTitle =
-                    if (entryInfo.title.isNotEmpty()) entryInfo.title else entryInfo.id.toString()
+                    if (entryInfo.title.isNotEmpty()) entryInfo.title else UuidUtil.toHexString(entryInfo.id)
                 collapsingToolbarLayout?.title = entryTitle
                 toolbar?.title = entryTitle
                 mUrl = entryInfo.url
+                // Assign colors
+                mBackgroundColor = entryInfo.backgroundColor
+                mForegroundColor = entryInfo.foregroundColor
 
                 loadingView?.hideByFading()
                 mEntryLoaded = true
@@ -204,9 +227,9 @@ class EntryActivity : DatabaseLockActivity() {
         }
 
         mEntryViewModel.onOtpElementUpdated.observe(this) { otpElement ->
-            if (otpElement == null)
+            if (otpElement == null) {
                 entryProgress?.visibility = View.GONE
-            when (otpElement?.type) {
+            } else when (otpElement.type) {
                 // Only add token if HOTP
                 OtpType.HOTP -> {
                     entryProgress?.visibility = View.GONE
@@ -215,7 +238,7 @@ class EntryActivity : DatabaseLockActivity() {
                 OtpType.TOTP -> {
                     entryProgress?.apply {
                         max = otpElement.period
-                        progress = otpElement.secondsRemaining
+                        setProgressCompat(otpElement.secondsRemaining, true)
                         visibility = View.VISIBLE
                     }
                 }
@@ -252,13 +275,6 @@ class EntryActivity : DatabaseLockActivity() {
         super.onDatabaseRetrieved(database)
 
         mEntryViewModel.loadDatabase(database)
-
-        // Assign title icon
-        mIcon?.let { icon ->
-            titleIconView?.let { iconView ->
-                mIconDrawableFactory?.assignDatabaseIcon(iconView, icon, mIconColor)
-            }
-        }
     }
 
     override fun onDatabaseActionFinished(
@@ -304,6 +320,29 @@ class EntryActivity : DatabaseLockActivity() {
         super.onPause()
     }
 
+    private fun applyToolbarColors() {
+        appBarLayout?.setBackgroundColor(mBackgroundColor ?: mColorPrimary)
+        collapsingToolbarLayout?.contentScrim = ColorDrawable(mBackgroundColor ?: mColorPrimary)
+        val backgroundDarker = if (mBackgroundColor != null) {
+            ColorUtils.blendARGB(mBackgroundColor!!, Color.WHITE, 0.1f)
+        } else {
+            mColorBackground
+        }
+        titleIconView?.background?.colorFilter = BlendModeColorFilterCompat
+            .createBlendModeColorFilterCompat(backgroundDarker, BlendModeCompat.SRC_IN)
+        mIcon?.let { icon ->
+            titleIconView?.let { iconView ->
+                mIconDrawableFactory?.assignDatabaseIcon(
+                    iconView,
+                    icon,
+                    mForegroundColor ?: mColorAccent
+                )
+            }
+        }
+        toolbar?.changeControlColor(mForegroundColor ?: mControlColor)
+        collapsingToolbarLayout?.changeTitleColor(mForegroundColor ?: mControlColor)
+    }
+
     override fun onCreateOptionsMenu(menu: Menu): Boolean {
         super.onCreateOptionsMenu(menu)
         if (mEntryLoaded) {
@@ -340,6 +379,7 @@ class EntryActivity : DatabaseLockActivity() {
         if (mSpecialMode != SpecialMode.DEFAULT) {
             menu?.findItem(R.id.menu_reload_database)?.isVisible = false
         }
+        applyToolbarColors()
         return super.onPrepareOptionsMenu(menu)
     }
 

app/src/main/java/com/kunzisoft/keepass/activities/EntryEditActivity.kt

@@ -74,6 +74,7 @@ import com.kunzisoft.keepass.tasks.AttachmentFileBinderManager
 import com.kunzisoft.keepass.timeout.TimeoutHelper
 import com.kunzisoft.keepass.utils.UriUtil
 import com.kunzisoft.keepass.view.*
+import com.kunzisoft.keepass.viewmodels.ColorPickerViewModel
 import com.kunzisoft.keepass.viewmodels.EntryEditViewModel
 import org.joda.time.DateTime
 import java.util.*
@@ -103,6 +104,8 @@ class EntryEditActivity : DatabaseLockActivity(),
     private var mEntryLoaded: Boolean = false
     private var mTemplatesSelectorAdapter: TemplatesSelectorAdapter? = null
 
+    private val mColorPickerViewModel: ColorPickerViewModel by viewModels()
+
     private var mAllowCustomFields = false
     private var mAllowOTP = false
 
@@ -243,6 +246,15 @@ class EntryEditActivity : DatabaseLockActivity(),
             IconPickerActivity.launch(this@EntryEditActivity, iconImage, mIconSelectionActivityResultLauncher)
         }
 
+        mEntryEditViewModel.requestColorSelection.observe(this) { color ->
+            ColorPickerDialogFragment.newInstance(color)
+                .show(supportFragmentManager, "ColorPickerFragment")
+        }
+
+        mColorPickerViewModel.colorPicked.observe(this) { color ->
+            mEntryEditViewModel.selectColor(color)
+        }
+
         mEntryEditViewModel.requestDateTimeSelection.observe(this) { dateInstant ->
             if (dateInstant.type == DateInstant.Type.TIME) {
                 // Launch the time picker

app/src/main/java/com/kunzisoft/keepass/activities/GroupActivity.kt

@@ -25,7 +25,7 @@ import android.app.TimePickerDialog
 import android.content.ComponentName
 import android.content.Context
 import android.content.Intent
-import android.graphics.Color
+import android.graphics.PorterDuff
 import android.os.*
 import android.util.Log
 import android.view.Menu
@@ -41,12 +41,15 @@ import androidx.appcompat.view.ActionMode
 import androidx.appcompat.widget.SearchView
 import androidx.appcompat.widget.Toolbar
 import androidx.coordinatorlayout.widget.CoordinatorLayout
+import androidx.core.view.isVisible
+import androidx.recyclerview.widget.RecyclerView
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.activities.dialogs.*
 import com.kunzisoft.keepass.activities.fragments.GroupFragment
 import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
 import com.kunzisoft.keepass.activities.helpers.SpecialMode
 import com.kunzisoft.keepass.activities.legacy.DatabaseLockActivity
+import com.kunzisoft.keepass.adapters.BreadcrumbAdapter
 import com.kunzisoft.keepass.adapters.SearchEntryCursorAdapter
 import com.kunzisoft.keepass.autofill.AutofillComponent
 import com.kunzisoft.keepass.autofill.AutofillHelper
@@ -60,6 +63,7 @@ import com.kunzisoft.keepass.model.GroupInfo
 import com.kunzisoft.keepass.model.RegisterInfo
 import com.kunzisoft.keepass.model.SearchInfo
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_UPDATE_ENTRY_TASK
+import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.ACTION_DATABASE_UPDATE_GROUP_TASK
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.NEW_NODES_KEY
 import com.kunzisoft.keepass.services.DatabaseTaskNotificationService.Companion.getListNodesFromBundle
 import com.kunzisoft.keepass.settings.PreferencesUtil
@@ -77,6 +81,7 @@ class GroupActivity : DatabaseLockActivity(),
         GroupFragment.NodeClickListener,
         GroupFragment.NodesActionMenuListener,
         GroupFragment.OnScrollListener,
+        GroupFragment.GroupRefreshedListener,
         SortDialogFragment.SortSelectionListener {
 
     // Views
@@ -84,18 +89,25 @@ class GroupActivity : DatabaseLockActivity(),
     private var coordinatorLayout: CoordinatorLayout? = null
     private var lockView: View? = null
     private var toolbar: Toolbar? = null
+    private var databaseNameContainer: ViewGroup? = null
+    private var databaseColorView: ImageView? = null
+    private var databaseNameView: TextView? = null
+    private var searchContainer: ViewGroup? = null
+    private var searchNumbers: TextView? = null
+    private var searchString: TextView? = null
+    private var toolbarBreadcrumb: Toolbar? = null
     private var searchTitleView: View? = null
     private var toolbarAction: ToolbarAction? = null
-    private var iconView: ImageView? = null
     private var numberChildrenView: TextView? = null
     private var addNodeButtonView: AddNodeButtonView? = null
-    private var groupNameView: TextView? = null
+    private var breadcrumbListView: RecyclerView? = null
-    private var groupMetaView: TextView? = null
     private var loadingView: ProgressBar? = null
 
     private val mGroupViewModel: GroupViewModel by viewModels()
     private val mGroupEditViewModel: GroupEditViewModel by viewModels()
 
+    private var mBreadcrumbAdapter: BreadcrumbAdapter? = null
+
     private var mGroupFragment: GroupFragment? = null
     private var mRecyclingBinEnabled = false
     private var mRecyclingBinIsCurrentGroup = false
@@ -123,8 +135,6 @@ class GroupActivity : DatabaseLockActivity(),
             AutofillHelper.buildActivityResultLauncher(this)
         else null
 
-    private var mIconColor: Int = 0
-
     override fun onCreate(savedInstanceState: Bundle?) {
         super.onCreate(savedInstanceState)
 
@@ -134,13 +144,18 @@ class GroupActivity : DatabaseLockActivity(),
         // Initialize views
         rootContainerView = findViewById(R.id.activity_group_container_view)
         coordinatorLayout = findViewById(R.id.group_coordinator)
-        iconView = findViewById(R.id.group_icon)
         numberChildrenView = findViewById(R.id.group_numbers)
         addNodeButtonView = findViewById(R.id.add_node_button)
         toolbar = findViewById(R.id.toolbar)
+        databaseNameContainer = findViewById(R.id.database_name_container)
+        databaseColorView = findViewById(R.id.database_color)
+        databaseNameView = findViewById(R.id.database_name)
+        searchContainer = findViewById(R.id.search_container)
+        searchNumbers = findViewById(R.id.search_numbers)
+        searchString = findViewById(R.id.search_string)
+        toolbarBreadcrumb = findViewById(R.id.toolbar_breadcrumb)
         searchTitleView = findViewById(R.id.search_title)
-        groupNameView = findViewById(R.id.group_name)
+        breadcrumbListView = findViewById(R.id.breadcrumb_list)
-        groupMetaView = findViewById(R.id.group_meta)
         toolbarAction = findViewById(R.id.toolbar_action)
         lockView = findViewById(R.id.lock_button)
         loadingView = findViewById(R.id.loading)
@@ -152,10 +167,42 @@ class GroupActivity : DatabaseLockActivity(),
         toolbar?.title = ""
         setSupportActionBar(toolbar)
 
-        // Retrieve the textColor to tint the icon
+        mBreadcrumbAdapter = BreadcrumbAdapter(this).apply {
-        val taTextColor = theme.obtainStyledAttributes(intArrayOf(R.attr.textColorInverse))
+            // Open group on breadcrumb click
-        mIconColor = taTextColor.getColor(0, Color.WHITE)
+            onItemClickListener = { node, _ ->
-        taTextColor.recycle()
+                // If last item & not a virtual root group
+                val currentGroup = mCurrentGroup
+                if (currentGroup != null && node == currentGroup
+                    && (currentGroup != mDatabase?.rootGroup
+                            || mDatabase?.rootGroupIsVirtual == false)
+                ) {
+                    finishNodeAction()
+                    launchDialogToShowGroupInfo(currentGroup)
+                } else {
+                    if (mGroupFragment?.nodeActionSelectionMode == true) {
+                        finishNodeAction()
+                    }
+                    mDatabase?.let { database ->
+                        onNodeClick(database, node)
+                    }
+                }
+            }
+            onLongItemClickListener = { node, position ->
+                val currentGroup = mCurrentGroup
+                if (currentGroup != null && node == currentGroup
+                    && (currentGroup != mDatabase?.rootGroup
+                            || mDatabase?.rootGroupIsVirtual == false)
+                ) {
+                    finishNodeAction()
+                    launchDialogForGroupUpdate(currentGroup)
+                } else {
+                    onItemClickListener?.invoke(node, position)
+                }
+            }
+        }
+        breadcrumbListView?.apply {
+            adapter = mBreadcrumbAdapter
+        }
 
         // Retrieve group if defined at launch
         manageIntent(intent)
@@ -213,23 +260,21 @@ class GroupActivity : DatabaseLockActivity(),
 
                 // Add listeners to the add buttons
                 addNodeButtonView?.setAddGroupClickListener {
-                    GroupEditDialogFragment.create(GroupInfo().apply {
+                    launchDialogForGroupCreation(currentGroup)
-                        if (currentGroup.allowAddNoteInGroup) {
-                            notes = ""
-                        }
-                    }).show(supportFragmentManager, GroupEditDialogFragment.TAG_CREATE_GROUP)
                 }
                 addNodeButtonView?.setAddEntryClickListener {
                     mDatabase?.let { database ->
                         EntrySelectionHelper.doSpecialAction(intent,
                             {
-                                mGroupFragment?.mEntryActivityResultLauncher?.let { resultLauncher ->
+                                mCurrentGroup?.nodeId?.let { currentParentGroupId ->
-                                    EntryEditActivity.launchToCreate(
+                                    mGroupFragment?.mEntryActivityResultLauncher?.let { resultLauncher ->
-                                        this@GroupActivity,
+                                        EntryEditActivity.launchToCreate(
-                                        database,
+                                            this@GroupActivity,
-                                        currentGroup.nodeId,
+                                            database,
-                                        resultLauncher
+                                            currentParentGroupId,
-                                    )
+                                            resultLauncher
+                                        )
+                                    }
                                 }
                             },
                             {
@@ -282,9 +327,6 @@ class GroupActivity : DatabaseLockActivity(),
                 }
             }
 
-            assignGroupViewElements(currentGroup)
-            invalidateOptionsMenu()
-
             loadingView?.hideByFading()
         }
 
@@ -371,7 +413,19 @@ class GroupActivity : DatabaseLockActivity(),
 
         // Search suggestion
         database?.let {
+            databaseNameView?.text = if (it.name.isNotEmpty()) it.name else getString(R.string.database)
+            val customColor = it.customColor
+            if (customColor != null) {
+                databaseColorView?.visibility = View.VISIBLE
+                databaseColorView?.setColorFilter(
+                    customColor,
+                    PorterDuff.Mode.SRC_IN
+                )
+            } else {
+                databaseColorView?.visibility = View.GONE
+            }
             mSearchSuggestionAdapter = SearchEntryCursorAdapter(this, it)
+            mBreadcrumbAdapter?.iconDrawableFactory = it.iconDrawableFactory
             mOnSuggestionListener = object : SearchView.OnSuggestionListener {
                 override fun onSuggestionClick(position: Int): Boolean {
                     mSearchSuggestionAdapter?.let { searchAdapter ->
@@ -446,16 +500,27 @@ class GroupActivity : DatabaseLockActivity(),
                     )
                 }
             }
+            ACTION_DATABASE_UPDATE_GROUP_TASK -> {
+                if (result.isSuccess) {
+                    try {
+                        if (mCurrentGroup == newNodes[0] as Group)
+                            reloadCurrentGroup()
+                    } catch (e: Exception) {
+                        Log.e(
+                            TAG,
+                            "Unable to perform action after group update",
+                            e
+                        )
+                    }
+                }
+            }
         }
 
         coordinatorLayout?.showActionErrorIfNeeded(result)
         if (!result.isSuccess) {
             reloadCurrentGroup()
         }
-
         finishNodeAction()
-
-        refreshNumberOfChildren(mCurrentGroup)
     }
 
     /**
@@ -500,62 +565,44 @@ class GroupActivity : DatabaseLockActivity(),
         super.onSaveInstanceState(outState)
     }
 
+    override fun onGroupRefreshed() {
+        mCurrentGroup?.let { currentGroup ->
+            assignGroupViewElements(currentGroup)
+        }
+    }
+
     private fun assignGroupViewElements(group: Group?) {
         // Assign title
-        if (group != null) {
-            if (groupNameView != null) {
-                val title = group.title
-                groupNameView?.text = if (title.isNotEmpty()) title else getText(R.string.root)
-                groupNameView?.invalidate()
-            }
-            if (groupMetaView != null) {
-                val meta = group.nodeId.toString()
-                groupMetaView?.text = meta
-                if (meta.isNotEmpty()
-                    && !group.isVirtual
-                    && PreferencesUtil.showUUID(this)) {
-                    groupMetaView?.visibility = View.VISIBLE
-                } else {
-                    groupMetaView?.visibility = View.GONE
-                }
-                groupMetaView?.invalidate()
-            }
-        }
-
         if (group?.isVirtual == true) {
-            searchTitleView?.visibility = View.VISIBLE
+            searchContainer?.visibility = View.VISIBLE
-            if (toolbar != null) {
+            val title = group.title
-                toolbar?.navigationIcon = null
+            searchString?.text = if (title.isNotEmpty()) title else ""
-            }
+            searchNumbers?.text = group.numberOfChildEntries.toString()
-            iconView?.visibility = View.GONE
+            databaseNameContainer?.visibility = View.GONE
+            toolbarBreadcrumb?.navigationIcon = null
+            toolbarBreadcrumb?.collapse()
         } else {
-            searchTitleView?.visibility = View.GONE
+            searchContainer?.visibility = View.GONE
-            // Assign the group icon depending of IconPack or custom icon
+            databaseNameContainer?.visibility = View.VISIBLE
-            iconView?.visibility = View.VISIBLE
+            // Refresh breadcrumb
-            group?.let { currentGroup ->
+            if (toolbarBreadcrumb?.isVisible != true) {
-                iconView?.let { imageView ->
+                toolbarBreadcrumb?.expand {
-                    mIconDrawableFactory?.assignDatabaseIcon(
+                    setBreadcrumbNode(group)
-                        imageView,
-                        currentGroup.icon,
-                        mIconColor
-                    )
-                }
-
-                if (toolbar != null) {
-                    if (group.containsParent())
-                        toolbar?.setNavigationIcon(R.drawable.ic_arrow_up_white_24dp)
-                    else {
-                        toolbar?.navigationIcon = null
-                    }
                 }
+            } else {
+                // Add breadcrumb
+                setBreadcrumbNode(group)
             }
         }
-
-        // Assign number of children
-        refreshNumberOfChildren(group)
-
-        // Hide button
         initAddButton(group)
+        invalidateOptionsMenu()
+    }
+
+    private fun setBreadcrumbNode(group: Group?) {
+        mBreadcrumbAdapter?.apply {
+            setNode(group)
+            breadcrumbListView?.scrollToPosition(itemCount -1)
+        }
     }
 
     private fun initAddButton(group: Group?) {
@@ -577,18 +624,6 @@ class GroupActivity : DatabaseLockActivity(),
         }
     }
 
-    private fun refreshNumberOfChildren(group: Group?) {
-        numberChildrenView?.apply {
-            if (PreferencesUtil.showNumberEntries(context)) {
-                group?.refreshNumberOfChildEntries(Group.ChildFilter.getDefaults(context))
-                text = group?.numberOfChildEntries?.toString() ?: ""
-                visibility = View.VISIBLE
-            } else {
-                visibility = View.GONE
-            }
-        }
-    }
-
     override fun onScrolled(dy: Int) {
         if (actionNodeMode == null)
             addNodeButtonView?.hideOrShowButtonOnScrollListener(dy)
@@ -815,12 +850,7 @@ class GroupActivity : DatabaseLockActivity(),
         finishNodeAction()
         when (node.type) {
             Type.GROUP -> {
-                mOldGroupToUpdate = node as Group
+                launchDialogForGroupUpdate(node as Group)
-                GroupEditDialogFragment.update(mOldGroupToUpdate!!.getGroupInfo())
-                    .show(
-                        supportFragmentManager,
-                        GroupEditDialogFragment.TAG_CREATE_GROUP
-                    )
             }
             Type.ENTRY -> {
                 mGroupFragment?.mEntryActivityResultLauncher?.let { resultLauncher ->
@@ -837,6 +867,25 @@ class GroupActivity : DatabaseLockActivity(),
         return true
     }
 
+    private fun launchDialogToShowGroupInfo(group: Group) {
+        GroupDialogFragment.launch(group.getGroupInfo())
+            .show(supportFragmentManager, GroupDialogFragment.TAG_SHOW_GROUP)
+    }
+
+    private fun launchDialogForGroupCreation(group: Group) {
+        GroupEditDialogFragment.create(GroupInfo().apply {
+            if (group.allowAddNoteInGroup) {
+                notes = ""
+            }
+        }).show(supportFragmentManager, GroupEditDialogFragment.TAG_CREATE_GROUP)
+    }
+
+    private fun launchDialogForGroupUpdate(group: Group) {
+        mOldGroupToUpdate = group
+        GroupEditDialogFragment.update(group.getGroupInfo())
+            .show(supportFragmentManager, GroupEditDialogFragment.TAG_CREATE_GROUP)
+    }
+
     override fun onCopyMenuClick(
         database: Database,
         nodes: List<Node>
@@ -1034,7 +1083,7 @@ class GroupActivity : DatabaseLockActivity(),
     override fun onOptionsItemSelected(item: MenuItem): Boolean {
         when (item.itemId) {
             android.R.id.home -> {
-                onBackPressed()
+                // TODO change database
                 return true
             }
             R.id.menu_search ->

app/src/main/java/com/kunzisoft/keepass/activities/PasswordActivity.kt

@@ -21,7 +21,6 @@ package com.kunzisoft.keepass.activities
 
 import android.app.Activity
 import android.content.Intent
-import android.content.pm.PackageManager
 import android.net.Uri
 import android.os.Build
 import android.os.Bundle
@@ -41,7 +40,6 @@ import androidx.annotation.RequiresApi
 import androidx.appcompat.app.AppCompatActivity
 import androidx.appcompat.widget.Toolbar
 import androidx.coordinatorlayout.widget.CoordinatorLayout
-import androidx.core.app.ActivityCompat
 import androidx.fragment.app.commit
 import com.google.android.material.snackbar.Snackbar
 import com.kunzisoft.keepass.R
@@ -101,18 +99,8 @@ class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.BuilderL
     private var mRememberKeyFile: Boolean = false
     private var mExternalFileHelper: ExternalFileHelper? = null
 
-    private var mPermissionAsked = false
     private var mReadOnly: Boolean = false
     private var mForceReadOnly: Boolean = false
-        set(value) {
-            infoContainerView?.visibility = if (value) {
-                mReadOnly = true
-                View.VISIBLE
-            } else {
-                View.GONE
-            }
-            field = value
-        }
 
     private var mAutofillActivityResultLauncher: ActivityResultLauncher<Intent>? =
         if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.O)
@@ -139,7 +127,6 @@ class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.BuilderL
         infoContainerView = findViewById(R.id.activity_password_info_container)
         coordinatorLayout = findViewById(R.id.activity_password_coordinator_layout)
 
-        mPermissionAsked = savedInstanceState?.getBoolean(KEY_PERMISSION_ASKED) ?: mPermissionAsked
         mReadOnly = if (savedInstanceState != null && savedInstanceState.containsKey(KEY_READ_ONLY)) {
             savedInstanceState.getBoolean(KEY_READ_ONLY)
         } else {
@@ -208,10 +195,19 @@ class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.BuilderL
 
         // Observe database file change
         mDatabaseFileViewModel.databaseFileLoaded.observe(this) { databaseFile ->
+
             // Force read only if the file does not exists
-            mForceReadOnly = databaseFile?.let {
+            val databaseFileNotExists = databaseFile?.let {
                 !it.databaseFileExists
             } ?: true
+            infoContainerView?.visibility = if (databaseFileNotExists) {
+                mReadOnly = true
+                View.VISIBLE
+            } else {
+                View.GONE
+            }
+            mForceReadOnly = databaseFileNotExists
+
             invalidateOptionsMenu()
 
             // Post init uri with KeyFile only if needed
@@ -249,8 +245,6 @@ class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.BuilderL
             mDatabaseFileViewModel.loadDatabaseFile(databaseFileUri)
         }
 
-        checkPermission()
-
         mDatabase?.let { database ->
             launchGroupActivityIfLoaded(database)
         }
@@ -510,7 +504,6 @@ class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.BuilderL
     }
 
     override fun onSaveInstanceState(outState: Bundle) {
-        outState.putBoolean(KEY_PERMISSION_ASKED, mPermissionAsked)
         mDatabaseKeyFileUri?.let {
             outState.putString(KEY_KEYFILE, it.toString())
         }
@@ -613,35 +606,6 @@ class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.BuilderL
         return true
     }
 
-    // Check permission
-    private fun checkPermission() {
-        if (Build.VERSION.SDK_INT in 23..28
-                && !mReadOnly
-                && !mPermissionAsked) {
-            mPermissionAsked = true
-            // Check self permission to show or not the dialog
-            val writePermission = android.Manifest.permission.WRITE_EXTERNAL_STORAGE
-            val permissions = arrayOf(writePermission)
-            if (toolbar != null
-                    && ActivityCompat.checkSelfPermission(this, writePermission) != PackageManager.PERMISSION_GRANTED) {
-                ActivityCompat.requestPermissions(this, permissions, WRITE_EXTERNAL_STORAGE_REQUEST)
-            }
-        }
-    }
-
-    override fun onRequestPermissionsResult(requestCode: Int, permissions: Array<out String>, grantResults: IntArray) {
-        super.onRequestPermissionsResult(requestCode, permissions, grantResults)
-
-        when (requestCode) {
-            WRITE_EXTERNAL_STORAGE_REQUEST -> {
-                if (grantResults.isEmpty() || grantResults[0] != PackageManager.PERMISSION_GRANTED) {
-                    if (ActivityCompat.shouldShowRequestPermissionRationale(this, android.Manifest.permission.WRITE_EXTERNAL_STORAGE))
-                        Toast.makeText(this, R.string.read_only_warning, Toast.LENGTH_LONG).show()
-                }
-            }
-        }
-    }
-
     // To fix multiple view education
     private var performedEductionInProgress = false
     private fun launchEducation(menu: Menu) {
@@ -729,8 +693,6 @@ class PasswordActivity : DatabaseModeActivity(), AdvancedUnlockFragment.BuilderL
         private const val KEY_READ_ONLY = "KEY_READ_ONLY"
         private const val KEY_PASSWORD = "password"
         private const val KEY_LAUNCH_IMMEDIATELY = "launchImmediately"
-        private const val KEY_PERMISSION_ASKED = "KEY_PERMISSION_ASKED"
-        private const val WRITE_EXTERNAL_STORAGE_REQUEST = 647
 
         private fun buildAndLaunchIntent(activity: Activity, databaseFile: Uri, keyFile: Uri?,
                                          intentBuildLauncher: (Intent) -> Unit) {

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/ColorPickerDialogFragment.kt

@@ -0,0 +1,95 @@
+package com.kunzisoft.keepass.activities.dialogs
+
+import android.app.Dialog
+import android.graphics.Color
+import android.os.Bundle
+import android.widget.CompoundButton
+import androidx.annotation.ColorInt
+import androidx.appcompat.app.AlertDialog
+import androidx.fragment.app.activityViewModels
+import com.kunzisoft.androidclearchroma.view.ChromaColorView
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.viewmodels.ColorPickerViewModel
+
+class ColorPickerDialogFragment : DatabaseDialogFragment() {
+
+    private val mColorPickerViewModel: ColorPickerViewModel by activityViewModels()
+
+    private lateinit var enableSwitchView: CompoundButton
+    private lateinit var chromaColorView: ChromaColorView
+
+    private var mDefaultColor = Color.WHITE
+    private var mActivated = false
+
+    override fun onCreateDialog(savedInstanceState: Bundle?): Dialog {
+
+        activity?.let { activity ->
+            val root = activity.layoutInflater.inflate(R.layout.fragment_color_picker, null)
+            enableSwitchView = root.findViewById(R.id.switch_element)
+            chromaColorView = root.findViewById(R.id.chroma_color_view)
+
+            if (savedInstanceState != null) {
+                if (savedInstanceState.containsKey(ARG_INITIAL_COLOR)) {
+                    mDefaultColor = savedInstanceState.getInt(ARG_INITIAL_COLOR)
+                }
+                if (savedInstanceState.containsKey(ARG_ACTIVATED)) {
+                    mActivated = savedInstanceState.getBoolean(ARG_ACTIVATED)
+                }
+            } else {
+                arguments?.apply {
+                    if (containsKey(ARG_INITIAL_COLOR)) {
+                        mDefaultColor = getInt(ARG_INITIAL_COLOR)
+                    }
+                    if (containsKey(ARG_ACTIVATED)) {
+                        mActivated = getBoolean(ARG_ACTIVATED)
+                    }
+                }
+            }
+            enableSwitchView.isChecked = mActivated
+            chromaColorView.currentColor = mDefaultColor
+
+            chromaColorView.setOnColorChangedListener {
+                if (!enableSwitchView.isChecked)
+                    enableSwitchView.isChecked = true
+            }
+
+            val builder = AlertDialog.Builder(activity)
+            builder.setView(root)
+                .setPositiveButton(android.R.string.ok) { _, _ ->
+                    val color: Int? = if (enableSwitchView.isChecked)
+                        chromaColorView.currentColor
+                    else
+                        null
+                    mColorPickerViewModel.pickColor(color)
+                }
+                .setNegativeButton(android.R.string.cancel) { _, _ ->
+                    // Do nothing
+                }
+
+            return builder.create()
+        }
+        return super.onCreateDialog(savedInstanceState)
+    }
+
+    override fun onSaveInstanceState(outState: Bundle) {
+        super.onSaveInstanceState(outState)
+        outState.putInt(ARG_INITIAL_COLOR, chromaColorView.currentColor)
+        outState.putBoolean(ARG_ACTIVATED, mActivated)
+    }
+
+    companion object {
+        private const val ARG_INITIAL_COLOR = "ARG_INITIAL_COLOR"
+        private const val ARG_ACTIVATED = "ARG_ACTIVATED"
+
+        fun newInstance(
+            @ColorInt initialColor: Int?,
+        ): ColorPickerDialogFragment {
+            return ColorPickerDialogFragment().apply {
+                arguments = Bundle().apply {
+                    putInt(ARG_INITIAL_COLOR, initialColor ?: Color.WHITE)
+                    putBoolean(ARG_ACTIVATED, initialColor != null)
+                }
+            }
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/GroupDialogFragment.kt

@@ -0,0 +1,151 @@
+/*
+ * Copyright 2021 Jeremy Jamet / Kunzisoft.
+ *     
+ * This file is part of KeePassDX.
+ *
+ *  KeePassDX is free software: you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation, either version 3 of the License, or
+ *  (at your option) any later version.
+ *
+ *  KeePassDX is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+ *
+ */
+package com.kunzisoft.keepass.activities.dialogs
+
+import android.app.Dialog
+import android.graphics.Color
+import android.os.Bundle
+import android.view.View
+import android.view.ViewGroup
+import android.widget.ImageView
+import android.widget.TextView
+import androidx.appcompat.app.AlertDialog
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.database.element.Database
+import com.kunzisoft.keepass.database.element.icon.IconImage
+import com.kunzisoft.keepass.model.GroupInfo
+import com.kunzisoft.keepass.settings.PreferencesUtil
+import com.kunzisoft.keepass.utils.UuidUtil
+import com.kunzisoft.keepass.view.DateTimeFieldView
+
+class GroupDialogFragment : DatabaseDialogFragment() {
+
+    private var mPopulateIconMethod: ((ImageView, IconImage) -> Unit)? = null
+    private var mGroupInfo = GroupInfo()
+
+    private lateinit var iconView: ImageView
+    private var mIconColor: Int = 0
+    private lateinit var nameTextView: TextView
+    private lateinit var notesTextLabelView: TextView
+    private lateinit var notesTextView: TextView
+    private lateinit var expirationView: DateTimeFieldView
+    private lateinit var creationView: TextView
+    private lateinit var modificationView: TextView
+    private lateinit var uuidContainerView: ViewGroup
+    private lateinit var uuidReferenceView: TextView
+
+    override fun onDatabaseRetrieved(database: Database?) {
+        super.onDatabaseRetrieved(database)
+        mPopulateIconMethod = { imageView, icon ->
+            database?.iconDrawableFactory?.assignDatabaseIcon(imageView, icon, mIconColor)
+        }
+        mPopulateIconMethod?.invoke(iconView, mGroupInfo.icon)
+    }
+
+    override fun onCreateDialog(savedInstanceState: Bundle?): Dialog {
+        activity?.let { activity ->
+            val root = activity.layoutInflater.inflate(R.layout.fragment_group, null)
+            iconView = root.findViewById(R.id.group_icon)
+            nameTextView = root.findViewById(R.id.group_name)
+            notesTextLabelView = root.findViewById(R.id.group_note_label)
+            notesTextView = root.findViewById(R.id.group_note)
+            expirationView = root.findViewById(R.id.group_expiration)
+            creationView = root.findViewById(R.id.group_created)
+            modificationView = root.findViewById(R.id.group_modified)
+            uuidContainerView = root.findViewById(R.id.group_UUID_container)
+            uuidReferenceView = root.findViewById(R.id.group_UUID_reference)
+
+            // Retrieve the textColor to tint the icon
+            val ta = activity.theme.obtainStyledAttributes(intArrayOf(R.attr.colorAccent))
+            mIconColor = ta.getColor(0, Color.WHITE)
+            ta.recycle()
+
+            if (savedInstanceState != null
+                    && savedInstanceState.containsKey(KEY_GROUP_INFO)) {
+                mGroupInfo = savedInstanceState.getParcelable(KEY_GROUP_INFO) ?: mGroupInfo
+            } else {
+                arguments?.apply {
+                    if (containsKey(KEY_GROUP_INFO)) {
+                        mGroupInfo = getParcelable(KEY_GROUP_INFO) ?: mGroupInfo
+                    }
+                }
+            }
+
+            // populate info in views
+            val title = mGroupInfo.title
+            if (title.isEmpty()) {
+                nameTextView.visibility = View.GONE
+            } else {
+                nameTextView.text = title
+                nameTextView.visibility = View.VISIBLE
+            }
+            val notes = mGroupInfo.notes
+            if (notes == null || notes.isEmpty()) {
+                notesTextLabelView.visibility = View.GONE
+                notesTextView.visibility = View.GONE
+            } else {
+                notesTextView.text = notes
+                notesTextLabelView.visibility = View.VISIBLE
+                notesTextView.visibility = View.VISIBLE
+            }
+            expirationView.activation = mGroupInfo.expires
+            expirationView.dateTime = mGroupInfo.expiryTime
+            creationView.text = mGroupInfo.creationTime.getDateTimeString(resources)
+            modificationView.text = mGroupInfo.lastModificationTime.getDateTimeString(resources)
+            val uuid = UuidUtil.toHexString(mGroupInfo.id)
+            if (uuid == null || uuid.isEmpty()) {
+                uuidContainerView.visibility = View.GONE
+            } else {
+                uuidReferenceView.text = uuid
+                uuidContainerView.apply {
+                    visibility = if (PreferencesUtil.showUUID(context)) View.VISIBLE else View.GONE
+                }
+            }
+
+            val builder = AlertDialog.Builder(activity)
+            builder.setView(root)
+                    .setPositiveButton(android.R.string.ok){ _, _ ->
+                        // Do nothing
+                    }
+            return builder.create()
+        }
+        return super.onCreateDialog(savedInstanceState)
+    }
+
+    override fun onSaveInstanceState(outState: Bundle) {
+        outState.putParcelable(KEY_GROUP_INFO, mGroupInfo)
+        super.onSaveInstanceState(outState)
+    }
+
+    data class Error(val isError: Boolean, val messageId: Int?)
+
+    companion object {
+        const val TAG_SHOW_GROUP = "TAG_SHOW_GROUP"
+        private const val KEY_GROUP_INFO = "KEY_GROUP_INFO"
+
+        fun launch(groupInfo: GroupInfo): GroupDialogFragment {
+            val bundle = Bundle()
+            bundle.putParcelable(KEY_GROUP_INFO, groupInfo)
+            val fragment = GroupDialogFragment()
+            fragment.arguments = bundle
+            return fragment
+        }
+    }
+}

app/src/main/java/com/kunzisoft/keepass/activities/dialogs/GroupEditDialogFragment.kt

@@ -246,8 +246,8 @@ class GroupEditDialogFragment : DatabaseDialogFragment() {
     companion object {
 
         const val TAG_CREATE_GROUP = "TAG_CREATE_GROUP"
-        const val KEY_ACTION_ID = "KEY_ACTION_ID"
+        private const val KEY_ACTION_ID = "KEY_ACTION_ID"
-        const val KEY_GROUP_INFO = "KEY_GROUP_INFO"
+        private const val KEY_GROUP_INFO = "KEY_GROUP_INFO"
 
         fun create(groupInfo: GroupInfo): GroupEditDialogFragment {
             val bundle = Bundle()

app/src/main/java/com/kunzisoft/keepass/activities/fragments/EntryEditFragment.kt

@@ -99,6 +99,12 @@ class EntryEditFragment: DatabaseFragment() {
             setOnIconClickListener {
                 mEntryEditViewModel.requestIconSelection(templateView.getIcon())
             }
+            setOnBackgroundColorClickListener {
+                mEntryEditViewModel.requestBackgroundColorSelection(templateView.getBackgroundColor())
+            }
+            setOnForegroundColorClickListener {
+                mEntryEditViewModel.requestForegroundColorSelection(templateView.getForegroundColor())
+            }
             setOnCustomEditionActionClickListener { field ->
                 mEntryEditViewModel.requestCustomFieldEdition(field)
             }
@@ -147,6 +153,14 @@ class EntryEditFragment: DatabaseFragment() {
             templateView.setIcon(iconImage)
         }
 
+        mEntryEditViewModel.onBackgroundColorSelected.observe(this) { color ->
+            templateView.setBackgroundColor(color)
+        }
+
+        mEntryEditViewModel.onForegroundColorSelected.observe(this) { color ->
+            templateView.setForegroundColor(color)
+        }
+
         mEntryEditViewModel.onPasswordSelected.observe(viewLifecycleOwner) { passwordField ->
             templateView.setPasswordField(passwordField)
         }

app/src/main/java/com/kunzisoft/keepass/activities/fragments/EntryFragment.kt

@@ -42,7 +42,6 @@ class EntryFragment: DatabaseFragment() {
     private var attachmentsAdapter: EntryAttachmentsItemsAdapter? = null
 
     private lateinit var uuidContainerView: View
-    private lateinit var uuidView: TextView
     private lateinit var uuidReferenceView: TextView
 
     private var mClipboardHelper: ClipboardHelper? = null
@@ -88,7 +87,6 @@ class EntryFragment: DatabaseFragment() {
         uuidContainerView.apply {
             visibility = if (PreferencesUtil.showUUID(context)) View.VISIBLE else View.GONE
         }
-        uuidView = view.findViewById(R.id.entry_UUID)
         uuidReferenceView = view.findViewById(R.id.entry_UUID_reference)
 
         mEntryViewModel.entryInfoHistory.observe(viewLifecycleOwner) { entryInfoHistory ->
@@ -200,7 +198,6 @@ class EntryFragment: DatabaseFragment() {
     }
 
     private fun assignUUID(uuid: UUID?) {
-        uuidView.text = uuid?.toString()
         uuidReferenceView.text = UuidUtil.toHexString(uuid)
     }
 

app/src/main/java/com/kunzisoft/keepass/activities/fragments/GroupFragment.kt

@@ -20,7 +20,6 @@
 package com.kunzisoft.keepass.activities.fragments
 
 import android.content.Context
-import android.content.Intent
 import android.os.Bundle
 import android.util.Log
 import android.view.*
@@ -34,12 +33,11 @@ import com.kunzisoft.keepass.activities.EntryEditActivity
 import com.kunzisoft.keepass.activities.dialogs.SortDialogFragment
 import com.kunzisoft.keepass.activities.helpers.EntrySelectionHelper
 import com.kunzisoft.keepass.activities.helpers.SpecialMode
-import com.kunzisoft.keepass.adapters.NodeAdapter
+import com.kunzisoft.keepass.adapters.NodesAdapter
 import com.kunzisoft.keepass.database.element.Database
 import com.kunzisoft.keepass.database.element.Group
 import com.kunzisoft.keepass.database.element.SortNodeEnum
 import com.kunzisoft.keepass.database.element.node.Node
-import com.kunzisoft.keepass.database.element.node.NodeId
 import com.kunzisoft.keepass.database.element.node.Type
 import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.tasks.ActionRunnable
@@ -50,10 +48,11 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
 
     private var nodeClickListener: NodeClickListener? = null
     private var onScrollListener: OnScrollListener? = null
+    private var groupRefreshed: GroupRefreshedListener? = null
 
     private var mNodesRecyclerView: RecyclerView? = null
     private var mLayoutManager: LinearLayoutManager? = null
-    private var mAdapter: NodeAdapter? = null
+    private var mAdapter: NodesAdapter? = null
 
     private val mGroupViewModel: GroupViewModel by activityViewModels()
 
@@ -102,12 +101,14 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
 
     override fun onAttach(context: Context) {
         super.onAttach(context)
+
+        // TODO Change to ViewModel
         try {
             nodeClickListener = context as NodeClickListener
         } catch (e: ClassCastException) {
             // The activity doesn't implement the interface, throw exception
             throw ClassCastException(context.toString()
-                    + " must implement " + NodeAdapter.NodeClickCallback::class.java.name)
+                    + " must implement " + NodesAdapter.NodeClickCallback::class.java.name)
         }
 
         try {
@@ -115,14 +116,24 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
         } catch (e: ClassCastException) {
             onScrollListener = null
             // Context menu can be omit
-            Log.w(TAG, context.toString()
+            Log.w(
+                TAG, context.toString()
                     + " must implement " + RecyclerView.OnScrollListener::class.java.name)
         }
+
+        try {
+            groupRefreshed = context as GroupRefreshedListener
+        } catch (e: ClassCastException) {
+            // The activity doesn't implement the interface, throw exception
+            throw ClassCastException(context.toString()
+                    + " must implement " + GroupRefreshedListener::class.java.name)
+        }
     }
 
     override fun onDetach() {
         nodeClickListener = null
         onScrollListener = null
+        groupRefreshed = null
         super.onDetach()
     }
 
@@ -138,8 +149,8 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
 
         contextThemed?.let { context ->
             database?.let { database ->
-                mAdapter = NodeAdapter(context, database).apply {
+                mAdapter = NodesAdapter(context, database).apply {
-                    setOnNodeClickListener(object : NodeAdapter.NodeClickCallback {
+                    setOnNodeClickListener(object : NodesAdapter.NodeClickCallback {
                         override fun onNodeClick(database: Database, node: Node) {
                             if (nodeActionSelectionMode) {
                                 if (listActionNodes.contains(node)) {
@@ -195,7 +206,7 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
         super.onCreateView(inflater, container, savedInstanceState)
         // To apply theme
         return inflater.cloneInContext(contextThemed)
-                .inflate(R.layout.fragment_group, container, false)
+                .inflate(R.layout.fragment_nodes, container, false)
     }
 
     override fun onViewCreated(view: View, savedInstanceState: Bundle?) {
@@ -260,6 +271,8 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
         } else {
             notFoundView?.visibility = View.GONE
         }
+
+        groupRefreshed?.onGroupRefreshed()
     }
 
     override fun onSortSelected(sortNodeEnum: SortNodeEnum,
@@ -292,15 +305,17 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
                     val sortDialogFragment: SortDialogFragment =
                             if (mRecycleBinEnable) {
                                 SortDialogFragment.getInstance(
-                                        PreferencesUtil.getListSort(context),
+                                    PreferencesUtil.getListSort(context),
-                                        PreferencesUtil.getAscendingSort(context),
+                                    PreferencesUtil.getAscendingSort(context),
-                                        PreferencesUtil.getGroupsBeforeSort(context),
+                                    PreferencesUtil.getGroupsBeforeSort(context),
-                                        PreferencesUtil.getRecycleBinBottomSort(context))
+                                    PreferencesUtil.getRecycleBinBottomSort(context)
+                                )
                             } else {
                                 SortDialogFragment.getInstance(
-                                        PreferencesUtil.getListSort(context),
+                                    PreferencesUtil.getListSort(context),
-                                        PreferencesUtil.getAscendingSort(context),
+                                    PreferencesUtil.getAscendingSort(context),
-                                        PreferencesUtil.getGroupsBeforeSort(context))
+                                    PreferencesUtil.getGroupsBeforeSort(context)
+                                )
                             }
 
                     sortDialogFragment.show(childFragmentManager, "sortDialog")
@@ -447,6 +462,10 @@ class GroupFragment : DatabaseFragment(), SortDialogFragment.SortSelectionListen
         fun onScrolled(dy: Int)
     }
 
+    interface GroupRefreshedListener {
+        fun onGroupRefreshed()
+    }
+
     companion object {
         private val TAG = GroupFragment::class.java.name
     }

app/src/main/java/com/kunzisoft/keepass/activities/stylish/StylishActivity.kt

@@ -28,7 +28,7 @@ import android.util.Log
 import android.view.WindowManager
 import androidx.annotation.StyleRes
 import androidx.appcompat.app.AppCompatActivity
-import com.kunzisoft.keepass.settings.NestedAppSettingsFragment.Companion.DATABASE_APPEARANCE_PREFERENCE_CHANGED
+import com.kunzisoft.keepass.settings.NestedAppSettingsFragment.Companion.DATABASE_PREFERENCE_CHANGED
 
 /**
  * Stylish Hide Activity that apply a dynamic style and sets FLAG_SECURE to prevent screenshots / from
@@ -89,8 +89,8 @@ abstract class StylishActivity : AppCompatActivity() {
         super.onResume()
 
         if ((customStyle && Stylish.getThemeId(this) != this.themeId)
-            || DATABASE_APPEARANCE_PREFERENCE_CHANGED) {
+            || DATABASE_PREFERENCE_CHANGED) {
-            DATABASE_APPEARANCE_PREFERENCE_CHANGED = false
+            DATABASE_PREFERENCE_CHANGED = false
             Log.d(this.javaClass.name, "Theme change detected, restarting activity")
             recreateActivity()
         }

app/src/main/java/com/kunzisoft/keepass/adapters/BreadcrumbAdapter.kt

@@ -0,0 +1,150 @@
+package com.kunzisoft.keepass.adapters
+
+import android.annotation.SuppressLint
+import android.content.Context
+import android.graphics.Color
+import android.view.LayoutInflater
+import android.view.View
+import android.view.ViewGroup
+import android.widget.ImageView
+import android.widget.TextView
+import androidx.recyclerview.widget.RecyclerView
+import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.database.element.Group
+import com.kunzisoft.keepass.database.element.node.Node
+import com.kunzisoft.keepass.database.element.node.Type
+import com.kunzisoft.keepass.icons.IconDrawableFactory
+import com.kunzisoft.keepass.settings.PreferencesUtil
+import com.kunzisoft.keepass.view.strikeOut
+
+class BreadcrumbAdapter(val context: Context)
+    : RecyclerView.Adapter<BreadcrumbAdapter.BreadcrumbGroupViewHolder>() {
+
+    private val inflater: LayoutInflater = LayoutInflater.from(context)
+    var iconDrawableFactory: IconDrawableFactory? = null
+        @SuppressLint("NotifyDataSetChanged")
+        set(value) {
+            field = value
+            notifyDataSetChanged()
+        }
+    private var mNodeBreadcrumb: MutableList<Node?> = mutableListOf()
+    var onItemClickListener: ((item: Node, position: Int)->Unit)? = null
+    var onLongItemClickListener: ((item: Node, position: Int)->Unit)? = null
+
+    private var mShowNumberEntries = false
+    private var mShowUUID = false
+    private var mIconColor: Int = 0
+
+    init {
+        mShowNumberEntries = PreferencesUtil.showNumberEntries(context)
+        mShowUUID = PreferencesUtil.showUUID(context)
+
+        // Retrieve the textColor to tint the icon
+        val taTextColor = context.theme.obtainStyledAttributes(intArrayOf(R.attr.textColorInverse))
+        mIconColor = taTextColor.getColor(0, Color.WHITE)
+        taTextColor.recycle()
+    }
+
+    @SuppressLint("NotifyDataSetChanged")
+    fun setNode(node: Node?) {
+        mNodeBreadcrumb.clear()
+        node?.let {
+            var currentNode = it
+            mNodeBreadcrumb.add(0, currentNode)
+            while (currentNode.containsParent()) {
+                currentNode.parent?.let { parent ->
+                    currentNode = parent
+                    mNodeBreadcrumb.add(0, currentNode)
+                }
+            }
+        }
+        notifyDataSetChanged()
+    }
+
+    override fun getItemViewType(position: Int): Int {
+        return when (position) {
+            mNodeBreadcrumb.size - 1 -> 0
+            else -> 1
+        }
+    }
+
+    override fun onCreateViewHolder(parent: ViewGroup, viewType: Int): BreadcrumbGroupViewHolder {
+        return BreadcrumbGroupViewHolder(inflater.inflate(
+            when (viewType) {
+                0 -> R.layout.item_group
+                else -> R.layout.item_breadcrumb
+            }, parent, false)
+        )
+    }
+
+    override fun onBindViewHolder(holder: BreadcrumbGroupViewHolder, position: Int) {
+        val node = mNodeBreadcrumb[position]
+
+        holder.groupNameView.apply {
+            text = node?.title ?: ""
+            strikeOut(node?.isCurrentlyExpires ?: false)
+        }
+
+        holder.itemView.apply {
+            setOnClickListener {
+                node?.let {
+                    onItemClickListener?.invoke(it, position)
+                }
+            }
+            setOnLongClickListener {
+                node?.let {
+                    onLongItemClickListener?.invoke(it, position)
+                }
+                true
+            }
+        }
+
+        if (node?.type == Type.GROUP) {
+            (node as Group).let { group ->
+
+                holder.groupIconView?.let { imageView ->
+                    iconDrawableFactory?.assignDatabaseIcon(
+                        imageView,
+                        group.icon,
+                        mIconColor
+                    )
+                }
+
+                holder.groupNumbersView?.apply {
+                    if (mShowNumberEntries) {
+                        group.refreshNumberOfChildEntries(Group.ChildFilter.getDefaults(context))
+                        text = group.numberOfChildEntries.toString()
+                        visibility = View.VISIBLE
+                    } else {
+                        visibility = View.GONE
+                    }
+                }
+
+                holder.groupMetaView?.apply {
+                    val meta = group.nodeId.toVisualString()
+                    visibility = if (meta != null
+                        && !group.isVirtual
+                        && mShowUUID
+                    ) {
+                        text = meta
+                        View.VISIBLE
+                    } else {
+                        View.GONE
+                    }
+                }
+            }
+        }
+
+    }
+
+    override fun getItemCount(): Int {
+        return mNodeBreadcrumb.size
+    }
+
+    inner class BreadcrumbGroupViewHolder(itemView: View) : RecyclerView.ViewHolder(itemView) {
+        var groupIconView: ImageView? = itemView.findViewById(R.id.group_icon)
+        var groupNumbersView: TextView? = itemView.findViewById(R.id.group_numbers)
+        var groupNameView: TextView = itemView.findViewById(R.id.group_name)
+        var groupMetaView: TextView? = itemView.findViewById(R.id.group_meta)
+    }
+}

app/src/main/java/com/kunzisoft/keepass/adapters/NodesAdapter.kt

@@ -34,6 +34,7 @@ import androidx.core.content.ContextCompat
 import androidx.recyclerview.widget.RecyclerView
 import androidx.recyclerview.widget.SortedList
 import androidx.recyclerview.widget.SortedListAdapterCallback
+import com.google.android.material.progressindicator.CircularProgressIndicator
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.database.element.Database
 import com.kunzisoft.keepass.database.element.Entry
@@ -55,9 +56,9 @@ import java.util.*
  * Create node list adapter with contextMenu or not
  * @param context Context to use
  */
-class NodeAdapter (private val context: Context,
+class NodesAdapter (private val context: Context,
-                   private val database: Database)
+                    private val database: Database)
-    : RecyclerView.Adapter<NodeAdapter.NodeViewHolder>() {
+    : RecyclerView.Adapter<NodesAdapter.NodeViewHolder>() {
 
     private var mNodeComparator: Comparator<NodeVersionedInterface<Group>>? = null
     private val mNodeSortedListCallback: NodeSortedListCallback
@@ -79,6 +80,8 @@ class NodeAdapter (private val context: Context,
     private var mShowOTP: Boolean = false
     private var mShowUUID: Boolean = false
     private var mEntryFilters = arrayOf<Group.ChildFilter>()
+    private var mOldVirtualGroup = false
+    private var mVirtualGroup = false
 
     private var mActionNodesList = LinkedList<Node>()
     private var mNodeClickCallback: NodeClickCallback? = null
@@ -87,9 +90,15 @@ class NodeAdapter (private val context: Context,
     @ColorInt
     private val mContentSelectionColor: Int
     @ColorInt
-    private val mIconGroupColor: Int
+    private val mTextColorPrimary: Int
     @ColorInt
-    private val mIconEntryColor: Int
+    private val mTextColor: Int
+    @ColorInt
+    private val mTextColorSecondary: Int
+    @ColorInt
+    private val mColorAccentLight: Int
+    @ColorInt
+    private val mTextColorInverse: Int
 
     /**
      * Determine if the adapter contains or not any element
@@ -110,12 +119,24 @@ class NodeAdapter (private val context: Context,
         this.mContentSelectionColor = ContextCompat.getColor(context, R.color.white)
         // Retrieve the color to tint the icon
         val taTextColorPrimary = context.theme.obtainStyledAttributes(intArrayOf(android.R.attr.textColorPrimary))
-        this.mIconGroupColor = taTextColorPrimary.getColor(0, Color.BLACK)
+        this.mTextColorPrimary = taTextColorPrimary.getColor(0, Color.BLACK)
         taTextColorPrimary.recycle()
-        // In two times to fix bug compilation
+        // To get text color
         val taTextColor = context.theme.obtainStyledAttributes(intArrayOf(android.R.attr.textColor))
-        this.mIconEntryColor = taTextColor.getColor(0, Color.BLACK)
+        this.mTextColor = taTextColor.getColor(0, Color.BLACK)
         taTextColor.recycle()
+        // To get text color secondary
+        val taTextColorSecondary = context.theme.obtainStyledAttributes(intArrayOf(android.R.attr.textColorSecondary))
+        this.mTextColorSecondary = taTextColorSecondary.getColor(0, Color.BLACK)
+        taTextColorSecondary.recycle()
+        // To get background color for selection
+        val taSelectionColor = context.theme.obtainStyledAttributes(intArrayOf(R.attr.colorAccentLight))
+        this.mColorAccentLight = taSelectionColor.getColor(0, Color.GRAY)
+        taSelectionColor.recycle()
+        // To get text color for selection
+        val taSelectionTextColor = context.theme.obtainStyledAttributes(intArrayOf(R.attr.textColorInverse))
+        this.mTextColorInverse = taSelectionTextColor.getColor(0, Color.WHITE)
+        taSelectionTextColor.recycle()
     }
 
     private fun assignPreferences() {
@@ -145,6 +166,8 @@ class NodeAdapter (private val context: Context,
      * Rebuild the list by clear and build children from the group
      */
     fun rebuildList(group: Group) {
+        mOldVirtualGroup = mVirtualGroup
+        mVirtualGroup = group.isVirtual
         assignPreferences()
         mNodeSortedList.replaceAll(group.getFilteredChildren(mEntryFilters))
     }
@@ -155,14 +178,19 @@ class NodeAdapter (private val context: Context,
         }
 
         override fun areContentsTheSame(oldItem: Node, newItem: Node): Boolean {
+            if (mOldVirtualGroup != mVirtualGroup)
+                return false
             var typeContentTheSame = true
             if (oldItem is Entry && newItem is Entry) {
                 typeContentTheSame = oldItem.getVisualTitle() == newItem.getVisualTitle()
                         && oldItem.username == newItem.username
+                        && oldItem.backgroundColor == newItem.backgroundColor
+                        && oldItem.foregroundColor == newItem.foregroundColor
                         && oldItem.getOtpElement() == newItem.getOtpElement()
                         && oldItem.containsAttachment() == newItem.containsAttachment()
             } else if (oldItem is Group && newItem is Group) {
                 typeContentTheSame = oldItem.numberOfChildEntries == newItem.numberOfChildEntries
+                        && oldItem.notes == newItem.notes
             }
             return typeContentTheSame
                     && oldItem.nodeId == newItem.nodeId
@@ -327,8 +355,8 @@ class NodeAdapter (private val context: Context,
         val iconColor = if (holder.container.isSelected)
             mContentSelectionColor
         else when (subNode.type) {
-            Type.GROUP -> mIconGroupColor
+            Type.GROUP -> mTextColorPrimary
-            Type.ENTRY -> mIconEntryColor
+            Type.ENTRY -> mTextColor
         }
         holder.imageIdentifier?.setColorFilter(iconColor)
         holder.icon.apply {
@@ -348,14 +376,24 @@ class NodeAdapter (private val context: Context,
         }
         // Add meta text to show UUID
         holder.meta.apply {
-            if (mShowUUID) {
+            val nodeId = subNode.nodeId?.toVisualString()
-                text = subNode.nodeId.toString()
+            if (mShowUUID && nodeId != null) {
+                text = nodeId
                 setTextSize(mTextSizeUnit, mMetaTextDefaultDimension, mPrefSizeMultiplier)
                 visibility = View.VISIBLE
             } else {
                 visibility = View.GONE
             }
         }
+        // Add path to virtual group
+        if (mVirtualGroup) {
+            holder.path?.apply {
+                text = subNode.getPathString()
+                visibility = View.VISIBLE
+            }
+        } else {
+            holder.path?.visibility = View.GONE
+        }
 
         // Specific elements for entry
         if (subNode.type == Type.ENTRY) {
@@ -398,6 +436,50 @@ class NodeAdapter (private val context: Context,
             holder.attachmentIcon?.visibility =
                     if (entry.containsAttachment()) View.VISIBLE else View.GONE
 
+            // Assign colors
+            val backgroundColor = entry.backgroundColor
+            if (!holder.container.isSelected) {
+                if (backgroundColor != null) {
+                    holder.container.setBackgroundColor(backgroundColor)
+                } else {
+                    holder.container.setBackgroundColor(Color.TRANSPARENT)
+                }
+            } else {
+                holder.container.setBackgroundColor(mColorAccentLight)
+            }
+            val foregroundColor = entry.foregroundColor
+            if (!holder.container.isSelected) {
+                if (foregroundColor != null) {
+                    holder.text.setTextColor(foregroundColor)
+                    holder.subText?.setTextColor(foregroundColor)
+                    holder.otpToken?.setTextColor(foregroundColor)
+                    holder.otpProgress?.setIndicatorColor(foregroundColor)
+                    holder.attachmentIcon?.setColorFilter(foregroundColor)
+                    holder.meta.setTextColor(foregroundColor)
+                    holder.icon.apply {
+                        database.iconDrawableFactory.assignDatabaseIcon(
+                            this,
+                            subNode.icon,
+                            foregroundColor
+                        )
+                    }
+                } else {
+                    holder.text.setTextColor(mTextColor)
+                    holder.subText?.setTextColor(mTextColorSecondary)
+                    holder.otpToken?.setTextColor(mTextColorSecondary)
+                    holder.otpProgress?.setIndicatorColor(mTextColorSecondary)
+                    holder.attachmentIcon?.setColorFilter(mTextColorSecondary)
+                    holder.meta.setTextColor(mTextColor)
+                }
+            } else {
+                holder.text.setTextColor(mTextColorInverse)
+                holder.subText?.setTextColor(mTextColorInverse)
+                holder.otpToken?.setTextColor(mTextColorInverse)
+                holder.otpProgress?.setIndicatorColor(mTextColorInverse)
+                holder.attachmentIcon?.setColorFilter(mTextColorInverse)
+                holder.meta.setTextColor(mTextColorInverse)
+            }
+
             database.stopManageEntry(entry)
         }
 
@@ -430,15 +512,16 @@ class NodeAdapter (private val context: Context,
             OtpType.HOTP -> {
                 holder?.otpProgress?.apply {
                     max = 100
-                    progress = 100
+                    setProgressCompat(100, true)
                 }
             }
             OtpType.TOTP -> {
                 holder?.otpProgress?.apply {
                     max = otpElement.period
-                    progress = otpElement.secondsRemaining
+                    setProgressCompat(otpElement.secondsRemaining, true)
                 }
             }
+            null -> {}
         }
         holder?.otpToken?.apply {
             text = otpElement?.token
@@ -497,8 +580,9 @@ class NodeAdapter (private val context: Context,
         var text: TextView = itemView.findViewById(R.id.node_text)
         var subText: TextView? = itemView.findViewById(R.id.node_subtext)
         var meta: TextView = itemView.findViewById(R.id.node_meta)
+        var path: TextView? = itemView.findViewById(R.id.node_path)
         var otpContainer: ViewGroup? = itemView.findViewById(R.id.node_otp_container)
-        var otpProgress: ProgressBar? = itemView.findViewById(R.id.node_otp_progress)
+        var otpProgress: CircularProgressIndicator? = itemView.findViewById(R.id.node_otp_progress)
         var otpToken: TextView? = itemView.findViewById(R.id.node_otp_token)
         var otpRunnable: OtpRunnable = OtpRunnable(otpContainer)
         var numberChildren: TextView? = itemView.findViewById(R.id.node_child_numbers)
@@ -506,6 +590,6 @@ class NodeAdapter (private val context: Context,
     }
 
     companion object {
-        private val TAG = NodeAdapter::class.java.name
+        private val TAG = NodesAdapter::class.java.name
     }
 }

app/src/main/java/com/kunzisoft/keepass/database/action/node/ActionNodeDatabaseRunnable.kt

@@ -36,7 +36,11 @@ abstract class ActionNodeDatabaseRunnable(
     abstract fun nodeAction()
 
     override fun onStartRun() {
-        nodeAction()
+        try {
+            nodeAction()
+        } catch (e: Exception) {
+            setError(e)
+        }
         super.onStartRun()
     }
 

app/src/main/java/com/kunzisoft/keepass/database/action/node/UpdateGroupRunnable.kt

@@ -42,6 +42,9 @@ class UpdateGroupRunnable constructor(
             // Update group with new values
             mNewGroup.touch(modified = true, touchParents = true)
 
+            if (database.rootGroup == mOldGroup) {
+                database.rootGroup = mNewGroup
+            }
             // Only change data in index
             database.updateGroup(mNewGroup)
         }
@@ -50,6 +53,9 @@ class UpdateGroupRunnable constructor(
     override fun nodeFinish(): ActionNodesValues {
         if (!result.isSuccess) {
             // If we fail to save, back out changes to global structure
+            if (database.rootGroup == mNewGroup) {
+                database.rootGroup = mOldGroup
+            }
             database.updateGroup(mOldGroup)
         }
 

app/src/main/java/com/kunzisoft/keepass/database/element/Database.kt

@@ -22,10 +22,10 @@ package com.kunzisoft.keepass.database.element
 import android.content.ContentResolver
 import android.content.Context
 import android.content.res.Resources
+import android.graphics.Color
 import android.net.Uri
-import android.os.Build
 import android.util.Log
-import com.kunzisoft.keepass.app.database.FileDatabaseHistoryAction
+import com.kunzisoft.androidclearchroma.ChromaUtil
 import com.kunzisoft.keepass.database.action.node.NodeHandler
 import com.kunzisoft.keepass.database.crypto.EncryptionAlgorithm
 import com.kunzisoft.keepass.database.crypto.kdf.KdfEngine
@@ -226,31 +226,33 @@ class Database {
             mDatabaseKDBX?.descriptionChanged = DateInstant()
         }
 
-    val allowDefaultUsername: Boolean
-        get() = mDatabaseKDBX != null
-        // TODO get() = mDatabaseKDB != null || mDatabaseKDBX != null
-
     var defaultUsername: String
         get() {
-            return mDatabaseKDBX?.defaultUserName ?: "" // TODO mDatabaseKDB default username
+            return mDatabaseKDB?.defaultUserName ?: mDatabaseKDBX?.defaultUserName ?: ""
         }
         set(username) {
+            mDatabaseKDB?.defaultUserName = username
             mDatabaseKDBX?.defaultUserName = username
             mDatabaseKDBX?.defaultUserNameChanged = DateInstant()
         }
 
-    val allowCustomColor: Boolean
+    var customColor: Int?
-        get() = mDatabaseKDBX != null
-        // TODO get() = mDatabaseKDB != null || mDatabaseKDBX != null
-
-    // with format "#000000"
-    var customColor: String
         get() {
-            return mDatabaseKDBX?.color ?: "" // TODO mDatabaseKDB color
+            var colorInt: Int? = null
+            mDatabaseKDBX?.color?.let {
+                try {
+                    colorInt = Color.parseColor(it)
+                } catch (e: Exception) {}
+            }
+            return mDatabaseKDB?.color ?: colorInt
         }
         set(value) {
-            // TODO Check color string
+            mDatabaseKDB?.color = value
-            mDatabaseKDBX?.color = value
+            mDatabaseKDBX?.color = if (value == null) {
+                ""
+            } else {
+                ChromaUtil.getFormattedColorString(value, false)
+            }
         }
 
     val allowOTP: Boolean
@@ -364,7 +366,7 @@ class Database {
             mDatabaseKDBX?.masterKey = masterKey
         }
 
-    val rootGroup: Group?
+    var rootGroup: Group?
         get() {
             mDatabaseKDB?.rootGroup?.let {
                 return Group(it)
@@ -374,6 +376,25 @@ class Database {
             }
             return null
         }
+        set(value) {
+            value?.groupKDB?.let { rootKDB ->
+                mDatabaseKDB?.rootGroup = rootKDB
+            }
+            value?.groupKDBX?.let { rootKDBX ->
+                mDatabaseKDBX?.rootGroup = rootKDBX
+            }
+        }
+
+    val rootGroupIsVirtual: Boolean
+        get() {
+            mDatabaseKDB?.let {
+                return true
+            }
+            mDatabaseKDBX?.let {
+                return false
+            }
+            return true
+        }
 
     /**
      * Do not modify groups here, used for read only

app/src/main/java/com/kunzisoft/keepass/database/element/Entry.kt

@@ -19,8 +19,10 @@
  */
 package com.kunzisoft.keepass.database.element
 
+import android.graphics.Color
 import android.os.Parcel
 import android.os.Parcelable
+import com.kunzisoft.androidclearchroma.ChromaUtil
 import com.kunzisoft.keepass.database.element.binary.AttachmentPool
 import com.kunzisoft.keepass.database.element.database.DatabaseKDBX
 import com.kunzisoft.keepass.database.element.database.DatabaseVersioned
@@ -238,6 +240,42 @@ class Entry : Node, EntryVersionedInterface<Group> {
             entryKDBX?.notes = value
         }
 
+    var backgroundColor: Int?
+        get() {
+            var colorInt: Int? = null
+            entryKDBX?.backgroundColor?.let {
+                try {
+                    colorInt = Color.parseColor(it)
+                } catch (e: Exception) {}
+            }
+            return colorInt
+        }
+        set(value) {
+            entryKDBX?.backgroundColor = if (value == null) {
+                ""
+            } else {
+                ChromaUtil.getFormattedColorString(value, false)
+            }
+        }
+
+    var foregroundColor: Int?
+        get() {
+            var colorInt: Int? = null
+            entryKDBX?.foregroundColor?.let {
+                try {
+                    colorInt = Color.parseColor(it)
+                } catch (e: Exception) {}
+            }
+            return colorInt
+        }
+        set(value) {
+            entryKDBX?.foregroundColor = if (value == null) {
+                ""
+            } else {
+                ChromaUtil.getFormattedColorString(value, false)
+            }
+        }
+
     private fun isTan(): Boolean {
         return title == PMS_TAN_ENTRY && username.isNotEmpty()
     }
@@ -419,6 +457,8 @@ class Entry : Node, EntryVersionedInterface<Group> {
             entryInfo.expiryTime = expiryTime
             entryInfo.url = url
             entryInfo.notes = notes
+            entryInfo.backgroundColor = backgroundColor
+            entryInfo.foregroundColor = foregroundColor
             entryInfo.customFields = getExtraFields().toMutableList()
             // Add otpElement to generate token
             entryInfo.otpModel = getOtpElement()?.otpModel
@@ -453,6 +493,8 @@ class Entry : Node, EntryVersionedInterface<Group> {
         expiryTime = newEntryInfo.expiryTime
         url = newEntryInfo.url
         notes = newEntryInfo.notes
+        backgroundColor = newEntryInfo.backgroundColor
+        foregroundColor = newEntryInfo.foregroundColor
         addExtraFields(newEntryInfo.customFields)
         database?.attachmentPool?.let { binaryPool ->
             newEntryInfo.attachments.forEach { attachment ->

app/src/main/java/com/kunzisoft/keepass/database/element/Group.kt

@@ -31,6 +31,7 @@ import com.kunzisoft.keepass.database.element.node.*
 import com.kunzisoft.keepass.model.EntryInfo
 import com.kunzisoft.keepass.model.GroupInfo
 import com.kunzisoft.keepass.settings.PreferencesUtil
+import com.kunzisoft.keepass.utils.UuidUtil
 import java.util.*
 import kotlin.collections.ArrayList
 
@@ -308,8 +309,9 @@ class Group : Node, GroupVersionedInterface<Group, Entry> {
         val withoutMetaStream = filters.contains(ChildFilter.META_STREAM)
         val showExpiredEntries = !filters.contains(ChildFilter.EXPIRED)
 
+        // TODO Change KDB parser to remove meta entries
         return groupKDB?.getChildEntries()?.filter {
-            (!withoutMetaStream || (withoutMetaStream && !it.isMetaStream))
+            (!withoutMetaStream || (withoutMetaStream && !it.isMetaStream()))
                     && (!it.isCurrentlyExpires or showExpiredEntries)
         }?.map {
             Entry(it)
@@ -453,6 +455,7 @@ class Group : Node, GroupVersionedInterface<Group, Entry> {
 
     fun getGroupInfo(): GroupInfo {
         val groupInfo = GroupInfo()
+        groupInfo.id = groupKDBX?.nodeId?.id
         groupInfo.title = title
         groupInfo.icon = icon
         groupInfo.creationTime = creationTime

app/src/main/java/com/kunzisoft/keepass/database/element/database/DatabaseKDB.kt

@@ -44,15 +44,13 @@ class DatabaseKDB : DatabaseVersioned<Int, UUID, GroupKDB, EntryKDB>() {
         get() = "V1"
 
     init {
+        // New manual root because KDB contains multiple root groups (here available with getRootGroups())
+        rootGroup = createGroup().apply {
+            icon.standard = getStandardIcon(IconImageStandard.DATABASE_ID)
+        }
         kdfListV3.add(KdfFactory.aesKdf)
     }
 
-    private fun getGroupById(groupId: Int): GroupKDB? {
-        if (groupId == -1)
-            return null
-        return getGroupById(NodeIdInt(groupId))
-    }
-
     val backupGroup: GroupKDB?
         get() {
             return retrieveBackup()
@@ -63,6 +61,10 @@ class DatabaseKDB : DatabaseVersioned<Int, UUID, GroupKDB, EntryKDB>() {
             return listOf(BACKUP_FOLDER_TITLE)
         }
 
+    var defaultUserName: String = ""
+
+    var color: Int? = null
+
     override val kdfEngine: KdfEngine
         get() = kdfListV3[0]
 
@@ -77,11 +79,6 @@ class DatabaseKDB : DatabaseVersioned<Int, UUID, GroupKDB, EntryKDB>() {
             return list
         }
 
-    val rootGroups: List<GroupKDB>
-        get() {
-            return rootGroup?.getChildGroups() ?: ArrayList()
-        }
-
     override val passwordEncoding: String
         get() = "ISO-8859-1"
 

app/src/main/java/com/kunzisoft/keepass/database/element/database/DatabaseKDBX.kt

@@ -414,37 +414,37 @@ class DatabaseKDBX : DatabaseVersioned<UUID, UUID, GroupKDBX, EntryKDBX> {
     }
 
     fun getEntryByTitle(title: String, recursionLevel: Int): EntryKDBX? {
-        return this.entryIndexes.values.find { entry ->
+        return findEntry { entry ->
             entry.decodeTitleKey(recursionLevel).equals(title, true)
         }
     }
 
     fun getEntryByUsername(username: String, recursionLevel: Int): EntryKDBX? {
-        return this.entryIndexes.values.find { entry ->
+        return findEntry { entry ->
             entry.decodeUsernameKey(recursionLevel).equals(username, true)
         }
     }
 
     fun getEntryByURL(url: String, recursionLevel: Int): EntryKDBX? {
-        return this.entryIndexes.values.find { entry ->
+        return findEntry { entry ->
             entry.decodeUrlKey(recursionLevel).equals(url, true)
         }
     }
 
     fun getEntryByPassword(password: String, recursionLevel: Int): EntryKDBX? {
-        return this.entryIndexes.values.find { entry ->
+        return findEntry { entry ->
             entry.decodePasswordKey(recursionLevel).equals(password, true)
         }
     }
 
     fun getEntryByNotes(notes: String, recursionLevel: Int): EntryKDBX? {
-        return this.entryIndexes.values.find { entry ->
+        return findEntry { entry ->
             entry.decodeNotesKey(recursionLevel).equals(notes, true)
         }
     }
 
     fun getEntryByCustomData(customDataValue: String): EntryKDBX? {
-        return entryIndexes.values.find { entry ->
+        return findEntry { entry ->
             entry.customData.containsItemWithValue(customDataValue)
         }
     }

app/src/main/java/com/kunzisoft/keepass/database/element/database/DatabaseVersioned.kt

@@ -67,7 +67,7 @@ abstract class DatabaseVersioned<
     var changeDuplicateId = false
 
     private var groupIndexes = LinkedHashMap<NodeId<GroupId>, Group>()
-    protected var entryIndexes = LinkedHashMap<NodeId<EntryId>, Entry>()
+    private var entryIndexes = LinkedHashMap<NodeId<EntryId>, Entry>()
 
     abstract val version: String
 
@@ -89,6 +89,7 @@ abstract class DatabaseVersioned<
         set(value) {
             field = value
             value?.let {
+                removeGroupIndex(it)
                 addGroupIndex(it)
             }
         }
@@ -198,12 +199,6 @@ abstract class DatabaseVersioned<
      * -------------------------------------
      */
 
-    fun doForEachGroupInIndex(action: (Group) -> Unit) {
-        for (group in groupIndexes) {
-            action.invoke(group.value)
-        }
-    }
-
     /**
      * Determine if an id number is already in use
      *
@@ -219,14 +214,7 @@ abstract class DatabaseVersioned<
         return groupIndexes.values
     }
 
-    fun setGroupIndexes(groupList: List<Group>) {
+    open fun getGroupById(id: NodeId<GroupId>): Group? {
-        this.groupIndexes.clear()
-        for (currentGroup in groupList) {
-            this.groupIndexes[currentGroup.nodeId] = currentGroup
-        }
-    }
-
-    fun getGroupById(id: NodeId<GroupId>): Group? {
         return this.groupIndexes[id]
     }
 
@@ -250,16 +238,6 @@ abstract class DatabaseVersioned<
         this.groupIndexes.remove(group.nodeId)
     }
 
-    fun numberOfGroups(): Int {
-        return groupIndexes.size
-    }
-
-    fun doForEachEntryInIndex(action: (Entry) -> Unit) {
-        for (entry in entryIndexes) {
-            action.invoke(entry.value)
-        }
-    }
-
     fun isEntryIdUsed(id: NodeId<EntryId>): Boolean {
         return entryIndexes.containsKey(id)
     }
@@ -272,6 +250,10 @@ abstract class DatabaseVersioned<
         return this.entryIndexes[id]
     }
 
+    fun findEntry(predicate: (Entry) -> Boolean): Entry? {
+        return this.entryIndexes.values.find(predicate)
+    }
+
     fun addEntryIndex(entry: Entry) {
         val entryId = entry.nodeId
         if (entryIndexes.containsKey(entryId)) {
@@ -292,10 +274,6 @@ abstract class DatabaseVersioned<
         this.entryIndexes.remove(entry.nodeId)
     }
 
-    fun numberOfEntries(): Int {
-        return entryIndexes.size
-    }
-
     open fun clearCache() {
         this.groupIndexes.clear()
         this.entryIndexes.clear()

app/src/main/java/com/kunzisoft/keepass/database/element/entry/EntryKDB.kt

@@ -25,6 +25,7 @@ import com.kunzisoft.keepass.database.element.Attachment
 import com.kunzisoft.keepass.database.element.binary.AttachmentPool
 import com.kunzisoft.keepass.database.element.binary.BinaryData
 import com.kunzisoft.keepass.database.element.group.GroupKDB
+import com.kunzisoft.keepass.database.element.icon.IconImageStandard
 import com.kunzisoft.keepass.database.element.icon.IconImageStandard.Companion.KEY_ID
 import com.kunzisoft.keepass.database.element.node.NodeId
 import com.kunzisoft.keepass.database.element.node.NodeIdUUID
@@ -60,18 +61,43 @@ class EntryKDB : EntryVersioned<Int, UUID, GroupKDB, EntryKDB>, NodeKDBInterface
     private var binaryDataId: Int? = null
 
     // Determine if this is a MetaStream entry
-    val isMetaStream: Boolean
+    fun isMetaStream(): Boolean {
-        get() {
+        if (notes.isEmpty()) return false
-            if (notes.isEmpty()) return false
+        if (binaryDescription != PMS_ID_BINDESC) return false
-            if (binaryDescription != PMS_ID_BINDESC) return false
+        if (title.isEmpty()) return false
-            if (title.isEmpty()) return false
+        if (title != PMS_ID_TITLE) return false
-            if (title != PMS_ID_TITLE) return false
+        if (username.isEmpty()) return false
-            if (username.isEmpty()) return false
+        if (username != PMS_ID_USER) return false
-            if (username != PMS_ID_USER) return false
+        if (url.isEmpty()) return false
-            if (url.isEmpty()) return false
+        if (url != PMS_ID_URL) return false
-            if (url != PMS_ID_URL) return false
+        return icon.standard.id == KEY_ID
-            return icon.standard.id == KEY_ID
+    }
-        }
+
+    fun isMetaStreamDefaultUsername(): Boolean {
+        return isMetaStream() && notes == PMS_STREAM_DEFAULTUSER
+    }
+
+    private fun setMetaStream() {
+        binaryDescription = PMS_ID_BINDESC
+        title = PMS_ID_TITLE
+        username = PMS_ID_USER
+        url = PMS_ID_URL
+        icon.standard = IconImageStandard(KEY_ID)
+    }
+
+    fun setMetaStreamDefaultUsername() {
+        notes = PMS_STREAM_DEFAULTUSER
+        setMetaStream()
+    }
+
+    fun isMetaStreamDatabaseColor(): Boolean {
+        return isMetaStream() && notes == PMS_STREAM_DBCOLOR
+    }
+
+    fun setMetaStreamDatabaseColor() {
+        notes = PMS_STREAM_DBCOLOR
+        setMetaStream()
+    }
 
     override fun initNodeId(): NodeId<UUID> {
         return NodeIdUUID()
@@ -184,6 +210,13 @@ class EntryKDB : EntryVersioned<Int, UUID, GroupKDB, EntryKDB>, NodeKDBInterface
         private const val PMS_ID_USER = "SYSTEM"
         private const val PMS_ID_URL = "$"
 
+         const val PMS_STREAM_SIMPLESTATE = "Simple UI State"
+         const val PMS_STREAM_DEFAULTUSER = "Default User Name"
+         const val PMS_STREAM_SEARCHHISTORYITEM = "Search History Item"
+         const val PMS_STREAM_CUSTOMKVP = "Custom KVP"
+         const val PMS_STREAM_DBCOLOR = "Database Color"
+         const val PMS_STREAM_KPXICON2 = "KPX_CUSTOM_ICONS_2"
+
         @JvmField
         val CREATOR: Parcelable.Creator<EntryKDB> = object : Parcelable.Creator<EntryKDB> {
             override fun createFromParcel(parcel: Parcel): EntryKDB {

app/src/main/java/com/kunzisoft/keepass/database/element/icon/IconImageStandard.kt

@@ -81,6 +81,7 @@ class IconImageStandard : IconImageDraw {
         const val CREDIT_CARD_ID = 37
         const val TRASH_ID = 43
         const val FOLDER_ID = 48
+        const val DATABASE_ID = 50
         const val LIST_ID = 57
         const val BUILD_ID = 59
         const val STAR_ID = 61

app/src/main/java/com/kunzisoft/keepass/database/element/node/Node.kt

@@ -32,6 +32,19 @@ interface Node: NodeVersionedInterface<Group> {
     fun removeParent() {
         parent = null
     }
+
+    fun getPathString(): String {
+        val pathNodes = mutableListOf<Node>()
+        var currentNode = this
+        pathNodes.add(0, currentNode)
+        while (currentNode.containsParent()) {
+            currentNode.parent?.let { parent ->
+                currentNode = parent
+                pathNodes.add(0, currentNode)
+            }
+        }
+        return pathNodes.joinToString("/") { it.title }
+    }
 }
 
 /**

app/src/main/java/com/kunzisoft/keepass/database/element/node/NodeId.kt

@@ -44,4 +44,6 @@ abstract class NodeId<Id> : Parcelable {
     override fun hashCode(): Int {
         return id?.hashCode() ?: 0
     }
+
+    abstract fun toVisualString(): String?
 }

app/src/main/java/com/kunzisoft/keepass/database/element/node/NodeIdInt.kt

@@ -63,6 +63,10 @@ class NodeIdInt : NodeId<Int> {
         return id.toString()
     }
 
+    override fun toVisualString(): String? {
+        return null
+    }
+
     companion object {
         @JvmField
         val CREATOR: Parcelable.Creator<NodeIdInt> = object : Parcelable.Creator<NodeIdInt> {

app/src/main/java/com/kunzisoft/keepass/database/element/node/NodeIdUUID.kt

@@ -64,6 +64,10 @@ class NodeIdUUID : NodeId<UUID> {
         return UuidUtil.toHexString(id) ?: id.toString()
     }
 
+    override fun toVisualString(): String {
+        return toString()
+    }
+
     companion object {
         @JvmField
         val CREATOR: Parcelable.Creator<NodeIdUUID> = object : Parcelable.Creator<NodeIdUUID> {

app/src/main/java/com/kunzisoft/keepass/database/file/DatabaseHeader.kt

@@ -19,8 +19,6 @@
  */
 package com.kunzisoft.keepass.database.file
 
-import com.kunzisoft.keepass.utils.UnsignedInt
-
 abstract class DatabaseHeader {
 
     /**
@@ -33,8 +31,4 @@ abstract class DatabaseHeader {
      */
     var encryptionIV = ByteArray(16)
 
-    companion object {
-        val PWM_DBSIG_1 = UnsignedInt(-0x655d26fd)
-    }
-
 }

app/src/main/java/com/kunzisoft/keepass/database/file/DatabaseHeaderKDB.kt

@@ -34,7 +34,7 @@ class DatabaseHeaderKDB : DatabaseHeader() {
      */
     var transformSeed = ByteArray(32)
 
-    var signature1 = UnsignedInt(0)                  // = PWM_DBSIG_1
+    var signature1 = UnsignedInt(0)                  // = DBSIG_1
     var signature2 = UnsignedInt(0)                  // = DBSIG_2
     var flags= UnsignedInt(0)
     var version= UnsignedInt(0)
@@ -84,9 +84,9 @@ class DatabaseHeaderKDB : DatabaseHeader() {
     companion object {
 
         // DB sig from KeePass 1.03
-        val DBSIG_2 = UnsignedInt(-0x4ab4049b)
+        val DBSIG_1 = UnsignedInt(-0x655d26fd) // 0x9AA2D903
-        // DB sig from KeePass 1.03
+        val DBSIG_2 = UnsignedInt(-0x4ab4049b) // 0xB54BFB65
-        val DBVER_DW = UnsignedInt(0x00030003)
+        val DBVER_DW = UnsignedInt(0x00030004)
 
         val FLAG_SHA2 = UnsignedInt(1)
         val FLAG_RIJNDAEL = UnsignedInt(2)
@@ -97,7 +97,7 @@ class DatabaseHeaderKDB : DatabaseHeader() {
         const val BUF_SIZE = 124
 
         fun matchesHeader(sig1: UnsignedInt, sig2: UnsignedInt): Boolean {
-            return sig1.toKotlinInt() == PWM_DBSIG_1.toKotlinInt() && sig2.toKotlinInt() == DBSIG_2.toKotlinInt()
+            return sig1.toKotlinInt() == DBSIG_1.toKotlinInt() && sig2.toKotlinInt() == DBSIG_2.toKotlinInt()
         }
 
         fun compatibleHeaders(one: UnsignedInt, two: UnsignedInt): Boolean {

app/src/main/java/com/kunzisoft/keepass/database/file/DatabaseHeaderKDBX.kt

@@ -311,8 +311,9 @@ class DatabaseHeaderKDBX(private val databaseV4: DatabaseKDBX) : DatabaseHeader(
 
     companion object {
 
-        val DBSIG_PRE2 = UnsignedInt(-0x4ab4049a)
+        val DBSIG_1 = UnsignedInt(-0x655d26fd) // 0x9AA2D903
-        val DBSIG_2 = UnsignedInt(-0x4ab40499)
+        val DBSIG_PRE2 = UnsignedInt(-0x4ab4049a) // 0xB54BFB66
+        val DBSIG_2 = UnsignedInt(-0x4ab40499) // 0xB54BFB67
 
         private val FILE_VERSION_CRITICAL_MASK = UnsignedInt(-0x10000)
         val FILE_VERSION_31 = UnsignedInt(0x00030001)
@@ -335,7 +336,7 @@ class DatabaseHeaderKDBX(private val databaseV4: DatabaseKDBX) : DatabaseHeader(
         }
 
         fun matchesHeader(sig1: UnsignedInt, sig2: UnsignedInt): Boolean {
-            return sig1 == PWM_DBSIG_1 && (sig2 == DBSIG_PRE2 || sig2 == DBSIG_2)
+            return sig1 == DBSIG_1 && (sig2 == DBSIG_PRE2 || sig2 == DBSIG_2)
         }
     }
 }

app/src/main/java/com/kunzisoft/keepass/database/file/input/DatabaseInputKDB.kt

@@ -20,6 +20,7 @@
 
 package com.kunzisoft.keepass.database.file.input
 
+import android.graphics.Color
 import com.kunzisoft.encrypt.HashManager
 import com.kunzisoft.keepass.database.crypto.EncryptionAlgorithm
 import com.kunzisoft.keepass.database.element.DateInstant
@@ -30,7 +31,6 @@ import com.kunzisoft.keepass.database.element.group.GroupKDB
 import com.kunzisoft.keepass.database.element.node.NodeIdInt
 import com.kunzisoft.keepass.database.element.node.NodeIdUUID
 import com.kunzisoft.keepass.database.exception.*
-import com.kunzisoft.keepass.database.file.DatabaseHeader
 import com.kunzisoft.keepass.database.file.DatabaseHeaderKDB
 import com.kunzisoft.keepass.tasks.ProgressTaskUpdater
 import com.kunzisoft.keepass.utils.*
@@ -98,7 +98,7 @@ class DatabaseInputKDB(cacheDirectory: File,
             if (fileSize != (contentSize + DatabaseHeaderKDB.BUF_SIZE))
                 throw IOException("Header corrupted")
 
-            if (header.signature1 != DatabaseHeader.PWM_DBSIG_1
+            if (header.signature1 != DatabaseHeaderKDB.DBSIG_1
                     || header.signature2 != DatabaseHeaderKDB.DBSIG_2) {
                 throw SignatureDatabaseException()
             }
@@ -153,10 +153,6 @@ class DatabaseInputKDB(cacheDirectory: File,
                     )
             )
 
-            // New manual root because KDB contains multiple root groups (here available with getRootGroups())
-            val newRoot = mDatabase.createGroup()
-            mDatabase.rootGroup = newRoot
-
             // Import all nodes
             val groupLevelList = HashMap<GroupKDB, Int>()
             var newGroup: GroupKDB? = null
@@ -303,7 +299,34 @@ class DatabaseInputKDB(cacheDirectory: File,
                             newGroup = null
                         }
                         newEntry?.let { entry ->
-                            mDatabase.addEntryIndex(entry)
+                            // Parse meta info
+                            when {
+                                entry.isMetaStreamDefaultUsername() -> {
+                                    var defaultUser = ""
+                                    entry.getBinary(mDatabase.attachmentPool)
+                                        ?.getInputDataStream(mDatabase.binaryCache)?.use {
+                                            defaultUser = String(it.readBytes())
+                                        }
+                                    mDatabase.defaultUserName = defaultUser
+                                }
+                                entry.isMetaStreamDatabaseColor() -> {
+                                    var color: Int? = null
+                                    entry.getBinary(mDatabase.attachmentPool)
+                                        ?.getInputDataStream(mDatabase.binaryCache)?.use {
+                                            val reverseColor = UnsignedInt(it.readBytes4ToUInt()).toKotlinInt()
+                                            color = Color.rgb(
+                                                Color.blue(reverseColor),
+                                                Color.green(reverseColor),
+                                                Color.red(reverseColor)
+                                            )
+                                        }
+                                    mDatabase.color = color
+                                }
+                                // TODO manager other meta stream
+                                else -> {
+                                    mDatabase.addEntryIndex(entry)
+                                }
+                            }
                             currentEntryNumber++
                             newEntry = null
                         }

app/src/main/java/com/kunzisoft/keepass/database/file/output/DatabaseHeaderOutputKDBX.kt

@@ -68,7 +68,7 @@ constructor(private val databaseKDBX: DatabaseKDBX,
     @Throws(IOException::class)
     fun output() {
 
-        mos.write4BytesUInt(DatabaseHeader.PWM_DBSIG_1)
+        mos.write4BytesUInt(DatabaseHeaderKDBX.DBSIG_1)
         mos.write4BytesUInt(DatabaseHeaderKDBX.DBSIG_2)
         mos.write4BytesUInt(header.version)
 

app/src/main/java/com/kunzisoft/keepass/database/file/output/DatabaseOutputKDB.kt

@@ -19,9 +19,11 @@
  */
 package com.kunzisoft.keepass.database.file.output
 
+import android.graphics.Color
 import com.kunzisoft.encrypt.HashManager
 import com.kunzisoft.keepass.database.crypto.EncryptionAlgorithm
 import com.kunzisoft.keepass.database.element.database.DatabaseKDB
+import com.kunzisoft.keepass.database.element.entry.EntryKDB
 import com.kunzisoft.keepass.database.element.group.GroupKDB
 import com.kunzisoft.keepass.database.exception.DatabaseOutputException
 import com.kunzisoft.keepass.database.file.DatabaseHeader
@@ -34,7 +36,6 @@ import java.io.ByteArrayOutputStream
 import java.io.IOException
 import java.io.OutputStream
 import java.security.*
-import java.util.*
 import javax.crypto.Cipher
 import javax.crypto.CipherOutputStream
 
@@ -44,6 +45,9 @@ class DatabaseOutputKDB(private val mDatabaseKDB: DatabaseKDB,
 
     private var headerHashBlock: ByteArray? = null
 
+    private var mGroupList = mutableListOf<GroupKDB>()
+    private var mEntryList = mutableListOf<EntryKDB>()
+
     @Throws(DatabaseOutputException::class)
     fun getFinalKey(header: DatabaseHeader): ByteArray? {
         try {
@@ -61,7 +65,7 @@ class DatabaseOutputKDB(private val mDatabaseKDB: DatabaseKDB,
         // and remove any orphaned nodes that are no longer part of the tree hierarchy
         // also remove the virtual root not present in kdb
         val rootGroup = mDatabaseKDB.rootGroup
-        sortGroupsForOutput()
+        sortNodesForOutput()
 
         val header = outputHeader(mOutputStream)
 
@@ -91,6 +95,7 @@ class DatabaseOutputKDB(private val mDatabaseKDB: DatabaseKDB,
         } finally {
             // Add again the virtual root group for better management
             mDatabaseKDB.rootGroup = rootGroup
+            clearParser()
         }
     }
 
@@ -105,7 +110,7 @@ class DatabaseOutputKDB(private val mDatabaseKDB: DatabaseKDB,
     override fun outputHeader(outputStream: OutputStream): DatabaseHeaderKDB {
         // Build header
         val header = DatabaseHeaderKDB()
-        header.signature1 = DatabaseHeader.PWM_DBSIG_1
+        header.signature1 = DatabaseHeaderKDB.DBSIG_1
         header.signature2 = DatabaseHeaderKDB.DBSIG_2
         header.flags = DatabaseHeaderKDB.FLAG_SHA2
 
@@ -120,8 +125,9 @@ class DatabaseOutputKDB(private val mDatabaseKDB: DatabaseKDB,
         }
 
         header.version = DatabaseHeaderKDB.DBVER_DW
-        header.numGroups = UnsignedInt(mDatabaseKDB.numberOfGroups())
+        // To remove root
-        header.numEntries = UnsignedInt(mDatabaseKDB.numberOfEntries())
+        header.numGroups = UnsignedInt(mGroupList.size)
+        header.numEntries = UnsignedInt(mEntryList.size)
         header.numKeyEncRounds = UnsignedInt.fromKotlinLong(mDatabaseKDB.numberKeyEncryptionRounds)
 
         setIVs(header)
@@ -194,31 +200,89 @@ class DatabaseOutputKDB(private val mDatabaseKDB: DatabaseKDB,
         }
 
         // Groups
-        mDatabaseKDB.doForEachGroupInIndex { group ->
+        mGroupList.forEach { group ->
-            GroupOutputKDB(group, outputStream).output()
+            if (group != mDatabaseKDB.rootGroup) {
+                GroupOutputKDB(group, outputStream).output()
+            }
         }
         // Entries
-        mDatabaseKDB.doForEachEntryInIndex { entry ->
+        mEntryList.forEach { entry ->
             EntryOutputKDB(mDatabaseKDB, entry, outputStream).output()
         }
     }
 
-    private fun sortGroupsForOutput() {
+    private fun clearParser() {
-        val groupList = ArrayList<GroupKDB>()
+        mGroupList.clear()
-        // Rebuild list according to sorting order removing any orphaned groups
+        mEntryList.clear()
-        for (rootGroup in mDatabaseKDB.rootGroups) {
-            sortGroup(rootGroup, groupList)
-        }
-        mDatabaseKDB.setGroupIndexes(groupList)
     }
 
-    private fun sortGroup(group: GroupKDB, groupList: MutableList<GroupKDB>) {
+    private fun sortNodesForOutput() {
+        clearParser()
+        // Rebuild list according to sorting order removing any orphaned groups
+        // Do not keep root
+        mDatabaseKDB.rootGroup?.getChildGroups()?.let { rootSubGroups ->
+            for (rootGroup in rootSubGroups) {
+                sortGroup(rootGroup)
+            }
+        }
+    }
+
+    private fun sortGroup(group: GroupKDB) {
         // Add current tree
-        groupList.add(group)
+        mGroupList.add(group)
+
+        for (childEntry in group.getChildEntries()) {
+            if (!childEntry.isMetaStreamDefaultUsername()
+                && !childEntry.isMetaStreamDatabaseColor()) {
+                mEntryList.add(childEntry)
+            }
+        }
+
+        // Add MetaStream
+        if (mDatabaseKDB.defaultUserName.isNotEmpty()) {
+            val metaEntry = EntryKDB().apply {
+                setMetaStreamDefaultUsername()
+                setDefaultUsername(this)
+            }
+            mDatabaseKDB.addEntryTo(metaEntry, group)
+            mEntryList.add(metaEntry)
+        }
+        if (mDatabaseKDB.color != null) {
+            val metaEntry = EntryKDB().apply {
+                setMetaStreamDatabaseColor()
+                setDatabaseColor(this)
+            }
+            mDatabaseKDB.addEntryTo(metaEntry, group)
+            mEntryList.add(metaEntry)
+        }
 
         // Recurse over children
         for (childGroup in group.getChildGroups()) {
-            sortGroup(childGroup, groupList)
+            sortGroup(childGroup)
+        }
+    }
+
+    private fun setDefaultUsername(entryKDB: EntryKDB) {
+        val binaryData = mDatabaseKDB.buildNewAttachment()
+        entryKDB.putBinary(binaryData, mDatabaseKDB.attachmentPool)
+        BufferedOutputStream(binaryData.getOutputDataStream(mDatabaseKDB.binaryCache)).use { outputStream ->
+            outputStream.write(mDatabaseKDB.defaultUserName.toByteArray())
+        }
+    }
+
+    private fun setDatabaseColor(entryKDB: EntryKDB) {
+        val binaryData = mDatabaseKDB.buildNewAttachment()
+        entryKDB.putBinary(binaryData, mDatabaseKDB.attachmentPool)
+        BufferedOutputStream(binaryData.getOutputDataStream(mDatabaseKDB.binaryCache)).use { outputStream ->
+            var reversColor = Color.BLACK
+            mDatabaseKDB.color?.let {
+                reversColor = Color.rgb(
+                    Color.blue(it),
+                    Color.green(it),
+                    Color.red(it)
+                )
+            }
+            outputStream.write4BytesUInt(UnsignedInt(reversColor))
         }
     }
 

app/src/main/java/com/kunzisoft/keepass/database/file/output/DatabaseOutputKDBX.kt

@@ -48,7 +48,6 @@ import com.kunzisoft.keepass.database.file.DateKDBXUtil
 import com.kunzisoft.keepass.stream.HashedBlockOutputStream
 import com.kunzisoft.keepass.stream.HmacBlockOutputStream
 import com.kunzisoft.keepass.utils.*
-import org.joda.time.DateTime
 import org.xmlpull.v1.XmlSerializer
 import java.io.IOException
 import java.io.OutputStream

app/src/main/java/com/kunzisoft/keepass/education/PasswordActivityEducation.kt

@@ -38,9 +38,9 @@ class PasswordActivityEducation(activity: Activity)
                         activity.getString(R.string.education_unlock_summary))
                         .outerCircleColorInt(getCircleColor())
                         .outerCircleAlpha(getCircleAlpha())
-                        .icon(ContextCompat.getDrawable(activity, R.mipmap.ic_launcher_round))
+                        .icon(ContextCompat.getDrawable(activity, R.drawable.ic_lock_open_white_24dp))
                         .textColorInt(getTextColor())
-                        .tintTarget(false)
+                        .tintTarget(true)
                         .cancelable(true),
                 object : TapTargetView.Listener() {
                     override fun onTargetClick(view: TapTargetView) {

app/src/main/java/com/kunzisoft/keepass/model/EntryInfo.kt

@@ -40,6 +40,8 @@ class EntryInfo : NodeInfo {
     var password: String = ""
     var url: String = ""
     var notes: String = ""
+    var backgroundColor: Int? = null
+    var foregroundColor: Int? = null
     var customFields: MutableList<Field> = mutableListOf()
     var attachments: MutableList<Attachment> = mutableListOf()
     var otpModel: OtpModel? = null
@@ -53,6 +55,10 @@ class EntryInfo : NodeInfo {
         password = parcel.readString() ?: password
         url = parcel.readString() ?: url
         notes = parcel.readString() ?: notes
+        val readBgColor = parcel.readInt()
+        backgroundColor = if (readBgColor == -1) null else readBgColor
+        val readFgColor = parcel.readInt()
+        foregroundColor = if (readFgColor == -1) null else readFgColor
         parcel.readList(customFields, Field::class.java.classLoader)
         parcel.readList(attachments, Attachment::class.java.classLoader)
         otpModel = parcel.readParcelable(OtpModel::class.java.classLoader) ?: otpModel
@@ -70,6 +76,8 @@ class EntryInfo : NodeInfo {
         parcel.writeString(password)
         parcel.writeString(url)
         parcel.writeString(notes)
+        parcel.writeInt(backgroundColor ?: -1)
+        parcel.writeInt(foregroundColor ?: -1)
         parcel.writeList(customFields)
         parcel.writeList(attachments)
         parcel.writeParcelable(otpModel, flags)
@@ -196,6 +204,8 @@ class EntryInfo : NodeInfo {
         if (password != other.password) return false
         if (url != other.url) return false
         if (notes != other.notes) return false
+        if (backgroundColor != other.backgroundColor) return false
+        if (foregroundColor != other.foregroundColor) return false
         if (customFields != other.customFields) return false
         if (attachments != other.attachments) return false
         if (otpModel != other.otpModel) return false
@@ -211,6 +221,8 @@ class EntryInfo : NodeInfo {
         result = 31 * result + password.hashCode()
         result = 31 * result + url.hashCode()
         result = 31 * result + notes.hashCode()
+        result = 31 * result + backgroundColor.hashCode()
+        result = 31 * result + foregroundColor.hashCode()
         result = 31 * result + customFields.hashCode()
         result = 31 * result + attachments.hashCode()
         result = 31 * result + (otpModel?.hashCode() ?: 0)

app/src/main/java/com/kunzisoft/keepass/model/GroupInfo.kt

@@ -1,12 +1,15 @@
 package com.kunzisoft.keepass.model
 
 import android.os.Parcel
+import android.os.ParcelUuid
 import android.os.Parcelable
 import com.kunzisoft.keepass.database.element.icon.IconImageStandard
 import com.kunzisoft.keepass.database.element.icon.IconImageStandard.Companion.FOLDER_ID
+import java.util.*
 
 class GroupInfo : NodeInfo {
 
+    var id: UUID? = null
     var notes: String? = null
 
     init {
@@ -16,11 +19,14 @@ class GroupInfo : NodeInfo {
     constructor(): super()
 
     constructor(parcel: Parcel): super(parcel) {
+        id = parcel.readParcelable<ParcelUuid>(ParcelUuid::class.java.classLoader)?.uuid ?: id
         notes = parcel.readString()
     }
 
     override fun writeToParcel(parcel: Parcel, flags: Int) {
         super.writeToParcel(parcel, flags)
+        val uuid = if (id != null) ParcelUuid(id) else null
+        parcel.writeParcelable(uuid, flags)
         parcel.writeString(notes)
     }
 
@@ -29,6 +35,7 @@ class GroupInfo : NodeInfo {
         if (other !is GroupInfo) return false
         if (!super.equals(other)) return false
 
+        if (id != other.id) return false
         if (notes != other.notes) return false
 
         return true
@@ -36,6 +43,7 @@ class GroupInfo : NodeInfo {
 
     override fun hashCode(): Int {
         var result = super.hashCode()
+        result = 31 * result + (id?.hashCode() ?: 0)
         result = 31 * result + (notes?.hashCode() ?: 0)
         return result
     }

app/src/main/java/com/kunzisoft/keepass/model/NodeInfo.kt

@@ -4,6 +4,8 @@ import android.os.Parcel
 import android.os.Parcelable
 import com.kunzisoft.keepass.database.element.DateInstant
 import com.kunzisoft.keepass.database.element.icon.IconImage
+import com.kunzisoft.keepass.utils.UuidUtil
+import java.util.*
 
 open class NodeInfo() : Parcelable {
 

app/src/main/java/com/kunzisoft/keepass/settings/NestedAppSettingsFragment.kt

@@ -452,7 +452,7 @@ class NestedAppSettingsFragment : NestedSettingsFragment() {
             getString(R.string.show_uuid_key),
             getString(R.string.enable_education_screens_key),
             getString(R.string.reset_education_screens_key) -> {
-                DATABASE_APPEARANCE_PREFERENCE_CHANGED = true
+                DATABASE_PREFERENCE_CHANGED = true
             }
         }
         return super.onPreferenceTreeClick(preference)
@@ -516,6 +516,6 @@ class NestedAppSettingsFragment : NestedSettingsFragment() {
     companion object {
         private const val TAG_PREF_FRAGMENT = "TAG_PREF_FRAGMENT"
 
-        var DATABASE_APPEARANCE_PREFERENCE_CHANGED = false
+        var DATABASE_PREFERENCE_CHANGED = false
     }
 }

app/src/main/java/com/kunzisoft/keepass/settings/NestedDatabaseSettingsFragment.kt

@@ -30,8 +30,8 @@ import androidx.preference.PreferenceCategory
 import androidx.preference.SwitchPreference
 import com.kunzisoft.androidclearchroma.ChromaUtil
 import com.kunzisoft.keepass.R
-import com.kunzisoft.keepass.activities.legacy.DatabaseRetrieval
 import com.kunzisoft.keepass.activities.dialogs.AssignMasterKeyDialogFragment
+import com.kunzisoft.keepass.activities.legacy.DatabaseRetrieval
 import com.kunzisoft.keepass.activities.legacy.resetAppTimeoutWhenViewTouchedOrFocused
 import com.kunzisoft.keepass.database.crypto.EncryptionAlgorithm
 import com.kunzisoft.keepass.database.crypto.kdf.KdfEngine
@@ -165,28 +165,19 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
 
         // Database default username
         dbDefaultUsernamePref = findPreference(getString(R.string.database_default_username_key))
-        if (database.allowDefaultUsername) {
+        dbDefaultUsernamePref?.summary = database.defaultUsername
-            dbDefaultUsernamePref?.summary = database.defaultUsername
-        } else {
-            dbDefaultUsernamePref?.isEnabled = false
-            // TODO dbGeneralPrefCategory?.removePreference(dbDefaultUsername)
-        }
 
         // Database custom color
         dbCustomColorPref = findPreference(getString(R.string.database_custom_color_key))
-        if (database.allowCustomColor) {
+        dbCustomColorPref?.apply {
-            dbCustomColorPref?.apply {
+            val customColor = database.customColor
-                try {
+            if (customColor != null) {
-                    color = Color.parseColor(database.customColor)
+                color = customColor
-                    summary = database.customColor
+                summary = ChromaUtil.getFormattedColorString(customColor, false)
-                } catch (e: Exception) {
+            } else{
-                    color = DialogColorPreference.DISABLE_COLOR
+                color = DialogColorPreference.DISABLE_COLOR
-                    summary = ""
+                summary = ""
-                }
             }
-        } else {
-            dbCustomColorPref?.isEnabled = false
-            // TODO dbGeneralPrefCategory?.removePreference(dbCustomColorPref)
         }
 
         // Version
@@ -348,12 +339,13 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
         }
     }
 
-    private val colorSelectedListener: ((Boolean, Int)-> Unit) = { enable, color ->
+    private val colorSelectedListener: ((Int?)-> Unit) = { color ->
-        dbCustomColorPref?.summary = ChromaUtil.getFormattedColorString(color, false)
+        if (color != null) {
-        if (enable) {
             dbCustomColorPref?.color = color
+            dbCustomColorPref?.summary = ChromaUtil.getFormattedColorString(color, false)
         } else {
             dbCustomColorPref?.color = DialogColorPreference.DISABLE_COLOR
+            dbCustomColorPref?.summary = ""
         }
     }
 
@@ -426,7 +418,7 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
                                 if (result.isSuccess) {
                                     newColor
                                 } else {
-                                    mDatabase?.customColor = oldColor
+                                    mDatabase?.customColor = Color.parseColor(oldColor)
                                     oldColor
                                 }
                         dbCustomColorPref?.summary = defaultColorToShow
@@ -681,6 +673,27 @@ class NestedDatabaseSettingsFragment : NestedSettingsFragment(), DatabaseRetriev
         }
     }
 
+    override fun onPreferenceTreeClick(preference: Preference?): Boolean {
+        // To reload group when database settings are modified
+        when (preference?.key) {
+            getString(R.string.database_name_key),
+            getString(R.string.database_description_key),
+            getString(R.string.database_default_username_key),
+            getString(R.string.database_custom_color_key),
+            getString(R.string.database_data_compression_key),
+            getString(R.string.database_data_remove_unlinked_attachments_key),
+            getString(R.string.recycle_bin_enable_key),
+            getString(R.string.recycle_bin_group_key),
+            getString(R.string.templates_group_enable_key),
+            getString(R.string.templates_group_uuid_key),
+            getString(R.string.max_history_items_key),
+            getString(R.string.max_history_size_key) -> {
+                NestedAppSettingsFragment.DATABASE_PREFERENCE_CHANGED = true
+            }
+        }
+        return super.onPreferenceTreeClick(preference)
+    }
+
     companion object {
         private const val TAG_PREF_FRAGMENT = "TAG_PREF_FRAGMENT"
     }

app/src/main/java/com/kunzisoft/keepass/settings/preference/DialogColorPreference.kt

@@ -41,7 +41,7 @@ class DialogColorPreference @JvmOverloads constructor(context: Context,
     }
 
     override fun getDialogLayoutResource(): Int {
-        return R.layout.pref_dialog_input_color
+        return R.layout.fragment_color_picker
     }
 
     companion object {

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseColorPreferenceDialogFragmentCompat.kt

@@ -30,27 +30,57 @@ import android.view.Window
 import android.widget.CompoundButton
 import androidx.annotation.ColorInt
 import androidx.appcompat.app.AlertDialog
-import com.kunzisoft.androidclearchroma.ChromaUtil
 import com.kunzisoft.androidclearchroma.IndicatorMode
 import com.kunzisoft.androidclearchroma.colormode.ColorMode
 import com.kunzisoft.androidclearchroma.fragment.ChromaColorFragment
 import com.kunzisoft.androidclearchroma.fragment.ChromaColorFragment.*
+import com.kunzisoft.androidclearchroma.view.ChromaColorView
 import com.kunzisoft.keepass.R
+import com.kunzisoft.keepass.activities.dialogs.ColorPickerDialogFragment
 import com.kunzisoft.keepass.database.element.Database
 
 class DatabaseColorPreferenceDialogFragmentCompat : DatabaseSavePreferenceDialogFragmentCompat() {
 
     private lateinit var rootView: View
     private lateinit var enableSwitchView: CompoundButton
-    private var chromaColorFragment: ChromaColorFragment? = null
+    private lateinit var chromaColorView: ChromaColorView
 
-    var onColorSelectedListener: ((enable: Boolean, color: Int) -> Unit)? = null
+    var onColorSelectedListener: ((color: Int?) -> Unit)? = null
+
+    private var mDefaultColor = Color.WHITE
+    private var mActivated = false
 
     override fun onCreateDialog(savedInstanceState: Bundle?): Dialog {
         val alertDialogBuilder = AlertDialog.Builder(requireActivity())
 
-        rootView = requireActivity().layoutInflater.inflate(R.layout.pref_dialog_input_color, null)
+        rootView = requireActivity().layoutInflater.inflate(R.layout.fragment_color_picker, null)
         enableSwitchView = rootView.findViewById(R.id.switch_element)
+        chromaColorView = rootView.findViewById(R.id.chroma_color_view)
+
+        if (savedInstanceState != null) {
+            if (savedInstanceState.containsKey(ARG_INITIAL_COLOR)) {
+                mDefaultColor = savedInstanceState.getInt(ARG_INITIAL_COLOR)
+            }
+            if (savedInstanceState.containsKey(ARG_ACTIVATED)) {
+                mActivated = savedInstanceState.getBoolean(ARG_ACTIVATED)
+            }
+        } else {
+            arguments?.apply {
+                if (containsKey(ARG_INITIAL_COLOR)) {
+                    mDefaultColor = getInt(ARG_INITIAL_COLOR)
+                }
+                if (containsKey(ARG_ACTIVATED)) {
+                    mActivated = getBoolean(ARG_ACTIVATED)
+                }
+            }
+        }
+        enableSwitchView.isChecked = mActivated
+        chromaColorView.currentColor = mDefaultColor
+
+        chromaColorView.setOnColorChangedListener {
+            if (!enableSwitchView.isChecked)
+                enableSwitchView.isChecked = true
+        }
 
         alertDialogBuilder.setPositiveButton(android.R.string.ok) { _, _ ->
             onDialogClosed(true)
@@ -68,8 +98,6 @@ class DatabaseColorPreferenceDialogFragmentCompat : DatabaseSavePreferenceDialog
         // request a window without the title
         dialog.window?.requestFeature(Window.FEATURE_NO_TITLE)
 
-        dialog.setOnShowListener { measureLayout(it as Dialog) }
-
         return dialog
     }
 
@@ -77,73 +105,48 @@ class DatabaseColorPreferenceDialogFragmentCompat : DatabaseSavePreferenceDialog
         super.onDatabaseRetrieved(database)
 
         database?.let {
-            val initColor = try {
+            var initColor = it.customColor
+            if (initColor != null) {
                 enableSwitchView.isChecked = true
-                Color.parseColor(it.customColor)
+            } else {
-            } catch (e: Exception) {
                 enableSwitchView.isChecked = false
-                DEFAULT_COLOR
+                initColor = DEFAULT_COLOR
             }
+            chromaColorView.currentColor = initColor
             arguments?.putInt(ARG_INITIAL_COLOR, initColor)
         }
-
-        val fragmentManager = childFragmentManager
-        chromaColorFragment = fragmentManager.findFragmentByTag(TAG_FRAGMENT_COLORS) as ChromaColorFragment?
-
-        if (chromaColorFragment == null) {
-            chromaColorFragment = newInstance(arguments)
-            fragmentManager.beginTransaction().apply {
-                add(com.kunzisoft.androidclearchroma.R.id.color_dialog_container, chromaColorFragment!!, TAG_FRAGMENT_COLORS)
-                commit()
-            }
-        }
     }
 
     override fun onDialogClosed(database: Database?, positiveResult: Boolean) {
         super.onDialogClosed(database, positiveResult)
         if (positiveResult) {
-            val customColorEnable = enableSwitchView.isChecked
+            val newColor: Int? = if (enableSwitchView.isChecked)
-            chromaColorFragment?.currentColor?.let { currentColor ->
+                chromaColorView.currentColor
-                onColorSelectedListener?.invoke(customColorEnable, currentColor)
+            else
-                database?.let {
+                null
-                    val newColor = if (customColorEnable) {
+            onColorSelectedListener?.invoke(newColor)
-                        ChromaUtil.getFormattedColorString(currentColor, false)
+            database?.let {
-                    } else {
+                val oldColor = database.customColor
-                        ""
+                database.customColor = newColor
-                    }
+                saveColor(oldColor, newColor)
-                    val oldColor = database.customColor
-                    database.customColor = newColor
-                    saveColor(oldColor, newColor)
-                }
             }
         }
     }
 
-    /**
-     * Set new dimensions to dialog
-     * @param ad dialog
-     */
-    private fun measureLayout(ad: Dialog) {
-        val typedValue = TypedValue()
-        resources.getValue(com.kunzisoft.androidclearchroma.R.dimen.chroma_dialog_height_multiplier, typedValue, true)
-        val heightMultiplier = typedValue.float
-        val height = (ad.context.resources.displayMetrics.heightPixels * heightMultiplier).toInt()
-
-        resources.getValue(com.kunzisoft.androidclearchroma.R.dimen.chroma_dialog_width_multiplier, typedValue, true)
-        val widthMultiplier = typedValue.float
-        val width = (ad.context.resources.displayMetrics.widthPixels * widthMultiplier).toInt()
-
-        ad.window?.setLayout(width, height)
-    }
-
     override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? {
         super.onCreateView(inflater, container, savedInstanceState)
         return rootView
     }
 
-    companion object {
+    override fun onSaveInstanceState(outState: Bundle) {
-        private const val TAG_FRAGMENT_COLORS = "TAG_FRAGMENT_COLORS"
+        super.onSaveInstanceState(outState)
+        outState.putInt(ARG_INITIAL_COLOR, chromaColorView.currentColor)
+        outState.putBoolean(ARG_ACTIVATED, mActivated)
+    }
 
+    companion object {
+        private const val ARG_INITIAL_COLOR = "ARG_INITIAL_COLOR"
+        private const val ARG_ACTIVATED = "ARG_ACTIVATED"
         @ColorInt
         const val DEFAULT_COLOR: Int = Color.WHITE
 
@@ -151,9 +154,7 @@ class DatabaseColorPreferenceDialogFragmentCompat : DatabaseSavePreferenceDialog
             val fragment = DatabaseColorPreferenceDialogFragmentCompat()
             val bundle = Bundle(1)
             bundle.putString(ARG_KEY, key)
-            bundle.putInt(ARG_INITIAL_COLOR, Color.BLACK)
+            bundle.putInt(ARG_INITIAL_COLOR, DEFAULT_COLOR)
-            bundle.putInt(ARG_COLOR_MODE, ColorMode.RGB.ordinal)
-            bundle.putInt(ARG_INDICATOR_MODE, IndicatorMode.HEX.ordinal)
             fragment.arguments = bundle
 
             return fragment

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DatabaseSavePreferenceDialogFragmentCompat.kt

@@ -22,6 +22,7 @@ package com.kunzisoft.keepass.settings.preferencedialogfragment
 import android.content.Context
 import android.os.Bundle
 import androidx.fragment.app.activityViewModels
+import com.kunzisoft.androidclearchroma.ChromaUtil
 import com.kunzisoft.keepass.activities.legacy.DatabaseRetrieval
 import com.kunzisoft.keepass.database.crypto.EncryptionAlgorithm
 import com.kunzisoft.keepass.database.crypto.kdf.KdfEngine
@@ -76,9 +77,17 @@ abstract class DatabaseSavePreferenceDialogFragmentCompat
         // To inherit to save element in database
     }
 
-    protected fun saveColor(oldColor: String,
+    protected fun saveColor(oldColor: Int?,
-                            newColor: String) {
+                            newColor: Int?) {
-        mDatabaseViewModel.saveColor(oldColor, newColor, mDatabaseAutoSaveEnable)
+        val oldColorString = if (oldColor != null)
+                ChromaUtil.getFormattedColorString(oldColor, false)
+            else
+                ""
+        val newColorString = if (newColor != null)
+            ChromaUtil.getFormattedColorString(newColor, false)
+        else
+            ""
+        mDatabaseViewModel.saveColor(oldColorString, newColorString, mDatabaseAutoSaveEnable)
     }
 
     protected fun saveCompression(oldCompression: CompressionAlgorithm,

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/DurationDialogFragmentCompat.kt

@@ -19,7 +19,13 @@
  */
 package com.kunzisoft.keepass.settings.preferencedialogfragment
 
+import android.app.AlarmManager
+import android.content.Context
+import android.content.Intent
+import android.os.Build
 import android.os.Bundle
+import android.provider.Settings.ACTION_REQUEST_SCHEDULE_EXACT_ALARM
+import android.util.Log
 import android.view.View
 import android.widget.NumberPicker
 import com.kunzisoft.keepass.R
@@ -62,6 +68,30 @@ class DurationDialogFragmentCompat : InputPreferenceDialogFragmentCompat() {
         }
     }
 
+    override fun onResume() {
+        super.onResume()
+
+        (context?.applicationContext?.getSystemService(Context.ALARM_SERVICE) as AlarmManager?)?.let { alarmManager ->
+            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S
+                && !alarmManager.canScheduleExactAlarms()) {
+                setExplanationText(R.string.warning_exact_alarm)
+                setExplanationButton(R.string.permission) {
+                    // Open the exact alarm permission screen
+                    try {
+                        startActivity(Intent().apply {
+                            action = ACTION_REQUEST_SCHEDULE_EXACT_ALARM
+                        })
+                    } catch (e: Exception) {
+                        Log.e(TAG, "Unable to open exact alarm permission screen", e)
+                    }
+                }
+            } else {
+                explanationText = ""
+                setExplanationButton("") {}
+            }
+        }
+    }
+
     private fun durationToDaysHoursMinutesSeconds(duration: Long) {
         if (duration < 0) {
             mEnabled = false
@@ -164,6 +194,7 @@ class DurationDialogFragmentCompat : InputPreferenceDialogFragmentCompat() {
     }
 
     companion object {
+        private const val TAG = "DurationDialogFrgCmpt"
         private const val ENABLE_KEY = "ENABLE_KEY"
         private const val DAYS_KEY = "DAYS_KEY"
         private const val HOURS_KEY = "HOURS_KEY"

app/src/main/java/com/kunzisoft/keepass/settings/preferencedialogfragment/InputPreferenceDialogFragmentCompat.kt

@@ -22,6 +22,7 @@ package com.kunzisoft.keepass.settings.preferencedialogfragment
 import android.view.View
 import android.view.inputmethod.EditorInfo
 import android.view.inputmethod.InputMethodManager
+import android.widget.Button
 import android.widget.CompoundButton
 import android.widget.EditText
 import android.widget.TextView
@@ -35,6 +36,7 @@ abstract class InputPreferenceDialogFragmentCompat : PreferenceDialogFragmentCom
     private var inputTextView: EditText? = null
     private var textUnitView: TextView? = null
     private var textExplanationView: TextView? = null
+    private var explanationButton: Button? = null
     private var switchElementView: CompoundButton? = null
 
     private var mOnInputTextEditorActionListener: TextView.OnEditorActionListener? = null
@@ -100,6 +102,27 @@ abstract class InputPreferenceDialogFragmentCompat : PreferenceDialogFragmentCom
         explanationText = getString(explanationTextId)
     }
 
+    val explanationButtonText: String?
+        get() = explanationButton?.text?.toString() ?: ""
+
+    fun setExplanationButton(explanationButtonText: String?, clickListener: View.OnClickListener) {
+        explanationButton?.apply {
+            if (explanationButtonText != null && explanationButtonText.isNotEmpty()) {
+                text = explanationButtonText
+                visibility = View.VISIBLE
+                setOnClickListener(clickListener)
+            } else {
+                text = ""
+                visibility = View.GONE
+                setOnClickListener(null)
+            }
+        }
+    }
+
+    fun setExplanationButton(@StringRes explanationButtonTextId: Int, clickListener: View.OnClickListener) {
+        setExplanationButton(getString(explanationButtonTextId), clickListener)
+    }
+
     override fun onBindDialogView(view: View) {
         super.onBindDialogView(view)
 
@@ -128,6 +151,8 @@ abstract class InputPreferenceDialogFragmentCompat : PreferenceDialogFragmentCom
         textUnitView?.visibility = View.GONE
         textExplanationView = view.findViewById(R.id.explanation_text)
         textExplanationView?.visibility = View.GONE
+        explanationButton = view.findViewById(R.id.explanation_button)
+        explanationButton?.visibility = View.GONE
         switchElementView = view.findViewById(R.id.switch_element)
         switchElementView?.visibility = View.GONE
     }

app/src/main/java/com/kunzisoft/keepass/timeout/TimeoutHelper.kt

@@ -66,9 +66,26 @@ object TimeoutHelper {
                     val triggerTime = System.currentTimeMillis() + timeout
                     Log.d(TAG, "TimeoutHelper start")
                     if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.KITKAT) {
-                        alarmManager.setExact(AlarmManager.RTC, triggerTime, getLockPendingIntent(context))
+                        if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S
+                            && !alarmManager.canScheduleExactAlarms()) {
+                            alarmManager.set(
+                                AlarmManager.RTC,
+                                triggerTime,
+                                getLockPendingIntent(context)
+                            )
+                        } else {
+                            alarmManager.setExact(
+                                AlarmManager.RTC,
+                                triggerTime,
+                                getLockPendingIntent(context)
+                            )
+                        }
                     } else {
-                        alarmManager.set(AlarmManager.RTC, triggerTime, getLockPendingIntent(context))
+                        alarmManager.set(
+                            AlarmManager.RTC,
+                            triggerTime,
+                            getLockPendingIntent(context)
+                        )
                     }
                 }
             }

app/src/main/java/com/kunzisoft/keepass/utils/BroadcastAction.kt

@@ -72,11 +72,29 @@ class LockReceiver(var lockAction: () -> Unit) : BroadcastReceiver() {
                             )
                             // Launch the effective action after a small time
                             val first: Long = System.currentTimeMillis() + context.getString(R.string.timeout_screen_off).toLong()
-                            val alarmManager = context.getSystemService(ALARM_SERVICE) as AlarmManager?
+                            (context.getSystemService(ALARM_SERVICE) as AlarmManager?)?.let { alarmManager ->
-                            if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.KITKAT) {
+                                if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.KITKAT) {
-                                alarmManager?.setExact(AlarmManager.RTC_WAKEUP, first, mLockPendingIntent)
+                                    if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S
-                            } else {
+                                        && !alarmManager.canScheduleExactAlarms()) {
-                                alarmManager?.set(AlarmManager.RTC_WAKEUP, first, mLockPendingIntent)
+                                        alarmManager.set(
+                                            AlarmManager.RTC_WAKEUP,
+                                            first,
+                                            mLockPendingIntent
+                                        )
+                                    } else {
+                                        alarmManager.setExact(
+                                            AlarmManager.RTC_WAKEUP,
+                                            first,
+                                            mLockPendingIntent
+                                        )
+                                    }
+                                } else {
+                                    alarmManager.set(
+                                        AlarmManager.RTC_WAKEUP,
+                                        first,
+                                        mLockPendingIntent
+                                    )
+                                }
                             }
                         } else {
                             cancelLockPendingIntent(context)

app/src/main/java/com/kunzisoft/keepass/view/TemplateAbstractView.kt

@@ -46,6 +46,10 @@ abstract class TemplateAbstractView<
 
     protected var headerContainerView: ViewGroup
     protected var entryIconView: ImageView
+    protected var backgroundColorView: View
+    protected var foregroundColorView: View
+    protected var backgroundColorButton: ImageView
+    protected var foregroundColorButton: ImageView
     private var titleContainerView: ViewGroup
     protected var templateContainerView: ViewGroup
     private var customFieldsContainerView: SectionView
@@ -57,6 +61,10 @@ abstract class TemplateAbstractView<
 
         headerContainerView = findViewById(R.id.template_header_container)
         entryIconView = findViewById(R.id.template_icon_button)
+        backgroundColorView = findViewById(R.id.template_background_color)
+        foregroundColorView = findViewById(R.id.template_foreground_color)
+        backgroundColorButton = findViewById(R.id.template_background_color_button)
+        foregroundColorButton = findViewById(R.id.template_foreground_color_button)
         titleContainerView = findViewById(R.id.template_title_container)
         templateContainerView = findViewById(R.id.template_fields_container)
         // To fix card view margin below Marshmallow
@@ -396,37 +404,61 @@ abstract class TemplateAbstractView<
 
         // Icon already populate
 
-        val titleView: TEntryFieldView? = findViewWithTag(FIELD_TITLE_TAG)
+        try {
-        titleView?.value?.let {
+            val titleView: TEntryFieldView? = findViewWithTag(FIELD_TITLE_TAG)
-            mEntryInfo?.title = it
+            titleView?.value?.let {
+                mEntryInfo?.title = it
+            }
+        } catch (e: Exception) {
+            Log.e(TAG, "Unable to populate title view", e)
         }
 
-        val userNameView: TEntryFieldView? = findViewWithTag(FIELD_USERNAME_TAG)
+        try {
-        userNameView?.value?.let {
+            val userNameView: TEntryFieldView? = findViewWithTag(FIELD_USERNAME_TAG)
-            mEntryInfo?.username = it
+            userNameView?.value?.let {
+                mEntryInfo?.username = it
+            }
+        } catch (e: Exception) {
+            Log.e(TAG, "Unable to populate username view", e)
         }
 
-        val passwordView: TEntryFieldView? = findViewWithTag(FIELD_PASSWORD_TAG)
+        try {
-        passwordView?.value?.let {
+            val passwordView: TEntryFieldView? = findViewWithTag(FIELD_PASSWORD_TAG)
-            mEntryInfo?.password = it
+            passwordView?.value?.let {
+                mEntryInfo?.password = it
+            }
+        } catch (e: Exception) {
+            Log.e(TAG, "Unable to populate password view", e)
         }
 
-        val urlView: TEntryFieldView? = findViewWithTag(FIELD_URL_TAG)
+        try {
-        urlView?.value?.let {
+            val urlView: TEntryFieldView? = findViewWithTag(FIELD_URL_TAG)
-            mEntryInfo?.url = it
+            urlView?.value?.let {
+                mEntryInfo?.url = it
+            }
+        } catch (e: Exception) {
+            Log.e(TAG, "Unable to populate url view", e)
         }
 
-        val expirationView: TDateTimeView? = findViewWithTag(FIELD_EXPIRES_TAG)
+        try {
-        expirationView?.activation?.let {
+            val expirationView: TDateTimeView? = findViewWithTag(FIELD_EXPIRES_TAG)
-            mEntryInfo?.expires = it
+            expirationView?.activation?.let {
-        }
+                mEntryInfo?.expires = it
-        expirationView?.dateTime?.let {
+            }
-            mEntryInfo?.expiryTime = it
+            expirationView?.dateTime?.let {
+                mEntryInfo?.expiryTime = it
+            }
+        } catch (e: Exception) {
+            Log.e(TAG, "Unable to populate expiration view", e)
         }
 
-        val notesView: TEntryFieldView? = findViewWithTag(FIELD_NOTES_TAG)
+        try {
-        notesView?.value?.let {
+            val notesView: TEntryFieldView? = findViewWithTag(FIELD_NOTES_TAG)
-            mEntryInfo?.notes = it
+            notesView?.value?.let {
+                mEntryInfo?.notes = it
+            }
+        } catch (e: Exception) {
+            Log.e(TAG, "Unable to populate notes view", e)
         }
 
         retrieveCustomFieldsFromView(templateFieldNotEmpty, retrieveDefaultValues)

app/src/main/java/com/kunzisoft/keepass/view/TemplateEditView.kt

@@ -5,13 +5,17 @@ import android.os.Build
 import android.util.AttributeSet
 import android.view.View
 import androidx.annotation.IdRes
+import androidx.core.graphics.BlendModeColorFilterCompat
+import androidx.core.graphics.BlendModeCompat
 import androidx.core.view.isVisible
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.database.element.DateInstant
 import com.kunzisoft.keepass.database.element.Field
 import com.kunzisoft.keepass.database.element.icon.IconImage
 import com.kunzisoft.keepass.database.element.security.ProtectedString
-import com.kunzisoft.keepass.database.element.template.*
+import com.kunzisoft.keepass.database.element.template.TemplateAttribute
+import com.kunzisoft.keepass.database.element.template.TemplateAttributeAction
+import com.kunzisoft.keepass.database.element.template.TemplateField
 import com.kunzisoft.keepass.otp.OtpEntryFields
 import org.joda.time.DateTime
 
@@ -51,7 +55,53 @@ class TemplateEditView @JvmOverloads constructor(context: Context,
 
     fun setIcon(iconImage: IconImage) {
         mEntryInfo?.icon = iconImage
-        populateIconMethod?.invoke(entryIconView, iconImage)
+        refreshIcon()
+    }
+
+    fun setOnBackgroundColorClickListener(onClickListener: OnClickListener) {
+        backgroundColorButton.setOnClickListener(onClickListener)
+    }
+
+    fun getBackgroundColor(): Int? {
+        return mEntryInfo?.backgroundColor
+    }
+
+    fun setBackgroundColor(color: Int?) {
+        applyBackgroundColor(color)
+        mEntryInfo?.backgroundColor = color
+    }
+
+    private fun applyBackgroundColor(color: Int?) {
+        if (color != null) {
+            backgroundColorView.background.colorFilter = BlendModeColorFilterCompat
+                .createBlendModeColorFilterCompat(color, BlendModeCompat.SRC_ATOP)
+            backgroundColorView.visibility = View.VISIBLE
+        } else {
+            backgroundColorView.visibility = View.GONE
+        }
+    }
+
+    fun setOnForegroundColorClickListener(onClickListener: OnClickListener) {
+        foregroundColorButton.setOnClickListener(onClickListener)
+    }
+
+    fun getForegroundColor(): Int? {
+        return mEntryInfo?.foregroundColor
+    }
+
+    fun setForegroundColor(color: Int?) {
+        applyForegroundColor(color)
+        mEntryInfo?.foregroundColor = color
+    }
+
+    private fun applyForegroundColor(color: Int?) {
+        if (color != null) {
+            foregroundColorView.background.colorFilter = BlendModeColorFilterCompat
+            .createBlendModeColorFilterCompat(color, BlendModeCompat.SRC_ATOP)
+            foregroundColorView.visibility = View.VISIBLE
+        } else {
+            foregroundColorView.visibility = View.GONE
+        }
     }
 
     override fun preProcessTemplate() {
@@ -196,6 +246,8 @@ class TemplateEditView @JvmOverloads constructor(context: Context,
 
     override fun populateViewsWithEntryInfo(showEmptyFields: Boolean): List<ViewField> {
         refreshIcon()
+        applyBackgroundColor(mEntryInfo?.backgroundColor)
+        applyForegroundColor(mEntryInfo?.foregroundColor)
         return super.populateViewsWithEntryInfo(showEmptyFields)
     }
 

app/src/main/java/com/kunzisoft/keepass/view/TextFieldView.kt

@@ -73,7 +73,7 @@ class TextFieldView @JvmOverloads constructor(context: Context,
     }
     private val valueView = AppCompatTextView(context).apply {
         setTextAppearance(context,
-            R.style.KeepassDXStyle_TextAppearance_TextEntryItem)
+            R.style.KeepassDXStyle_TextAppearance_TextNode)
         layoutParams = LayoutParams(
             LayoutParams.MATCH_PARENT,
             LayoutParams.WRAP_CONTENT).also {

app/src/main/java/com/kunzisoft/keepass/view/ToolbarAction.kt

@@ -80,7 +80,8 @@ class ToolbarAction @JvmOverloads constructor(context: Context,
         mActionModeCallback = null
     }
 
-    fun invalidateMenu() {
+    override fun invalidateMenu() {
+        super.invalidateMenu()
         open()
         mActionModeCallback?.onPrepareActionMode(actionMode, menu)
     }

app/src/main/java/com/kunzisoft/keepass/view/ViewUtil.kt

@@ -23,9 +23,7 @@ import android.animation.Animator
 import android.animation.AnimatorSet
 import android.animation.ValueAnimator
 import android.content.Context
-import android.graphics.Color
+import android.graphics.*
-import android.graphics.Paint
-import android.graphics.Typeface
 import android.text.Selection
 import android.text.Spannable
 import android.text.SpannableString
@@ -37,6 +35,7 @@ import android.view.View
 import android.view.animation.AccelerateDecelerateInterpolator
 import android.widget.TextView
 import android.widget.Toast
+import androidx.appcompat.widget.Toolbar
 import androidx.coordinatorlayout.widget.CoordinatorLayout
 import androidx.core.view.isVisible
 import androidx.core.view.updatePadding
@@ -44,6 +43,16 @@ import com.google.android.material.snackbar.Snackbar
 import com.kunzisoft.keepass.R
 import com.kunzisoft.keepass.settings.PreferencesUtil
 import com.kunzisoft.keepass.tasks.ActionRunnable
+import androidx.appcompat.view.menu.ActionMenuItemView
+
+import android.widget.ImageView
+import androidx.appcompat.widget.ActionMenuView
+
+import androidx.core.graphics.drawable.DrawableCompat
+
+import android.graphics.drawable.Drawable
+import com.google.android.material.appbar.CollapsingToolbarLayout
+
 
 /**
  * Replace font by monospace, must be called after setText()
@@ -207,4 +216,50 @@ fun CoordinatorLayout.showActionErrorIfNeeded(result: ActionRunnable.Result) {
             Snackbar.make(this, message, Snackbar.LENGTH_LONG).asError().show()
         }
     }
+}
+
+fun Toolbar.changeControlColor(color: Int) {
+    val colorFilter = PorterDuffColorFilter(color, PorterDuff.Mode.SRC_ATOP);
+    for (i in 0 until childCount) {
+        val view: View = getChildAt(i)
+        // Change the color of back button (or open drawer button).
+        if (view is ImageView) {
+            //Action Bar back button
+            view.drawable.colorFilter = colorFilter
+        }
+        if (view is ActionMenuView) {
+            view.post {
+                for (j in 0 until view.childCount) {
+                    // Change the color of any ActionMenuViews - icons that
+                    // are not back button, nor text, nor overflow menu icon.
+                    val innerView: View = view.getChildAt(j)
+                    if (innerView is ActionMenuItemView) {
+                        innerView.compoundDrawables.forEach { drawable ->
+                            //Important to set the color filter in separate thread,
+                            //by adding it to the message queue
+                            //Won't work otherwise.
+                            drawable?.colorFilter = colorFilter
+                        }
+                    }
+                }
+            }
+        }
+    }
+    // Change the color of title and subtitle.
+    setTitleTextColor(color)
+    setSubtitleTextColor(color)
+    // Change the color of the Overflow Menu icon.
+    var drawable: Drawable? = overflowIcon
+    if (drawable != null) {
+        drawable = DrawableCompat.wrap(drawable)
+        DrawableCompat.setTint(drawable.mutate(), color)
+        overflowIcon = drawable
+    }
+    invalidate()
+}
+
+fun CollapsingToolbarLayout.changeTitleColor(color: Int) {
+    setCollapsedTitleTextColor(color)
+    setExpandedTitleColor(color)
+    invalidate()
 }

app/src/main/java/com/kunzisoft/keepass/viewmodels/ColorPickerViewModel.kt

@@ -0,0 +1,15 @@
+package com.kunzisoft.keepass.viewmodels
+
+import androidx.lifecycle.LiveData
+import androidx.lifecycle.MutableLiveData
+import androidx.lifecycle.ViewModel
+
+class ColorPickerViewModel: ViewModel() {
+
+    val colorPicked : LiveData<Int?> get() = _colorPicked
+    private val _colorPicked = MutableLiveData<Int?>()
+
+    fun pickColor(color: Int?) {
+        _colorPicked.value = color
+    }
+}

app/src/main/java/com/kunzisoft/keepass/viewmodels/NodeEditViewModel.kt

@@ -14,6 +14,14 @@ abstract class NodeEditViewModel : ViewModel() {
     val onIconSelected : LiveData<IconImage> get() = _onIconSelected
     private val _onIconSelected = SingleLiveEvent<IconImage>()
 
+    private var mColorRequest: ColorRequest = ColorRequest.BACKGROUND
+    val requestColorSelection : LiveData<Int?> get() = _requestColorSelection
+    private val _requestColorSelection = SingleLiveEvent<Int?>()
+    val onBackgroundColorSelected : LiveData<Int?> get() = _onBackgroundColorSelected
+    private val _onBackgroundColorSelected = SingleLiveEvent<Int?>()
+    val onForegroundColorSelected : LiveData<Int?> get() = _onForegroundColorSelected
+    private val _onForegroundColorSelected = SingleLiveEvent<Int?>()
+
     val requestDateTimeSelection : LiveData<DateInstant> get() = _requestDateTimeSelection
     private val _requestDateTimeSelection = SingleLiveEvent<DateInstant>()
     val onDateSelected : LiveData<DataDate> get() = _onDateSelected
@@ -29,6 +37,23 @@ abstract class NodeEditViewModel : ViewModel() {
         _onIconSelected.value = iconImage
     }
 
+    fun requestBackgroundColorSelection(initialColor: Int?) {
+        mColorRequest = ColorRequest.BACKGROUND
+        _requestColorSelection.value = initialColor
+    }
+
+    fun requestForegroundColorSelection(initialColor: Int?) {
+        mColorRequest = ColorRequest.FOREGROUND
+        _requestColorSelection.value = initialColor
+    }
+
+    fun selectColor(color: Int?) {
+        when (mColorRequest) {
+            ColorRequest.BACKGROUND -> _onBackgroundColorSelected.value = color
+            ColorRequest.FOREGROUND -> _onForegroundColorSelected.value = color
+        }
+    }
+
     fun requestDateTimeSelection(dateInstant: DateInstant) {
         _requestDateTimeSelection.value = dateInstant
     }
@@ -40,4 +65,8 @@ abstract class NodeEditViewModel : ViewModel() {
     fun selectTime(hours: Int, minutes: Int) {
         _onTimeSelected.value = DataTime(hours, minutes)
     }
+
+    private enum class ColorRequest {
+        BACKGROUND, FOREGROUND
+    }
 }

app/src/main/res/drawable/ic_color_background_white_24dp.xml

@@ -0,0 +1,13 @@
+<?xml version="1.0" encoding="utf-8"?>
+<vector xmlns:android="http://schemas.android.com/apk/res/android"
+    android:width="24dp"
+    android:height="24dp"
+    android:viewportWidth="24"
+    android:viewportHeight="24">
+    <group>
+        <path
+            android:fillColor="#ffffff"
+            android:strokeWidth="0.99630105"
+            android:pathData="M 10,4 C 10,4 3.4004241,12.16731 4.0449219,16 4.4765841,18.566843 7.4158222,21 10,21 12.584196,21 15.523434,18.566843 15.955078,16 16.599576,12.16731 10,4 10,4 Z m 4,0 c 0,0 -0.59708,0.7527282 -1.386719,1.8476562 0.462543,0.6601114 0.953468,1.3798579 1.455078,2.1855469 0.803823,1.2911023 1.594188,2.7131219 2.15625,4.1015629 0.562116,1.388441 0.935799,2.740544 0.71875,4.03125 -0.268817,1.598597 -1.257809,3.011777 -2.517578,4.064453 -0.31833,0.265996 -0.657402,0.509805 -1.009765,0.726562 C 13.611687,20.98319 13.807101,21 14,21 16.584196,21 19.523434,18.566843 19.955078,16 20.599576,12.16731 14,4 14,4 Z m -4,2.5 c 0,0 0.497912,0.6283173 1.144531,1.53125 C 9.4508061,10.655343 7.697485,13.933867 8.0449219,16 8.262611,17.29447 9.126046,18.542028 10.253906,19.470703 10.169439,19.477241 10.083657,19.5 10,19.5 8.0238755,19.5 5.7754103,17.638661 5.4453125,15.675781 4.9524592,12.744903 10,6.5 10,6.5 Z" />
+    </group>
+</vector>

app/src/main/res/drawable/ic_color_foreground_white_24dp.xml

@@ -0,0 +1,13 @@
+<?xml version="1.0" encoding="utf-8"?>
+<vector xmlns:android="http://schemas.android.com/apk/res/android"
+    android:width="24dp"
+    android:height="24dp"
+    android:viewportWidth="24"
+    android:viewportHeight="24">
+    <group>
+        <path
+            android:fillColor="#ffffff"
+            android:strokeWidth="0.99630105"
+            android:pathData="M 10,4 C 10,4 3.4004241,12.16731 4.0449219,16 4.4765841,18.566843 7.4158222,21 10,21 12.584196,21 15.523434,18.566843 15.955078,16 16.599576,12.16731 10,4 10,4 Z m 4,0 c 0,0 -0.597156,0.7527282 -1.386719,1.8476562 0.284669,0.4062608 0.575588,0.8441093 0.882813,1.3125 C 13.714676,6.8748215 14,6.5 14,6.5 c 0,0 5.04754,6.244903 4.554688,9.175781 -0.249068,1.481044 -1.591665,2.900275 -3.083985,3.509766 -0.31745,0.376905 -0.666337,0.728573 -1.044922,1.044922 -0.31833,0.265996 -0.657402,0.509805 -1.009765,0.726562 C 13.61168,20.98319 13.807101,21 14,21 16.584196,21 19.523434,18.566843 19.955078,16 20.599576,12.16731 14,4 14,4 Z" />
+    </group>
+</vector>

app/src/main/res/layout/activity_entry.xml

@@ -29,7 +29,8 @@
     <com.google.android.material.appbar.AppBarLayout
         android:id="@+id/app_bar"
         android:layout_width="match_parent"
-        android:layout_height="@dimen/toolbar_parallax_height">
+        android:layout_height="@dimen/toolbar_parallax_height"
+        android:background="?attr/colorPrimary">
 
         <com.google.android.material.appbar.CollapsingToolbarLayout
             android:id="@+id/toolbar_layout"

app/src/main/res/layout/activity_group.xml

@@ -31,11 +31,80 @@
         android:layout_height="wrap_content"
         android:theme="?attr/toolbarSpecialAppearance" />
 
+    <androidx.appcompat.widget.Toolbar
+        android:id="@+id/toolbar"
+        android:title="@string/app_name"
+        android:layout_width="match_parent"
+        android:layout_height="?attr/actionBarSize"
+        android:layout_below="@+id/special_mode_view"
+        android:background="?attr/colorPrimary"
+        android:theme="?attr/toolbarAppearance" >
+        <LinearLayout
+            android:id="@+id/database_name_container"
+            android:layout_width="wrap_content"
+            android:layout_height="wrap_content"
+            android:orientation="horizontal">
+            <ImageView
+                android:id="@+id/database_color"
+                android:layout_width="12dp"
+                android:layout_height="12dp"
+                android:src="@drawable/background_rounded_square"
+                android:layout_marginRight="12dp"
+                android:layout_marginEnd="12dp"
+                android:contentDescription="@string/content_description_database_color"/>
+            <TextView
+                android:id="@+id/database_name"
+                android:layout_width="wrap_content"
+                android:layout_height="wrap_content"
+                tools:text="Database"
+                style="@style/KeepassDXStyle.TextAppearance.Title.TextOnPrimary" />
+        </LinearLayout>
+        <RelativeLayout
+            android:id="@+id/search_container"
+            android:layout_width="wrap_content"
+            android:layout_height="wrap_content"
+            android:visibility="gone"
+            android:orientation="vertical">
+            <TextView
+                android:id="@+id/search_title"
+                android:layout_width="wrap_content"
+                android:layout_height="wrap_content"
+                android:text="@string/search_results"
+                style="@style/KeepassDXStyle.TextAppearance.Default.TextOnPrimary" />
+            <androidx.appcompat.widget.AppCompatTextView
+                android:id="@+id/search_numbers"
+                android:layout_width="wrap_content"
+                android:layout_height="wrap_content"
+                tools:text="3"
+                android:layout_margin="4dp"
+                android:layout_below="@+id/search_title"
+                style="@style/KeepassDXStyle.TextAppearance.Info" />
+            <androidx.appcompat.widget.AppCompatTextView
+                android:id="@+id/search_string"
+                android:layout_width="match_parent"
+                android:layout_height="wrap_content"
+                android:text="@string/search"
+                android:maxLines="1"
+                android:ellipsize="end"
+                android:layout_marginTop="2dp"
+                android:layout_marginStart="4dp"
+                android:layout_marginLeft="4dp"
+                android:layout_marginEnd="4dp"
+                android:layout_marginRight="4dp"
+                android:layout_alignParentRight="true"
+                android:layout_alignParentEnd="true"
+                android:layout_below="@+id/search_title"
+                android:layout_toRightOf="@+id/search_numbers"
+                android:layout_toEndOf="@+id/search_numbers"
+                style="@style/KeepassDXStyle.TextAppearance.Title.TextOnPrimary" />
+        </RelativeLayout>
+    </androidx.appcompat.widget.Toolbar>
+
     <androidx.coordinatorlayout.widget.CoordinatorLayout
         android:id="@+id/group_coordinator"
         android:layout_width="match_parent"
         android:layout_height="match_parent"
-        android:layout_below="@+id/special_mode_view"
+        android:layout_below="@+id/toolbar"
         android:layout_above="@+id/toolbar_action">
 
         <com.google.android.material.appbar.AppBarLayout
@@ -43,84 +112,22 @@
             android:layout_width="match_parent"
             android:layout_height="wrap_content"
             tools:targetApi="lollipop"
-            android:elevation="4dp"
             android:fitsSystemWindows="true">
 
             <androidx.appcompat.widget.Toolbar
-                android:id="@+id/toolbar"
+                android:id="@+id/toolbar_breadcrumb"
-                android:title="@string/app_name"
                 android:layout_width="match_parent"
                 android:layout_height="?attr/actionBarSize"
                 android:background="?attr/colorPrimary"
                 android:theme="?attr/toolbarAppearance"
-                android:elevation="4dp"
+                app:layout_scrollFlags="scroll|snap|enterAlways"
                 tools:targetApi="lollipop">
-                <LinearLayout
+                <androidx.recyclerview.widget.RecyclerView
-                    android:id="@+id/group_header"
+                    android:id="@+id/breadcrumb_list"
-                    android:layout_width="wrap_content"
+                    android:layout_width="match_parent"
                     android:layout_height="wrap_content"
-                    android:layout_alignParentLeft="true"
+                    app:layoutManager="androidx.recyclerview.widget.LinearLayoutManager"
-                    android:layout_alignParentStart="true"
+                    android:orientation="horizontal" />
-                    android:layout_below="@+id/toolbar"
-                    android:orientation="vertical">
-                    <TextView android:id="@+id/search_title"
-                        android:layout_width="match_parent"
-                        android:layout_height="wrap_content"
-                        android:text="@string/search_results"
-                        android:visibility="gone"
-                        style="@style/KeepassDXStyle.TextAppearance.Default.TextOnPrimary" />
-                    <LinearLayout
-                        android:layout_width="match_parent"
-                        android:layout_height="wrap_content"
-                        android:orientation="horizontal"
-                        android:gravity="center_vertical"
-                        android:baselineAligned="false">
-                        <RelativeLayout
-                            android:layout_width="wrap_content"
-                            android:layout_height="wrap_content"
-                            android:gravity="center_vertical">
-                            <androidx.appcompat.widget.AppCompatImageView
-                                android:id="@+id/group_icon"
-                                android:layout_width="32dp"
-                                android:layout_height="32dp"
-                                android:layout_gravity="end|center_vertical"
-                                android:layout_marginStart="6dp"
-                                android:layout_marginEnd="6dp"
-                                android:scaleType="fitXY" />
-                            <androidx.appcompat.widget.AppCompatTextView
-                                android:id="@+id/group_numbers"
-                                android:layout_width="wrap_content"
-                                android:layout_height="wrap_content"
-                                tools:text="3"
-                                style="@style/KeepassDXStyle.TextAppearance.Info" />
-                        </RelativeLayout>
-                        <LinearLayout
-                            android:layout_width="match_parent"
-                            android:layout_height="wrap_content"
-                            android:orientation="vertical"
-                            android:layout_gravity="start|center_vertical"
-                            android:layout_marginLeft="14dp"
-                            android:layout_marginStart="14dp"
-                            android:layout_weight="1">
-                            <androidx.appcompat.widget.AppCompatTextView
-                                android:id="@+id/group_name"
-                                android:layout_width="match_parent"
-                                android:layout_height="match_parent"
-                                android:text="@string/root"
-                                android:maxLines="2"
-                                android:ellipsize="end"
-                                style="@style/KeepassDXStyle.TextAppearance.Title.TextOnPrimary" />
-                            <androidx.appcompat.widget.AppCompatTextView
-                                android:id="@+id/group_meta"
-                                android:layout_height="match_parent"
-                                android:layout_width="match_parent"
-                                tools:text="7543A7EAB2EA7CFD1394F1615EBEB08C"
-                                android:lines="1"
-                                android:singleLine="true"
-                                style="@style/KeepassDXStyle.TextAppearance.Meta.TextOnPrimary" />
-                        </LinearLayout>
-                    </LinearLayout>
-                </LinearLayout>
             </androidx.appcompat.widget.Toolbar>
 
         </com.google.android.material.appbar.AppBarLayout>
@@ -159,6 +166,7 @@
     <FrameLayout
         android:layout_width="match_parent"
         android:layout_height="match_parent">
+
         <ProgressBar
             android:id="@+id/loading"
             android:layout_width="wrap_content"

app/src/main/res/layout/activity_password.xml

@@ -44,7 +44,8 @@
         <com.google.android.material.appbar.AppBarLayout
             android:id="@+id/app_bar"
             android:layout_width="match_parent"
-            android:layout_height="wrap_content">
+            android:layout_height="wrap_content"
+            android:background="?attr/colorPrimary">
 
             <com.google.android.material.appbar.CollapsingToolbarLayout
                 android:id="@+id/toolbar_layout"
@@ -57,7 +58,8 @@
                     android:layout_width="match_parent"
                     android:layout_height="match_parent"
                     android:minHeight="144dp"
-                    android:layout_marginTop="?attr/actionBarSize">
+                    android:layout_marginTop="?attr/actionBarSize"
+                    android:background="?attr/colorPrimary">
                     <ImageView
                         android:layout_width="96dp"
                         android:layout_height="96dp"
@@ -219,6 +221,7 @@
             android:id="@+id/activity_password_info_container"
             android:layout_width="match_parent"
             android:layout_height="wrap_content"
+            android:visibility="gone"
             android:orientation="vertical">
             <androidx.appcompat.widget.AppCompatTextView
                 android:id="@+id/activity_password_info_text"

app/src/main/res/layout/fragment_browser_install.xml

@@ -35,6 +35,6 @@
 		android:layout_margin="@dimen/button_margin"
 		android:layout_width="match_parent"
 		android:layout_height="wrap_content"
-		android:gravity="center_horizontal"
+		android:text="@string/file_browser"
-		android:text="@string/file_browser" />
+		style="@style/Widget.AppCompat.Button.Small"/>
 </LinearLayout>

app/src/main/res/layout/fragment_color_picker.xml

@@ -1,6 +1,6 @@
 <?xml version="1.0" encoding="utf-8"?>
 <!--
- Copyright 2019 Jeremy Jamet / Kunzisoft.
+ Copyright 2022 Jeremy Jamet / Kunzisoft.
      
  This file is part of KeePassDX.
 
@@ -17,8 +17,7 @@
   You should have received a copy of the GNU General Public License
   along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
 -->
-<androidx.constraintlayout.widget.ConstraintLayout
+<androidx.constraintlayout.widget.ConstraintLayout xmlns:android="http://schemas.android.com/apk/res/android"
-	xmlns:android="http://schemas.android.com/apk/res/android"
 	xmlns:tools="http://schemas.android.com/tools"
 	xmlns:app="http://schemas.android.com/apk/res-auto"
 	android:id="@+id/edit"
@@ -27,10 +26,13 @@
 	android:layout_height="match_parent"
 	android:importantForAutofill="noExcludeDescendants"
 	tools:targetApi="o">
-	<FrameLayout
+	<com.kunzisoft.androidclearchroma.view.ChromaColorView
-		android:id="@+id/color_dialog_container"
+		android:id="@+id/chroma_color_view"
 		android:layout_width="match_parent"
-		android:layout_height="wrap_content"
+		android:layout_height="300dp"
+		app:chromaInitialColor="@color/white"
+		app:chromaColorMode="RGB"
+		app:chromaIndicatorMode="HEX"
 		app:layout_constraintTop_toTopOf="parent"
 		app:layout_constraintStart_toStartOf="parent"
 		app:layout_constraintEnd_toEndOf="parent" />
@@ -41,7 +43,7 @@
 		android:layout_margin="20dp"
 		android:text="@string/enable"
 		android:background="@drawable/background_button_small"
-		android:textColor="?attr/textColorInverse"
+		android:textColor="@color/white"
 		app:layout_constraintTop_toTopOf="parent"
 		app:layout_constraintStart_toStartOf="parent"
 		android:minHeight="48dp"/>

app/src/main/res/layout/fragment_entry.xml

@@ -77,7 +77,7 @@
 				android:id="@+id/entry_created"
 				android:layout_width="match_parent"
 				android:layout_height="wrap_content"
-				style="@style/KeepassDXStyle.TextAppearance.TextEntryItem" />
+				style="@style/KeepassDXStyle.TextAppearance.TextNode" />
 
 			<!-- Modified -->
 			<androidx.appcompat.widget.AppCompatTextView
@@ -90,7 +90,7 @@
 				android:id="@+id/entry_modified"
 				android:layout_width="match_parent"
 				android:layout_height="wrap_content"
-				style="@style/KeepassDXStyle.TextAppearance.TextEntryItem" />
+				style="@style/KeepassDXStyle.TextAppearance.TextNode" />
 
 			<!-- Accessed -->
 			<androidx.appcompat.widget.AppCompatTextView
@@ -127,16 +127,6 @@
 				android:layout_height="wrap_content"
 				android:text="@string/entry_UUID"
 				style="@style/KeepassDXStyle.TextAppearance.LabelTextStyle" />
-			<HorizontalScrollView
-				android:layout_width="match_parent"
-				android:layout_height="match_parent">
-				<androidx.appcompat.widget.AppCompatTextView
-					android:id="@+id/entry_UUID"
-					android:layout_width="wrap_content"
-					android:layout_height="wrap_content"
-					android:textIsSelectable="true"
-					style="@style/KeepassDXStyle.TextAppearance.LabelTextStyle" />
-			</HorizontalScrollView>
 			<HorizontalScrollView
 				android:layout_width="match_parent"
 				android:layout_height="match_parent">
@@ -145,7 +135,7 @@
 					android:layout_width="wrap_content"
 					android:layout_height="wrap_content"
 					android:textIsSelectable="true"
-					style="@style/KeepassDXStyle.TextAppearance.TextEntryItem" />
+					style="@style/KeepassDXStyle.TextAppearance.TextNode" />
 			</HorizontalScrollView>
 		</LinearLayout>
 	</androidx.cardview.widget.CardView>

app/src/main/res/layout/fragment_group.xml

@@ -1,7 +1,7 @@
 <?xml version="1.0" encoding="utf-8"?>
 <!--
  Copyright 2019 Jeremy Jamet / Kunzisoft.
-
+     
  This file is part of KeePassDX.
 
   KeePassDX is free software: you can redistribute it and/or modify
@@ -17,38 +17,128 @@
   You should have received a copy of the GNU General Public License
   along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
 -->
-<FrameLayout
+<androidx.core.widget.NestedScrollView
-    xmlns:android="http://schemas.android.com/apk/res/android"
+	xmlns:android="http://schemas.android.com/apk/res/android"
-    android:orientation="vertical"
+	xmlns:tools="http://schemas.android.com/tools"
-    android:layout_width="match_parent"
+	android:layout_width="match_parent"
-    android:layout_height="match_parent">
+	android:layout_height="match_parent">
-    <androidx.recyclerview.widget.RecyclerView
+
-        android:id="@+id/nodes_list"
+	<LinearLayout
-        android:contentDescription="@string/content_description_node_children"
+		android:orientation="vertical"
-        android:scrollbars="vertical"
+		android:layout_width="match_parent"
-        android:scrollbarStyle="insideOverlay"
+		android:layout_height="wrap_content"
-        android:layout_width="match_parent"
+		android:importantForAutofill="noExcludeDescendants">
-        android:layout_height="match_parent"
+
-        android:background="?android:attr/windowBackground"
+		<FrameLayout
-        android:paddingBottom="?attr/actionBarSize"
+			android:layout_width="match_parent"
-        android:clipToPadding="false" />
+			android:layout_height="wrap_content"
-    <LinearLayout
+			android:background="?attr/colorPrimary">
-        android:id="@+id/not_found_container"
+			<LinearLayout
-        android:layout_gravity="center"
+				android:id="@+id/title_block"
-        android:orientation="vertical"
+				android:layout_width="match_parent"
-        android:layout_width="wrap_content"
+				android:layout_height="match_parent"
-        android:layout_height="wrap_content"
+				android:orientation="vertical"
-        android:visibility="gone">
+				android:padding="@dimen/default_margin"
-        <androidx.appcompat.widget.AppCompatImageView
+				android:background="@drawable/background_repeat"
-            android:id="@+id/not_found_img"
+				android:gravity="center"
-            android:layout_width="wrap_content"
+				style="@style/KeepassDXStyle.TextAppearance.Default">
-            android:layout_height="wrap_content"
+
-            android:layout_gravity="center"
+				<!-- Icon -->
-            android:src="@drawable/img_not_found"/>
+				<androidx.appcompat.widget.AppCompatImageView
-        <TextView
+					android:id="@+id/group_icon"
-            android:id="@+id/not_found_text"
+					android:layout_width="wrap_content"
-            android:layout_width="wrap_content"
+					android:layout_height="wrap_content"
-            android:layout_height="wrap_content"
+					android:layout_gravity="center"
-            android:text="@string/no_results"/>
+					android:layout_margin="@dimen/default_margin"
-    </LinearLayout>
+					android:src="@drawable/ic_blank_32dp"
-</FrameLayout>
+					style="@style/KeepassDXStyle.Icon"/>
+
+				<!-- Name -->
+				<androidx.appcompat.widget.AppCompatTextView
+					android:id="@+id/group_name"
+					android:layout_width="match_parent"
+					android:layout_height="wrap_content"
+					android:gravity="center"
+					style="@style/KeepassDXStyle.Expanded.Title" />
+			</LinearLayout>
+		</FrameLayout>
+
+		<LinearLayout
+			android:orientation="vertical"
+			android:layout_width="match_parent"
+			android:layout_height="wrap_content"
+			android:padding="@dimen/default_margin"
+			tools:targetApi="o">
+
+			<!-- Note -->
+			<androidx.appcompat.widget.AppCompatTextView
+				android:id="@+id/group_note_label"
+				android:layout_width="match_parent"
+				android:layout_height="wrap_content"
+				android:text="@string/entry_notes"
+				style="@style/KeepassDXStyle.TextAppearance.LabelTextStyle" />
+			<androidx.appcompat.widget.AppCompatTextView
+				android:id="@+id/group_note"
+				android:layout_width="match_parent"
+				android:layout_height="wrap_content"
+				android:inputType="textMultiLine"
+				style="@style/KeepassDXStyle.TextAppearance.TextNode" />
+
+			<!-- Expiration -->
+			<com.kunzisoft.keepass.view.DateTimeFieldView
+				android:id="@+id/group_expiration"
+				android:layout_width="match_parent"
+				android:layout_height="wrap_content" />
+
+			<!-- Created -->
+			<androidx.appcompat.widget.AppCompatTextView
+				android:id="@+id/group_created_label"
+				android:layout_width="match_parent"
+				android:layout_height="wrap_content"
+				android:text="@string/entry_created"
+				style="@style/KeepassDXStyle.TextAppearance.LabelTextStyle" />
+			<androidx.appcompat.widget.AppCompatTextView
+				android:id="@+id/group_created"
+				android:layout_width="match_parent"
+				android:layout_height="wrap_content"
+				style="@style/KeepassDXStyle.TextAppearance.TextNode" />
+
+			<!-- Modified -->
+			<androidx.appcompat.widget.AppCompatTextView
+				android:id="@+id/group_modified_label"
+				android:layout_width="match_parent"
+				android:layout_height="wrap_content"
+				android:text="@string/entry_modified"
+				style="@style/KeepassDXStyle.TextAppearance.LabelTextStyle" />
+			<androidx.appcompat.widget.AppCompatTextView
+				android:id="@+id/group_modified"
+				android:layout_width="match_parent"
+				android:layout_height="wrap_content"
+				style="@style/KeepassDXStyle.TextAppearance.TextNode" />
+
+			<!-- UUID -->
+			<LinearLayout
+				android:id="@+id/group_UUID_container"
+				android:layout_height="wrap_content"
+				android:layout_width="match_parent"
+				android:orientation="vertical">
+				<androidx.appcompat.widget.AppCompatTextView
+					android:id="@+id/group_UUID_label"
+					android:layout_width="match_parent"
+					android:layout_height="wrap_content"
+					android:text="@string/entry_UUID"
+					style="@style/KeepassDXStyle.TextAppearance.LabelTextStyle" />
+				<HorizontalScrollView
+					android:layout_width="match_parent"
+					android:layout_height="match_parent">
+					<androidx.appcompat.widget.AppCompatTextView
+						android:id="@+id/group_UUID_reference"
+						android:layout_width="wrap_content"
+						android:layout_height="wrap_content"
+						android:textIsSelectable="true"
+						style="@style/KeepassDXStyle.TextAppearance.TextNode" />
+				</HorizontalScrollView>
+			</LinearLayout>
+		</LinearLayout>
+	</LinearLayout>
+</androidx.core.widget.NestedScrollView>

app/src/main/res/layout/fragment_nodes.xml

@@ -0,0 +1,54 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!--
+ Copyright 2019 Jeremy Jamet / Kunzisoft.
+
+ This file is part of KeePassDX.
+
+  KeePassDX is free software: you can redistribute it and/or modify
+  it under the terms of the GNU General Public License as published by
+  the Free Software Foundation, either version 3 of the License, or
+  (at your option) any later version.
+
+  KeePassDX is distributed in the hope that it will be useful,
+  but WITHOUT ANY WARRANTY; without even the implied warranty of
+  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+  GNU General Public License for more details.
+
+  You should have received a copy of the GNU General Public License
+  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+-->
+<FrameLayout
+    xmlns:android="http://schemas.android.com/apk/res/android"
+    android:orientation="vertical"
+    android:layout_width="match_parent"
+    android:layout_height="match_parent">
+    <androidx.recyclerview.widget.RecyclerView
+        android:id="@+id/nodes_list"
+        android:contentDescription="@string/content_description_node_children"
+        android:scrollbars="vertical"
+        android:scrollbarStyle="insideOverlay"
+        android:layout_width="match_parent"
+        android:layout_height="match_parent"
+        android:background="?android:attr/windowBackground"
+        android:paddingBottom="?attr/actionBarSize"
+        android:clipToPadding="false" />
+    <LinearLayout
+        android:id="@+id/not_found_container"
+        android:layout_gravity="center"
+        android:orientation="vertical"
+        android:layout_width="wrap_content"
+        android:layout_height="wrap_content"
+        android:visibility="gone">
+        <androidx.appcompat.widget.AppCompatImageView
+            android:id="@+id/not_found_img"
+            android:layout_width="wrap_content"
+            android:layout_height="wrap_content"
+            android:layout_gravity="center"
+            android:src="@drawable/img_not_found"/>
+        <TextView
+            android:id="@+id/not_found_text"
+            android:layout_width="wrap_content"
+            android:layout_height="wrap_content"
+            android:text="@string/no_results"/>
+    </LinearLayout>
+</FrameLayout>

app/src/main/res/layout/item_attachment.xml

@@ -54,7 +54,7 @@
 
         <androidx.appcompat.widget.AppCompatTextView
             android:id="@+id/item_attachment_title"
-            style="@style/KeepassDXStyle.TextAppearance.TextEntryItem"
+            style="@style/KeepassDXStyle.TextAppearance.TextNode"
             android:layout_width="match_parent"
             android:layout_height="match_parent"
             android:layout_toStartOf="@+id/item_attachment_size_container"

app/src/main/res/layout/item_breadcrumb.xml

@@ -0,0 +1,66 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!--
+ Copyright 2021 Jeremy Jamet / Kunzisoft.
+
+ This file is part of KeePassDX.
+
+  KeePassDX is free software: you can redistribute it and/or modify
+  it under the terms of the GNU General Public License as published by
+  the Free Software Foundation, either version 3 of the License, or
+  (at your option) any later version.
+
+  KeePassDX is distributed in the hope that it will be useful,
+  but WITHOUT ANY WARRANTY; without even the implied warranty of
+  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+  GNU General Public License for more details.
+
+  You should have received a copy of the GNU General Public License
+  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+-->
+<LinearLayout
+    xmlns:android="http://schemas.android.com/apk/res/android"
+    xmlns:tools="http://schemas.android.com/tools"
+    android:id="@+id/breadcrumb_group"
+    android:layout_width="wrap_content"
+    android:layout_height="match_parent"
+    android:orientation="horizontal"
+    android:gravity="center_vertical"
+    android:baselineAligned="false"
+    android:background="?android:attr/selectableItemBackground">
+    <androidx.appcompat.widget.AppCompatImageView
+        android:id="@+id/group_icon"
+        android:layout_width="26dp"
+        android:layout_height="26dp"
+        android:layout_marginStart="6dp"
+        android:layout_marginLeft="6dp"
+        android:layout_marginEnd="6dp"
+        android:layout_marginRight="6dp"
+        android:layout_gravity="center_vertical"
+        android:contentDescription="@string/hint_icon_name"
+        android:scaleType="fitXY" />
+    <androidx.appcompat.widget.AppCompatTextView
+        android:id="@+id/group_name"
+        android:layout_width="wrap_content"
+        android:layout_height="wrap_content"
+        android:layout_gravity="start|center_vertical"
+        android:text="@string/root"
+        android:maxLines="2"
+        android:ellipsize="end"
+        style="@style/KeepassDXStyle.TextAppearance.SubTitle.TextOnPrimary"
+        android:layout_marginStart="8dp"
+        android:layout_marginLeft="8dp"
+        android:layout_marginEnd="8dp"
+        android:layout_marginRight="8dp"/>
+    <androidx.appcompat.widget.AppCompatImageView
+        android:id="@+id/group_separator"
+        android:layout_width="wrap_content"
+        android:layout_height="wrap_content"
+        android:src="@drawable/ic_arrow_right_white_24dp"
+        android:tint="?attr/textColorInverse"
+        android:importantForAccessibility="no"
+        android:layout_marginEnd="6dp"
+        android:layout_marginRight="6dp"
+        style="@style/KeepassDXStyle.TextAppearance.SubTitle.TextOnPrimary"
+        android:textStyle="bold"
+        tools:targetApi="jelly_bean" />
+</LinearLayout>

app/src/main/res/layout/item_group.xml

@@ -0,0 +1,76 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!--
+ Copyright 2021 Jeremy Jamet / Kunzisoft.
+
+ This file is part of KeePassDX.
+
+  KeePassDX is free software: you can redistribute it and/or modify
+  it under the terms of the GNU General Public License as published by
+  the Free Software Foundation, either version 3 of the License, or
+  (at your option) any later version.
+
+  KeePassDX is distributed in the hope that it will be useful,
+  but WITHOUT ANY WARRANTY; without even the implied warranty of
+  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+  GNU General Public License for more details.
+
+  You should have received a copy of the GNU General Public License
+  along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
+-->
+<LinearLayout
+    xmlns:android="http://schemas.android.com/apk/res/android"
+    xmlns:tools="http://schemas.android.com/tools"
+    android:id="@+id/breadcrumb_group"
+    android:layout_width="wrap_content"
+    android:layout_height="match_parent"
+    android:orientation="horizontal"
+    android:gravity="center_vertical"
+    android:baselineAligned="false"
+    android:background="?android:attr/selectableItemBackground">
+    <RelativeLayout
+        android:layout_width="wrap_content"
+        android:layout_height="wrap_content"
+        android:layout_marginEnd="6dp"
+        android:layout_marginRight="6dp"
+        android:gravity="center_vertical">
+        <androidx.appcompat.widget.AppCompatImageView
+            android:id="@+id/group_icon"
+            android:layout_width="32dp"
+            android:layout_height="32dp"
+            android:layout_gravity="end|center_vertical"
+            android:layout_marginStart="8dp"
+            android:layout_marginEnd="8dp"
+            android:scaleType="fitXY" />
+        <androidx.appcompat.widget.AppCompatTextView
+            android:id="@+id/group_numbers"
+            android:layout_width="wrap_content"
+            android:layout_height="wrap_content"
+            tools:text="3"
+            style="@style/KeepassDXStyle.TextAppearance.Info" />
+    </RelativeLayout>
+    <LinearLayout
+        android:layout_width="0dp"
+        android:layout_height="wrap_content"
+        android:orientation="vertical"
+        android:layout_gravity="start|center_vertical"
+        android:layout_marginEnd="6dp"
+        android:layout_marginRight="6dp"
+        android:layout_weight="1">
+        <androidx.appcompat.widget.AppCompatTextView
+            android:id="@+id/group_name"
+            android:layout_width="match_parent"
+            android:layout_height="match_parent"
+            android:text="@string/root"
+            android:maxLines="2"
+            android:ellipsize="end"
+            style="@style/KeepassDXStyle.TextAppearance.Title.TextOnPrimary" />
+        <androidx.appcompat.widget.AppCompatTextView
+            android:id="@+id/group_meta"
+            android:layout_height="match_parent"
+            android:layout_width="match_parent"
+            tools:text="7543A7EAB2EA7CFD1394F1615EBEB08C"
+            android:lines="1"
+            android:singleLine="true"
+            style="@style/KeepassDXStyle.TextAppearance.Meta.TextOnPrimary" />
+    </LinearLayout>
+</LinearLayout>

app/src/main/res/layout/item_icon.xml

@@ -22,7 +22,7 @@
     android:id="@+id/icon_container"
     android:layout_width="match_parent"
     android:layout_height="80dp"
-    android:background="@drawable/background_item_selection">
+    style="@style/KeepassDXStyle.Selectable.Item">
     <androidx.appcompat.widget.AppCompatImageView
         android:id="@+id/icon_image"
         android:layout_width="wrap_content"

app/src/main/res/layout/item_list_entry_history.xml

@@ -29,7 +29,7 @@
     <androidx.appcompat.widget.AppCompatTextView
         android:id="@+id/entry_history_last_modified"
         tools:text = "Last Modified"
-        style="@style/KeepassDXStyle.TextAppearance.TextEntryItem"
+        style="@style/KeepassDXStyle.TextAppearance.TextNode"
         android:gravity="center"
         android:layout_width="0dp"
         android:layout_height="wrap_content"
@@ -38,7 +38,7 @@
     <androidx.appcompat.widget.AppCompatTextView
         android:id="@+id/entry_history_title"
         tools:text = "Title"
-        style="@style/KeepassDXStyle.TextAppearance.TextEntryItem"
+        style="@style/KeepassDXStyle.TextAppearance.TextNode"
         android:maxLines="6"
         android:ellipsize="end"
         android:gravity="center"
@@ -49,7 +49,7 @@
     <androidx.appcompat.widget.AppCompatTextView
         android:id="@+id/entry_history_username"
         tools:text = "Username"
-        style="@style/KeepassDXStyle.TextAppearance.TextEntryItem"
+        style="@style/KeepassDXStyle.TextAppearance.TextNode"
         android:maxLines="6"
         android:ellipsize="end"
         android:gravity="center"

app/src/main/res/layout/item_list_nodes_entry.xml

@@ -27,52 +27,53 @@
     style="@style/KeepassDXStyle.Selectable.Item">
 
     <androidx.constraintlayout.widget.ConstraintLayout
+        android:id="@+id/constraintLayout"
         android:layout_width="0dp"
         android:layout_height="match_parent"
         android:layout_gravity="center_vertical"
+        android:background="?android:attr/selectableItemBackground"
         android:minHeight="48dp"
-        app:layout_constraintWidth_percent="@dimen/content_percent"
-        app:layout_constraintTop_toTopOf="parent"
         app:layout_constraintBottom_toBottomOf="parent"
-        app:layout_constraintStart_toStartOf="parent"
         app:layout_constraintEnd_toEndOf="parent"
-        android:background="?android:attr/selectableItemBackground" >
+        app:layout_constraintStart_toStartOf="parent"
+        app:layout_constraintTop_toTopOf="parent"
+        app:layout_constraintWidth_percent="@dimen/content_percent">
 
         <androidx.appcompat.widget.AppCompatImageView
             android:id="@+id/node_icon"
             android:layout_width="32dp"
             android:layout_height="32dp"
-            android:layout_marginTop="@dimen/image_list_margin_horizontal"
-            android:layout_marginBottom="@dimen/image_list_margin_horizontal"
-            android:layout_marginLeft="@dimen/image_list_margin_vertical"
-            android:layout_marginStart="@dimen/image_list_margin_vertical"
-            android:layout_marginRight="@dimen/image_list_margin_vertical"
-            android:layout_marginEnd="@dimen/image_list_margin_vertical"
             android:layout_gravity="center"
+            android:layout_marginStart="@dimen/image_list_margin_vertical"
+            android:layout_marginLeft="@dimen/image_list_margin_vertical"
+            android:layout_marginTop="@dimen/image_list_margin_horizontal"
+            android:layout_marginEnd="@dimen/image_list_margin_vertical"
+            android:layout_marginRight="@dimen/image_list_margin_vertical"
+            android:layout_marginBottom="@dimen/image_list_margin_horizontal"
             android:scaleType="fitXY"
             android:src="@drawable/ic_blank_32dp"
-            app:layout_constraintTop_toTopOf="parent"
             app:layout_constraintBottom_toBottomOf="parent"
+            app:layout_constraintLeft_toLeftOf="parent"
             app:layout_constraintStart_toStartOf="parent"
-            app:layout_constraintLeft_toLeftOf="parent" />
+            app:layout_constraintTop_toTopOf="parent" />
 
         <LinearLayout
             android:id="@+id/node_container_info"
             android:layout_width="0dp"
             android:layout_height="wrap_content"
-            android:paddingTop="4dp"
-            android:paddingBottom="4dp"
             android:layout_marginStart="@dimen/image_list_margin_vertical"
             android:layout_marginLeft="@dimen/image_list_margin_vertical"
             android:layout_marginEnd="12dp"
             android:layout_marginRight="12dp"
             android:orientation="vertical"
-            app:layout_constraintTop_toTopOf="parent"
+            android:paddingTop="4dp"
+            android:paddingBottom="4dp"
             app:layout_constraintBottom_toBottomOf="parent"
-            app:layout_constraintStart_toEndOf="@+id/node_icon"
-            app:layout_constraintLeft_toRightOf="@+id/node_icon"
             app:layout_constraintEnd_toStartOf="@+id/node_options"
-            app:layout_constraintRight_toLeftOf="@+id/node_options">
+            app:layout_constraintLeft_toRightOf="@+id/node_icon"
+            app:layout_constraintRight_toLeftOf="@+id/node_options"
+            app:layout_constraintStart_toEndOf="@+id/node_icon"
+            app:layout_constraintTop_toTopOf="parent">
 
             <androidx.appcompat.widget.AppCompatTextView
                 android:id="@+id/node_text"
@@ -101,32 +102,41 @@
                 android:lines="1"
                 android:singleLine="true"
                 tools:text="7543A7EAB2EA7CFD1394F1615EBEB08C" />
+
+            <androidx.appcompat.widget.AppCompatTextView
+                android:id="@+id/node_path"
+                style="@style/KeepassDXStyle.TextAppearance.Entry.Meta"
+                android:layout_width="wrap_content"
+                android:layout_height="wrap_content"
+                android:maxLines="2"
+                android:visibility="gone"
+                tools:text="Database / Group A / Group B" />
         </LinearLayout>
 
         <LinearLayout
             android:id="@+id/node_options"
             android:layout_width="wrap_content"
             android:layout_height="wrap_content"
-            android:orientation="vertical"
-            android:gravity="end"
             android:layout_marginStart="12dp"
             android:layout_marginLeft="12dp"
-            app:layout_constraintTop_toTopOf="parent"
+            android:gravity="end"
+            android:orientation="vertical"
             app:layout_constraintBottom_toBottomOf="parent"
-            app:layout_constraintEnd_toEndOf="parent">
+            app:layout_constraintEnd_toEndOf="parent"
+            app:layout_constraintTop_toTopOf="parent">
 
             <LinearLayout
                 android:id="@+id/node_otp_container"
                 android:layout_width="wrap_content"
                 android:layout_height="wrap_content"
-                android:layout_marginEnd="12dp"
+                android:layout_marginEnd="8dp"
-                android:layout_marginRight="12dp"
+                android:layout_marginRight="8dp"
-                android:padding="4dp"
-                android:orientation="horizontal"
                 android:background="?android:attr/selectableItemBackground"
-                app:layout_constraintTop_toTopOf="parent"
+                android:orientation="horizontal"
+                android:padding="4dp"
                 app:layout_constraintBottom_toTopOf="@+id/node_attachment_icon"
-                app:layout_constraintEnd_toEndOf="parent">
+                app:layout_constraintEnd_toEndOf="parent"
+                app:layout_constraintTop_toTopOf="parent">
 
                 <TextView
                     android:id="@+id/node_otp_token"
@@ -135,20 +145,22 @@
                     android:layout_height="wrap_content"
                     android:layout_gravity="center"
                     tools:text="5136" />
+
                 <FrameLayout
                     android:layout_width="wrap_content"
                     android:layout_height="wrap_content"
                     android:layout_gravity="center"
                     android:layout_marginStart="4dp"
                     android:layout_marginLeft="4dp">
-                    <ProgressBar
+
+                    <com.google.android.material.progressindicator.CircularProgressIndicator
                         android:id="@+id/node_otp_progress"
-                        style="@style/KeepassDXStyle.ProgressBar.Circle.Secondary"
+                        android:layout_width="wrap_content"
-                        android:layout_width="18dp"
+                        android:layout_height="wrap_content"
-                        android:layout_height="18dp"
+                        app:indicatorSize="16dp"
-                        android:layout_gravity="center"
+                        app:trackThickness="2dp"
-                        android:max="100"
+                        app:indicatorDirectionCircular="counterclockwise"
-                        android:progress="60" />
+                        android:layout_gravity="center" />
                 </FrameLayout>
             </LinearLayout>
 
@@ -170,12 +182,12 @@
         <View
             android:layout_width="match_parent"
             android:layout_height="1dp"
-            android:background="?android:attr/listDivider"
-            android:layout_marginLeft="72dp"
             android:layout_marginStart="72dp"
-            android:layout_marginRight="48dp"
+            android:layout_marginLeft="72dp"
             android:layout_marginEnd="48dp"
-            app:layout_constraintBottom_toBottomOf="parent"/>
+            android:layout_marginRight="48dp"
+            android:background="?android:attr/listDivider"
+            app:layout_constraintBottom_toBottomOf="parent" />
 
     </androidx.constraintlayout.widget.ConstraintLayout>
 </androidx.constraintlayout.widget.ConstraintLayout>

app/src/main/res/layout/pref_dialog_duration.xml

@@ -17,133 +17,155 @@
   You should have received a copy of the GNU General Public License
   along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
 -->
-<androidx.constraintlayout.widget.ConstraintLayout
+<ScrollView xmlns:android="http://schemas.android.com/apk/res/android"
-	xmlns:android="http://schemas.android.com/apk/res/android"
-	xmlns:tools="http://schemas.android.com/tools"
 	xmlns:app="http://schemas.android.com/apk/res-auto"
-	android:id="@+id/edit"
+	xmlns:tools="http://schemas.android.com/tools"
-	android:orientation="vertical"
 	android:layout_width="match_parent"
-	android:layout_height="match_parent"
+	android:layout_height="match_parent">
-	android:importantForAutofill="noExcludeDescendants"
-	tools:targetApi="o">
-    <androidx.appcompat.widget.AppCompatTextView
-		android:id="@+id/explanation_text"
-		android:layout_height="wrap_content"
-		android:layout_width="0dp"
-		android:gravity="center"
-        android:layout_marginBottom="8dp"
-		app:layout_constraintTop_toTopOf="parent"
-		app:layout_constraintStart_toStartOf="parent"
-		app:layout_constraintLeft_toLeftOf="parent"
-		app:layout_constraintEnd_toEndOf="parent"
-		app:layout_constraintRight_toRightOf="parent"
-        style="@style/KeepassDXStyle.TextAppearance.SmallTitle"/>
-
-	<androidx.appcompat.widget.SwitchCompat
-		android:id="@+id/switch_element"
-		android:layout_width="wrap_content"
-		android:layout_height="wrap_content"
-		android:text="@string/enable"
-		android:layout_marginStart="20dp"
-		android:layout_marginLeft="20dp"
-		android:layout_marginEnd="20dp"
-		android:layout_marginRight="20dp"
-		app:layout_constraintEnd_toEndOf="parent"
-		app:layout_constraintRight_toRightOf="parent"
-		app:layout_constraintTop_toBottomOf="@+id/explanation_text" />
-
 	<androidx.constraintlayout.widget.ConstraintLayout
+		android:id="@+id/edit"
+		android:orientation="vertical"
 		android:layout_width="match_parent"
 		android:layout_height="wrap_content"
-		app:layout_constraintTop_toBottomOf="@+id/switch_element">
+		android:importantForAutofill="noExcludeDescendants"
-
+		tools:targetApi="o">
-		<LinearLayout
+		<androidx.appcompat.widget.AppCompatTextView
-			android:id="@+id/duration_days_picker"
+			android:id="@+id/explanation_text"
-			android:layout_width="wrap_content"
 			android:layout_height="wrap_content"
-			android:orientation="horizontal"
+			android:layout_width="0dp"
+			android:gravity="center"
+			android:layout_marginStart="20dp"
+			android:layout_marginLeft="20dp"
+			android:layout_marginEnd="20dp"
+			android:layout_marginRight="20dp"
+			android:layout_marginTop="8dp"
 			app:layout_constraintTop_toTopOf="parent"
 			app:layout_constraintStart_toStartOf="parent"
 			app:layout_constraintLeft_toLeftOf="parent"
-			app:layout_constraintEnd_toStartOf="@+id/duration_hours_picker"
-			app:layout_constraintRight_toLeftOf="@+id/duration_hours_picker">
-			<NumberPicker
-				android:id="@+id/days_picker"
-				android:scrollbarFadeDuration="0"
-				android:scrollbarDefaultDelayBeforeFade="0"
-				android:layout_width="wrap_content"
-				android:layout_height="wrap_content"/>
-			<ImageView
-				android:layout_width="wrap_content"
-				android:layout_height="match_parent"
-				android:gravity="center"
-				android:src="@drawable/ic_day_white_24dp"
-				app:tint="?android:attr/textColor"
-				android:contentDescription="@string/digits" />
-		</LinearLayout>
-
-		<LinearLayout
-			android:id="@+id/duration_hours_picker"
-			android:layout_width="wrap_content"
-			android:layout_height="wrap_content"
-			android:orientation="horizontal"
-			tools:ignore="HardcodedText"
-			app:layout_constraintTop_toTopOf="parent"
-			app:layout_constraintStart_toEndOf="@+id/duration_days_picker"
-			app:layout_constraintLeft_toRightOf="@+id/duration_days_picker"
-			app:layout_constraintEnd_toStartOf="@+id/duration_time_picker"
-			app:layout_constraintRight_toLeftOf="@+id/duration_time_picker">
-			<NumberPicker
-				android:id="@+id/hours_picker"
-				android:scrollbarFadeDuration="0"
-				android:scrollbarDefaultDelayBeforeFade="0"
-				android:layout_width="wrap_content"
-				android:layout_height="wrap_content"/>
-			<TextView
-				android:layout_width="wrap_content"
-				android:layout_height="match_parent"
-				android:gravity="center"
-				android:textStyle="bold"
-				android:text=":" />
-		</LinearLayout>
-
-		<LinearLayout
-			android:id="@+id/duration_time_picker"
-			android:layout_width="wrap_content"
-			android:layout_height="wrap_content"
-			android:orientation="horizontal"
-			tools:ignore="HardcodedText"
-			app:layout_constraintTop_toTopOf="parent"
-			app:layout_constraintStart_toEndOf="@+id/duration_hours_picker"
-			app:layout_constraintLeft_toRightOf="@+id/duration_hours_picker"
 			app:layout_constraintEnd_toEndOf="parent"
-			app:layout_constraintRight_toRightOf="parent">
+			app:layout_constraintRight_toRightOf="parent"
-			<NumberPicker
+			style="@style/KeepassDXStyle.TextAppearance.SmallTitle"/>
-				android:id="@+id/minutes_picker"
-				android:scrollbarFadeDuration="0"
-				android:scrollbarDefaultDelayBeforeFade="0"
-				android:layout_width="wrap_content"
-				android:layout_height="wrap_content"/>
-			<TextView
-				android:layout_width="wrap_content"
-				android:layout_height="match_parent"
-				android:gravity="center"
-				android:textSize="28sp"
-				android:text="'"/>
-			<NumberPicker
-				android:id="@+id/seconds_picker"
-				android:scrollbarFadeDuration="0"
-				android:scrollbarDefaultDelayBeforeFade="0"
-				android:layout_width="wrap_content"
-				android:layout_height="wrap_content"/>
-			<TextView
-				android:layout_width="wrap_content"
-				android:layout_height="match_parent"
-				android:gravity="center"
-				android:textSize="28sp"
-				android:text="''"/>
-		</LinearLayout>
 
+		<Button
+			android:id="@+id/explanation_button"
+			android:layout_width="wrap_content"
+			android:layout_height="wrap_content"
+			android:layout_marginTop="8dp"
+			android:layout_marginStart="20dp"
+			android:layout_marginLeft="20dp"
+			android:layout_marginEnd="20dp"
+			android:layout_marginRight="20dp"
+			tools:text="permission"
+			style="@style/Widget.AppCompat.Button.Small"
+			app:layout_constraintStart_toStartOf="parent"
+			app:layout_constraintEnd_toEndOf="parent"
+			app:layout_constraintTop_toBottomOf="@+id/explanation_text" />
+
+		<androidx.appcompat.widget.SwitchCompat
+			android:id="@+id/switch_element"
+			android:layout_width="wrap_content"
+			android:layout_height="wrap_content"
+			android:text="@string/enable"
+			android:layout_marginTop="8dp"
+			android:layout_marginStart="20dp"
+			android:layout_marginLeft="20dp"
+			android:layout_marginEnd="20dp"
+			android:layout_marginRight="20dp"
+			app:layout_constraintEnd_toEndOf="parent"
+			app:layout_constraintTop_toBottomOf="@+id/explanation_button" />
+
+		<androidx.constraintlayout.widget.ConstraintLayout
+			android:layout_width="match_parent"
+			android:layout_height="wrap_content"
+			app:layout_constraintTop_toBottomOf="@+id/switch_element">
+
+			<LinearLayout
+				android:id="@+id/duration_days_picker"
+				android:layout_width="wrap_content"
+				android:layout_height="wrap_content"
+				android:orientation="horizontal"
+				app:layout_constraintTop_toTopOf="parent"
+				app:layout_constraintStart_toStartOf="parent"
+				app:layout_constraintLeft_toLeftOf="parent"
+				app:layout_constraintEnd_toStartOf="@+id/duration_hours_picker"
+				app:layout_constraintRight_toLeftOf="@+id/duration_hours_picker">
+				<NumberPicker
+					android:id="@+id/days_picker"
+					android:scrollbarFadeDuration="0"
+					android:scrollbarDefaultDelayBeforeFade="0"
+					android:layout_width="wrap_content"
+					android:layout_height="wrap_content"/>
+				<ImageView
+					android:layout_width="wrap_content"
+					android:layout_height="match_parent"
+					android:gravity="center"
+					android:src="@drawable/ic_day_white_24dp"
+					app:tint="?android:attr/textColor"
+					android:contentDescription="@string/digits" />
+			</LinearLayout>
+
+			<LinearLayout
+				android:id="@+id/duration_hours_picker"
+				android:layout_width="wrap_content"
+				android:layout_height="wrap_content"
+				android:orientation="horizontal"
+				tools:ignore="HardcodedText"
+				app:layout_constraintTop_toTopOf="parent"
+				app:layout_constraintStart_toEndOf="@+id/duration_days_picker"
+				app:layout_constraintLeft_toRightOf="@+id/duration_days_picker"
+				app:layout_constraintEnd_toStartOf="@+id/duration_time_picker"
+				app:layout_constraintRight_toLeftOf="@+id/duration_time_picker">
+				<NumberPicker
+					android:id="@+id/hours_picker"
+					android:scrollbarFadeDuration="0"
+					android:scrollbarDefaultDelayBeforeFade="0"
+					android:layout_width="wrap_content"
+					android:layout_height="wrap_content"/>
+				<TextView
+					android:layout_width="wrap_content"
+					android:layout_height="match_parent"
+					android:gravity="center"
+					android:textStyle="bold"
+					android:text=":" />
+			</LinearLayout>
+
+			<LinearLayout
+				android:id="@+id/duration_time_picker"
+				android:layout_width="wrap_content"
+				android:layout_height="wrap_content"
+				android:orientation="horizontal"
+				tools:ignore="HardcodedText"
+				app:layout_constraintTop_toTopOf="parent"
+				app:layout_constraintStart_toEndOf="@+id/duration_hours_picker"
+				app:layout_constraintLeft_toRightOf="@+id/duration_hours_picker"
+				app:layout_constraintEnd_toEndOf="parent"
+				app:layout_constraintRight_toRightOf="parent">
+				<NumberPicker
+					android:id="@+id/minutes_picker"
+					android:scrollbarFadeDuration="0"
+					android:scrollbarDefaultDelayBeforeFade="0"
+					android:layout_width="wrap_content"
+					android:layout_height="wrap_content"/>
+				<TextView
+					android:layout_width="wrap_content"
+					android:layout_height="match_parent"
+					android:gravity="center"
+					android:textSize="28sp"
+					android:text="'"/>
+				<NumberPicker
+					android:id="@+id/seconds_picker"
+					android:scrollbarFadeDuration="0"
+					android:scrollbarDefaultDelayBeforeFade="0"
+					android:layout_width="wrap_content"
+					android:layout_height="wrap_content"/>
+				<TextView
+					android:layout_width="wrap_content"
+					android:layout_height="match_parent"
+					android:gravity="center"
+					android:textSize="28sp"
+					android:text="''"/>
+			</LinearLayout>
+
+		</androidx.constraintlayout.widget.ConstraintLayout>
 	</androidx.constraintlayout.widget.ConstraintLayout>
-</androidx.constraintlayout.widget.ConstraintLayout>
+</ScrollView>

app/src/main/res/layout/view_date_time.xml

@@ -26,6 +26,6 @@
             android:id="@+id/date_time_value"
             android:layout_width="match_parent"
             android:layout_height="wrap_content"
-            style="@style/KeepassDXStyle.TextAppearance.TextEntryItem" />
+            style="@style/KeepassDXStyle.TextAppearance.TextNode" />
     </LinearLayout>
 </LinearLayout>

app/src/main/res/layout/view_edit_date_time.xml

@@ -20,7 +20,7 @@
             android:focusable="false"
             android:cursorVisible="false"
             android:focusableInTouchMode="false"
-            style="@style/KeepassDXStyle.TextAppearance.TextEntryItem"
+            style="@style/KeepassDXStyle.TextAppearance.TextNode"
             tools:text="2020-03-04 05:00" />
     </com.google.android.material.textfield.TextInputLayout>
     <androidx.appcompat.widget.SwitchCompat

app/src/main/res/layout/view_template.xml

@@ -17,9 +17,9 @@
   You should have received a copy of the GNU General Public License
   along with KeePassDX.  If not, see <http://www.gnu.org/licenses/>.
 -->
-<LinearLayout
+<LinearLayout xmlns:android="http://schemas.android.com/apk/res/android"
-	xmlns:android="http://schemas.android.com/apk/res/android"
 	xmlns:tools="http://schemas.android.com/tools"
+	xmlns:app="http://schemas.android.com/apk/res-auto"
 	tools:targetApi="o"
 	android:layout_width="match_parent"
 	android:layout_height="wrap_content"
@@ -29,30 +29,70 @@
 		android:id="@+id/template_header_container"
 		android:layout_width="match_parent"
 		android:layout_height="wrap_content"
-		style="?attr/cardViewStyle"
+		style="?attr/cardViewStyle">
-		android:visibility="gone">
-		<LinearLayout
-			android:orientation="vertical"
-			android:layout_width="match_parent"
-			android:layout_height="wrap_content"
-			android:layout_margin="@dimen/card_view_padding">
 
-			<!-- Icon -->
+		<FrameLayout
-			<androidx.appcompat.widget.AppCompatImageButton
+			android:layout_width="match_parent"
-				android:id="@+id/template_icon_button"
+			android:layout_height="wrap_content">
+
+			<View
+				android:id="@+id/template_background_color"
+				android:layout_width="36dp"
+				android:layout_height="36dp"
+				android:layout_margin="9dp"
+				android:layout_gravity="top|end"
+				android:background="@drawable/background_rounded_square" />
+			<View
+				android:id="@+id/template_foreground_color"
+				android:layout_width="36dp"
+				android:layout_height="36dp"
+				android:layout_margin="32dp"
+				android:layout_gravity="top|end"
+				android:background="@drawable/background_rounded_square" />
+
+			<ImageView
+				android:id="@+id/template_background_color_button"
 				android:layout_width="wrap_content"
 				android:layout_height="wrap_content"
-				android:layout_margin="4dp"
+				android:layout_gravity="top|end"
-				android:src="@drawable/ic_blank_32dp"
+				android:layout_margin="3dp"
-				android:contentDescription="@string/content_description_entry_icon"
+				android:src="@drawable/ic_color_background_white_24dp"
-				android:layout_gravity="center"/>
+				android:contentDescription="@string/content_description_entry_background_color"
+				style="@style/KeepassDXStyle.ImageButton.Simple.Mini" />
+			<ImageView
+				android:id="@+id/template_foreground_color_button"
+				android:layout_width="wrap_content"
+				android:layout_height="wrap_content"
+				android:layout_gravity="top|end"
+				android:layout_margin="25dp"
+				android:src="@drawable/ic_color_foreground_white_24dp"
+				android:contentDescription="@string/content_description_entry_background_color"
+				style="@style/KeepassDXStyle.ImageButton.Simple.Mini" />
 
-			<!-- Title -->
+			<LinearLayout
-			<FrameLayout
+				android:orientation="vertical"
-				android:id="@+id/template_title_container"
 				android:layout_width="match_parent"
-				android:layout_height="wrap_content" />
+				android:layout_height="wrap_content"
-		</LinearLayout>
+				android:layout_gravity="center"
+				android:layout_margin="@dimen/card_view_padding">
+
+				<!-- Icon -->
+				<androidx.appcompat.widget.AppCompatImageButton
+					android:id="@+id/template_icon_button"
+					android:layout_width="wrap_content"
+					android:layout_height="wrap_content"
+					android:elevation="8dp"
+					android:layout_gravity="center_horizontal"
+					android:src="@drawable/ic_blank_32dp"
+					android:contentDescription="@string/content_description_entry_icon"/>
+
+				<!-- Title -->
+				<FrameLayout
+					android:id="@+id/template_title_container"
+					android:layout_width="match_parent"
+					android:layout_height="wrap_content" />
+			</LinearLayout>
+		</FrameLayout>
 	</androidx.cardview.widget.CardView>
 
 	<LinearLayout

app/src/main/res/values-ar/strings.xml

@@ -88,7 +88,7 @@
     <string name="space">المساحة</string>
     <string name="search_label">البحث</string>
     <string name="sort_menu">الفرز</string>
-    <string name="sort_ascending">تصاعدياً</string>
+    <string name="sort_ascending">تصاعدي ↓</string>
     <string name="sort_title">العنوان</string>
     <string name="sort_username">اسم المستخدِم</string>
     <string name="sort_creation_time">تاريخ الإنشاء</string>
@@ -472,7 +472,7 @@
     <string name="error_import_app_properties">خطأ أثناء استيراد خصائص التطبيق</string>
     <string name="error_export_app_properties">خطأ أثناء تصدير خصائص التطبيق</string>
     <string name="warning_database_info_changed">غُيِّرت معلومات قاعدة البيانات من خارج هذا التطبيق.</string>
-    <string name="warning_database_info_changed_options">اكتب فوق التعديلات الخارجية عن طريق حفظ قاعدة البيانات أو أعد تحميلها لتضمين هذه التغييرات.</string>
+    <string name="warning_database_info_changed_options">اكتب فوق التعديلات الخارجية عن طريق حفظ قاعدة البيانات أو أعد تحميلها لجلب آخر التغييرات.</string>
     <string name="open_advanced_unlock_prompt_store_credential">افتح محث فك القفل المتقدم لتخزين بيانات الاعتماد</string>
     <string name="open_advanced_unlock_prompt_unlock_database">افتح محث فك القفل المتقدم لفتح قاعدة البيانات</string>
     <string name="credential_before_click_advanced_unlock_button">اكتب كلمة السر، وأنقر هذا الزر.</string>
@@ -483,4 +483,10 @@
     <string name="keyboard_previous_fill_in_title">إجراء لمس تلقائي</string>
     <string name="keyboard_previous_lock_title">اقفل قاعدة البيانات</string>
     <string name="education_advanced_unlock_title">فك القفل المتقدم لقاعدة البيانات</string>
+    <string name="hint_icon_name">اسم الأيقونة</string>
+    <string name="autofill_manual_selection_title">اختيار يدوي</string>
+    <string name="description_app_properties">خصائص KeePassDX لإدارة إعدادات التطبيقات</string>
+    <string name="warning_empty_recycle_bin">هل تريد حذف جميع العقد نهائيًا من سلة المهملات؟</string>
+    <string name="autofill_save_search_info_title">احفظ معلومات البحث</string>
+    <string name="autofill_ask_to_save_data_title">اسأل لحفظ البيانات</string>
 </resources>

app/src/main/res/values-bn-rBD/strings.xml

@@ -29,4 +29,16 @@
     <string name="discard">বাতিল</string>
     <string name="validate">সত্যায়ন</string>
     <string name="content_description_background">পটভূমি</string>
+    <string name="entry_cancel">বাতিল</string>
+    <string name="entry_notes">দ্রষ্টব্য</string>
+    <string name="entry_created">তৈরিকৃত</string>
+    <string name="entry_expires">মেয়াদ</string>
+    <string name="entry_UUID">বিশেষ শনাক্তকরণ সংকেত(ইউইউআইডি)</string>
+    <string name="entry_history">ইতিহাস</string>
+    <string name="entry_attachments">সংযুক্তি</string>
+    <string name="entry_keyfile">চাবিনথি(কিফাইল)</string>
+    <string name="entry_modified">পরিবর্তিত</string>
+    <string name="clipboard_cleared">ক্লিপবোর্ড পরিষ্কার করা হয়েছে</string>
+    <string name="entry_accessed">শেষ ব্যবহার</string>
+    <string name="clipboard_error">কিছু ডিভাইস অ্যাপ্লিকেশনগুলোকে ক্লিপবোর্ড ব্যবহার করতে দেয় না।</string>
 </resources>

app/src/main/res/values-cs/strings.xml

@@ -602,4 +602,7 @@
     <string name="autofill_select_entry">Vyberte položku…</string>
     <string name="autofill_manual_selection_summary">Zobrazit možnosti umožňující uživateli si vybrat položku z databáze</string>
     <string name="autofill_manual_selection_title">Ruční výběr</string>
+    <string name="hint_icon_name">Jméno symbolu</string>
+    <string name="warning_exact_alarm">Nepovolili jste aplikaci použít přesný alarm. Výsledkem je, že funkce požadující časovač nebudou provedeny v přesný okamžik.</string>
+    <string name="permission">Povolení</string>
 </resources>

app/src/main/res/values-da/strings.xml

@@ -449,7 +449,7 @@
     <string name="autofill_application_id_blocklist_summary">Blokeringsliste der forhindrer automatisk udfyldning af programmer</string>
     <string name="autofill_application_id_blocklist_title">Blokeringsliste for program</string>
     <string name="keyboard_previous_fill_in_summary">Skift automatisk tilbage til det forrige tastatur efter udførelse af \"Automatisk tastehandling\"</string>
-    <string name="keyboard_previous_fill_in_title">Auto nøglehandling</string>
+    <string name="keyboard_previous_fill_in_title">Automatisk tastehandling</string>
     <string name="keyboard_previous_database_credentials_summary">Skift automatisk tilbage til det forrige tastatur på databasens legitimationsskærm</string>
     <string name="keyboard_previous_database_credentials_title">Skærmbilledet til databaselegitimationsoplysninger</string>
     <string name="keyboard_change">Skifte tastatur</string>

app/src/main/res/values-de/strings.xml

@@ -160,7 +160,7 @@
     <string name="clipboard_notifications_title">Zwischenablage-Benachrichtigung</string>
     <string name="clipboard_notifications_summary">Benachrichtigungen zur Zwischenablage anzeigen, um beim Betrachten eines Eintrags Felder kopieren zu können</string>
     <string name="lock_database_screen_off_title">Bildschirmsperre</string>
-    <string name="lock_database_screen_off_summary">Datenbank sperren, einige Sekunden nachdem der Bildschirm ausgeschaltet wird</string>
+    <string name="lock_database_screen_off_summary">Datenbank einige Sekunden, nachdem der Bildschirm ausgeschaltet ist, sperren</string>
     <string name="create_keepass_file">Neue Datenbank erstellen</string>
     <string name="assign_master_key">Hauptschlüssel zuweisen</string>
     <string name="path">Pfad</string>
@@ -253,7 +253,7 @@
     <string name="education_sort_title">Sortierung der Einträge</string>
     <string name="education_sort_summary">Auswählen, wie Einträge und Gruppen sortiert werden.</string>
     <string name="education_donation_title">Mitmachen</string>
-    <string name="education_donation_summary">Mithelfen, um Stabilität und Sicherheit zu verbessern und weitere Funktionen zu ermöglichen.</string>
+    <string name="education_donation_summary">Mithelfen, um Stabilität und Sicherheit zu verbessern sowie weitere Funktionen zu ermöglichen.</string>
     <string name="html_text_ad_free">Anders als viele andere Passwortmanager ist dieser &lt;strong&gt;werbefrei&lt;/strong&gt;, &lt;strong&gt;quelloffen&lt;/strong&gt; und unter einer &lt;strong&gt;Copyleft-Lizenz&lt;/strong&gt;. Es werden keine persönlichen Daten gesammelt, in welcher Form auch immer, unabhängig von der verwendeten Version (kostenlos oder Pro).</string>
     <string name="html_text_buy_pro">Mit dem Kauf der Pro-Version erhalten Sie Zugriff auf diesen &lt;strong&gt;visuellen Stil&lt;/strong&gt; und unterstützen insbesondere &lt;strong&gt;die Umsetzung gemeinschaftlicher Projekte.&lt;/strong&gt;</string>
     <string name="html_text_feature_generosity">Dieser &lt;strong&gt;visuelle Stil&lt;/strong&gt; wurde wegen Ihrer Großzügigkeit freigeschaltet.</string>
@@ -343,7 +343,7 @@
     <string name="list_groups_show_number_entries_summary">Anzahl der Einträge in einer Gruppe anzeigen</string>
     <string name="content_description_add_node">Knoten hinzufügen</string>
     <string name="lock_database_back_root_title">„Zurück“ drücken, um zu sperren</string>
-    <string name="clear_clipboard_notification_summary">Die Datenbank sperren, wenn die Dauer der Zwischenablage abläuft oder die Benachrichtigung geschlossen wird, nachdem Sie sie zu benutzen begonnen haben</string>
+    <string name="clear_clipboard_notification_summary">Die Datenbank sperren, wenn die Dauer der Zwischenablage abläuft oder die Benachrichtigung geschlossen wird, nachdem Sie sie benutzt haben</string>
     <string name="content_description_node_children">Untergeordneter Knotenpunkt</string>
     <string name="content_description_keyfile_checkbox">Schlüsseldatei-Kontrollkästchen</string>
     <string name="error_move_entry_here">Hierher kann kein Eintrag verschoben werden.</string>
@@ -450,7 +450,7 @@
     <string name="autofill_auto_search_summary">Suchergebnisse automatisch nach Web-Domain oder Anwendungs-ID vorschlagen</string>
     <string name="autofill_auto_search_title">Automatische Suche</string>
     <string name="autofill_manual_selection_title">Manuelle Auswahl</string>
-    <string name="autofill_manual_selection_summary">Manuelle Auswahl des Datenbank-Eintrags ermöglichen</string>
+    <string name="autofill_manual_selection_summary">Manuelle Auswahl des Datenbankeintrags ermöglichen</string>
     <string name="lock_database_show_button_summary">Zeigt die Sperrtaste in der Benutzeroberfläche an</string>
     <string name="lock_database_show_button_title">Sperrtaste anzeigen</string>
     <string name="autofill_preference_title">Einstellungen für automatisches Ausfüllen</string>
@@ -488,13 +488,13 @@
 \nMit diesem Upload könnte Ihre Datenbank sehr groß werden und an Geschwindigkeit verlieren.</string>
     <string name="upload_attachment">%1$s hochladen</string>
     <string name="education_add_attachment_title">Anhang hinzufügen</string>
-    <string name="database_data_remove_unlinked_attachments_summary">Entfernt Anhänge die in der Datenbank enthalten, aber keinem Eintrag zugeordnet sind</string>
+    <string name="database_data_remove_unlinked_attachments_summary">Entfernt Anhänge, die in der Datenbank enthalten, aber keinem Eintrag zugeordnet sind</string>
     <string name="warning_sure_add_file">Soll die Datei trotzdem hinzugefügt werden\?</string>
     <string name="show_uuid_summary">Zeigt die mit einem Eintrag oder einer Gruppe verknüpfte UUID an</string>
     <string name="show_uuid_title">UUID anzeigen</string>
     <string name="autofill_read_only_save">Das Speichern von Daten ist für eine als schreibgeschützt geöffnete Datenbank nicht zulässig.</string>
     <string name="autofill_close_database_title">Datenbank schließen</string>
-    <string name="keyboard_previous_lock_summary">Automatisches Zurückschalten zur vorherigen Tastatur nach dem Sperren der Datenbank</string>
+    <string name="keyboard_previous_lock_summary">Nach dem Sperren der Datenbank automatisch zur vorherigen Tastatur zurückschalten</string>
     <string name="keyboard_previous_lock_title">Datenbank sperren</string>
     <string name="notification">Benachrichtigung</string>
     <string name="biometric_security_update_required">Biometrisches Sicherheitsupdate erforderlich.</string>
@@ -503,12 +503,12 @@
     <string name="save_mode">Speichermodus</string>
     <string name="search_mode">Suchmodus</string>
     <string name="error_registration_read_only">Das Speichern eines neuen Elements in einer schreibgeschützten Datenbank ist nicht zulässig</string>
-    <string name="autofill_save_search_info_summary">Suchdaten bei manueller Auswahl einer Eingabe wenn möglich speichern</string>
+    <string name="autofill_save_search_info_summary">Suchdaten bei manueller Auswahl einer Eingabe, wenn möglich, speichern</string>
     <string name="autofill_ask_to_save_data_summary">Nachfragen, ob die Daten gespeichert werden sollen, wenn ein Formular ausgefüllt ist</string>
     <string name="autofill_ask_to_save_data_title">Speichern von Daten abfragen</string>
     <string name="autofill_save_search_info_title">Suchinformationen speichern</string>
     <string name="autofill_close_database_summary">Datenbank nach Auswahl eines Eintrags zum automatischen Ausfüllen schließen</string>
-    <string name="keyboard_save_search_info_summary">Nachdem eine URL mit KeePassDX geteilt und ein Eintrag gewählt wurde, wird versucht sich diesen Eintrag für weitere Nutzungen zu merken</string>
+    <string name="keyboard_save_search_info_summary">Nachdem eine URL mit KeePassDX geteilt und ein Eintrag gewählt wurde, wird versucht, sich diesen Eintrag für die weitere Nutzung zu merken</string>
     <string name="keyboard_save_search_info_title">Gemeinsam genutzte Informationen speichern</string>
     <string name="warning_empty_recycle_bin">Sollen alle ausgewählten Knoten wirklich aus dem Papierkorb gelöscht werden\?</string>
     <string name="error_field_name_already_exists">Der Feldname existiert bereits.</string>
@@ -519,8 +519,8 @@
     <string name="advanced_unlock_prompt_store_credential_title">Moderne Entsperrerkennung</string>
     <string name="education_advanced_unlock_summary">Verknüpfen Sie Ihr Passwort mit Ihren gescannten Biometriedaten oder Daten zur Geräteanmeldung, um schnell Ihre Datenbank zu entsperren.</string>
     <string name="education_advanced_unlock_title">Moderne Entsperrung der Datenbank</string>
-    <string name="advanced_unlock_timeout">Verfallzeit der modernen Entsperrung</string>
+    <string name="advanced_unlock_timeout">Verfallszeit der modernen Entsperrung</string>
-    <string name="temp_advanced_unlock_timeout_summary">Laufzeit der modernen Entsperrung bevor ihr Inhalt gelöscht wird</string>
+    <string name="temp_advanced_unlock_timeout_summary">Laufzeit der modernen Entsperrung, bevor ihr Inhalt gelöscht wird</string>
     <string name="temp_advanced_unlock_timeout_title">Verfall der modernen Entsperrung</string>
     <string name="temp_advanced_unlock_enable_summary">Keine zur modernen Entsperrung verwendeten, verschlüsselten Inhalte speichern</string>
     <string name="temp_advanced_unlock_enable_title">Befristete moderne Entsperrung</string>
@@ -530,7 +530,7 @@
     <string name="advanced_unlock_prompt_extract_credential_title">Datenbank mit moderner Entsperrerkennung öffnen</string>
     <string name="enter">Eingabetaste</string>
     <string name="backspace">Rücktaste</string>
-    <string name="select_entry">Wähle Eintrag</string>
+    <string name="select_entry">Eintrag auswählen</string>
     <string name="back_to_previous_keyboard">Zurück zur vorherigen Tastatur</string>
     <string name="custom_fields">Benutzerdefinierte Felder</string>
     <string name="advanced_unlock_delete_all_key_warning">Alle Verschlüsselungsschlüssel, die mit der modernen Entsperrerkennung zusammenhängen, löschen\?</string>
@@ -576,7 +576,7 @@
     <string name="unit_byte">B</string>
     <string name="download_canceled">Abgebrochen!</string>
     <string name="autofill_inline_suggestions_keyboard">Vorschläge für automatisches Ausfüllen hinzugefügt.</string>
-    <string name="autofill_inline_suggestions_summary">Wenn möglich unmittelbar Vorschläge zum automatischen Ausfüllen auf einer kompatiblen Tastatur anzeigen</string>
+    <string name="autofill_inline_suggestions_summary">Wenn möglich, Vorschläge zum automatischen Ausfüllen direkt auf einer kompatiblen Tastatur anzeigen</string>
     <string name="properties">Eigenschaften</string>
     <string name="description_app_properties">KeePassDX-Eigenschaften zur Verwaltung der App-Einstellungen</string>
     <string name="secure_note">Sicherer Hinweis</string>
@@ -613,4 +613,7 @@
     <string name="menu_external_icon">Externes Symbol</string>
     <string name="show_otp_token_summary">Zeigt OTP-Tokens in der Liste der Einträge an</string>
     <string name="show_otp_token_title">OTP-Token anzeigen</string>
+    <string name="hint_icon_name">Symbolname</string>
+    <string name="permission">Erlaubnis</string>
+    <string name="warning_exact_alarm">Sie haben der App nicht erlaubt, einen genauen Alarm zu verwenden. Deshalb werden die Funktionen, die einen Timer erfordern, nicht zu einer genauen Zeit ausgeführt.</string>
 </resources>

app/src/main/res/values-el/strings.xml

@@ -602,4 +602,7 @@
     <string name="autofill_manual_selection_summary">Εμφάνισης επιλογής για να επιτρέψει στον χρήστη να επιλέξει την καταχώρηση βάσης δεδομένων</string>
     <string name="autofill_manual_selection_title">Χειροκίνητη επιλογή</string>
     <string name="autofill_select_entry">Επιλογή καταχώρησης…</string>
+    <string name="hint_icon_name">Όνομα εικονιδίου</string>
+    <string name="warning_exact_alarm">Δεν έχετε επιτρέψει στην εφαρμογή να χρησιμοποιεί ακριβή συναγερμό. Ως αποτέλεσμα, οι λειτουργίες που απαιτούν χρονόμετρο δεν θα γίνονται με ακριβή χρόνο.</string>
+    <string name="permission">Άδεια</string>
 </resources>

app/src/main/res/values-es/strings.xml

@@ -604,4 +604,7 @@
     <string name="autofill_manual_selection_summary">Mostrar opción para permitir al usuario seleccionar la entrada de la base de datos</string>
     <string name="autofill_manual_selection_title">Selección manual</string>
     <string name="autofill_select_entry">Seleccionar entrada…</string>
+    <string name="hint_icon_name">Nombre del icono</string>
+    <string name="warning_exact_alarm">No ha permitido que la app use una alarma exacta. Como resultado, las funciones que requieren un temporizador no se harán con una hora exacta.</string>
+    <string name="permission">Permiso</string>
 </resources>

app/src/main/res/values-fr/strings.xml

@@ -569,9 +569,9 @@
     <string name="success_import_app_properties">Propriétés de l\'application importées</string>
     <string name="description_app_properties">Propriétés KeePassDX pour gérer les paramètres de l\'application</string>
     <string name="export_app_properties_summary">Créer un fichier pour exporter les propriétés de l\'application</string>
-    <string name="export_app_properties_title">Export des propriétés de l\'app</string>
+    <string name="export_app_properties_title">Exporter les propriétés de l\'application</string>
     <string name="import_app_properties_summary">Sélectionner un fichier pour importer les propriétés de l\'application</string>
-    <string name="import_app_properties_title">Importation des propriétés de l\'appli</string>
+    <string name="import_app_properties_title">Importer les propriétés de l\'application</string>
     <string name="error_start_database_action">Une erreur s\'est produite lors de l\'exécution d\'une action sur la base de données.</string>
     <string name="error_move_group_here">Vous ne pouvez pas déplacer un groupe ici.</string>
     <string name="error_word_reserved">Ce mot est réservé et ne peut pas être utilisé.</string>
@@ -609,4 +609,5 @@
     <string name="menu_external_icon">Icône externe</string>
     <string name="autofill_manual_selection_summary">Afficher l\'option permettant à l\'utilisateur de sélectionner l\'entrée de la base de données</string>
     <string name="autofill_manual_selection_title">Sélection manuelle</string>
+    <string name="hint_icon_name">Nom de l\'icône</string>
 </resources>

app/src/main/res/values-hr/strings.xml

@@ -597,4 +597,5 @@
     <string name="autofill_select_entry">Odaberi unos …</string>
     <string name="menu_external_icon">Vanjska ikona</string>
     <string name="seed">Tajna fraza</string>
+    <string name="hint_icon_name">Ime ikone</string>
 </resources>

app/src/main/res/values-id/strings.xml

@@ -455,4 +455,37 @@
     <string name="public_key">Kunci publik</string>
     <string name="private_key">Kunci pribadi</string>
     <string name="membership">Keanggotaan</string>
+    <string name="hint_icon_name">Nama ikon</string>
+    <string name="card_verification_value">CVV</string>
+    <string name="personal_identification_number">PIN</string>
+    <string name="id_card">Kartu ID</string>
+    <string name="email">Surel</string>
+    <string name="email_address">Alamat surel</string>
+    <string name="ssid">SSID</string>
+    <string name="token">Token</string>
+    <string name="seed">Bibit</string>
+    <string name="bank_identifier_code">SWIFT/BIC</string>
+    <string name="secure_note">Catatan Aman</string>
+    <string name="menu_external_icon">Ikon eksternal</string>
+    <string name="holder">Penyangga</string>
+    <string name="autofill_select_entry">Pilih entri…</string>
+    <string name="biometric_auto_open_prompt_summary">Secara otomatis meminta buka kunci lanjutan jika basis data diatur menggunakan itu</string>
+    <string name="temp_advanced_unlock_enable_title">Buka kunci lanjutan sementara</string>
+    <string name="temp_advanced_unlock_enable_summary">Jangan simpan konten terenkripsi apa pun untuk menggunakan buka kunci lanjutan</string>
+    <string name="temp_advanced_unlock_timeout_summary">Durasi penggunaan buka kunci lanjutan sebelum menghapus konten tersebut</string>
+    <string name="advanced_unlock_timeout">Batas waktu membuka kunci lanjutan</string>
+    <string name="advanced_unlock_delete_all_key_warning">Hapus semua kunci enkripsi yang terkait pengenalan buka kunci lanjutan\?</string>
+    <string name="templates_group_enable_title">Penggunaan templat</string>
+    <string name="biometric_delete_all_key_summary">Hapus semua kunci enkripsi yang terkait pengenalan buka kunci lanjutan</string>
+    <string name="max_history_items_summary">Batasi jumlah item riwayat per entri</string>
+    <string name="template_group_name">Templat</string>
+    <string name="date_of_issue">Tanggal diterbitkan</string>
+    <string name="template">Templat</string>
+    <string name="place_of_issue">Tempat diterbitkan</string>
+    <string name="device_credential_unlock_enable_summary">Membiarkan Anda menggunakan kredensial perangkat Anda untuk membuka basis data</string>
+    <string name="unavailable_feature_text">Tidak bisa memulai fitur ini.</string>
+    <string name="templates_group_uuid_title">Grup templat</string>
+    <string name="max_history_size_summary">Batasi ukuran riwayat per entri</string>
+    <string name="max_history_size_title">Ukuran maksimum</string>
+    <string name="biometric_delete_all_key_title">Hapus kunci enkripsi</string>
 </resources>

app/src/main/res/values-it/strings.xml

@@ -605,4 +605,5 @@
     <string name="autofill_manual_selection_summary">Mostra l\'opzione che permette all\'utente di scegliere la voce nel database</string>
     <string name="autofill_manual_selection_title">Selezione manuale</string>
     <string name="autofill_select_entry">Seleziona voce…</string>
+    <string name="hint_icon_name">Nome icona</string>
 </resources>

app/src/main/res/values-ja/strings.xml

@@ -600,4 +600,5 @@
     <string name="templates_group_uuid_title">テンプレート グループ</string>
     <string name="menu_external_icon">外部アイコン</string>
     <string name="template">テンプレート</string>
+    <string name="hint_icon_name">アイコン名</string>
 </resources>

app/src/main/res/values-nb/strings.xml

@@ -499,4 +499,105 @@
     <string name="content_description_otp_information">Éngangspassordsinfo</string>
     <string name="template_group_name">Maler</string>
     <string name="content_description_credentials_information">Identitetdetaljsinfo</string>
+    <string name="templates_group_enable_summary">Bruk dynamiske maler for å fylle inn feltene for en oppføring</string>
+    <string name="templates">Maler</string>
+    <string name="error_word_reserved">Dette ordet er reservert og kan ikke brukes.</string>
+    <string name="enter">Enter-tast</string>
+    <string name="hint_icon_name">Ikonnavn</string>
+    <string name="menu_reload_database">Last inn databasen igjen</string>
+    <string name="menu_keystore_remove_key">Slett avansert opplåsningsnøkkel</string>
+    <string name="remember_database_locations_summary">Holder øye med hvor databaser lagres</string>
+    <string name="remember_keyfile_locations_title">Husk hvor lagringsfiler er lagret</string>
+    <string name="remember_keyfile_locations_summary">Holder øye med hvor nøkkelfiler er lagret</string>
+    <string name="show_recent_files_summary">Vis hvor nylige databaser er lagret</string>
+    <string name="description_app_properties">KeePassDX-egenskaper for håndtering av programinnstillinger</string>
+    <string name="success_import_app_properties">Programegenskaper importert</string>
+    <string name="filter">Filter</string>
+    <string name="warning_database_info_changed">Informasjonen som er å finne i databsefilen din har blitt endret utenfor programmet.</string>
+    <string name="warning_database_info_changed_options">Overskriv eksisterende endringer ved å lagre databasen, eller last den inn igjen med de siste endringene.</string>
+    <string name="warning_file_too_big">En KeePass-database er ment å kun inneholde små bruksfiler (som f-eks PGP-nøkkelfiler).
+\n
+\nDatabasen din kan bli veldig stor og få redusert ytelse med denne opplastingen.</string>
+    <string name="warning_empty_keyfile_explanation">Innholdet i nøkkelfilen bør aldri endre seg, og skal helst inneholde kun tilfeldig generert data.</string>
+    <string name="warning_database_revoked">Tilgang til filen ble tilbakekalt av filbehandleren. Lukk databasen og åpne den igjen fra dens posisjon.</string>
+    <string name="error_import_app_properties">Feil under importering av programegenskaper</string>
+    <string name="success_export_app_properties">Programegenskaper eksportert</string>
+    <string name="error_export_app_properties">Feil under eksportering av programegenskaper</string>
+    <string name="place_of_issue">Utsteder</string>
+    <string name="cryptocurrency">Kryptovaluta-lommebok</string>
+    <string name="seed">Utgangspunkt</string>
+    <string name="debit_credit_card">Bankkort</string>
+    <string name="secure_note">Sikkehetsnotis</string>
+    <string name="standard">Forvalg</string>
+    <string name="bank_identifier_code">SWIFT/BIC</string>
+    <string name="error_registration_read_only">Å lagre et nytt element tillates ikke i skrivebeskyttet database.</string>
+    <string name="error_database_uri_null">Database-URI kan ikke innhentes.</string>
+    <string name="error_rebuild_list">Kunne ikke gjenoppbygge listen på riktig måte.</string>
+    <string name="error_upload_file">En feil inntraff under opplasting av fildataen.</string>
+    <string name="error_remove_file">En feil inntraff under fjerning av fildataen.</string>
+    <string name="properties">Egenskaper</string>
+    <string name="advanced_unlock_prompt_extract_credential_title">Åpne databasen med avansert opplåsningsgjenkjennelse</string>
+    <string name="advanced_unlock_prompt_extract_credential_message">Pakk ut database-identitetsdetalj med avansert opplåsningsdata</string>
+    <string name="advanced_unlock_invalid_key">Kan ikke lese avansert opplåsningsnøkkel. Slett den og gjenta gjenkjenning av opplåsningsprosedyre.</string>
+    <string name="advanced_unlock_prompt_not_initialized">Kunne ikke igangsette avansert opplåsningsspørring.</string>
+    <string name="permission">Tilgang</string>
+    <string name="biometric_security_update_required">Biometrisk sikkerhetsoppdatering kreves.</string>
+    <string name="warning_exact_alarm">Du har ikke tillat programmet å bruke en eksakt alarm. Som resultat vil funksjoner som krever et tidsur ikke gjøres til eksakt tid.</string>
+    <string name="open_advanced_unlock_prompt_unlock_database">Åpne avansert opplåsningsspørring for å låse opp databasen</string>
+    <string name="open_advanced_unlock_prompt_store_credential">Åpne avansert opplåsningsspørring for å lagre identitetsdetaljer</string>
+    <string name="advanced_unlock_prompt_store_credential_message">Advarsel: Du vil fremdeles måtte huske hovedpassordet ditt hvis du bruker avansert opplåsningsgjenkjennelse.</string>
+    <string name="advanced_unlock_not_recognized">Kunne ikke gjenkjenne avansert opplåsningsskrift</string>
+    <string name="credential_before_click_advanced_unlock_button">Skriv inn passordet, og klikk deretter på denne knappen.</string>
+    <string name="device_credential">Enhets-identitetsdetalj</string>
+    <string name="autofill_select_entry">Velg oppføring …</string>
+    <string name="temp_advanced_unlock_enable_title">Midlertidig avansert opplåsing</string>
+    <string name="temp_advanced_unlock_timeout_title">Utløp av avansert opplåsing</string>
+    <string name="device_credential_unlock_enable_summary">Lar deg bruke din enhets-identitetsdetalj for å åpne databasen</string>
+    <string name="temp_advanced_unlock_timeout_summary">Varighet av avansert opplåsningsbruk for sletting av dens innhold</string>
+    <string name="advanced_unlock_explanation_summary">Bruk avansert databaseopplåsing for enklere åpning av databaser</string>
+    <string name="device_credential_unlock_enable_title">Opplåsning av enhetsidentitetsdetalj</string>
+    <string name="advanced_unlock_timeout">Tidsavbrudd for avansert opplåsing</string>
+    <string name="templates_group_enable_title">Mal-bruk</string>
+    <string name="database_data_remove_unlinked_attachments_summary">Fjerner vedlegg som er å finne i databasen, men som ikke er lenket til en oppføring</string>
+    <string name="keyboard_save_search_info_summary">Etter deling av en nettadresse til KeePassDX, vil oppføringer som velges bli forsøkt husket for fremtidig bruk</string>
+    <string name="keyboard_previous_database_credentials_title">Skjem for database-identitetsdetaljer</string>
+    <string name="keyboard_previous_database_credentials_summary">Bytt tilbake til forrige tastatur atuomatisk på skjermen for database-identitetsdetaljer</string>
+    <string name="autofill_inline_suggestions_title">Forslag på linjen</string>
+    <string name="autofill_inline_suggestions_summary">Prøv å vise autofullføringsforslag direkte fra et kompatibelt tastatur</string>
+    <string name="autofill_manual_selection_title">Manuellt utvalg</string>
+    <string name="autofill_manual_selection_summary">Vis alternativ for å la brukeren velge databaseoppføring</string>
+    <string name="keyboard_previous_fill_in_title">Automatisk tastehandling</string>
+    <string name="autofill_application_id_blocklist_title">Programsvarteliste</string>
+    <string name="autofill_application_id_blocklist_summary">Svartelisten som forhindrer automatisk innfylling i programmer</string>
+    <string name="autofill_web_domain_blocklist_title">Svarteliste for vev-domene</string>
+    <string name="autofill_web_domain_blocklist_summary">Svarteliste som forhindrer automatisk innfylling av vev-domener</string>
+    <string name="autofill_ask_to_save_data_summary">Spør om å lagre data når et skjema bekreftes</string>
+    <string name="education_add_attachment_summary">Last opp et vedlegg til din oppføring for å lagre viktig ekstern data.</string>
+    <string name="education_setup_OTP_summary">Sett opp engangspassordhåndtering (HOTP/TOTP) for å generere et symbol forespurt for to-faktoridentitetsbekreftelse (2FA).</string>
+    <string name="show_otp_token_title">Vis OTP-symbol</string>
+    <string name="keyboard_auto_go_action_summary">«Start»-nøkkelhandling etter at en «Felt»-nøkkel trykkes</string>
+    <string name="keyboard_auto_go_action_title">Automatisk nøkkelhandling</string>
+    <string name="keyboard_search_share_summary">Filtrer oppføringene ved bruk av nettadressedomenet ved deling av en nettadresse til KeePassDX</string>
+    <string name="settings_database_force_changing_master_key_next_time_summary">Krev endring av hovednøkkelen neste gang (én gang)</string>
+    <string name="settings_database_force_changing_master_key_next_time_title">Påtving fornyelse neste gang</string>
+    <string name="database_data_remove_unlinked_attachments_title">Fjen ulenket data</string>
+    <string name="biometric_auto_open_prompt_summary">Forespør opplasting automatisk hvis databasen er satt opp til å bruke det</string>
+    <string name="menu_external_icon">Eksternt ikon</string>
+    <string name="subdomain_search_title">Underdomenesøk</string>
+    <string name="error_otp_type">Eksisterende OTP-type gjenkjennes ikke av dette skjemaet. Bekreftelse av trenger ikke nødvendigvis å generere symbolet på riktig måte.</string>
+    <string name="error_start_database_action">En feil inntraff under utføring av en databasehandling.</string>
+    <string name="temp_advanced_unlock_enable_summary">Ikke lagre noe kryptert innhold for å bruke avansert opplåsing</string>
+    <string name="subdomain_search_summary">Søk i vev-domener med underdomene-begrensninger</string>
+    <string name="max_history_items_summary">Begrens antall historikkelementer per oppføring</string>
+    <string name="show_otp_token_summary">Viser OTP-symboler i listen over oppføringer</string>
+    <string name="warning_replace_file">Opplasting av denne filen erstatter den som finnes.</string>
+    <string name="max_history_size_summary">Begrens historikkstørrelse per oppføring</string>
+    <string name="import_app_properties_summary">Velg en fil for å importere programegenskaper</string>
+    <string name="export_app_properties_summary">Opprett en fil for å eksportere programegenskaper</string>
+    <string name="warning_remove_unlinked_attachment">Fjerning av ulenket data kan redusere databasestørrelsen din, men kan også slette data bruk av KeePass-programtillegg.</string>
+    <string name="settings_database_force_changing_master_key_summary">Krev endring av hovednøkkelen (dager)</string>
+    <string name="biometric_auto_open_prompt_title">Åpne spørring automatisk</string>
+    <string name="settings_database_recommend_changing_master_key_summary">Anbefal endring av hovednøkkel (dager)</string>
+    <string name="keystore_not_accessible">Nøkkellageret er ikke igangsatt på riktig vis.</string>
+    <string name="keyboard_previous_fill_in_summary">Bytt tilbake til forrige tastatur automatisk etter kjøring av «Automatisk tastehandling»</string>
 </resources>

app/src/main/res/values-nl/strings.xml

@@ -603,4 +603,5 @@
     <string name="number">Nummer</string>
     <string name="debit_credit_card">Betaalkaart</string>
     <string name="template_group_name">Sjablonen</string>
+    <string name="hint_icon_name">Naam van het pictogram</string>
 </resources>

app/src/main/res/values-pl/strings.xml

@@ -162,8 +162,8 @@
     <string name="kdf_explanation">Aby wygenerować klucz dla algorytmu szyfrowania, klucz główny jest transformowany przy użyciu losowo solonej funkcji wyprowadzania klucza.</string>
     <string name="memory_usage">Użycie pamięci</string>
     <string name="memory_usage_explanation">Ilość pamięci do użycia przez funkcję wyprowadzania klucza.</string>
-    <string name="parallelism">Równoległy</string>
+    <string name="parallelism">Równoległość</string>
-    <string name="parallelism_explanation">Stopień równoległości (tj. Liczba wątków) wykorzystywany przez funkcję wyprowadzania klucza.</string>
+    <string name="parallelism_explanation">Stopień równoległości (tj. liczba wątków) wykorzystywany przez funkcję wyprowadzania klucza.</string>
     <string name="sort_menu">Sortuj</string>
     <string name="sort_ascending">Od najniższej ↓</string>
     <string name="sort_username">Nazwa Użytkownika</string>
@@ -602,4 +602,7 @@
     <string name="autofill_manual_selection_summary">Wyświetl opcję pozwalającą użytkownikowi wybrać wpis bazy danych</string>
     <string name="autofill_manual_selection_title">Wybór ręczny</string>
     <string name="autofill_select_entry">Wybierz wpis…</string>
+    <string name="hint_icon_name">Nazwa ikony</string>
+    <string name="warning_exact_alarm">Nie zezwolono aplikacji na użycie dokładnego alarmu. W rezultacie funkcje wymagające czasomierza nie będą wykonywane z dokładnym czasem.</string>
+    <string name="permission">Uprawnienie</string>
 </resources>

app/src/main/res/values-pt-rBR/strings.xml

@@ -23,9 +23,9 @@
     <string name="accept">Aceitar</string>
     <string name="add_entry">Adicionar entrada</string>
     <string name="add_group">Adicionar grupo</string>
-    <string name="encryption_algorithm">Algoritmo de cifragem</string>
+    <string name="encryption_algorithm">Algoritmo de criptografia</string>
     <string name="app_timeout">Tempo de espera</string>
-    <string name="app_timeout_summary">Inatividade até que o aplicativo seja bloqueado</string>
+    <string name="app_timeout_summary">Inatividade até que o banco de dados seja bloqueado</string>
     <string name="application">Aplicativo</string>
     <string name="menu_app_settings">Configurações do aplicativo</string>
     <string name="brackets">Parênteses</string>
@@ -77,7 +77,7 @@
     <string name="password">Senha</string>
     <string name="hint_pass">Senha</string>
     <string name="invalid_credentials">Não foi possível ler credenciais.</string>
-    <string name="invalid_db_sig">Não pôde reconhecer formato da base de dados.</string>
+    <string name="invalid_db_sig">Não foi possível reconhecer o formato do banco de dados.</string>
     <string name="length">Comprimento</string>
     <string name="list_size_title">Tamanho da lista de grupos</string>
     <string name="list_size_summary">Tamanho do texto na lista de grupos</string>
@@ -86,14 +86,14 @@
     <string name="hide_password_title">Esconder senhas</string>
     <string name="hide_password_summary">Mascarar senhas (***) por padrão</string>
     <string name="about">Sobre</string>
-    <string name="menu_change_key_settings">Modificar a chave mestra</string>
+    <string name="menu_change_key_settings">Modificar a chave-mestra</string>
     <string name="settings">Configurações</string>
     <string name="menu_database_settings">Configurações do banco de dados</string>
     <string name="menu_delete">Deletar</string>
     <string name="menu_donate">Doar</string>
     <string name="menu_edit">Editar</string>
     <string name="menu_hide_password">Esconder senha</string>
-    <string name="menu_lock">Bloquear base de dados</string>
+    <string name="menu_lock">Bloquear banco de dados</string>
     <string name="menu_open">Abrir</string>
     <string name="menu_search">Buscar</string>
     <string name="menu_showpass">Mostrar senha</string>
@@ -109,7 +109,7 @@
     <string name="content_description_remove_from_list">Remover</string>
     <string name="root">Raiz</string>
     <string name="rounds">Rodadas de transformação</string>
-    <string name="rounds_explanation">Rodadas adicionais de cifragem adicionam mais proteção contra ataques de força bruta, mas podem tornar o processo de carregar e salvar mais lentos.</string>
+    <string name="rounds_explanation">Rodadas adicionais de criptografia adicionam mais proteção contra ataques de força bruta, mas podem tornar o processo de carregar e salvar mais lentos.</string>
     <string name="saving_database">Salvando banco de dados…</string>
     <string name="space">Espaço</string>
     <string name="search_label">Busca</string>
@@ -122,13 +122,13 @@
     <string name="version_label">Versão %1$s</string>
     <string name="education_unlock_summary">Entre com a senha e/ou com o caminho para o arquivo-chave do banco de dados.
 \n
-\nGuarde uma cópia do seu arquivo do banco em um lugar mais seguro depois de cada alteração.</string>
+\nFaça um backup do banco em um lugar mais seguro depois de cada alteração.</string>
     <string-array name="list_size_options">
         <item>Pequeno</item>
         <item>Médio</item>
         <item>Grande</item>
     </string-array>
-    <string name="encryption">Cifragem</string>
+    <string name="encryption">Criptografia</string>
     <string name="key_derivation_function">Função de derivação de chave</string>
     <string name="extended_ASCII">ASCII estendido</string>
     <string name="allow">Permitir</string>
@@ -137,10 +137,10 @@
     <string name="clipboard_error_clear">Não foi possível limpar a área de transferência</string>
     <string name="entry_not_found">Não pôde encontrar dados de entrada.</string>
     <string name="error_string_key">Um nome do campo é necessário para cada string.</string>
-    <string name="error_autofill_enable_service">Não pôde ser habilitado o serviço de preenchimento automático.</string>
+    <string name="error_autofill_enable_service">Não foi possível habilitar o serviço de preenchimento automático.</string>
     <string name="field_name">Nome do campo</string>
     <string name="field_value">Valor do campo</string>
-    <string name="file_not_found_content">Não pôde encontrar o arquivo. Tente reabri-lo de seu explorador de arquivos.</string>
+    <string name="file_not_found_content">Não foi possível encontrar o arquivo. Tente reabri-lo de seu explorador de arquivos.</string>
     <string name="invalid_algorithm">Algoritmo errado.</string>
     <string name="keyfile_is_empty">O arquivo-chave está vazio.</string>
     <string name="copy_field">Cópia de %1$s</string>
@@ -156,8 +156,8 @@
     <string name="read_only_warning">KeePassDX precisa de permissões de escrita para poder mudar qualquer coisa no seu banco.</string>
     <string name="show_recent_files_title">Exibir arquivos recentes</string>
     <string name="show_recent_files_summary">Exibir locais de bancos de dados recentes</string>
-    <string name="encryption_explanation">Algoritmo de cifragem usado para todos os dados.</string>
+    <string name="encryption_explanation">Algoritmo de criptografia usado para todos os dados.</string>
-    <string name="kdf_explanation">Para gerar uma chave para o algoritmo de cifragem, a chave mestra é transformada usando uma função de derivação de chave salgada aleatoriamente.</string>
+    <string name="kdf_explanation">Para gerar uma chave para o algoritmo de criptografia, a chave-mestra é transformada usando uma função de derivação de chave salgada aleatoriamente.</string>
     <string name="memory_usage">Uso de memória</string>
     <string name="memory_usage_explanation">Quantidade de memória a ser usada pela função de derivação de chave.</string>
     <string name="parallelism">Paralelismo</string>
@@ -174,8 +174,8 @@
     <string name="search_results">Resultados da busca</string>
     <string name="warning">Aviso</string>
     <string name="warning_password_encoding">Evite caracteres fora do formato de codificação do arquivo do banco (todos os caracteres não reconhecidos são convertidos para a mesma letra).</string>
-    <string name="warning_empty_password">Continuar sem proteção de desbloqueio de senha\?</string>
+    <string name="warning_empty_password">Continuar sem proteção de desbloqueio por senha\?</string>
-    <string name="warning_no_encryption_key">Continuar sem chave de cifragem\?</string>
+    <string name="warning_no_encryption_key">Continuar sem chave de criptografia\?</string>
     <string name="encrypted_value_stored">Senha cifrada armazenada</string>
     <string name="no_credentials_stored">Ainda não há nenhuma senha armazenada nesse banco de dados.</string>
     <string name="database_history">Histórico</string>
@@ -199,14 +199,14 @@
     <string name="advanced_unlock">Desbloqueio avançado</string>
     <string name="biometric_unlock_enable_title">Desbloqueio biométrico</string>
     <string name="biometric_unlock_enable_summary">Permite que você escaneie sua biometria para a abertura do banco de dados</string>
-    <string name="biometric_delete_all_key_title">Apague chaves de cifragem</string>
+    <string name="biometric_delete_all_key_title">Apague chaves de criptografia</string>
-    <string name="biometric_delete_all_key_summary">Apagar todas as chaves de cifragem relacionadas ao reconhecimento de desbloqueio avançado</string>
+    <string name="biometric_delete_all_key_summary">Apagar todas as chaves de criptografia relacionadas ao reconhecimento de desbloqueio avançado</string>
     <string name="unavailable_feature_text">Não foi possível iniciar esse recurso.</string>
     <string name="unavailable_feature_version">O dispositivo está utilizando Android %1$s, mas precisa %2$s ou posterior.</string>
     <string name="unavailable_feature_hardware">Não foi possível encontrar o hardware correspondente.</string>
     <string name="file_name">Nome do arquivo</string>
     <string name="path">Caminho</string>
-    <string name="assign_master_key">Defina uma chave mestra</string>
+    <string name="assign_master_key">Defina uma chave-mestra</string>
     <string name="create_keepass_file">Criar novo banco</string>
     <string name="recycle_bin_title">Usar lixeira</string>
     <string name="recycle_bin_summary">Mover grupos e entradas para o grupo \"Lixeira\" antes de apagar</string>
@@ -224,7 +224,7 @@
     <string name="keyboard">Teclado</string>
     <string name="magic_keyboard_title">Magikeyboard</string>
     <string name="magic_keyboard_explanation_summary">Ative um teclado customizado, populando suas senhas e todos os campos de identidade</string>
-    <string name="allow_no_password_title">Não permitir chave mestra</string>
+    <string name="allow_no_password_title">Não permitir chave-mestra</string>
     <string name="allow_no_password_summary">Permitir tocar no botão \"Abrir\" se nenhuma credencial for selecionada</string>
     <string name="enable_read_only_title">Somente leitura</string>
     <string name="enable_read_only_summary">Por padrão, abrir seu banco de dados no modo somente leitura</string>
@@ -238,9 +238,9 @@
     <string name="education_select_database_title">Abra um banco de dados existente</string>
     <string name="education_select_database_summary">Abra seu arquivo de banco de dados existente a partir do navegador de arquivos.</string>
     <string name="education_new_node_title">Adicione itens ao seu banco</string>
-    <string name="education_new_node_summary">Entradas ajudam a gerenciar suas identidades digitais. 
+    <string name="education_new_node_summary">Entradas ajudam a gerenciar suas identidades digitais.
-\n 
+\n
-\nGrupos (~pastas) organizam suas entradas e sua base de dados.</string>
+\nGrupos (~pastas) organizam suas entradas e seu banco de dados.</string>
     <string name="education_search_title">Pesquise suas entradas</string>
     <string name="education_search_summary">Entre com título, nome de usuário ou outros campos para recuperar facilmente suas senhas.</string>
     <string name="education_entry_edit_title">Modifique a entrada</string>
@@ -248,7 +248,7 @@
     <string name="education_generate_password_title">Criar uma senha forte</string>
     <string name="education_generate_password_summary">Gere uma senha forte para associar a sua entrada, defina-a facilmente de acordo com os critérios do formulário e lembre-se de torná-la segura.</string>
     <string name="education_entry_new_field_title">Adicione campos customizados</string>
-    <string name="education_entry_new_field_summary">Registrar um campo adicional, adicionar um valor e, opcionalmente, protegê-lo.</string>
+    <string name="education_entry_new_field_summary">Registre um campo adicional, adicione um valor e, opcionalmente, proteja-o.</string>
     <string name="education_unlock_title">Desbloqueie seu banco de dados</string>
     <string name="education_read_only_title">Proteja seu banco de modificações</string>
     <string name="education_read_only_summary">Altere o modo de abertura para a sessão.
@@ -301,7 +301,7 @@
     <string name="keyboard_notification_entry_content_title">%1$s disponível no Magikeyboard</string>
     <string name="keyboard_notification_entry_content_text">%1$s</string>
     <string name="keyboard_notification_entry_clear_close_title">Limpar ao fechar</string>
-    <string name="keyboard_notification_entry_clear_close_summary">Fecha a base de dados ao dispensar a notificação</string>
+    <string name="keyboard_notification_entry_clear_close_summary">Fechar o banco de dados ao dispensar a notificação</string>
     <string name="keyboard_appearance_category">Aparência</string>
     <string name="keyboard_theme_title">Tema do teclado</string>
     <string name="keyboard_keys_category">Teclas</string>
@@ -347,7 +347,7 @@
     <string name="biometric_auto_open_prompt_summary">Solicitar desbloqueio avançado automaticamente se o banco de dados estiver configurado para usá-lo</string>
     <string name="enable">Habilitado</string>
     <string name="disable">Desabilitado</string>
-    <string name="master_key">Chave mestra</string>
+    <string name="master_key">Chave-mestra</string>
     <string name="security">Segurança</string>
     <string name="entry_history">Histórico</string>
     <string name="entry_setup_otp">Configure uma senha de uso único</string>
@@ -368,7 +368,7 @@
     <string name="invalid_db_same_uuid">%1$s com o mesmo UUID %2$s já existe.</string>
     <string name="creating_database">Criando banco de dados…</string>
     <string name="menu_security_settings">Configurações de segurança</string>
-    <string name="menu_master_key_settings">Configurações da chave mestra</string>
+    <string name="menu_master_key_settings">Configurações da chave-mestra</string>
     <string name="contains_duplicate_uuid">O banco de dados contém UUIDs duplicados.</string>
     <string name="contains_duplicate_uuid_procedure">Consertar o problema gerando nova UUIDs para duplicatas para continuar\?</string>
     <string name="database_opened">Banco de dados aberto</string>
@@ -381,11 +381,11 @@
     <string name="max_history_size_title">Tamanho máximo</string>
     <string name="max_history_size_summary">Limitar o tamanho do histórico por entrada</string>
     <string name="settings_database_recommend_changing_master_key_title">Renovação recomendada</string>
-    <string name="settings_database_recommend_changing_master_key_summary">Recomende a mudança da chave mestra (em dias)</string>
+    <string name="settings_database_recommend_changing_master_key_summary">Recomende a mudança da chave-mestra (em dias)</string>
     <string name="settings_database_force_changing_master_key_title">Forçar renovação</string>
-    <string name="settings_database_force_changing_master_key_summary">Forçar mudança da chave mestra (em dias)</string>
+    <string name="settings_database_force_changing_master_key_summary">Forçar mudança da chave-mestra (em dias)</string>
     <string name="settings_database_force_changing_master_key_next_time_title">Forçar renovação na próxima vez</string>
-    <string name="settings_database_force_changing_master_key_next_time_summary">Forçar mudança da chave mestra na próxima vez (uma vez)</string>
+    <string name="settings_database_force_changing_master_key_next_time_summary">Forçar mudança da chave-mestra na próxima vez (uma vez)</string>
     <string name="database_default_username_title">Usuário padrão</string>
     <string name="database_custom_color_title">Cor personalizada do banco de dados</string>
     <string name="compression">Compressão</string>
@@ -399,8 +399,8 @@
     <string name="warning_permanently_delete_nodes">Apagar permanentemente os nós selecionados\?</string>
     <string name="keystore_not_accessible">O armazenamento chaves não foi propriamente inicializado.</string>
     <string name="recycle_bin_group_title">Grupo de lixeira</string>
-    <string name="enable_auto_save_database_title">Salvar automaticamente a base de dados</string>
+    <string name="enable_auto_save_database_title">Salvar automaticamente o banco de dados</string>
-    <string name="enable_auto_save_database_summary">Salvar automaticamente a base de dados depois de uma ação importante (somente no modo \"Modificável\")</string>
+    <string name="enable_auto_save_database_summary">Salvar automaticamente o banco de dados depois de uma ação importante (somente no modo \"Modificável\")</string>
     <string name="discard">Descartar</string>
     <string name="contact">Contato</string>
     <string name="auto_focus_search_title">Busca rápida</string>
@@ -423,10 +423,10 @@
     <string name="lock_database_show_button_title">Mostrar botão de bloqueio</string>
     <string name="autofill_preference_title">Configurações de preenchimento automático</string>
     <string name="warning_database_link_revoked">Acesso ao arquivo revogado pelo gerenciador de arquivos</string>
-    <string name="warning_database_read_only">Conceder acesso de gravação de arquivo para salvar alterações na base de dados</string>
+    <string name="warning_database_read_only">Conceder acesso de gravação de arquivo para salvar alterações no banco de dados</string>
-    <string name="hide_broken_locations_summary">Esconder links quebrados na lista de bases de dados recentes</string>
+    <string name="hide_broken_locations_summary">Esconder links quebrados na lista de bancos de dados recentes</string>
     <string name="hide_broken_locations_title">Ocultar links quebrados do banco de dados</string>
-    <string name="remember_keyfile_locations_summary">Manter o local onde os arquivos-chave são armazenados</string>
+    <string name="remember_keyfile_locations_summary">Lembrar o local onde os arquivos-chave são guardados</string>
     <string name="remember_keyfile_locations_title">Lembrar a localização dos arquivos-chave</string>
     <string name="remember_database_locations_summary">Lembra o local onde os bancos de dados são guardados</string>
     <string name="remember_database_locations_title">Lembrar a localização dos bancos de dados</string>
@@ -589,7 +589,7 @@
     <string name="templates_group_uuid_title">Grupo de modelos</string>
     <string name="templates_group_enable_summary">Use modelos dinâmicos para preencher os campos de uma entrada</string>
     <string name="templates_group_enable_title">Uso de modelos</string>
-    <string name="advanced_unlock_delete_all_key_warning">Apagar todas as chaves de cifragem relacionadas ao reconhecimento de desbloqueio avançado\?</string>
+    <string name="advanced_unlock_delete_all_key_warning">Apagar todas as chaves de criptografia relacionadas ao reconhecimento de desbloqueio avançado\?</string>
     <string name="advanced_unlock_timeout">Tempo limite de desbloqueio avançado</string>
     <string name="temp_advanced_unlock_timeout_summary">Duração do uso de desbloqueio avançado antes de excluir seu conteúdo</string>
     <string name="temp_advanced_unlock_timeout_title">Expiração de desbloqueio avançado</string>
@@ -600,4 +600,7 @@
     <string name="advanced_unlock_tap_delete">Toque para excluir as chaves de desbloqueio avançado</string>
     <string name="content">Conteúdo</string>
     <string name="autofill_select_entry">Selecione a entrada…</string>
+    <string name="hint_icon_name">Nome do ícone</string>
+    <string name="permission">Permissão</string>
+    <string name="warning_exact_alarm">Você não permitiu que o aplicativo usasse um alarme exato. Como resultado, os recursos que requerem um cronômetro não serão executados com um tempo exato.</string>
 </resources>

app/src/main/res/values-pt/strings.xml

@@ -578,4 +578,7 @@
     <string name="debit_credit_card">Cartão de crédito / débito</string>
     <string name="template_group_name">Modelos</string>
     <string name="content_description_otp_information">Informação de palavra-passe de uso único</string>
+    <string name="hint_icon_name">Nome do ícone</string>
+    <string name="permission">Permissão</string>
+    <string name="warning_exact_alarm">Não permitiu que a app usasse um alarme exato. Como resultado, as funcionalidades que requerem um temporizador não serão feitas com um tempo exato.</string>
 </resources>

app/src/main/res/values-ru/strings.xml

@@ -494,7 +494,7 @@
     <string name="save_mode">Режим записи</string>
     <string name="search_mode">Режим поиска</string>
     <string name="error_registration_read_only">Сохранение новых записей невозможно, т.к. база открыта только для чтения</string>
-    <string name="error_field_name_already_exists">Поле с таким именем уже существует.</string>
+    <string name="error_field_name_already_exists">Поле с таким названием уже существует.</string>
     <string name="device_credential_unlock_enable_summary">Позволяет использовать учётные данные вашего устройства для открытия базы</string>
     <string name="device_credential_unlock_enable_title">Разблокировка учётными данными устройства</string>
     <string name="device_credential">Учётные данные устройства</string>
@@ -602,4 +602,7 @@
     <string name="autofill_select_entry">Выбор записи…</string>
     <string name="autofill_manual_selection_summary">Показывать функцию, позволяющую пользователю вручную выбирать запить из базы</string>
     <string name="autofill_manual_selection_title">Ручной выбор</string>
+    <string name="hint_icon_name">Название значка</string>
+    <string name="permission">Разрешение</string>
+    <string name="warning_exact_alarm">Вы не разрешили приложению использовать точный сигнал будильника. В результате требующие этого функции не будут выполняться с точным временем.</string>
 </resources>

app/src/main/res/values-tr/strings.xml

@@ -300,7 +300,7 @@
     <string name="icon_pack_choose_title">Simge paketi</string>
     <string name="icon_pack_choose_summary">Uygulamada kullanılan simge paketi</string>
     <string name="selection_mode">Seçim modu</string>
-    <string name="do_not_kill_app">Uygulamayı öldürmeyin…</string>
+    <string name="do_not_kill_app">Uygulamayı sonlandırmayın…</string>
     <string name="lock_database_back_root_summary">Kullanıcı kök ekranda geri düğmesine tıkladığında veri tabanını kilitle</string>
     <string name="clear_clipboard_notification_title">Kapanışta temizle</string>
     <string name="clear_clipboard_notification_summary">Panonun süresi dolduğunda veya kullanmaya başladıktan sonra bildirim kapatıldığında veri tabanını kilitle</string>
@@ -597,4 +597,7 @@
     <string name="autofill_manual_selection_summary">Kullanıcının veri tabanı girdisini seçmesine izin veren seçeneği göster</string>
     <string name="autofill_manual_selection_title">Elle seçim</string>
     <string name="autofill_select_entry">Girdi seç…</string>
+    <string name="hint_icon_name">Simge adı</string>
+    <string name="warning_exact_alarm">Uygulamanın tam bir alarm kullanmasına izin vermediniz. Sonuç olarak zamanlayıcı gerektiren özellikler kesin bir süre ile yapılmayacaktır.</string>
+    <string name="permission">İzinler</string>
 </resources>

app/src/main/res/values-uk/strings.xml

@@ -134,7 +134,7 @@
     <string name="content_description_open_file">Відкрити файл</string>
     <string name="extended_ASCII">Розширений ASCII</string>
     <string name="edit_entry">Змінити запис</string>
-    <string name="clear_clipboard_notification_summary">Блокувати базу даних після закінчення терміну дії буфера обміну, або закрито сповіщення після початку користування ним</string>
+    <string name="clear_clipboard_notification_summary">Блокувати базу даних після закриття сповіщення після використання або якщо вичерпано час очікування</string>
     <string name="content_description_add_group">Додати групу</string>
     <string name="content_description_update_from_list">Оновити</string>
     <string name="keyboard">Клавіатура</string>
@@ -159,7 +159,7 @@
     <string name="clipboard_error">Деякі пристрої не дозволяють застосункам користуватися буфером обміну.</string>
     <string name="clipboard_error_title">Помилка буфера обміну</string>
     <string name="allow">Дозволити</string>
-    <string name="key_derivation_function">Функція створення ключа</string>
+    <string name="key_derivation_function">Функція генерування ключа</string>
     <string name="encryption">Шифрування</string>
     <string name="security">Безпека</string>
     <string name="master_key">Головний ключ</string>
@@ -375,7 +375,7 @@
     <string name="file_name">Назва файлу</string>
     <string name="unavailable_feature_version">Пристрій працює під керуванням Android %1$s, але необхідний %2$s чи пізніші.</string>
     <string name="unavailable_feature_text">Не вдалось запустити цю функцію.</string>
-    <string name="biometric_delete_all_key_summary">Видалити всі ключі шифрування, пов\'язані з розпізнаванням розширеного розблокування</string>
+    <string name="biometric_delete_all_key_summary">Видалити всі ключі шифрування, пов’язані з розпізнаванням розширеного розблокування</string>
     <string name="biometric_delete_all_key_title">Видалити ключі шифрування</string>
     <string name="biometric_auto_open_prompt_summary">Автоматично запитувати розширене розблокування, якщо базу даних налаштовано для роботи з ним</string>
     <string name="biometric_auto_open_prompt_title">Автозапит ключа</string>
@@ -471,8 +471,8 @@
     <string name="warning_empty_keyfile">Не рекомендовано додавати порожній файл ключа.</string>
     <string name="warning_empty_keyfile_explanation">Вміст файлу ключів ніколи не слід змінювати, а в кращому випадку повинен містити випадково згенеровані дані.</string>
     <string name="data">Дані</string>
-    <string name="database_data_remove_unlinked_attachments_title">Вилучити незв\'язані дані</string>
+    <string name="database_data_remove_unlinked_attachments_title">Вилучити непов’язані дані</string>
-    <string name="database_data_remove_unlinked_attachments_summary">Вилучає вкладення, що містяться в базі даних, але не пов’язані із записом</string>
+    <string name="database_data_remove_unlinked_attachments_summary">Вилучає вкладення, що містяться в базі даних, але не пов’язані з записом</string>
     <string name="show_uuid_summary">Показ пов\'язаного з записом чи групою UUID</string>
     <string name="show_uuid_title">Показувати UUID</string>
     <string name="autofill_read_only_save">Збереження даних заборонено для бази даних, відкритої лише для читання.</string>
@@ -495,7 +495,7 @@
     <string name="search_mode">Режим пошуку</string>
     <string name="error_registration_read_only">Збереження нового елемента заборонено в базі даних лише для читання</string>
     <string name="error_field_name_already_exists">Назва поля вже існує.</string>
-    <string name="advanced_unlock_delete_all_key_warning">Видалити всі ключі шифрування, пов\'язані з розширеним розпізнаванням розблокування\?</string>
+    <string name="advanced_unlock_delete_all_key_warning">Видалити всі ключі шифрування, пов’язані з розширеним розпізнаванням розблокування\?</string>
     <string name="device_credential_unlock_enable_summary">Дає змогу використовувати облікові дані пристрою для відкриття бази даних</string>
     <string name="device_credential_unlock_enable_title">Розблокування облікових даних пристрою</string>
     <string name="device_credential">Облікові дані пристрою</string>
@@ -521,7 +521,7 @@
     <string name="education_advanced_unlock_summary">Пов’яжіть свій пароль зі сканованими біометричними даними або даними пристрою, щоб швидко розблокувати базу даних.</string>
     <string name="education_advanced_unlock_title">Розширене розблокування бази даних</string>
     <string name="temp_advanced_unlock_timeout_summary">Тривалість використання розширеного розблокування перед видаленням його вмісту</string>
-    <string name="temp_advanced_unlock_enable_summary">Не зберігайте зашифрований вміст для використання розширеного розблокування</string>
+    <string name="temp_advanced_unlock_enable_summary">Не зберігати зашифрований вміст для використання розширеного розблокування</string>
     <string name="temp_advanced_unlock_enable_title">Тимчасове розширене розблокування</string>
     <string name="advanced_unlock_tap_delete">Торкнутися, щоб видалити клавіші розширеного розблокування</string>
     <string name="content">Вміст</string>
@@ -542,7 +542,7 @@
     <string name="download_canceled">Скасовано!</string>
     <string name="icon_section_custom">Власні</string>
     <string name="icon_section_standard">Стандартні</string>
-    <string name="style_brightness_summary">Вибрати світлі або темні теми</string>
+    <string name="style_brightness_summary">Вибрати світлу або темну теми</string>
     <string name="style_brightness_title">Яскравість теми</string>
     <string name="error_upload_file">Під час передавання даних файлу сталася помилка.</string>
     <string name="error_file_to_big">Файл, який ви намагаєтеся передати, завеликий.</string>
@@ -602,4 +602,7 @@
     <string name="autofill_manual_selection_summary">Параметр показу, який дає користувачеві змогу вибрати запис бази даних</string>
     <string name="autofill_manual_selection_title">Вибір вручну</string>
     <string name="autofill_select_entry">Вибрати запис…</string>
+    <string name="hint_icon_name">Назва піктограми</string>
+    <string name="permission">Дозвіл</string>
+    <string name="warning_exact_alarm">Ви не дозволили застосунку використовувати точний час. У результаті функції, для яких потрібен таймер, не виконуватимуться точно за часом.</string>
 </resources>